![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/unknown.gif) | 10000_magyar_ebook.rar | 2012-08-13 22:38 | 3.0G | |
![[ ]](/icons/compressed.gif) | Tekercsek.zip | 2007-05-16 20:30 | 91M | |
![[ ]](/icons/compressed.gif) | Magus_-_Új_Tekercsek kalandmodul.zip | 2007-04-15 04:09 | 91M | |
![[ ]](/icons/compressed.gif) | Pallas nagy lexikona.zip | 2007-03-24 02:58 | 40M | |
![[ ]](/icons/layout.gif) | The.Elder.Scrolls.IV.Oblivion-MAGYAR.KÉZIKÖNYV.pdf | 2006-04-03 08:38 | 40M | |
![[ ]](/icons/compressed.gif) | buzzati_dino_kepes_poema_hu_pdf.zip | 2007-03-24 02:52 | 17M | |
![[ ]](/icons/layout.gif) | Magus - A demon atka kalandmodul.pdf | 2006-10-22 16:30 | 16M | |
![[ ]](/icons/compressed.gif) | vargha_balazs_csokonai_vitez_mihaly_hu_pdf.zip | 2007-03-24 03:00 | 15M | |
![[ ]](/icons/compressed.gif) | Magus - A demon atka kalandmodul.zip | 2007-04-15 04:06 | 15M | |
![[ ]](/icons/compressed.gif) | csatari_jozsef_a_spanyol_barikadokon_hu_doc_nncl3221-722v1.zip | 2007-03-24 02:52 | 13M | |
![[ ]](/icons/unknown.gif) | Stephen King-Setet torony 1-6.rar | 2007-11-04 10:28 | 13M | |
![[ ]](/icons/compressed.gif) | morris_desmond_az_emberallat_hu_pdf.zip | 2007-03-24 02:52 | 12M | |
![[ ]](/icons/compressed.gif) | sagan_carl_az_eden_sarkanyai_hu_pdf.zip | 2007-03-24 02:52 | 10M | |
![[ ]](/icons/compressed.gif) | Magus_-_Kisertetjarta_haz kalandmodul.zip | 2007-04-15 04:08 | 8.9M | |
![[ ]](/icons/compressed.gif) | jung_chang_vadhattyuk_illusztralt_hu_rtf_nncl2377-671v1.zip | 2007-03-24 02:56 | 8.5M | |
![[ ]](/icons/compressed.gif) | kenedine_szanto_livia_az_etruszkok_nyomaban_hu_djvu.zip | 2007-03-24 02:56 | 7.7M | |
![[ ]](/icons/layout.gif) | Timelords Szabájk.magyar.pdf | 2007-03-24 02:54 | 7.5M | |
![[ ]](/icons/compressed.gif) | pease_pease_miert_hazudik_a_ferfi_miert_sir_a_no_hu_pdf_nncl3205-719v1.zip | 2007-03-24 02:49 | 7.3M | |
![[ ]](/icons/compressed.gif) | esterhazy_peter_a_sziv_segedigei_html.zip | 2007-03-24 02:53 | 7.2M | |
![[ ]](/icons/compressed.gif) | Esterhazy Peter-A sziv segedigeji.zip | 2007-03-24 02:53 | 7.2M | |
![[ ]](/icons/unknown.gif) | Excalibur - 1. A tél királya.rtf | 2007-03-08 23:43 | 7.0M | |
![[ ]](/icons/compressed.gif) | Bbiblia Magyar nyelven.zip | 2007-03-24 02:51 | 6.9M | |
![[ ]](/icons/compressed.gif) | Nagy kepes tortenelem.zip | 2007-03-24 02:58 | 6.8M | |
![[ ]](/icons/compressed.gif) | baudrillard_jean_a_szimulakrum_elsobbsege_hu_jpg.zip | 2007-03-24 02:56 | 6.5M | |
![[ ]](/icons/unknown.gif) | Excalibur - 2. Isten ellensége.rtf | 2007-03-08 23:49 | 6.5M | |
![[ ]](/icons/unknown.gif) | Excalibur - 3. Excalibur.rtf | 2007-03-08 23:53 | 6.5M | |
![[ ]](/icons/compressed.gif) | pilinszky_janos_publicisztikai_irasok_html.zip | 2007-03-24 02:58 | 6.0M | |
![[ ]](/icons/unknown.gif) | Stonhenge.rtf | 2007-03-08 23:38 | 5.9M | |
![[ ]](/icons/compressed.gif) | mikszath_kalman_cikkek_es_karcolatok_3_pdf.zip | 2007-03-24 02:57 | 5.7M | |
![[ ]](/icons/compressed.gif) | goldziher_ignac_az_iszlam_hu_pdf.zip | 2007-03-24 02:55 | 5.5M | |
![[ ]](/icons/compressed.gif) | beevor_antony_sztalingrad_hu_kepek_terkepek_jpg_nncl2980-701v1.zip | 2007-03-24 02:49 | 5.5M | |
![[ ]](/icons/compressed.gif) | M Kutas Ilona-Baro Podmaniczky Pal es a Norveg biblia.zip | 2007-03-24 02:57 | 5.3M | |
![[ ]](/icons/compressed.gif) | hunyady_jozsef_a_fekete_lovag_illusztralt_hu_doc_nncl1662-595v1.zip | 2007-03-24 02:55 | 5.2M | |
![[ ]](/icons/compressed.gif) | Isaac Asimov - Magazinokban megjelent.zip | 2007-03-22 05:30 | 5.1M | |
![[ ]](/icons/compressed.gif) | mikszath_kalman_cikkek_es_karcolatok_2_pdf.zip | 2007-03-24 02:57 | 5.1M | |
![[ ]](/icons/compressed.gif) | nagy_laszlo_egy_szablyas_magyar_ur_genfben_hu_doc_nncl2411-67bv1.zip | 2007-03-24 02:58 | 5.1M | |
![[ ]](/icons/compressed.gif) | hawking-mlodinow_az_ido_meg_rovidebb_tortenete_hu_html_nncl3179-70ev1.zip | 2007-03-24 03:00 | 5.1M | |
![[ ]](/icons/compressed.gif) | John D Barrow-A vilagegyetem szuletese.zip | 2007-03-24 02:56 | 5.1M | |
![[ ]](/icons/compressed.gif) | banks_iain_a_jatekmester_hu_pdf_nncl2322-663v1.zip | 2007-03-24 02:55 | 5.1M | |
![[ ]](/icons/compressed.gif) | orwell_george_haborus_naplo_kepek_hu_jpg_nncl3226-722v1.zip | 2007-03-24 02:54 | 4.9M | |
![[ ]](/icons/compressed.gif) | mikszath_kalman_cikkek_es_karcolatok_1_pdf.zip | 2007-03-24 02:57 | 4.7M | |
![[ ]](/icons/compressed.gif) | ellert_gerhart_atilla_hu_pdf.zip | 2007-03-24 02:55 | 4.7M | |
![[ ]](/icons/unknown.gif) | A Látnok Ciklus - 2. A király orgyilkosa.rtf | 2007-03-08 23:15 | 4.5M | |
![[ ]](/icons/compressed.gif) | brown_dan_a_da_vinci_kod_fuggelekkel_hu_doc_nncl1587-551v2.zip | 2007-03-24 02:52 | 4.5M | |
![[ ]](/icons/compressed.gif) | Slozar Jozsef-Biblia-ami a kulissak mogott vav 1-2.zip | 2007-03-24 03:00 | 4.3M | |
![[ ]](/icons/compressed.gif) | beevor_antony_a_spanyol_polgarhaboru_kepek_hu_jpg_nncl3219-722v1.zip | 2007-03-24 02:49 | 4.2M | |
![[ ]](/icons/compressed.gif) | varkonyi_nandor_sziriat_oszlopai_hu_djvu_nncl2677-6c2v0.zip | 2007-03-24 03:01 | 4.1M | |
![[ ]](/icons/unknown.gif) | Weis-Hickman A nyári tqz sárkányai.doc | 2007-03-26 23:34 | 4.0M | |
![[ ]](/icons/unknown.gif) | clarke_arthur_c_2010_masodik_urodisszea.rtf | 2007-11-14 05:18 | 4.0M | |
![[ ]](/icons/layout.gif) | magus_azimgyongye.pdf | 2007-04-15 16:55 | 3.9M | |
![[ ]](/icons/compressed.gif) | foster_alan_dean_az_utolso_csillagharcos_hu_pdf.zip | 2007-03-24 02:49 | 3.8M | |
![[ ]](/icons/compressed.gif) | Foster, Alan Dean - Az utolso_csillagharcos_hu_pdf.zip | 2007-03-26 14:44 | 3.8M | |
![[ ]](/icons/compressed.gif) | howard_louise_zen_barikak_szamara_hu_pdf.zip | 2007-03-24 02:57 | 3.8M | |
![[ ]](/icons/compressed.gif) | delau_reinhard_mecsetek_es_mandulafak_hu_kepek_jpg_nncl2891-6f3v1.zip | 2007-03-24 02:59 | 3.7M | |
![[ ]](/icons/compressed.gif) | beevor_antony_berlin_hu_rtf_nncl2863-6efv1.zip | 2007-03-24 02:49 | 3.7M | |
![[ ]](/icons/compressed.gif) | hugo_vicor_a_nyomorultak_pdf.zip | 2007-03-24 03:01 | 3.7M | |
![[ ]](/icons/compressed.gif) | ende_michael_vegtelen_tortenet_hu_doc_nncl2158-63cv1.zip | 2007-03-24 02:57 | 3.7M | |
![[ ]](/icons/unknown.gif) | egy_bolygo_robinzonjai.doc | 2007-11-14 09:52 | 3.7M | |
![[ ]](/icons/unknown.gif) | NAGY receptkonyv.doc | 2007-03-24 02:59 | 3.6M | |
![[ ]](/icons/compressed.gif) | ady_endre_osszes_proza_rtf.zip | 2007-03-24 02:55 | 3.6M | |
![[ ]](/icons/layout.gif) | Harry_Potter_7_teljes.pdf | 2007-10-07 18:34 | 3.5M | |
![[ ]](/icons/unknown.gif) | 021-128.PDF | 2007-03-24 02:54 | 3.5M | |
![[ ]](/icons/compressed.gif) | caselli_giovanni_a_kozepkor_hu_pdf.zip | 2007-03-24 02:55 | 3.4M | |
![[ ]](/icons/compressed.gif) | Setét Torony1-6.zip | 2007-11-12 01:08 | 3.4M | |
![[ ]](/icons/compressed.gif) | ady_endre_osszes_proza_html.zip | 2007-03-24 02:55 | 3.4M | |
![[ ]](/icons/unknown.gif) | A Látnok Ciklus - 3. Nép orgyilkosa.rtf | 2007-03-08 23:08 | 3.4M | |
![[ ]](/icons/unknown.gif) | Rejto Jeno konyvek 29db.rar | 2007-03-24 02:59 | 3.3M | |
![[ ]](/icons/compressed.gif) | thompson_hunter_s_felelem_es_reszketes_las_vegasban_hu_rtf.zip | 2007-03-24 02:55 | 3.1M | |
![[ ]](/icons/compressed.gif) | griffin_w_e_b_a_tengereszgyalogosok_3._hu_pdf.zip | 2007-03-24 03:01 | 3.1M | |
![[ ]](/icons/layout.gif) | 2003-A setét torony 5-Callai farkasok.pdf | 2007-11-04 06:51 | 3.1M | |
![[ ]](/icons/layout.gif) | 1997-A setét torony 4-Varázsló és üveg.pdf | 2007-11-04 06:51 | 3.1M | |
![[ ]](/icons/compressed.gif) | A mandalak vilaga.zip | 2007-03-24 02:53 | 3.0M | |
![[ ]](/icons/layout.gif) | Dragonlance - Krónikák - 4. A nyári tüz sárkányai.pdf | 2007-01-20 17:26 | 3.0M | |
![[ ]](/icons/compressed.gif) | an_nefzawi_muhammad_illatos_kert_hu_doc.zip | 2007-03-24 02:58 | 3.0M | |
![[ ]](/icons/compressed.gif) | asimov_isaac_a_biologia_rovid_tortenete_hu_doc_nncl3190-711v1.zip | 2007-03-24 02:55 | 3.0M | |
![[ ]](/icons/compressed.gif) | Magyar-angol szotar.zip | 2007-03-24 03:00 | 2.9M | |
![[ ]](/icons/layout.gif) | A Gályák tengerének kalózai - Fekete mély vízen.pdf | 2007-04-15 16:48 | 2.9M | |
![[ ]](/icons/compressed.gif) | tolsztoj_haboru_es_beke_rtf.zip | 2007-03-24 02:57 | 2.8M | |
![[ ]](/icons/compressed.gif) | perruchot_henri_manet_elete_hu_html.zip | 2007-03-24 02:55 | 2.8M | |
![[ ]](/icons/compressed.gif) | fust_milan_teljes_naplo_html.zip | 2007-03-24 02:54 | 2.8M | |
![[ ]](/icons/compressed.gif) | Molnar Reka-FENG-SHUI.zip | 2007-03-24 02:58 | 2.7M | |
![[ ]](/icons/layout.gif) | [KER]- (4) A morális szabály.pdf | 2007-04-15 16:56 | 2.7M | |
![[ ]](/icons/compressed.gif) | Metagalaktika 3.zip | 2007-03-24 02:57 | 2.7M | |
![[ ]](/icons/layout.gif) | 1991-A setét torony 3-Puszta földek.pdf | 2007-11-04 06:51 | 2.7M | |
![[ ]](/icons/unknown.gif) | 324-355.PDF | 2007-03-24 02:54 | 2.6M | |
![[ ]](/icons/compressed.gif) | mg3.zip | 2007-08-04 15:36 | 2.6M | |
![[ ]](/icons/compressed.gif) | englis-hungarian,hungaeian-englis maintenance.zip | 2007-03-24 03:00 | 2.6M | |
![[ ]](/icons/compressed.gif) | smith_wilbur_a_solyom_ropte_hu_pdf.zip | 2007-03-24 03:01 | 2.6M | |
![[ ]](/icons/compressed.gif) | bajomi_lazar_endre_a_montmartre_hu_pdf_nncl2476-68ev1.zip | 2007-03-24 02:49 | 2.5M | |
![[ ]](/icons/compressed.gif) | cornwell_bernard_stonehenge_hu_pdf.zip | 2007-03-24 02:50 | 2.5M | |
![[ ]](/icons/unknown.gif) | king_stephen_hasznos_holmik.doc | 2004-11-03 09:22 | 2.5M | |
![[ ]](/icons/unknown.gif) | hamilton_laurell_k_lelancolt_narcisszusz_1_hu.rtf | 2007-02-23 20:00 | 2.4M | |
![[ ]](/icons/compressed.gif) | fable_vavyan_almok_tengere_hu_pdf_nncl3196-715v1.zip | 2007-03-24 03:01 | 2.4M | |
![[ ]](/icons/unknown.gif) | Alapítvány és Föld.doc | 2007-11-14 09:33 | 2.4M | |
![[ ]](/icons/compressed.gif) | read_piers_paul_a_templomosok_hu_doc_nncl2659-6bfv2.zip | 2007-03-24 02:58 | 2.4M | |
![[ ]](/icons/compressed.gif) | fable_vavyan_apad_anyad_ide_lojon_hu_pdf_nncl3003-704v1.zip | 2007-03-24 03:01 | 2.4M | |
![[ ]](/icons/compressed.gif) | hawking_stephen_az_ido_rovid_tortenete_hu_html.zip | 2007-03-24 03:00 | 2.4M | |
![[ ]](/icons/unknown.gif) | DragonLance - A Téli Éj Sárkányai.doc | 2007-03-26 23:35 | 2.3M | |
![[ ]](/icons/compressed.gif) | foldes_peter_a_karvalyos_zaszlo_hu_rtf.zip | 2007-03-24 02:54 | 2.3M | |
![[ ]](/icons/compressed.gif) | feist_raymond_e_tundermese_hu_rtf_nncl2223-649v1.zip | 2007-03-24 02:54 | 2.3M | |
![[ ]](/icons/compressed.gif) | Feist, Raymond E - Tundermese hu rtf.zip.zip | 2007-03-26 14:40 | 2.3M | |
![[ ]](/icons/compressed.gif) | mikula_valentin_stuka_hu_pdf_nncl1954-619v1.zip | 2007-03-24 03:00 | 2.3M | |
![[ ]](/icons/compressed.gif) | keegan_john_a_masodik_vilaghaboru_hu_doc_nncl2422-67ev1.zip | 2007-03-24 02:56 | 2.3M | |
![[ ]](/icons/compressed.gif) | jung_chang_vadhattyuk_hu_rtf_nncl2377-671v1.zip | 2007-03-24 02:56 | 2.2M | |
![[ ]](/icons/unknown.gif) | A Látnok Ciklus - 4. Az orgyilkos küldetése.rtf | 2007-03-08 23:21 | 2.2M | |
![[ ]](/icons/compressed.gif) | Egy bolygo robin.zip | 2007-02-21 16:45 | 2.2M | |
![[ ]](/icons/unknown.gif) | 6. Káoszgyermek.rtf | 2007-03-06 02:22 | 2.2M | |
![[ ]](/icons/compressed.gif) | stone_jeffrey_a_hajnal_trilogiaja_hu_doc_nncl2711-6cbv1.zip | 2007-03-24 02:58 | 2.2M | |
![[ ]](/icons/compressed.gif) | cousteau_dumas_a_csend_vilaga_hu_rtf.zip | 2007-03-24 02:55 | 2.2M | |
![[ ]](/icons/compressed.gif) | orwell_george_a_wigani_molo_kepek_hu_jpg_nncl3243-72av1.zip | 2007-03-24 02:54 | 2.2M | |
![[ ]](/icons/compressed.gif) | fable_vavyan_tiz_kicsi_kommandos_hu_pdf_nncl2954-6fav1.zip | 2007-03-24 03:01 | 2.2M | |
![[ ]](/icons/unknown.gif) | A hajnal bolygó robotjai.doc | 2007-11-14 07:30 | 2.2M | |
![[ ]](/icons/compressed.gif) | adams_douglas_utoljara_lathato.zip | 2007-03-24 02:53 | 2.2M | |
![[TXT]](/icons/text.gif) | Stephen King - A setét torny 2.htm | 2007-02-16 16:15 | 2.2M | |
![[ ]](/icons/unknown.gif) | 257-323.PDF | 2007-03-24 02:54 | 2.2M | |
![[ ]](/icons/compressed.gif) | mikszath_kalman_magyarorszag_lovagvarai_hu_doc.zip | 2007-03-24 02:58 | 2.2M | |
![[ ]](/icons/unknown.gif) | 5. Harlekin.rtf | 2007-03-06 02:17 | 2.1M | |
![[ ]](/icons/compressed.gif) | krudy_gyula_szindbad.zip | 2007-03-24 02:56 | 2.1M | |
![[ ]](/icons/compressed.gif) | donaszy_ferencz_az_arany_szalamandra_hu_doc_nncl2222-649v1.zip | 2007-03-24 02:53 | 2.1M | |
![[ ]](/icons/compressed.gif) | mora_ferenc_tapei_furfangosok.pdf.zip | 2007-03-24 02:58 | 2.1M | |
![[ ]](/icons/unknown.gif) | DuneEretnekei.rtf | 2007-11-14 07:24 | 2.1M | |
![[ ]](/icons/unknown.gif) | Vámpirkrónikák - 1. Interjú a vámpírral.rtf | 2006-12-13 13:32 | 2.1M | |
![[ ]](/icons/compressed.gif) | csukas_istvan_a_nagy_ho-ho-ho-horgasz_telen_html.zip | 2007-03-24 02:57 | 2.1M | |
![[ ]](/icons/compressed.gif) | George R. R. Martin - Tüz és jég dala - 3. Kardok vihara.zip | 2007-03-23 05:03 | 2.1M | |
![[ ]](/icons/compressed.gif) | dumas_alexandre_pamfil_kapitany_hu_doc_nncl2786-701v1.zip | 2007-03-24 02:49 | 2.1M | |
![[ ]](/icons/compressed.gif) | vas_zoltan_kossuth_lajos_elete_doc_hu.zip | 2007-03-24 03:01 | 2.1M | |
![[ ]](/icons/compressed.gif) | Michael Crichton - Szörnypark.zip | 2007-04-15 03:59 | 2.1M | |
![[ ]](/icons/unknown.gif) | botond-bolics_gyorgy_ha_felszall_a_kod_hu_doc.doc | 2007-11-14 05:17 | 2.1M | |
![[ ]](/icons/compressed.gif) | brooks_terry_shannara_a_kard_hu_rtf_nncl2467-68ev1.zip | 2007-03-24 03:00 | 2.1M | |
![[ ]](/icons/compressed.gif) | martin_jozsef_a_volkswagen_sztori_hu_pdf.zip | 2007-03-24 02:57 | 2.1M | |
![[ ]](/icons/compressed.gif) | scott_walter_ivanhoe_pdf.zip | 2007-03-24 03:01 | 2.1M | |
![[ ]](/icons/unknown.gif) | tuzgolyofutam.doc | 2007-04-15 16:56 | 2.1M | |
![[ ]](/icons/layout.gif) | Boszorkányok élete - 1-2. Boszorkányok órája 2.pdf | 2007-01-20 16:01 | 2.1M | |
![[ ]](/icons/unknown.gif) | idegen_bolygon_szuletett.doc | 2007-11-14 08:45 | 2.1M | |
![[ ]](/icons/compressed.gif) | Mario de Andrade-Makunaima.zip | 2007-03-24 02:57 | 2.1M | |
![[ ]](/icons/unknown.gif) | Gáspár András - Két életem egy halálom.rtf | 2007-11-14 04:03 | 2.1M | |
![[ ]](/icons/compressed.gif) | swale_rosie_a_horn_fok_gyermekei_hu_rtf_nncl2219-648v1.zip | 2007-03-24 03:00 | 2.1M | |
![[ ]](/icons/unknown.gif) | lcts.ace | 2007-03-24 02:52 | 2.0M | |
![[ ]](/icons/layout.gif) | A Gályák tengerének kalózai - Kalmárvirtus.pdf | 2007-04-15 16:41 | 2.0M | |
![[ ]](/icons/compressed.gif) | Francis Carsac - A vilárűr Robinsonjai.zip | 2007-03-23 05:12 | 2.0M | |
![[ ]](/icons/unknown.gif) | Darren Shan I-II-III-IV - V-VI-VII-VIII - IX-X-XI-XII.rar | 2007-10-31 08:22 | 2.0M | |
![[ ]](/icons/compressed.gif) | babits_mihaly_jonas_konyve_hu_doc.zip | 2007-03-24 02:55 | 2.0M | |
![[ ]](/icons/compressed.gif) | marton_bela_utazas_a_venuszra_hu_rtf.zip | 2007-03-24 02:57 | 2.0M | |
![[ ]](/icons/compressed.gif) | Terry Prachett - Az igazi macska.zip | 2007-03-26 18:19 | 2.0M | |
![[ ]](/icons/compressed.gif) | queneau_raymond_az_elet_vasarnapja_hu_pdf.zip | 2007-03-24 02:59 | 2.0M | |
![[ ]](/icons/compressed.gif) | cherryh_c_j_melyallomas_hu_pdf.zip | 2007-03-24 02:52 | 2.0M | |
![[ ]](/icons/compressed.gif) | weis_hickman_ikrek_hatalma_hu_rtf_nncl3208-719v1.zip | 2007-03-24 03:01 | 2.0M | |
![[TXT]](/icons/text.gif) | Stephen King - A setét torny 3.htm | 2007-02-20 13:02 | 2.0M | |
![[ ]](/icons/layout.gif) | 2004-A setét torony 6-Susannah dala.pdf | 2007-11-04 06:51 | 2.0M | |
![[ ]](/icons/compressed.gif) | Feist Wurts - A birodalom leanya hu doc .zip.zip | 2007-03-26 14:39 | 1.9M | |
![[ ]](/icons/unknown.gif) | abs_nehez_istennek_lenni_a_hetfo_szombaton_kezdodoik_hu.rtf | 2007-11-14 08:49 | 1.9M | |
![[ ]](/icons/unknown.gif) | kaptalanhaz.doc | 2007-11-14 07:29 | 1.9M | |
![[ ]](/icons/compressed.gif) | scott_walter_kenilworth_pdf.zip | 2007-03-24 03:01 | 1.9M | |
![[ ]](/icons/compressed.gif) | magyar_foldmerok_arckepcsarnoka.zip | 2007-03-24 02:57 | 1.9M | |
![[ ]](/icons/unknown.gif) | 179-256.PDF | 2007-03-24 02:54 | 1.9M | |
![[ ]](/icons/layout.gif) | Dragonlance - Krónikák - 2. A téli éj sárkányai.pdf | 2007-01-21 10:08 | 1.9M | |
![[ ]](/icons/layout.gif) | Boszorkányok élete - 2. Lasher.pdf | 2007-01-20 16:01 | 1.9M | |
![[ ]](/icons/compressed.gif) | vu_cseng_en_nyugati_utazas_1_hu_pdf.zip | 2007-03-24 03:01 | 1.9M | |
![[ ]](/icons/layout.gif) | 1987-A setét torony 2_A hármak elhívatása.pdf | 2007-11-04 06:51 | 1.9M | |
![[ ]](/icons/compressed.gif) | lissak_gyorgy_az_aranykigyo_hu_doc_nncl2819-6e4v1.zip | 2007-03-24 02:57 | 1.9M | |
![[ ]](/icons/compressed.gif) | teknos_peter_kerdezz_felelek_mindenre_hu_pdf.zip | 2007-03-24 03:00 | 1.9M | |
![[ ]](/icons/unknown.gif) | ezer_ev_a_venuszon.doc | 2007-11-14 09:45 | 1.9M | |
![[ ]](/icons/compressed.gif) | christie_agatha_poirot_munkaban_hu_doc_nncl2827-6e6v1.zip | 2007-03-24 02:49 | 1.8M | |
![[ ]](/icons/unknown.gif) | sogun.rtf | 2007-03-24 02:55 | 1.8M | |
![[ ]](/icons/compressed.gif) | mckenna_juliet_e_kegyetlen_esku_hu_doc_nncl2687-6c4v1.zip | 2007-03-24 02:56 | 1.8M | |
![[ ]](/icons/unknown.gif) | 129-178.PDF | 2007-03-24 02:54 | 1.8M | |
![[ ]](/icons/compressed.gif) | gaiman_neil_amerikai_istenek_hu_pdf.zip | 2007-03-24 02:58 | 1.8M | |
![[ ]](/icons/compressed.gif) | ignacz_rozsa_szavannatuz_hu_pdf_nncl2487-68ev0.zip | 2007-03-24 02:55 | 1.8M | |
![[ ]](/icons/compressed.gif) | griffin_w_e_b_a_tengereszgyalogosok_2_hu_pdf.zip | 2007-03-24 03:01 | 1.8M | |
![[ ]](/icons/unknown.gif) | Dune_Isten-csaszara.doc | 2007-11-14 09:31 | 1.8M | |
![[ ]](/icons/compressed.gif) | vu_cseng_en_nyugati_utazas_2_hu_pdf.zip | 2007-03-24 03:01 | 1.8M | |
![[ ]](/icons/compressed.gif) | Feist, Raymond E - Mágus. A mester.zip | 2007-03-26 14:40 | 1.8M | |
![[ ]](/icons/unknown.gif) | hamilton_laurell_k_lelancolt_narcisszusz_2_hu.rtf | 2007-02-04 13:49 | 1.8M | |
![[ ]](/icons/unknown.gif) | Frank Herbert - A düne.rtf | 2007-11-14 08:36 | 1.8M | |
![[ ]](/icons/compressed.gif) | simai_mihaly_szemkozt_az_urtigrissel_hu_doc.zip | 2007-03-24 03:00 | 1.8M | |
![[ ]](/icons/compressed.gif) | mckenna_juliet_e_forgando_szerencse_hu_doc_nncl2688-6c4v1.zip | 2007-03-24 02:56 | 1.7M | |
![[ ]](/icons/compressed.gif) | petofi_sandor_osszes_koltemenyei_doc.zip | 2007-03-24 02:55 | 1.7M | |
![[ ]](/icons/compressed.gif) | schatzing_frank_raj_hu_rtf_nncl2445-689v3.zip | 2007-03-24 02:54 | 1.7M | |
![[ ]](/icons/compressed.gif) | mckenna_juliet_e_veszelyes_jatszma_hu_doc_nncl2527-697v1.zip | 2007-03-24 02:56 | 1.7M | |
![[ ]](/icons/unknown.gif) | zahn_timothy_a_jovo_latomasa.rtf | 2007-03-24 02:54 | 1.7M | |
![[ ]](/icons/compressed.gif) | csukas_sajdik_pom_pom_mesei_ltrk_hu_djvu.zip | 2007-03-24 02:57 | 1.7M | |
![[ ]](/icons/compressed.gif) | caldwell_john_a_kaosz_szive_hu_rtf_nncl3236-72av1.zip | 2007-03-24 02:58 | 1.7M | |
![[ ]](/icons/compressed.gif) | jan_v_g_a_tatarjaras_hu_djvu.zip | 2007-03-24 02:56 | 1.7M | |
![[ ]](/icons/compressed.gif) | illyes_gyula_itt_elned_kell_I-II_html.zip | 2007-03-24 02:55 | 1.7M | |
![[ ]](/icons/compressed.gif) | krudy_gyula_regi_pesti_historiak.zip | 2007-03-24 02:56 | 1.7M | |
![[ ]](/icons/compressed.gif) | pease_allan_testbeszed.jpg.zip | 2007-03-24 02:49 | 1.7M | |
![[ ]](/icons/compressed.gif) | goodkind_terry_az_elso_szabaly_2_a_nepek_palotaja_hu_doc_nncl3260-732v1.zip | 2007-03-24 03:00 | 1.7M | |
![[ ]](/icons/compressed.gif) | pease_allan_testbeszed_hu_pdf_nncl2989-701v1.zip | 2007-03-24 02:49 | 1.7M | |
![[ ]](/icons/compressed.gif) | updike_john_parok_hu_pdf.zip | 2007-03-24 02:56 | 1.6M | |
![[ ]](/icons/compressed.gif) | koszegi_imre-a_fellegvari_venusz_hu_djvu.zip | 2007-03-24 02:56 | 1.6M | |
![[ ]](/icons/compressed.gif) | laymon_richard_vidampark_hu_pdf_nncl2652-6bbv1.zip | 2007-03-24 02:59 | 1.6M | |
![[ ]](/icons/compressed.gif) | istrati_panait_kyra_kyralina_hu_pdf.zip | 2007-03-24 02:58 | 1.6M | |
![[ ]](/icons/unknown.gif) | Kurt Vonnegut-Macskabolcso | 2007-03-24 02:57 | 1.6M | |
![[ ]](/icons/compressed.gif) | Kurt Vonnegut - Macskabolcso.pdf.zip | 2007-02-21 16:48 | 1.6M | |
![[ ]](/icons/compressed.gif) | vonnegut_kurt_macskabolcso.pdf.zip | 2007-03-24 02:57 | 1.6M | |
![[ ]](/icons/compressed.gif) | krudy_gyula_almoskonyv.zip | 2007-03-24 02:56 | 1.6M | |
![[ ]](/icons/compressed.gif) | perez-reverte_arturo_a_dumas-klub_hu_doc_nncl2549-6a2v1.zip | 2007-03-24 02:49 | 1.6M | |
![[ ]](/icons/compressed.gif) | paungger_poppe_utmutato_hold_hu_pdf.zip | 2007-03-24 02:56 | 1.6M | |
![[ ]](/icons/compressed.gif) | fable_vavyan_almok_tengere_hu_rtf_nncl3196-715v1.zip | 2007-03-24 03:01 | 1.6M | |
![[ ]](/icons/compressed.gif) | clavell_james_forgoszel_hu_doc.zip | 2007-03-24 02:55 | 1.6M | |
![[ ]](/icons/unknown.gif) | brooks_terry_shannara_az_elso_kiraly.rtf | 2007-02-08 17:41 | 1.6M | |
![[ ]](/icons/compressed.gif) | dumas_alexandre_bragelonne_vicomte_rtf.zip | 2007-03-24 02:49 | 1.6M | |
![[ ]](/icons/compressed.gif) | Miert nem birjuk az.zip | 2007-03-24 02:57 | 1.6M | |
![[ ]](/icons/compressed.gif) | eco_umberto_a_foucault_inga_hu_doc.zip | 2007-03-24 03:00 | 1.6M | |
![[ ]](/icons/compressed.gif) | goodkind_terry_az_elso_szabaly_1_az_igazsag_keresoje_hu_doc_nncl3259-732v1.zip | 2007-03-24 03:00 | 1.6M | |
![[ ]](/icons/unknown.gif) | crichton_michael_szornyek_szigete.doc | 2007-11-14 09:04 | 1.6M | |
![[ ]](/icons/compressed.gif) | gacs_demeter_uj_nap_fele_hu_doc.zip | 2007-03-24 02:54 | 1.6M | |
![[ ]](/icons/compressed.gif) | foldes_peter_vallanak_az_osi_kronikak_hu_doc.zip | 2007-03-24 02:54 | 1.6M | |
![[ ]](/icons/compressed.gif) | Lossai-Kodex.zip | 2007-03-24 02:57 | 1.6M | |
![[ ]](/icons/unknown.gif) | Alan O'Connor - Hollóidők.doc | 2007-04-02 22:08 | 1.6M | |
![[ ]](/icons/compressed.gif) | janikovszky_eva_az_ugy_volt_hu_doc_nncl3239-72av1.zip | 2007-03-24 02:56 | 1.6M | |
![[ ]](/icons/compressed.gif) | caldwell_john_a_kaosz_szava_hu_rtf_nncl3235-72av1.zip | 2007-03-24 02:58 | 1.6M | |
![[ ]](/icons/compressed.gif) | A filozofia tortenete 1.zip | 2007-03-24 02:49 | 1.6M | |
![[ ]](/icons/compressed.gif) | hasek_jaroslav_dekameron_hu_abrak_pcx_nncl3061-706v1.zip | 2007-03-24 02:56 | 1.5M | |
![[ ]](/icons/compressed.gif) | Vámpirvadász - 8. Sápadt hold.zip | 2007-03-26 15:04 | 1.5M | |
![[ ]](/icons/compressed.gif) | mann_thomas_jozsef_es_testverei_rtf.zip | 2007-03-24 03:00 | 1.5M | |
![[ ]](/icons/unknown.gif) | negyen_a_venusz-asztroplanon.doc | 2007-11-14 09:51 | 1.5M | |
![[ ]](/icons/compressed.gif) | mikszath_kalman_levelezese_pdf.zip | 2007-03-24 02:58 | 1.5M | |
![[ ]](/icons/compressed.gif) | borges_jorge_luis_a_titkos_csoda_hu_html.zip | 2007-03-24 02:56 | 1.5M | |
![[ ]](/icons/compressed.gif) | Lazarus Morell-A szornyuseges megvalto.zip | 2007-03-24 02:57 | 1.5M | |
![[ ]](/icons/compressed.gif) | 03. Könnyek Köve - 3. A kard varázslója.zip | 2007-03-26 14:59 | 1.5M | |
![[ ]](/icons/compressed.gif) | clavell_james_gajdzsin_hu_doc.zip | 2007-03-24 02:55 | 1.5M | |
![[ ]](/icons/compressed.gif) | 01. Könnyek Köve - 1. Sötét árnyak ébredése.zip | 2007-03-26 14:59 | 1.5M | |
![[ ]](/icons/unknown.gif) | Demonhercegno_hu.rtf | 2007-03-24 02:54 | 1.5M | |
![[ ]](/icons/compressed.gif) | A filozofia tortenete 2.zip | 2007-03-24 02:49 | 1.5M | |
![[ ]](/icons/unknown.gif) | Kicsik.doc | 2007-03-24 02:57 | 1.5M | |
![[ ]](/icons/compressed.gif) | balint_agnes_mi_ujsag_a_futrinka_utcaban_hu_doc.zip | 2007-03-24 02:52 | 1.5M | |
![[ ]](/icons/unknown.gif) | gibson_william_trendvadasz_hu_nncl2502-692v1.doc | 2007-11-14 09:50 | 1.5M | |
![[ ]](/icons/compressed.gif) | 02. Könnyek Köve - 2. A halálhozó.zip | 2007-03-26 14:59 | 1.5M | |
![[ ]](/icons/compressed.gif) | nagy_laszlo_a_rossz_hiru_bathoryak_hu_doc_nncl2433-683v1.zip | 2007-03-24 02:58 | 1.5M | |
![[ ]](/icons/unknown.gif) | brooks_terry_shannara_a_kard.rtf | 2007-02-08 17:24 | 1.5M | |
![[ ]](/icons/layout.gif) | jeffrey_stone_-_cherubion_legendai.pdf | 2006-07-12 13:51 | 1.5M | |
![[ ]](/icons/compressed.gif) | griffin_w_e_b_a_tengereszgyalogosok_4._hu_pdf.zip | 2007-03-24 03:01 | 1.5M | |
![[ ]](/icons/compressed.gif) | caldwell_stone_a_kaosz_eje_hu_doc_nncl2121-637v1.zip | 2007-03-24 02:58 | 1.5M | |
![[ ]](/icons/compressed.gif) | hunyady_jozsef_a_napisten_fiai_hu_doc.zip | 2007-03-24 02:55 | 1.5M | |
![[ ]](/icons/compressed.gif) | mikszath_kalman_a_noszty_fiu_esete_toth_marival_pdf.zip | 2007-03-24 02:57 | 1.5M | |
![[ ]](/icons/compressed.gif) | paasilinna_arto_a_nyul_eve_hu_doc_nncl2579-6a8v1.zip | 2007-03-24 02:49 | 1.5M | |
![[ ]](/icons/unknown.gif) | bradley.doc | 2007-11-14 09:09 | 1.4M | |
![[ ]](/icons/compressed.gif) | Dan Brown - A Da-Vinci kod.zip | 2007-03-20 12:55 | 1.4M | |
![[ ]](/icons/unknown.gif) | Dragonlance - Krónikák - 1. Az öszi alkony sárkányai.pd | 2007-01-20 17:25 | 1.4M | |
![[ ]](/icons/unknown.gif) | king_stephen_remauto.doc | 2004-10-13 19:51 | 1.4M | |
![[ ]](/icons/compressed.gif) | gilbert_henry_robin_hood_hu_doc.zip | 2007-03-24 02:55 | 1.4M | |
![[ ]](/icons/compressed.gif) | 08. Szelek temploma - 2. A prófécia.zip | 2007-03-26 14:59 | 1.4M | |
![[ ]](/icons/unknown.gif) | Új vámpir történetek - 1. Pandora.rtf | 2005-02-25 18:47 | 1.4M | |
![[ ]](/icons/compressed.gif) | 09. Szelek temploma - 3. A jocopo kincs.zip | 2007-03-26 14:59 | 1.4M | |
![[ ]](/icons/layout.gif) | Boszorkányok élete - 1-1. Boszorkányok órája 1.pdf | 2007-01-20 16:00 | 1.4M | |
![[ ]](/icons/compressed.gif) | toke_peter_a_nyevigak_hu_doc_nncl2653-6bbv1.zip | 2007-03-24 03:00 | 1.4M | |
![[ ]](/icons/compressed.gif) | brown_dan_angyalok_es_demonok_hu_doc_nncl2426-683v1.zip | 2007-03-24 02:52 | 1.4M | |
![[ ]](/icons/compressed.gif) | 07. Szelek temploma - 1. A vörös hold.zip | 2007-03-26 14:59 | 1.4M | |
![[ ]](/icons/unknown.gif) | preda.doc | 2007-11-14 06:53 | 1.4M | |
![[ ]](/icons/compressed.gif) | hugo_vicor_a_nyomorultak_rtf.zip | 2007-03-24 03:01 | 1.4M | |
![[ ]](/icons/compressed.gif) | illyes_gyula_iranytuvel_html.zip | 2007-03-24 02:55 | 1.4M | |
![[ ]](/icons/compressed.gif) | moldova_gyorgy_eg_a_duna_html.zip | 2007-03-24 02:58 | 1.4M | |
![[ ]](/icons/compressed.gif) | kertesz_p_balazs_krisztoforo_es_a_gozlovag_hu_djvu_nncl3193-711v1.zip | 2007-03-24 02:56 | 1.4M | |
![[ ]](/icons/compressed.gif) | H P Lovecraft-Olvasoterem.zip | 2007-03-24 02:55 | 1.4M | |
![[ ]](/icons/layout.gif) | Boszorkányok élete - 3. Táltos .pdf | 2007-01-20 16:01 | 1.4M | |
![[ ]](/icons/compressed.gif) | weis_hickman_a_mult_es_jovo_ura_hu_rtf_nncl2858-6efv1.zip | 2007-03-24 03:01 | 1.4M | |
![[ ]](/icons/compressed.gif) | Star Wars.zip | 2006-05-31 08:55 | 1.4M | |
![[ ]](/icons/compressed.gif) | monus_miklos_o_es_az_hu_doc_nncl1997-61dv1.zip | 2007-03-24 02:58 | 1.4M | |
![[ ]](/icons/compressed.gif) | weis_hickman_haboru_hu_rtf_nncl3207-719v1.zip | 2007-03-24 03:01 | 1.4M | |
![[ ]](/icons/unknown.gif) | asimov_isaac_az_ur_aramlatai.rtf | 2007-11-14 04:35 | 1.4M | |
![[ ]](/icons/unknown.gif) | 3. Morgena könnyei.doc | 2001-06-27 20:58 | 1.4M | |
![[ ]](/icons/compressed.gif) | Carroll,Lewis-Alice csodaorszagban.zip | 2007-03-24 02:52 | 1.4M | |
![[ ]](/icons/compressed.gif) | popper_peter_az_onmagaba_tero_osveny_hu_pdf.zip | 2007-03-24 02:58 | 1.4M | |
![[ ]](/icons/layout.gif) | Múmia.pdf | 2007-01-20 16:01 | 1.4M | |
![[ ]](/icons/compressed.gif) | Vámpirvadász - 9. Obszidián pillangó.zip | 2007-03-26 15:04 | 1.3M | |
![[ ]](/icons/compressed.gif) | jankovich_ferenc_tyukodi_pajtas_hu_doc.zip | 2007-03-24 02:56 | 1.3M | |
![[ ]](/icons/unknown.gif) | Otthon.doc | 2007-03-24 02:54 | 1.3M | |
![[ ]](/icons/compressed.gif) | Feist, Raymond E - Mágus. A tanítvány.zip | 2007-03-26 14:40 | 1.3M | |
![[ ]](/icons/compressed.gif) | kapuscinski_ryszad_a_csaszar_a_sahinsah_hu_pdf.zip | 2007-03-24 03:00 | 1.3M | |
![[ ]](/icons/compressed.gif) | weis_hickman_talalkozas_hu_rtf_nncl2950-6f3v1.zip | 2007-03-24 03:01 | 1.3M | |
![[ ]](/icons/compressed.gif) | jeffrey_stone_-_cherubion_legendai.zip | 2007-04-15 04:05 | 1.3M | |
![[ ]](/icons/compressed.gif) | udvarhelyi_denes_aquincumi_elegia_hu_rtf_nncl2291-65ev2.zip | 2007-03-24 03:00 | 1.3M | |
![[ ]](/icons/unknown.gif) | angyali_udvozlet.rtf | 2007-11-14 04:54 | 1.3M | |
![[ ]](/icons/compressed.gif) | 10. Tüz lelke - 1. A mágia tolvajai.zip | 2007-03-26 14:59 | 1.3M | |
![[ ]](/icons/unknown.gif) | Ganésa gyémántjai.doc | 2007-03-24 02:57 | 1.3M | |
![[ ]](/icons/compressed.gif) | 12. Tüz lelke - 3. Három harmonia.zip | 2007-03-26 14:59 | 1.3M | |
![[ ]](/icons/compressed.gif) | capek_karel_harc_a_szalamandrakkal_hu_doc.zip | 2007-03-24 02:56 | 1.3M | |
![[ ]](/icons/compressed.gif) | weis_hickman_pusztulas_hu_rtf_nncl3209-719v1.zip | 2007-03-24 03:01 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2 Alapítvány és Birodalom.doc | 2007-11-14 09:37 | 1.3M | |
![[ ]](/icons/compressed.gif) | feist_raymond_e_magus_a_mester.zip | 2007-03-24 02:54 | 1.3M | |
![[ ]](/icons/compressed.gif) | martinov_georgij_a_fold_novere_hu_doc.zip | 2007-03-24 02:54 | 1.3M | |
![[ ]](/icons/layout.gif) | Havas Henrik-Mehkiralyno.pdf | 2007-10-30 22:43 | 1.3M | |
![[ ]](/icons/compressed.gif) | carr_joseph_j_a_megtort_kereszt_rtf_hu_nncl2814-6e4v1.zip | 2007-03-24 02:56 | 1.3M | |
![[ ]](/icons/compressed.gif) | cervantes_don_quijote_hu_pdf.zip | 2007-03-24 02:52 | 1.3M | |
![[ ]](/icons/compressed.gif) | botond-bolics_gyorgy_negyen_a_venusz-asztroplanon_hu_doc.zip | 2007-03-24 02:52 | 1.3M | |
![[ ]](/icons/compressed.gif) | Botond Bolics György - Négyen a Vénusz-asztroplánon hu doc.zip | 2007-02-21 16:39 | 1.3M | |
![[ ]](/icons/unknown.gif) | ozonviz balladaja.doc | 2007-11-14 09:46 | 1.3M | |
![[ ]](/icons/layout.gif) | [ A Sötétség Ostroma ].pdf | 2007-03-24 02:54 | 1.3M | |
![[ ]](/icons/compressed.gif) | weis_istvan_a_mai_magyar_tarsadalom_hu_pdf.zip | 2007-03-24 03:01 | 1.3M | |
![[ ]](/icons/compressed.gif) | 06. Falka vére - 3. A varázslok tornya.zip | 2007-03-26 14:59 | 1.3M | |
![[ ]](/icons/layout.gif) | [ A Félszerzet Ékköve ].pdf | 2007-03-24 02:54 | 1.3M | |
![[ ]](/icons/layout.gif) | [ Csillagtalan éj ].pdf | 2007-03-24 02:54 | 1.3M | |
![[ ]](/icons/compressed.gif) | nagy_laszlo_az_eros_fekete_beg_hu_doc.zip | 2007-03-24 02:58 | 1.3M | |
![[ ]](/icons/unknown.gif) | weis_hickman_az_oszi_alkony_sarkanyai.rtf | 2007-03-26 23:34 | 1.3M | |
![[ ]](/icons/unknown.gif) | Arthur C. Clarke - A jövő körvonalai(1962).doc | 2007-11-14 08:48 | 1.3M | |
![[ ]](/icons/compressed.gif) | mikszath_kalman_jokai_mor_elete_es_kora_pdf.zip | 2007-03-24 02:58 | 1.3M | |
![[ ]](/icons/compressed.gif) | kiss_lajos_a_szegeny_asszony_elete_hu_pdf.zip | 2007-03-24 02:56 | 1.3M | |
![[ ]](/icons/unknown.gif) | gibson_william_idoru_hu_nncl2575-6a7v1.rtf | 2007-11-14 06:40 | 1.3M | |
![[ ]](/icons/unknown.gif) | Dragonlance - Krónikák - 3. A tavaszi hajnal sárkánya | 2007-01-21 15:52 | 1.3M | |
![[ ]](/icons/compressed.gif) | 05. Falka vére - 2. Az álomjáró.zip | 2007-03-26 14:59 | 1.3M | |
![[ ]](/icons/unknown.gif) | Az alapitvány pereme 1.doc | 2007-11-14 09:14 | 1.3M | |
![[ ]](/icons/compressed.gif) | kovacs_sz_zoltan_fizi_karcsi_kalandjai_hu_html.zip | 2007-03-24 02:56 | 1.3M | |
![[ ]](/icons/unknown.gif) | 3 Második Alapítvány.doc | 2007-11-14 08:35 | 1.3M | |
![[ ]](/icons/compressed.gif) | may_karl_az_inka_oroksege_hu_rtf.zip | 2007-03-24 02:56 | 1.3M | |
![[ ]](/icons/layout.gif) | [ A Csend Pengéi ].pdf | 2007-03-24 02:54 | 1.3M | |
![[ ]](/icons/unknown.gif) | robotok es birodalom.rtf | 2007-11-14 02:15 | 1.3M | |
![[ ]](/icons/compressed.gif) | fulop_janos_bors_1_hu_pdf.zip | 2007-03-24 02:54 | 1.3M | |
![[ ]](/icons/unknown.gif) | Kurt Vonnegut-BORLESZK avagy nincs tobe magany | 2007-03-24 02:57 | 1.3M | |
![[ ]](/icons/layout.gif) | [ Kristalyszilánk ].pdf | 2007-03-24 02:54 | 1.3M | |
![[ ]](/icons/compressed.gif) | feist_raymond_e_magus_a_tanitvany_hu_doc.zip | 2007-03-24 02:54 | 1.3M | |
![[ ]](/icons/compressed.gif) | griffin_w_e_b_a_tengereszgyalogosok_6_hu_pdf_nncl2117-636v1.zip | 2007-03-24 03:01 | 1.3M | |
![[ ]](/icons/compressed.gif) | lorenz_konrad_mentsetek_meg_a_remenyt_hu_rtf_nncl2387-672v1.zip | 2007-03-24 02:56 | 1.3M | |
![[ ]](/icons/compressed.gif) | weis_hickman_az_ikrek_probaja_hu_rtf_nncl3206-719v1.zip | 2007-03-24 03:01 | 1.2M | |
![[ ]](/icons/compressed.gif) | 11. Tüz lelke - 2. Birodalmi strázsák.zip | 2007-03-26 14:59 | 1.2M | |
![[ ]](/icons/compressed.gif) | sternhagen_kyle_agyvihar_hu_pdf.zip | 2007-03-24 02:57 | 1.2M | |
![[ ]](/icons/unknown.gif) | tavol_a_foldtol.doc | 2007-11-14 04:53 | 1.2M | |
![[ ]](/icons/compressed.gif) | durrell_gerald_allatkert_a_poggyaszomban_hu_rtf.zip | 2007-03-24 02:54 | 1.2M | |
![[ ]](/icons/unknown.gif) | dilov_ljuben_az_ikarosz_utja.rtf | 2007-11-14 07:13 | 1.2M | |
![[ ]](/icons/compressed.gif) | botond-bolics_gyorgy_ha_felszall_a_kod_hu_doc.zip | 2007-03-24 02:52 | 1.2M | |
![[ ]](/icons/compressed.gif) | hicks_e_es_j_salamon_beavato_mesei_hu_doc.zip | 2007-03-24 02:53 | 1.2M | |
![[ ]](/icons/layout.gif) | Vámpirkrónikák - 4. A testrabló meséje.pdf | 2007-01-20 15:59 | 1.2M | |
![[ ]](/icons/compressed.gif) | bentley_jon_louis_a_programozas_gyongyszemei_hu_pdf.zip | 2007-03-24 02:56 | 1.2M | |
![[ ]](/icons/unknown.gif) | A Krytos-csapda.doc | 2007-03-24 02:54 | 1.2M | |
![[ ]](/icons/unknown.gif) | Stephen King - A setét torony 1.rar | 2007-02-13 02:53 | 1.2M | |
![[ ]](/icons/compressed.gif) | orkeny_istvan_egyperces_novellak_hu_txt.zip | 2007-03-24 02:58 | 1.2M | |
![[ ]](/icons/compressed.gif) | ronaszegi_miklos_botrany_a_suliban_hu_pdf.zip | 2007-03-24 03:00 | 1.2M | |
![[ ]](/icons/compressed.gif) | updike_john_nyulhaj_hu_pdf_nncl1265-4cdv1.zip | 2007-03-24 02:56 | 1.2M | |
![[ ]](/icons/compressed.gif) | chapman_wayne_a_fekete_dalnok_hu_rtf_nncl2645-6bav1.zip | 2007-03-24 03:01 | 1.2M | |
![[ ]](/icons/unknown.gif) | Robin Hood a tolvajok fejedelme.rtf | 2007-03-11 20:15 | 1.2M | |
![[ ]](/icons/unknown.gif) | roger_macbride_allen_utopia.rtf | 2007-11-14 09:54 | 1.2M | |
![[ ]](/icons/compressed.gif) | Vámpirvadász - 7. Égö áldozatok.zip | 2007-03-26 15:04 | 1.2M | |
![[ ]](/icons/layout.gif) | [ A Száműzött ].pdf | 2007-03-24 02:54 | 1.2M | |
![[ ]](/icons/compressed.gif) | 14. A kardok tengere.zip | 2007-03-26 18:34 | 1.2M | |
![[ ]](/icons/compressed.gif) | salvatore_r_a_kardok_tengere_hu_rtf.zip | 2006-05-29 06:05 | 1.2M | |
![[ ]](/icons/compressed.gif) | tamasi_aron_osszes_novellai_I-II_html.zip | 2007-03-24 03:00 | 1.2M | |
![[ ]](/icons/compressed.gif) | Botond Bolics György - 1 Ha felszall a kod hu doc.zip | 2007-02-21 16:50 | 1.2M | |
![[ ]](/icons/compressed.gif) | sienkiewicz_henryk_ozonviz_rtf.zip | 2007-03-24 02:55 | 1.2M | |
![[ ]](/icons/compressed.gif) | anderson_poul_a_tengernep_gyermekei_hu_pdf.zip | 2007-03-24 02:58 | 1.2M | |
![[ ]](/icons/compressed.gif) | 04. Falka vére - 1. A plerátus gyürüje.zip | 2007-03-26 14:59 | 1.2M | |
![[ ]](/icons/compressed.gif) | vonnegut_kurt_borleszk_hu_pdf.zip | 2007-03-24 02:57 | 1.2M | |
![[ ]](/icons/unknown.gif) | AZ ANDROMÉDA TÖRZS.doc | 2007-11-14 06:36 | 1.2M | |
![[ ]](/icons/compressed.gif) | sagan_carl_milliardok_es_milliardok_hu_rtf.zip | 2007-03-24 02:52 | 1.2M | |
![[ ]](/icons/layout.gif) | [ Menedék ].pdf | 2007-03-24 02:54 | 1.2M | |
![[ ]](/icons/compressed.gif) | feist_raymond_e_torott_korona_hu_doc_nncl2358-66av1.zip | 2007-03-24 02:54 | 1.2M | |
![[ ]](/icons/unknown.gif) | 1 Alapítvány.doc | 2007-11-14 03:07 | 1.2M | |
![[ ]](/icons/compressed.gif) | watson_ian_teljes_warhammer_5F5F40000_univerzuma_hu_rtf_nncl2710-6cbv2.zip | 2007-03-24 02:55 | 1.2M | |
![[ ]](/icons/layout.gif) | [ A Hajnal Ösvénye ].pdf | 2007-03-24 02:54 | 1.2M | |
![[ ]](/icons/unknown.gif) | Asimov - Az istenek is.doc | 2007-11-14 02:17 | 1.2M | |
![[ ]](/icons/compressed.gif) | Feist, Raymond E - Torot korona hu doc.zip.zip | 2007-03-26 14:40 | 1.2M | |
![[ ]](/icons/unknown.gif) | Salamon beavato mesei-Esthe es Jerry Hicks | 2007-03-24 03:00 | 1.2M | |
![[ ]](/icons/unknown.gif) | sztrugackij_a_b_a_karhozott_varos_hu.rtf | 2007-11-14 04:58 | 1.2M | |
![[ ]](/icons/compressed.gif) | faludy_gyorgy_versek_html.zip | 2007-03-24 02:55 | 1.2M | |
![[ ]](/icons/compressed.gif) | carroll_lewis_alice_csodaorszagban_html.zip | 2007-03-24 02:57 | 1.2M | |
![[ ]](/icons/layout.gif) | Tündéres Szabájk.Magyar.pdf | 2007-03-24 02:54 | 1.2M | |
![[ ]](/icons/layout.gif) | [ Otthon ].pdf | 2007-03-24 02:54 | 1.2M | |
![[ ]](/icons/unknown.gif) | Csillagok háborúja.doc | 2007-11-14 08:56 | 1.2M | |
![[ ]](/icons/unknown.gif) | 1. George Lucas - Csillagok h borŁja.doc | 2005-08-19 11:05 | 1.2M | |
![[ ]](/icons/compressed.gif) | dumas_alexandre_egy_orvos_feljegyzesei_hu_rtf.zip | 2007-03-24 02:49 | 1.2M | |
![[ ]](/icons/compressed.gif) | Lewis C.S.- Narnia 3 hu.doc.zip | 2007-03-26 16:35 | 1.2M | |
![[ ]](/icons/compressed.gif) | lewis_c_s_narnia_3_hu_doc.zip | 2007-03-24 02:52 | 1.2M | |
![[ ]](/icons/compressed.gif) | mora_ferenc_aranykoporso.pdf.zip | 2007-03-24 02:58 | 1.2M | |
![[ ]](/icons/compressed.gif) | crick_francis_az_elet_mikentje_hu_rtf.zip | 2007-03-24 02:54 | 1.2M | |
![[ ]](/icons/compressed.gif) | griffin_w_e_b_a_tengereszgyalogosok_1_hu_pdf.zip | 2007-03-24 03:01 | 1.2M | |
![[ ]](/icons/compressed.gif) | ahlberg_janet_allan_kis_kukac_konyv_hu_pdf.zip | 2007-03-24 02:49 | 1.2M | |
![[ ]](/icons/compressed.gif) | ady_endre_osszes_koltemeny_pdf.zip | 2007-03-24 02:55 | 1.2M | |
![[ ]](/icons/unknown.gif) | idovonal.rtf | 2007-11-14 05:03 | 1.1M | |
![[ ]](/icons/compressed.gif) | jokai_mor_frater_gyorgy_pdf.zip | 2007-03-24 02:56 | 1.1M | |
![[ ]](/icons/unknown.gif) | sztrugackij_a_b_santa_sors_hu.rtf | 2007-11-14 08:30 | 1.1M | |
![[ ]](/icons/compressed.gif) | updike_john_gyere_hozzam_felesegul_hu_pdf.zip | 2007-03-24 02:56 | 1.1M | |
![[ ]](/icons/compressed.gif) | bogati_peter_az_agasvari_csata_hu_doc.zip | 2007-03-24 02:51 | 1.1M | |
![[ ]](/icons/compressed.gif) | mikszath_kalman_kulonos_hazassag_pdf.zip | 2007-03-24 02:58 | 1.1M | |
![[ ]](/icons/compressed.gif) | Michael Crichton - Repülő koporsó.zip | 2007-04-15 03:59 | 1.1M | |
![[ ]](/icons/unknown.gif) | az_alapitvany_gyozelme.rtf | 2007-11-14 06:48 | 1.1M | |
![[ ]](/icons/compressed.gif) | botond-bolics_gyorgy_idegen_bolygon_szuletett_hu_doc.zip | 2007-03-24 02:52 | 1.1M | |
![[ ]](/icons/compressed.gif) | Botond Bolics György - 3 Idegen bolygon szuletett hu doc.zip | 2006-05-10 07:44 | 1.1M | |
![[ ]](/icons/compressed.gif) | Feist, Raymond E - KHL2_A kalmárfejedelem titka.zip | 2007-03-26 14:39 | 1.1M | |
![[ ]](/icons/compressed.gif) | feist_raymond_e_a_kalmarfejedelem_titka_hu_doc_nncl2231-64bv1.zip | 2007-03-24 02:54 | 1.1M | |
![[ ]](/icons/layout.gif) | Indiana Jones 's az elveszett frigyl da fosztogat˘i.pdf | 2006-05-27 09:10 | 1.1M | |
![[ ]](/icons/unknown.gif) | Roland Morgen - Sárkányháború.doc | 2007-04-02 22:04 | 1.1M | |
![[ ]](/icons/compressed.gif) | gilstrap_john_nathan_futasa_hu_pdf.zip | 2007-03-24 02:56 | 1.1M | |
![[ ]](/icons/unknown.gif) | Programozás.ace | 2007-03-24 02:58 | 1.1M | |
![[ ]](/icons/compressed.gif) | fable_vavyan_apad_anyad_ide_lojon_hu_rtf_nncl3003-704v1.zip | 2007-03-24 03:01 | 1.1M | |
![[ ]](/icons/unknown.gif) | asimov_kavics_az_ egben_hu.rtf | 2007-11-14 09:11 | 1.1M | |
![[ ]](/icons/compressed.gif) | Karoli Gaspar-Biblia.zip | 2007-03-24 02:56 | 1.1M | |
![[ ]](/icons/compressed.gif) | graves_robert_az_aranygyapju_hu_rtf.zip | 2007-03-24 02:59 | 1.1M | |
![[ ]](/icons/unknown.gif) | stephen_king-a_holtsav.rtf | 2007-03-24 03:00 | 1.1M | |
![[ ]](/icons/unknown.gif) | 2. Jó széllel toroni partra.doc | 2001-05-04 10:52 | 1.1M | |
![[ ]](/icons/unknown.gif) | andromeda.rtf | 2007-11-14 09:33 | 1.1M | |
![[ ]](/icons/unknown.gif) | elveszett_profeciak.rtf | 2007-03-24 02:54 | 1.1M | |
![[ ]](/icons/unknown.gif) | zahn_timothy_a_birodalom_orokosei.rtf | 2007-03-24 02:54 | 1.1M | |
![[ ]](/icons/unknown.gif) | arthur_c_clarke_isten_porolye.rtf | 2007-11-14 07:37 | 1.1M | |
![[ ]](/icons/compressed.gif) | Alexander Dumas-Monte Cristo grofja.zip | 2007-03-24 02:49 | 1.1M | |
![[ ]](/icons/compressed.gif) | feist_raymond_e_a_demonkiraly_duhe_2_hu_doc_nncl2356-66av1.zip | 2007-03-24 02:54 | 1.1M | |
![[ ]](/icons/unknown.gif) | orvosi.ace | 2007-03-24 02:52 | 1.1M | |
![[ ]](/icons/compressed.gif) | sagan_carl_az_eden_sarkanyai_hu_doc_nncl1242-4c0v1.zip | 2007-03-24 02:52 | 1.1M | |
![[ ]](/icons/compressed.gif) | Feist, Raymond E - A demonkiraly duhe 2 hu doc.zip.zip | 2007-03-26 14:39 | 1.1M | |
![[ ]](/icons/unknown.gif) | 1. Fekete vizek.doc | 2001-07-10 10:10 | 1.1M | |
![[ ]](/icons/compressed.gif) | dumas_alexandre_monte_cristo_grofja.zip | 2007-03-24 02:49 | 1.1M | |
![[ ]](/icons/compressed.gif) | Vámpirvadász - 6. Gyilkos tánc.zip | 2007-03-26 15:04 | 1.1M | |
![[ ]](/icons/compressed.gif) | Iles,Greg-Fekete kereszt.zip | 2007-03-24 02:55 | 1.1M | |
![[ ]](/icons/compressed.gif) | iles_greg_fekete kereszt.zip | 2007-03-24 02:55 | 1.1M | |
![[ ]](/icons/compressed.gif) | arany_janos_osszes_koltemenyei_html.zip | 2007-03-24 02:55 | 1.1M | |
![[ ]](/icons/unknown.gif) | Ryan Hawkwood - Farkasének.doc | 2007-04-02 22:08 | 1.1M | |
![[ ]](/icons/compressed.gif) | lem_stanislaw_solaris_hu_pdf.zip | 2007-03-24 03:00 | 1.1M | |
![[ ]](/icons/compressed.gif) | Stanislaw Lem - Solaris_hu_pdf.zip | 2006-05-29 04:03 | 1.1M | |
![[ ]](/icons/compressed.gif) | Star Trek Voyager 7.zip | 2007-03-26 18:56 | 1.1M | |
![[ ]](/icons/unknown.gif) | ozon.ace | 2007-03-24 02:52 | 1.1M | |
![[ ]](/icons/compressed.gif) | feist_raymond_e_a_demonkiraly_duhe_1_hu_doc_nncl2355-66av1.zip | 2007-03-24 02:54 | 1.1M | |
![[ ]](/icons/unknown.gif) | heinlein.doc | 2007-11-14 04:45 | 1.1M | |
![[ ]](/icons/compressed.gif) | Feist, Raymond E - A demonkiraly duhe 1 hu doc.zip.zip | 2007-03-26 14:39 | 1.1M | |
![[ ]](/icons/unknown.gif) | gerber_michael_NNCL904.doc | 2005-02-07 23:11 | 1.1M | |
![[ ]](/icons/compressed.gif) | Feist, Raymond E - KHL1_A sötét királynő árnyéka.zip | 2007-03-26 14:39 | 1.1M | |
![[ ]](/icons/compressed.gif) | feist_raymond_e_a_sotet_kiralyno_arnyeka_hu_doc_nncl2230-64bv1.zip | 2007-03-24 02:54 | 1.1M | |
![[ ]](/icons/compressed.gif) | gazdag_erzsi_mesebolt_hu_pdf.zip | 2007-03-24 02:54 | 1.1M | |
![[ ]](/icons/compressed.gif) | clavell_james_a_sogun_hu_html.zip | 2007-03-24 02:55 | 1.1M | |
![[ ]](/icons/compressed.gif) | smith_wilbur_a_folyo_istene_hu_rtf.zip | 2007-03-24 03:01 | 1.1M | |
![[ ]](/icons/compressed.gif) | iljin_m_hany_ora_hu_html.zip | 2007-03-24 02:57 | 1.1M | |
![[ ]](/icons/unknown.gif) | zahn_timothy_sotet_erok_ebredese.rtf | 2007-03-24 02:54 | 1.1M | |
![[ ]](/icons/compressed.gif) | Vámpirvadász - 5. Véres csontok.zip | 2007-03-26 15:04 | 1.1M | |
![[ ]](/icons/compressed.gif) | moldova_gyorgy_kis_aljassagok_lanyaimnak_hu_doc_nncl2689-6c4v1.zip | 2007-03-24 02:58 | 1.1M | |
![[ ]](/icons/compressed.gif) | fazekas_mihaly_ludas_matyi_hu_pdf_nncl2125-637v1.zip | 2007-03-24 02:57 | 1.1M | |
![[ ]](/icons/compressed.gif) | szabo_lorinc_konyvek_es_emberek_az_eletemben_html.zip | 2007-03-24 03:00 | 1.1M | |
![[TXT]](/icons/text.gif) | krimi.htm | 2007-03-24 02:58 | 1.1M | |
![[ ]](/icons/compressed.gif) | kiyosaki_robert_t_gazdag_papa_profeciaja_hu_html.zip | 2007-03-24 02:59 | 1.1M | |
![[ ]](/icons/compressed.gif) | szabo_lorinc_huszonot_ev_html.zip | 2007-03-24 03:00 | 1.0M | |
![[ ]](/icons/layout.gif) | Indiana Jones és az órások tánca.pdf | 2006-05-27 09:30 | 1.0M | |
![[ ]](/icons/compressed.gif) | Feist, Raymond E - RH4_Sethanon alkonya.zip | 2007-03-26 14:40 | 1.0M | |
![[ ]](/icons/compressed.gif) | feist_raymond_e_sethanon_alkonya_hu_doc.zip | 2007-03-24 02:54 | 1.0M | |
![[ ]](/icons/compressed.gif) | Lewis C.S.- Narnia 4 hu.doc.zip | 2007-03-26 16:35 | 1.0M | |
![[ ]](/icons/compressed.gif) | lewis_c_s_narnia_4_hu_doc.zip | 2007-03-24 02:52 | 1.0M | |
![[ ]](/icons/unknown.gif) | A csillagok akár a por.doc | 2007-11-13 22:41 | 1.0M | |
![[ ]](/icons/unknown.gif) | Ryan Hawkwood - Árnyjáték.doc | 2007-04-02 21:57 | 1.0M | |
![[ ]](/icons/compressed.gif) | Michael Crichton - Kongó.zip | 2007-05-16 20:23 | 1.0M | |
![[ ]](/icons/compressed.gif) | solymosi_laszlo_sakkozzunk_fiatalok_hu_pdf.zip | 2007-03-24 03:00 | 1.0M | |
![[ ]](/icons/compressed.gif) | caldwell_john_a_kaosz_eve_hu_rtf_nncl2540-69dv1.zip | 2007-03-24 02:58 | 1.0M | |
![[TXT]](/icons/text.gif) | Mitológia.TXT | 2007-03-24 02:58 | 1.0M | |
![[ ]](/icons/compressed.gif) | Isaac Asimov-Alapitvany elot.zip | 2007-03-24 02:55 | 1.0M | |
![[ ]](/icons/compressed.gif) | Feist, Raymond E - RH5_Vérbeli herceg.zip | 2007-03-26 14:40 | 1.0M | |
![[ ]](/icons/compressed.gif) | feist_raymond_e_verbeli_herceg_hu_doc.zip | 2007-03-24 02:54 | 1.0M | |
![[ ]](/icons/unknown.gif) | Dale Avery - A renagát.doc | 2007-04-02 21:58 | 1.0M | |
![[ ]](/icons/unknown.gif) | CSERNAI.doc | 2007-11-14 06:38 | 1.0M | |
![[ ]](/icons/unknown.gif) | Raoul Renier - Acél és oroszlán.doc | 2007-04-02 21:37 | 1.0M | |
![[ ]](/icons/compressed.gif) | Vámpirvadász - 2. A nevetö holttest.zip | 2007-03-26 15:03 | 1.0M | |
![[ ]](/icons/layout.gif) | Seraph.pdf | 2007-04-15 16:46 | 1.0M | |
![[ ]](/icons/compressed.gif) | kiss_lajos_a_szegeny_ember_elete_hu_pdf.zip | 2007-03-24 02:56 | 1.0M | |
![[ ]](/icons/unknown.gif) | a_mult_kisertete.rtf | 2007-03-24 02:54 | 1.0M | |
![[ ]](/icons/compressed.gif) | benson_ann_a_fekete_halal_hu_pdf.zip | 2007-03-24 02:49 | 1.0M | |
![[ ]](/icons/compressed.gif) | deak_ferenc_beszedei_rtf.zip | 2007-03-24 02:55 | 1.0M | |
![[ ]](/icons/compressed.gif) | Star Trek Voyager 5.zip | 2007-03-26 18:56 | 1.0M | |
![[ ]](/icons/unknown.gif) | a_torott_kard.doc | 2007-11-14 05:43 | 1.0M | |
![[ ]](/icons/compressed.gif) | spiro_gyorgy_fogsag_hu_rtf_nncl2434-683v1.zip | 2007-03-24 03:00 | 1.0M | |
![[ ]](/icons/compressed.gif) | szecheny_zsigmond_szarvasok_nyomaban_hu_doc_nncl2039-625v2.zip | 2007-03-24 03:00 | 1.0M | |
![[ ]](/icons/compressed.gif) | George R. R. Martin - Tüz és jég dala - 2. Királyok csatája.zip | 2007-03-23 05:03 | 1.0M | |
![[ ]](/icons/unknown.gif) | albaryu_esther_sarkanyhaboruk.rtf | 2007-03-24 02:54 | 1.0M | |
![[ ]](/icons/compressed.gif) | Feist, Raymond E - RH6_A király kalóza I.zip | 2007-03-26 14:40 | 1.0M | |
![[ ]](/icons/compressed.gif) | feist_raymond_e_a_kiraly_kaloza_I_hu_doc.zip | 2007-03-24 02:54 | 1.0M | |
![[ ]](/icons/unknown.gif) | A Látnok Ciklus - 1. Az orgyilkos tanítványa.rtf | 2007-03-08 23:24 | 1.0M | |
![[ ]](/icons/unknown.gif) | AZAELOTT.RTF | 2007-11-14 07:35 | 1.0M | |
![[ ]](/icons/unknown.gif) | Kobrafészek, a dal hava, Shulurtól Caedonig, Romok Caedon mellett, Bosszú, Cerin Laim | 2007-04-15 16:54 | 1.0M | |
![[ ]](/icons/compressed.gif) | czako_gabor_a_sarkanymocsar_ura_hu_pdf.zip | 2007-03-24 02:52 | 1.0M | |
![[ ]](/icons/compressed.gif) | ende_michael_momo_hu_html.zip | 2007-03-24 02:57 | 1.0M | |
![[ ]](/icons/compressed.gif) | Vámpirvadász - 1. Bünös vágyak.zip | 2007-03-26 15:03 | 1.0M | |
![[ ]](/icons/compressed.gif) | illyes_gyula_osszegyujtott_versei_html.zip | 2007-03-24 02:55 | 1.0M | |
![[ ]](/icons/layout.gif) | Fejvadász-akciók 1.pdf | 2007-04-15 16:49 | 1.0M | |
![[ ]](/icons/compressed.gif) | ArisztoteleszALelekrol.zip | 2007-03-24 02:49 | 1.0M | |
![[ ]](/icons/compressed.gif) | botond-bolics_gyorgy_ezer_ev_a_venuszon_hu_doc.zip | 2007-03-24 02:52 | 1.0M | |
![[ ]](/icons/compressed.gif) | Botond Bolics György - 2 Ezer ev a venuszon hu doc.zip | 2007-02-21 16:42 | 1.0M | |
![[ ]](/icons/unknown.gif) | Timothy Zahn-3. Utols˘ parancs .rtf | 2007-02-22 17:42 | 1.0M | |
![[TXT]](/icons/text.gif) | Demonhercegno_hu.txt | 2007-03-24 02:54 | 1.0M | |
![[ ]](/icons/compressed.gif) | davis_jim_garfield_es_a_merges_magus_hu_doc.zip | 2007-03-24 02:56 | 1.0M | |
![[ ]](/icons/compressed.gif) | aszlanyi_karoly_kalandos_vakacio_hu_doc.zip | 2007-03-24 02:49 | 1.0M | |
![[ ]](/icons/compressed.gif) | druon_maurice_az_elatkozott_kiralyok_2_hu_doc_nncl2817-6e4v1.zip | 2007-03-24 02:57 | 1.0M | |
![[ ]](/icons/unknown.gif) | jazz-zeneszek.ace | 2007-03-24 02:52 | 1.0M | |
![[ ]](/icons/compressed.gif) | Star Trek Voyager 6.zip | 2007-03-26 18:56 | 1.0M | |
![[ ]](/icons/layout.gif) | ho_hull_a_holtakra.pdf | 2007-04-15 16:43 | 1.0M | |
![[ ]](/icons/layout.gif) | Indiana Jones 's az utols˘ keresztes lovag.pdf | 2006-05-27 09:25 | 1.0M | |
![[ ]](/icons/compressed.gif) | asimov_isaac_alapitvany_trilogia_javitott.zip | 2007-03-24 02:55 | 1.0M | |
![[ ]](/icons/compressed.gif) | Isaac Asimov - Alapitvany_trilogia_javitott.zip | 2007-02-21 16:46 | 1.0M | |
![[ ]](/icons/compressed.gif) | Alapitvany_trilogia_javitott.zip | 2007-08-04 15:31 | 1.0M | |
![[ ]](/icons/unknown.gif) | carsac_francois_a_vilagur_robinsonjai.doc | 2007-11-14 05:48 | 1.0M | |
![[ ]](/icons/compressed.gif) | doyle_arthur_conan_sherlock_holmes_kalandjai_pdf.zip | 2007-03-24 02:49 | 1.0M | |
![[ ]](/icons/compressed.gif) | Lewis C.S.- Narnia 2 hu.doc.zip | 2007-03-26 16:34 | 1.0M | |
![[ ]](/icons/compressed.gif) | lewis_c_s_narnia_2_hu_doc.zip | 2007-03-24 02:52 | 1.0M | |
![[ ]](/icons/unknown.gif) | Nemere_Istvan_a_terido_istenei_hu_rtf.doc | 2005-12-07 10:53 | 1.0M | |
![[ ]](/icons/compressed.gif) | boros_lajos_sakalok_hu_pdf_nncl2478-68ev1.zip | 2007-03-24 02:52 | 1.0M | |
![[ ]](/icons/compressed.gif) | davis_jim_garfield_es_a_titokzatos_mumia_hu_doc.zip | 2007-03-24 02:56 | 1.0M | |
![[ ]](/icons/compressed.gif) | robinson_kim_stanley_voros_mars_hu_doc_nncl431-xxxv1.zip | 2007-03-24 02:56 | 1.0M | |
![[ ]](/icons/compressed.gif) | mccullough_colleen_troja_eneke_hu_doc_nncl2547-6a1v1.zip | 2007-03-24 02:52 | 1.0M | |
![[ ]](/icons/compressed.gif) | davis_jim_garfield_es_a_zur_kommando_2_hu_doc.zip | 2007-03-24 02:56 | 1.0M | |
![[ ]](/icons/compressed.gif) | krudy_gyula_rakoczi_harangja.zip | 2007-03-24 02:56 | 1.0M | |
![[ ]](/icons/unknown.gif) | A keselyük gyászzenéje.doc | 2007-03-24 02:57 | 1.0M | |
![[ ]](/icons/unknown.gif) | Tron.doc | 2007-11-14 09:07 | 1.0M | |
![[ ]](/icons/compressed.gif) | krudy_gyula_magyar_tajak.zip | 2007-03-24 02:56 | 1.0M | |
![[ ]](/icons/unknown.gif) | dune_gyermekei.rtf | 2007-11-14 07:27 | 1.0M | |
![[ ]](/icons/unknown.gif) | Láng Attila D. Nicky.doc | 2005-07-09 17:35 | 1.0M | |
![[ ]](/icons/compressed.gif) | Romhanyi Jozsef-Mezga Aladar kulonos kalandjai.zip | 2007-03-24 03:00 | 1.0M | |
![[ ]](/icons/compressed.gif) | Feist, Raymond E - RH6_A király kalóza II.zip | 2007-03-26 14:40 | 1.0M | |
![[ ]](/icons/compressed.gif) | feist_raymond_e_a_kiraly_kaloza_II_hu_doc.zip | 2007-03-24 02:54 | 1.0M | |
![[ ]](/icons/unknown.gif) | gomb.rtf | 2007-11-14 09:03 | 1.0M | |
![[ ]](/icons/compressed.gif) | romhanyi_jozsef_mezga_aladar_kulonos_kalandjai_hu_doc.zip | 2007-03-24 02:53 | 1.0M | |
![[ ]](/icons/unknown.gif) | DFDoom.doc | 2007-11-14 08:31 | 1.0M | |
![[ ]](/icons/compressed.gif) | omolnar_miklos_rb_kapitany_hu_html.zip | 2007-03-24 02:58 | 1.0M | |
![[ ]](/icons/compressed.gif) | Hamvas Bela-Tabula smaragdina.zip | 2007-03-24 02:53 | 1.0M | |
![[ ]](/icons/compressed.gif) | dumas_alexandre_emma_lyonna_hu_rtf.zip | 2007-03-24 02:49 | 1.0M | |
![[ ]](/icons/compressed.gif) | weis_hickman_a_teli_ej_sarkanyai_hu_doc_nncl1953-619v1.zip | 2007-03-24 03:01 | 1.0M | |
![[ ]](/icons/compressed.gif) | caldwell_john_a_kaosz_kincse_hu_rtf_nncl2842-6e9v1.zip | 2007-03-24 02:58 | 972K | |
![[ ]](/icons/compressed.gif) | smith_wilbur_harag_hu_rtf_nncl2564-6a6v1.zip | 2007-03-24 03:01 | 971K | |
![[ ]](/icons/compressed.gif) | Rowling, J.K - Harry Potter és a Varázslók háborúja.zip | 2007-03-20 05:06 | 971K | |
![[ ]](/icons/compressed.gif) | arad.zip | 2007-03-24 02:49 | 969K | |
![[ ]](/icons/compressed.gif) | Jorge Luis Borges valogatott muvei.zip | 2007-03-24 02:56 | 968K | |
![[ ]](/icons/compressed.gif) | harte_bret_aranyasok_hu_rtf.zip | 2007-03-24 02:52 | 968K | |
![[ ]](/icons/unknown.gif) | 4. Sogron lángjai I.doc | 2001-06-29 14:48 | 968K | |
![[ ]](/icons/compressed.gif) | bogati_peter_a_hovirag_masodkormanyosa_jelenti_hu_doc.zip | 2007-03-24 02:51 | 968K | |
![[ ]](/icons/compressed.gif) | gibson_william_a_szamlalo_nullara_hu_pdf_nncl2963-6fav1.zip | 2007-03-24 03:01 | 966K | |
![[ ]](/icons/compressed.gif) | Star Trek Voyager 3.zip | 2007-03-26 18:56 | 966K | |
![[ ]](/icons/layout.gif) | 1982-A setét torony 1-A harcos.pdf | 2007-11-04 06:51 | 964K | |
![[ ]](/icons/unknown.gif) | rice_anne_memnoch_a_satan_hu_nncl3579-780v1.rtf | 2006-11-13 16:57 | 963K | |
![[ ]](/icons/compressed.gif) | warner_rex_aerodrom_hu_pdf.zip | 2007-03-24 02:59 | 962K | |
![[ ]](/icons/compressed.gif) | Charles Dickens-David Copperfield.zip | 2007-03-24 02:52 | 960K | |
![[ ]](/icons/compressed.gif) | mora_ferenc_enek_a_buzamezokrol.pdf.zip | 2007-03-24 02:58 | 960K | |
![[ ]](/icons/compressed.gif) | dickens_charles_david_copperfield_rtf.zip | 2007-03-24 02:52 | 959K | |
![[ ]](/icons/compressed.gif) | Star Trek voy negyedik evad.zip | 2007-03-26 18:56 | 959K | |
![[ ]](/icons/compressed.gif) | Star Trek Voyager 4.zip | 2007-03-26 18:56 | 959K | |
![[ ]](/icons/unknown.gif) | a_kek_sziget.rtf | 2007-11-14 09:49 | 959K | |
![[ ]](/icons/compressed.gif) | davis_jim_garfield_es_a_zur_kommando_1_hu_doc.zip | 2007-03-24 02:56 | 958K | |
![[ ]](/icons/layout.gif) | [ Ezüst erek ].pdf | 2007-03-24 02:54 | 956K | |
![[ ]](/icons/layout.gif) | Versenymodul_v2.0.pdf | 2007-04-15 16:56 | 955K | |
![[ ]](/icons/unknown.gif) | Gyűrűvilág.rtf | 2007-11-13 23:37 | 954K | |
![[ ]](/icons/compressed.gif) | montanus_ambrose_egykor_hu_pdf.zip | 2007-03-24 02:49 | 954K | |
![[ ]](/icons/compressed.gif) | Ambrose Montanus-Egykor.zip | 2007-03-24 02:49 | 954K | |
![[ ]](/icons/compressed.gif) | davis_jim_garfield_es_a_zur_kommando_3_hu_doc.zip | 2007-03-24 02:56 | 949K | |
![[ ]](/icons/compressed.gif) | hamvas_bela_karneval_hu_html.zip | 2007-03-24 02:55 | 946K | |
![[ ]](/icons/compressed.gif) | Frank Herbert-A DUNE 1-2.zip | 2007-03-24 02:54 | 944K | |
![[ ]](/icons/unknown.gif) | clarke_a_mars_titka.doc | 2007-11-14 09:39 | 944K | |
![[ ]](/icons/compressed.gif) | swerling_beverly_almok_varosa_hu_rtf_nncl2948-6f3v1.zip | 2007-03-24 02:51 | 943K | |
![[ ]](/icons/compressed.gif) | kovacs_endre_ultikodex_hu_djvu.zip | 2007-03-24 02:56 | 943K | |
![[ ]](/icons/compressed.gif) | boros_lajos_sakalok_hu_doc_nncl2478-68ev1.zip | 2007-03-24 02:52 | 941K | |
![[ ]](/icons/unknown.gif) | A_Szilmarilok.rtf | 2007-11-14 09:06 | 941K | |
![[ ]](/icons/compressed.gif) | weis_hickman_a_sotetseg_kutja_2_hu_rtf_nncl2380-671v1.zip | 2007-03-24 03:01 | 939K | |
![[ ]](/icons/compressed.gif) | Feist, Raymond E - RH3_Ezüsttövis.zip | 2007-03-26 14:40 | 937K | |
![[ ]](/icons/compressed.gif) | feist_raymond_e_ezusttovis_hu_doc.zip | 2007-03-24 02:54 | 937K | |
![[ ]](/icons/compressed.gif) | herbert_frank_dune.zip | 2007-03-24 02:54 | 936K | |
![[ ]](/icons/compressed.gif) | Frank Herbert - A Düne.zip | 2006-08-24 22:02 | 936K | |
![[ ]](/icons/compressed.gif) | goodkind_terry_a_konnyek_kove_3_a_kard_varazsloja_hu_doc_nncl3285-73ev1.zip | 2007-03-24 03:00 | 935K | |
![[ ]](/icons/compressed.gif) | solomon_neil_tahitian_noni_juice_hu_rtf.zip | 2007-03-24 02:53 | 935K | |
![[ ]](/icons/compressed.gif) | gordon_richard_mibol_lesz_az_orvosdoktor_hu_pdf.zip | 2007-03-24 02:59 | 935K | |
![[ ]](/icons/compressed.gif) | vukovic_cedo_a_robotok_ura_hu_doc.zip | 2007-03-24 02:52 | 933K | |
![[ ]](/icons/compressed.gif) | dosztojevszkij_fjodor_a_karamazov_testverek_rtf.zip | 2007-03-24 02:53 | 930K | |
![[ ]](/icons/compressed.gif) | fable_vavyan_szennybol_az_angyal_hu_rtf_nncl3282-73ev1.zip | 2007-03-24 03:01 | 930K | |
![[ ]](/icons/compressed.gif) | zsigray_julianna_tavoli_feny_hu_rtf.zip | 2007-03-24 03:01 | 929K | |
![[ ]](/icons/compressed.gif) | herbert_frank_dune_eretnekei_hu_rtf.zip.zip | 2007-03-24 02:54 | 929K | |
![[ ]](/icons/compressed.gif) | eco_umberto_hat_seta_a_fikcio_erdejeben_hu_doc.zip | 2007-03-24 03:00 | 928K | |
![[ ]](/icons/unknown.gif) | daley_brian_erzekeny_bucsu_a_birodalomtol.rtf | 2007-03-24 02:54 | 927K | |
![[ ]](/icons/compressed.gif) | cornwell_bernard_excalibur_2_hu_rtf.zip | 2007-03-24 02:50 | 926K | |
![[ ]](/icons/compressed.gif) | feist_raymond_e_krondor_arulas_hu_doc.zip | 2007-03-24 02:54 | 925K | |
![[ ]](/icons/unknown.gif) | W Hamilton Green - Renegátok (A kardok könyve).doc | 2007-04-02 22:02 | 924K | |
![[ ]](/icons/compressed.gif) | szabo_zoltan_cifra_nyomorusag_hu_pdf.zip | 2007-03-24 03:00 | 923K | |
![[ ]](/icons/compressed.gif) | goodkind_terry_a_konnyek_kove_1_sotet_arnyak_ebredese_hu_doc_nncl3283-73ev1.zip | 2007-03-24 03:00 | 923K | |
![[ ]](/icons/unknown.gif) | Mike McQuay - Gyanú.rtf | 2006-07-19 20:58 | 922K | |
![[ ]](/icons/compressed.gif) | davis_jim_garfield_es_a_zur_kommando_4_hu_doc.zip | 2007-03-24 02:56 | 922K | |
![[ ]](/icons/compressed.gif) | kis_danilo_a_holtak_enciklopediaja_hun_pdf_nncl2157-63bv1.zip | 2007-03-24 02:52 | 921K | |
![[ ]](/icons/compressed.gif) | shaw_irwin_oroszlankolykok_hu_doc.zip | 2007-03-24 02:55 | 921K | |
![[ ]](/icons/compressed.gif) | Feist, Raymond E - Krondor arulas hu doc.zip.zip | 2007-03-26 14:39 | 919K | |
![[ ]](/icons/compressed.gif) | follett_ken_a_katedralis_hu_rtf.zip | 2007-03-24 02:56 | 919K | |
![[ ]](/icons/compressed.gif) | crichton_michael_oslenypark_hu_doc_nncl2461-68ev1.zip | 2007-03-24 02:57 | 917K | |
![[ ]](/icons/compressed.gif) | szabo_lorinc_osszes_versei_html.zip | 2007-03-24 03:00 | 917K | |
![[ ]](/icons/compressed.gif) | weis_hickman_a_sotetseg_kutja_1_hu_rtf_nncl2352-667v1.zip | 2007-03-24 03:01 | 917K | |
![[ ]](/icons/compressed.gif) | scott_walter_a_lammermoori_nasz_pdf.zip | 2007-03-24 03:01 | 917K | |
![[ ]](/icons/compressed.gif) | dickens_charles_dombey_es_fia_rtf.zip | 2007-03-24 02:52 | 916K | |
![[ ]](/icons/compressed.gif) | ARANY JANOS versei.zip | 2007-03-24 02:55 | 916K | |
![[ ]](/icons/layout.gif) | [ Örökség ].pdf | 2007-03-24 02:54 | 916K | |
![[ ]](/icons/unknown.gif) | patkanykiraly.rtf | 2007-03-24 02:55 | 914K | |
![[ ]](/icons/unknown.gif) | Gáspár András - Kiálts Farkast.rtf | 2007-11-14 06:21 | 914K | |
![[ ]](/icons/compressed.gif) | black_campbell_az_elveszett_frigylada_fosztogatoi_hu_pdf.zip | 2007-03-24 02:52 | 913K | |
![[ ]](/icons/compressed.gif) | golding_william_a_torony_hu_rtf.zip | 2007-03-24 03:01 | 910K | |
![[ ]](/icons/compressed.gif) | Isaac Asimov-Elojatek az alapitvanyhoz.zip | 2007-03-24 02:55 | 908K | |
![[ ]](/icons/compressed.gif) | chapman_wayne_eszak_langjai_hu_doc.zip | 2007-03-24 03:01 | 908K | |
![[ ]](/icons/compressed.gif) | rasch_carlos_meteorvadaszok_hu_doc.zip | 2007-03-24 02:52 | 906K | |
![[ ]](/icons/compressed.gif) | Subah Zoltan-MARTA.zip | 2007-03-24 03:00 | 904K | |
![[ ]](/icons/unknown.gif) | herbert_frank_dune_messiasa.rtf | 2007-11-14 09:16 | 904K | |
![[ ]](/icons/layout.gif) | crown_empire_2_-_a_sotet_sereg.pdf | 2007-01-20 17:02 | 904K | |
![[ ]](/icons/unknown.gif) | a_ragyogas.rtf | 2004-10-04 05:12 | 904K | |
![[ ]](/icons/compressed.gif) | hamilton_laurell_k_obszidian_pillango_hu_rtf_nncl3275-739v1.zip | 2007-03-24 02:57 | 903K | |
![[ ]](/icons/unknown.gif) | a_tuzgyujto.rtf | 2004-05-31 19:00 | 902K | |
![[ ]](/icons/compressed.gif) | tamasi_aron_szinjatekai_html.zip | 2007-03-24 03:00 | 901K | |
![[ ]](/icons/compressed.gif) | szabo_zoltan_a_tardi_helyzet_hu_pdf.zip | 2007-03-24 03:00 | 900K | |
![[ ]](/icons/unknown.gif) | ALAPELOJ.RTF | 2007-11-14 07:44 | 899K | |
![[ ]](/icons/unknown.gif) | Wayne Chapman - A Halál Havában.doc | 2007-03-24 02:54 | 895K | |
![[ ]](/icons/compressed.gif) | aszlanyi_karoly_az_eszaki_park_felfedezese_hu_doc.zip | 2007-03-24 02:49 | 894K | |
![[ ]](/icons/compressed.gif) | Nemere István - Senkinek_se_nyiss_ajtot_hu_rtf.zip | 2007-03-26 17:41 | 894K | |
![[ ]](/icons/compressed.gif) | Paolini, Christoper - Eragon az elsőszülött.zip | 2007-03-20 05:19 | 892K | |
![[ ]](/icons/compressed.gif) | asimov_isaac_a_hajnal_bolygo_robotjai_doc.zip | 2007-03-24 02:55 | 892K | |
![[ ]](/icons/unknown.gif) | kaliban.rtf | 2007-11-14 09:08 | 891K | |
![[ ]](/icons/compressed.gif) | Les martin-Az arnyek[The shadow].zip | 2007-03-24 02:57 | 891K | |
![[ ]](/icons/compressed.gif) | Frederic Pohl - Átjáró.zip | 2007-03-26 18:10 | 891K | |
![[ ]](/icons/unknown.gif) | halalsoron.rtf | 2005-03-03 17:55 | 890K | |
![[ ]](/icons/compressed.gif) | anderson_poul_atjaro.zip | 2007-03-24 02:58 | 890K | |
![[ ]](/icons/compressed.gif) | goodkind_terry_a_konnyek_kove_2_a_halalhozo_hu_doc_nncl3284-73ev1.zip | 2007-03-24 03:00 | 887K | |
![[ ]](/icons/layout.gif) | Stephen King-A setét torony 1.pdf | 2007-02-13 02:43 | 886K | |
![[ ]](/icons/compressed.gif) | Ivan Jefremov - Az Androméda-köd.zip | 2007-03-26 15:30 | 885K | |
![[ ]](/icons/compressed.gif) | kemeny_dezso_titokzatos_kecskebak_hu_doc_nncl2959-6fav1.zip | 2007-03-24 02:56 | 883K | |
![[ ]](/icons/compressed.gif) | clancy_tom_elnoki_jatszma_hu_rtf.zip | 2007-03-24 03:00 | 883K | |
![[ ]](/icons/unknown.gif) | Túl a kék eseményhorizonton.doc | 2007-11-14 07:14 | 883K | |
![[ ]](/icons/compressed.gif) | Wayne Chapman - Észak lángjai hu doc.zip | 2006-05-10 21:48 | 881K | |
![[ ]](/icons/unknown.gif) | KUNSZAKW.ZIP | 2007-03-24 02:59 | 881K | |
![[ ]](/icons/compressed.gif) | ludlum_robert_a_fantom_ultimatuma_hu_rtf.zip | 2007-03-24 02:59 | 880K | |
![[ ]](/icons/unknown.gif) | hh.doc | 2007-11-14 06:24 | 880K | |
![[ ]](/icons/unknown.gif) | Az alapitvány pereme 2.doc | 2007-11-14 02:40 | 880K | |
![[ ]](/icons/compressed.gif) | Star Trek Voyager 2.zip | 2007-03-26 18:56 | 879K | |
![[ ]](/icons/unknown.gif) | Margaret Weis 's Tracy Hickman - S rk nysz rny I.rtf | 2007-03-26 02:19 | 879K | |
![[ ]](/icons/compressed.gif) | feist_raymond_e_krondor_orgyilkosok_hu_doc.zip | 2007-03-24 02:54 | 878K | |
![[ ]](/icons/unknown.gif) | p_20020512.ace | 2007-03-24 02:52 | 878K | |
![[ ]](/icons/compressed.gif) | jokai_anna_az_ifju_halasz_es_a_to_html.zip | 2007-03-24 02:56 | 877K | |
![[ ]](/icons/compressed.gif) | rowling_j_k_harry_potter_es_a_fonix_rendje_hu_doc_nncl1386-507v3.zip | 2007-03-24 02:55 | 875K | |
![[ ]](/icons/compressed.gif) | Feist, Raymond E - Krondor_az _istenek_konnye_hu_doc_nncl2120-637v1.zip.zip | 2007-03-26 14:40 | 874K | |
![[ ]](/icons/layout.gif) | crown_empire_3_-_demonlelek.pdf | 2007-01-20 17:02 | 874K | |
![[ ]](/icons/compressed.gif) | Feist, Raymond E - Krondor_orgyilkosok_hu_doc.zip.zip | 2007-03-26 14:40 | 874K | |
![[ ]](/icons/compressed.gif) | feist_raymond_e_rho3_krondor_az _istenek_konnye_hu_doc_nncl2120-637v1.zip | 2007-03-24 02:54 | 874K | |
![[ ]](/icons/compressed.gif) | fust_milan_osszegyujtott_elbeszelesei_html.zip | 2007-03-24 02:54 | 873K | |
![[ ]](/icons/compressed.gif) | fawcett_harrison_best_of_brett_shaw_hu_doc_nncl2375-671v1.zip | 2007-03-24 02:55 | 872K | |
![[ ]](/icons/compressed.gif) | toke_peter_veszedelem_az_osvilagbol_hu_pdf.zip | 2007-03-24 03:00 | 872K | |
![[ ]](/icons/compressed.gif) | Isaac Asimov - F451 Site-ról.zip | 2007-03-22 05:29 | 872K | |
![[ ]](/icons/compressed.gif) | rice_anne_lasher_hu_doc.zip | 2007-03-24 02:49 | 872K | |
![[ ]](/icons/compressed.gif) | tolsztoj_anna_karenina_rtf.zip | 2007-03-24 02:57 | 872K | |
![[ ]](/icons/compressed.gif) | nemere_istvan_senkinek_se_nyiss_ajtot_hu_rtf.zip | 2007-03-24 02:58 | 871K | |
![[ ]](/icons/unknown.gif) | szokeveny_robot.doc | 2007-11-14 06:23 | 871K | |
![[ ]](/icons/unknown.gif) | hambly_barbara_alkonybolygo.rtf | 2007-03-24 02:54 | 869K | |
![[ ]](/icons/compressed.gif) | cronin_a_j_ezt_latjak_a_csillagok_hu_doc_nncl2427-683v1.zip | 2007-03-24 02:49 | 869K | |
![[ ]](/icons/unknown.gif) | follett_james_a_jeg.doc | 2007-11-14 09:04 | 868K | |
![[ ]](/icons/unknown.gif) | Patkánykirály.rtf | 2007-03-24 02:55 | 868K | |
![[ ]](/icons/compressed.gif) | simenon_georges_maigret_es_a_hazudos_szeretok_hu_doc_nncl2762-6d9v1.zip | 2007-03-24 02:54 | 867K | |
![[ ]](/icons/compressed.gif) | smith_wilbur_a_kard_hatalma_hu_rtf_nncl2570-6a7v1.zip | 2007-03-24 03:01 | 866K | |
![[ ]](/icons/compressed.gif) | graves_robert_jezus_kiraly_hu_doc_nncl2763-6d9v1.zip | 2007-03-24 02:59 | 863K | |
![[ ]](/icons/unknown.gif) | Homokszemek.doc | 2007-04-15 16:42 | 863K | |
![[ ]](/icons/compressed.gif) | gemma_16_scifi_novella.zip | 2007-08-04 15:31 | 863K | |
![[ ]](/icons/compressed.gif) | Vámpirvadász - 4. Telihold kávézo.zip | 2007-03-26 15:04 | 862K | |
![[ ]](/icons/compressed.gif) | Douglas Adams-Jobbara artalmatlan.zip | 2007-03-24 02:53 | 862K | |
![[ ]](/icons/compressed.gif) | jokai_mor_a_magyar_nemzet_tortenete_html.zip | 2007-03-24 02:56 | 862K | |
![[ ]](/icons/compressed.gif) | magyarosi_gizella_ki_fogja_a_kukacot_hu_rtf.zip | 2007-03-24 02:57 | 861K | |
![[ ]](/icons/compressed.gif) | lem_stanislaw_csillanaplo_hu_doc.zip | 2007-03-24 03:00 | 861K | |
![[ ]](/icons/compressed.gif) | Stanislaw Lem - Csillanaplo_hu_doc.zip | 2006-05-29 03:49 | 861K | |
![[ ]](/icons/compressed.gif) | ANARHIAZMUS-Modern ideologiak.zip | 2007-03-24 02:49 | 860K | |
![[ ]](/icons/compressed.gif) | adams_douglas_jobbara_artalmatlan.zip | 2007-03-24 02:53 | 860K | |
![[ ]](/icons/unknown.gif) | Esther Albaryu - Sárkányháborúk.rtf | 2006-07-19 06:45 | 860K | |
![[ ]](/icons/compressed.gif) | may_karl_a_szerencset_hozo_almasderes_hu_rtf.zip | 2007-03-24 02:56 | 859K | |
![[ ]](/icons/unknown.gif) | hoyle_elliot_andromeda_hu.rtf | 2007-11-14 04:37 | 857K | |
![[ ]](/icons/unknown.gif) | nemere_istvan_a_titan_terv_hu_nncl2169_63cv1.doc | 2006-04-09 14:25 | 857K | |
![[ ]](/icons/unknown.gif) | Raoul Renier - Korona és kehely.doc | 2007-04-02 22:04 | 855K | |
![[ ]](/icons/unknown.gif) | hidmut.ace | 2007-03-24 02:52 | 854K | |
![[ ]](/icons/compressed.gif) | Asimov nyomán - Allen Macbride - Inferno.zip | 2006-12-13 23:15 | 851K | |
![[ ]](/icons/unknown.gif) | Zahn-Hoditok.doc | 2007-03-24 02:54 | 851K | |
![[ ]](/icons/compressed.gif) | smith_wilbur_a_langolo_part_hu_doc_nncl2535_69cv1.zip | 2007-03-24 03:01 | 849K | |
![[ ]](/icons/unknown.gif) | DOSADI.RTF | 2007-11-14 07:13 | 847K | |
![[ ]](/icons/unknown.gif) | SEHOLLAKOK.doc | 2007-11-14 09:48 | 847K | |
![[ ]](/icons/unknown.gif) | holdrenges.ace | 2007-03-24 02:52 | 847K | |
![[ ]](/icons/compressed.gif) | jones_james_most_es_mindorokke_hu_rtf.zip | 2007-03-24 02:55 | 844K | |
![[ ]](/icons/layout.gif) | Gyilkos_az_arnyekban.pdf | 2007-03-24 02:54 | 843K | |
![[ ]](/icons/compressed.gif) | Nietzche-tar.zip | 2007-03-24 02:54 | 843K | |
![[ ]](/icons/layout.gif) | Halálkapu - 2. Sárkányszárny 2.pdf | 2007-01-21 15:54 | 843K | |
![[ ]](/icons/unknown.gif) | regatta.rtf | 2007-11-14 05:52 | 842K | |
![[ ]](/icons/compressed.gif) | martinov_georgij_idospiral_hu_doc.zip | 2007-03-24 02:54 | 839K | |
![[ ]](/icons/compressed.gif) | clancy_tom_a_retteges_arenaja_hu_rtf.zip | 2007-03-24 03:00 | 838K | |
![[ ]](/icons/compressed.gif) | martin_les_az_arnyek_hu_txt.zip | 2007-03-24 02:57 | 838K | |
![[ ]](/icons/layout.gif) | 3.A hajnal hadura.pdf | 2006-06-22 08:56 | 838K | |
![[ ]](/icons/compressed.gif) | csukas_istvan_osszegyujtot_versek_html.zip | 2007-03-24 02:57 | 836K | |
![[ ]](/icons/compressed.gif) | wodehouse_p_g_psmith_a_penzvilagban_hu_rtf_nncl1989-61bv2.zip | 2007-03-24 02:58 | 836K | |
![[ ]](/icons/compressed.gif) | schury_gudrun_elteto_nedv_hu_pdf.zip | 2007-03-24 02:55 | 834K | |
![[ ]](/icons/unknown.gif) | voros_oroszlan_2.rtf | 2007-11-14 09:05 | 833K | |
![[ ]](/icons/compressed.gif) | crichton_michael_az_andromeda_torzs_hu_doc.zip | 2007-03-24 02:57 | 832K | |
![[ ]](/icons/compressed.gif) | Michael Crichton - Az andromeda törzs hu doc.zip | 2006-05-10 17:32 | 832K | |
![[ ]](/icons/unknown.gif) | VLTSZR~1.ACE | 2007-03-24 02:54 | 831K | |
![[ ]](/icons/compressed.gif) | S0L--A vilag leghujebb konyve.zip | 2007-03-24 03:00 | 830K | |
![[ ]](/icons/compressed.gif) | gulacsy_iren_nagy_lajos_kiraly_hu_doc.zip | 2007-03-24 02:55 | 830K | |
![[ ]](/icons/compressed.gif) | perry_stephani_az_iszonyat_foka_hu_pdf.zip | 2007-03-24 03:00 | 829K | |
![[ ]](/icons/unknown.gif) | csaszari_ver.rtf | 2007-03-24 02:54 | 827K | |
![[ ]](/icons/unknown.gif) | tollaskigyo.doc | 2007-11-14 08:57 | 826K | |
![[ ]](/icons/compressed.gif) | carcaterra_lorenzo_pokoli_lecke_hu_pdf_nncl2188-641v1.zip | 2007-03-24 02:57 | 826K | |
![[ ]](/icons/compressed.gif) | merrick_monte_memphis_belle_hu_pdf.zip | 2007-03-24 02:58 | 825K | |
![[ ]](/icons/compressed.gif) | eco_umberto_babeli_beszelgetes_hu_pdf.zip | 2007-03-24 03:00 | 823K | |
![[ ]](/icons/compressed.gif) | Douglas Adams-etterem a vilagegyetem vegen.zip | 2007-03-24 02:53 | 822K | |
![[ ]](/icons/compressed.gif) | maugham_w_somerset_sor_es_perec_hu_pdf.zip | 2007-03-24 03:00 | 821K | |
![[ ]](/icons/compressed.gif) | einstein_albert_hogyan_latom_a_vilagot_hu_pdf.zip | 2007-03-24 02:49 | 821K | |
![[ ]](/icons/compressed.gif) | fable_vavyan_tundertanc_hu_rtf.zip | 2007-03-24 03:01 | 820K | |
![[ ]](/icons/unknown.gif) | Alan O'Connor - Kék éjszakák árnyai.doc | 2007-04-02 22:07 | 820K | |
![[ ]](/icons/compressed.gif) | vorosmarty_mihaly_osszes_koltemenyei.zip | 2007-03-24 02:55 | 819K | |
![[ ]](/icons/compressed.gif) | krudy_gyula_valogatott_elbeszelesei.zip | 2007-03-24 02:57 | 819K | |
![[ ]](/icons/compressed.gif) | Franc Kafka-Naplok,levelek.zip | 2007-03-24 02:54 | 817K | |
![[ ]](/icons/unknown.gif) | roger_macbride_allen_inferno.rtf | 2007-11-14 08:36 | 817K | |
![[ ]](/icons/compressed.gif) | anderson_kevin_j_antitestek_hu_pdf.zip | 2007-03-24 02:56 | 816K | |
![[ ]](/icons/compressed.gif) | maugham_w_somerset_orok_szolgasag_hu_doc.zip | 2007-03-24 03:00 | 814K | |
![[ ]](/icons/compressed.gif) | meissner_janusz_jan_marten_kaloz_regenyes_historiaja_hu_rtf_nncl2936-6f3v1.zip | 2007-03-24 02:56 | 813K | |
![[ ]](/icons/compressed.gif) | abe_kabo_a_negyedik_jegkorszak_pdf.zip | 2007-03-24 02:49 | 812K | |
![[ ]](/icons/compressed.gif) | adams_douglas_vendeglo_a_vilag_vegen.zip | 2007-03-24 02:53 | 812K | |
![[ ]](/icons/compressed.gif) | merle_robert_ime_a_kiraly_hu_doc.zip | 2007-03-24 02:59 | 808K | |
![[ ]](/icons/compressed.gif) | koontz_dean_r_idegen_emlekek_hu_doc_nncl2627-6b9v1.zip | 2007-03-24 02:52 | 808K | |
![[ ]](/icons/compressed.gif) | verne_jules_a_rejtelmes_sziget_rtf.zip | 2007-03-24 02:56 | 807K | |
![[ ]](/icons/compressed.gif) | mckenna_juliet_e_kuzdelmes_huseg_hu_doc_nncl2759-6d9v1.zip | 2007-03-24 02:56 | 807K | |
![[ ]](/icons/unknown.gif) | Raoul Renier - Pokol.doc | 2007-04-02 22:05 | 807K | |
![[ ]](/icons/compressed.gif) | morris_dave_tnt2_hatlovetuek_es_dobocsillagok_hu_doc.zip | 2007-03-24 02:52 | 807K | |
![[ ]](/icons/compressed.gif) | millar_george_a_nagy_lokatorhaboru_hu_rtf.zip | 2007-03-24 02:54 | 806K | |
![[ ]](/icons/layout.gif) | Halálkapu - 8. A sötétség kútja 2.pdf | 2007-01-21 15:52 | 806K | |
![[ ]](/icons/compressed.gif) | del_rey_lester_a_szokeveny_robot_hu_doc.zip | 2007-03-24 02:57 | 806K | |
![[ ]](/icons/compressed.gif) | Lewis C.S.- Narnia 1 hu.doc.zip | 2007-03-26 16:34 | 804K | |
![[ ]](/icons/compressed.gif) | lewis_c_s_narnia_1_hu_doc.zip | 2007-03-24 02:52 | 804K | |
![[ ]](/icons/unknown.gif) | KULIN.DOC | 2007-11-14 03:49 | 803K | |
![[ ]](/icons/unknown.gif) | Üzen a 8 bolygó.DOC | 2002-12-13 09:45 | 803K | |
![[ ]](/icons/compressed.gif) | stevenson_r_l_emberrablok_pdf.zip | 2007-03-24 02:58 | 803K | |
![[ ]](/icons/compressed.gif) | lord_walter_hihetetlen_gyozelem_hu_rtf_nncl1952-620v2.zip | 2007-03-24 03:01 | 803K | |
![[ ]](/icons/compressed.gif) | clancy_tom_szivarvany_kommando_hu_rtf_nncl1981-61bv1.zip | 2007-03-24 03:00 | 800K | |
![[ ]](/icons/compressed.gif) | Vámpirvadász - 3. A kárhozottak cirkusza.zip | 2007-03-26 15:04 | 799K | |
![[ ]](/icons/compressed.gif) | ignacz_rozsa_szavannatuz_hu_doc_nncl2487-68ev1.zip | 2007-03-24 02:55 | 798K | |
![[ ]](/icons/compressed.gif) | king_stephen_remalmok_es_lidercek_hu_doc.zip | 2007-03-24 03:00 | 797K | |
![[ ]](/icons/compressed.gif) | Stephen King - Remalmok_es_lidercek_hu_doc.zip | 2006-05-29 00:03 | 797K | |
![[ ]](/icons/compressed.gif) | fawcett_harrison_a_katedralis_harcosai_hu_rtf_nncl3009-704v2.zip | 2007-03-24 02:55 | 796K | |
![[ ]](/icons/compressed.gif) | maclean_alistair_randevu_az_arannyal_hu_doc_nncl2983-701v1.zip | 2007-03-24 02:49 | 796K | |
![[ ]](/icons/compressed.gif) | dickens_charles_a_pickwick_klub_rtf.zip | 2007-03-24 02:52 | 795K | |
![[ ]](/icons/compressed.gif) | eco_umberto_a_rozsa_neve_hu_doc.zip | 2007-03-24 03:00 | 794K | |
![[ ]](/icons/compressed.gif) | moravia_alberto_a_megvetes_hu_pdf.zip | 2007-03-24 02:49 | 794K | |
![[ ]](/icons/compressed.gif) | waltari_mika_az_emberiseg_ellensegei_hu_rtf.zip | 2007-03-24 02:57 | 793K | |
![[ ]](/icons/unknown.gif) | David Brin - Az Alapítvány győzelme.rtf | 2006-07-19 18:55 | 793K | |
![[ ]](/icons/compressed.gif) | clavell_james_a_tajpan_hu_rtf.zip | 2007-03-24 02:55 | 793K | |
![[ ]](/icons/compressed.gif) | James Clavell-A Tajpan.zip | 2007-03-24 02:55 | 793K | |
![[ ]](/icons/compressed.gif) | jokai_mor_a_jovo_szazad_regenye_html.zip | 2007-03-24 02:56 | 790K | |
![[ ]](/icons/compressed.gif) | piper_h_b_aki_megkerulte_a_lovakat_doc.zip | 2007-03-24 02:55 | 789K | |
![[ ]](/icons/compressed.gif) | Aki megkerulte a lovakat-H Beam Piper.zip | 2007-03-24 02:55 | 789K | |
![[ ]](/icons/compressed.gif) | druon_maurice_az_elatkozott_kiralyok_1_hu_doc_nncl2816-6e4v1.zip | 2007-03-24 02:57 | 789K | |
![[ ]](/icons/compressed.gif) | morris_dave_tnt1_az_eltemetett_kincs_hu_doc.zip | 2007-03-24 02:52 | 789K | |
![[ ]](/icons/layout.gif) | Halálkapu - 6. Tüztenger 2.pdf | 2007-01-21 15:54 | 786K | |
![[ ]](/icons/compressed.gif) | howard_robert_e_conan_a_kimmeriai_hu_rtf.zip | 2007-03-24 02:59 | 785K | |
![[ ]](/icons/compressed.gif) | Jokai Mor-A jovo szazad regenye.zip | 2007-03-24 02:56 | 785K | |
![[ ]](/icons/unknown.gif) | BOOKFILE.JAR5 | 2007-03-24 02:54 | 784K | |
![[ ]](/icons/compressed.gif) | davis_jim_garfield_es_a_suli_fantomja_hu_doc.zip | 2007-03-24 02:56 | 783K | |
![[ ]](/icons/compressed.gif) | uris_leon_mila_18_hu_doc_nncl3118-706v1.zip | 2007-03-24 02:57 | 782K | |
![[ ]](/icons/compressed.gif) | lyndon_murray_b_csillaghullas_hu_pdf_nncl2053-62av2.zip | 2007-03-24 02:58 | 782K | |
![[ ]](/icons/compressed.gif) | papp_laszlo_erdekes_trefas_es_igaz_tortenetek_hires_emberekrol_hu_doc_nncl2196-643v1.zip | 2007-03-24 02:58 | 782K | |
![[ ]](/icons/unknown.gif) | Nemere Istvan - A Hegy.doc | 2007-03-24 02:58 | 782K | |
![[ ]](/icons/unknown.gif) | Földrengések szigete.doc | 2007-11-14 08:58 | 782K | |
![[ ]](/icons/unknown.gif) | anderson_kevin_j_sotetkard.rtf | 2007-03-24 02:54 | 781K | |
![[ ]](/icons/compressed.gif) | morris_dave_tnt3_szecska_akcioban_hu_doc.zip | 2007-03-24 02:52 | 780K | |
![[ ]](/icons/unknown.gif) | nemere_istvan_a_faraok_titkai.doc | 2005-10-06 10:25 | 780K | |
![[ ]](/icons/compressed.gif) | balint_agnes_szeleburdi_csalad_hu_html.zip | 2007-03-24 02:52 | 779K | |
![[ ]](/icons/unknown.gif) | Garzó László Ötödkor.doc | 2005-08-04 15:31 | 779K | |
![[ ]](/icons/compressed.gif) | goldsmith_donald_nemezis_hu_doc_nncl2894-6f3v1.zip | 2007-03-24 02:53 | 778K | |
![[ ]](/icons/unknown.gif) | I.RTF | 2007-11-14 04:50 | 778K | |
![[ ]](/icons/compressed.gif) | Stone, Jeffrey - A hajnal_lovagja.zip | 2007-03-26 19:08 | 778K | |
![[ ]](/icons/compressed.gif) | lem_stanislaw_lymphater_utolso_keplete_hu_doc_nncl2432-688v1.zip | 2007-03-24 03:00 | 778K | |
![[ ]](/icons/unknown.gif) | excfuzet.ace | 2007-03-24 02:58 | 778K | |
![[ ]](/icons/compressed.gif) | racz_gyula_uj_buveszkonyv_hu_doc.zip | 2007-03-24 02:53 | 777K | |
![[ ]](/icons/compressed.gif) | rpghu2_magusmodul.zip | 2007-04-15 16:54 | 777K | |
![[ ]](/icons/compressed.gif) | Stone, Jeffrey - A hajnal_hadura.zip | 2007-03-26 19:08 | 775K | |
![[ ]](/icons/unknown.gif) | i - a gyűrű szövetsége.rtf | 2007-03-20 14:42 | 775K | |
![[ ]](/icons/layout.gif) | [KER]- (3) Tetemre hívás.pdf | 2007-04-15 16:44 | 775K | |
![[ ]](/icons/compressed.gif) | o_brian_patrick_kapitany_es_katona_1_hu_doc_nncl2253_650v1.zip | 2007-03-24 02:58 | 775K | |
![[ ]](/icons/compressed.gif) | wallace_edgar_het_lakat_alatt_hu_pdf.zip | 2007-03-24 02:53 | 775K | |
![[ ]](/icons/unknown.gif) | 001-020.PDF | 2007-03-24 02:54 | 773K | |
![[ ]](/icons/compressed.gif) | beregi_tamas_egyetleneim_hu_doc_nncl2525-696v1.zip | 2007-03-24 02:50 | 773K | |
![[ ]](/icons/compressed.gif) | weis_hickman_sarkanyszarny_2_hu_rtf.zip | 2007-03-24 03:01 | 771K | |
![[ ]](/icons/unknown.gif) | king_stephen_vilagnagy_strand.doc | 2003-10-03 00:00 | 771K | |
![[ ]](/icons/unknown.gif) | Világnagy strand.doc | 2007-03-24 03:00 | 771K | |
![[ ]](/icons/compressed.gif) | duane_diane_corrivale_csillaga_hu_doc.zip | 2007-03-24 02:52 | 770K | |
![[ ]](/icons/compressed.gif) | beckman_thea_keresztes_hadjarat_farmerban_hu_doc_nncl2836-6e8v2.zip | 2007-03-24 03:00 | 770K | |
![[ ]](/icons/unknown.gif) | Titkok.rtf | 2004-04-17 21:08 | 770K | |
![[ ]](/icons/unknown.gif) | Alan Dean Foster - Alien IV Idegenek a Földön.zip2 | 2007-03-24 02:49 | 770K | |
![[ ]](/icons/unknown.gif) | g033.ace | 2007-03-24 02:52 | 769K | |
![[ ]](/icons/compressed.gif) | hunyady_jozsef_a_fekete_lovag_illusztralatlan_hu_doc_nncl1662-595v1.zip | 2007-03-24 02:55 | 769K | |
![[ ]](/icons/compressed.gif) | cannon_titus_luben_hu_doc_nncl3279-73ev1.zip | 2007-03-24 03:00 | 768K | |
![[ ]](/icons/compressed.gif) | mazan_tihor_kard_es_magia_hu_html.zip | 2007-03-24 02:57 | 768K | |
![[ ]](/icons/compressed.gif) | lord_walter_a_titanic_pusztulasa.zip | 2007-03-24 03:01 | 768K | |
![[ ]](/icons/compressed.gif) | farkashazy_tivadar_a_kek_mauritius_hu_doc_nncl3176-70dv1.zip | 2007-03-24 02:54 | 767K | |
![[ ]](/icons/unknown.gif) | Ester Albaryu - Sárkányháborúk II - Pusztulás évei.rtf | 2006-07-19 19:01 | 765K | |
![[ ]](/icons/compressed.gif) | ciolkovszkij_k_e_tavol_a_foldtol_hu_doc.zip | 2007-03-24 02:56 | 765K | |
![[ ]](/icons/compressed.gif) | smith_wilbur_monszun_hu_rtf.zip | 2007-03-24 03:01 | 765K | |
![[ ]](/icons/compressed.gif) | kirst_hans_helmut_tisztgyar_hu_doc.zip | 2007-03-24 02:55 | 764K | |
![[ ]](/icons/compressed.gif) | ludlum_robert_a_matarese_klan_hu_rtf.zip | 2007-03-24 02:59 | 763K | |
![[ ]](/icons/compressed.gif) | wallace_randall_pearl_harbor_hu_pdf.zip | 2007-03-24 02:58 | 763K | |
![[ ]](/icons/layout.gif) | 2.a_hajnal_kiralynoje.pdf | 2006-06-22 08:56 | 762K | |
![[ ]](/icons/unknown.gif) | Ray O'Sullivan - Sötét térítő.doc | 2007-04-02 22:07 | 762K | |
![[ ]](/icons/compressed.gif) | kinai_akupresszura_hu_pdf.zip | 2007-03-24 02:56 | 762K | |
![[ ]](/icons/compressed.gif) | fable_vavyan_a_hold_forro_jegen_hu_rtf_nncl3272-733v1.zip | 2007-03-24 03:01 | 761K | |
![[ ]](/icons/compressed.gif) | jokai_mor_elbeszelesek_html.zip | 2007-03-24 02:56 | 761K | |
![[ ]](/icons/layout.gif) | Dragonlance - Legendák - 2. Találkozás.pdf | 2007-01-21 15:54 | 761K | |
![[ ]](/icons/compressed.gif) | beevor_antony_sztalingrad_hu_doc_nncl2980-701v1.zip | 2007-03-24 02:49 | 760K | |
![[ ]](/icons/unknown.gif) | Roland Morgan - Mágikus vihar.doc | 2007-04-02 22:07 | 760K | |
![[ ]](/icons/unknown.gif) | ejszakai_muszak.rtf | 2004-08-17 23:32 | 758K | |
![[ ]](/icons/compressed.gif) | asimov_isaac_robotok_es_birodalom_hu_rtf.zip | 2007-03-24 02:55 | 757K | |
![[ ]](/icons/compressed.gif) | herbert_anderson_a_butleri_dzsihad_hu_doc.zip | 2007-03-24 02:52 | 757K | |
![[ ]](/icons/layout.gif) | gus5.pdf | 2007-11-14 04:04 | 756K | |
![[ ]](/icons/compressed.gif) | mora_ferenc_az_ember_feje_nem_fuge.pdf.zip | 2007-03-24 02:58 | 755K | |
![[ ]](/icons/compressed.gif) | eco_umberto_la_mancha_es_babel_kozott_hu_rtf.zip | 2007-03-24 03:00 | 755K | |
![[ ]](/icons/unknown.gif) | fegyverek_halala.doc | 2007-11-14 08:51 | 755K | |
![[ ]](/icons/compressed.gif) | hugo_vicor_a_nyomorultak_1_hu_rtf.zip | 2007-03-24 03:01 | 753K | |
![[ ]](/icons/unknown.gif) | sztrugackij_a_b_a_biborszinu_felhok_bolygoja.rtf | 2007-11-14 00:02 | 753K | |
![[ ]](/icons/compressed.gif) | haney_eric_l_delta_force_hu_doc_nncl2991-703v1.zip | 2007-03-24 02:53 | 751K | |
![[ ]](/icons/unknown.gif) | alan_dean_foster_kiberritus.rtf | 2007-11-14 06:43 | 751K | |
![[ ]](/icons/compressed.gif) | morris_dave_tnt5_dinoszaurusztelep_hu_doc.zip | 2007-03-24 02:52 | 750K | |
![[ ]](/icons/compressed.gif) | Lewis C.S.- Narnia 7 hu.doc.zip | 2007-03-26 16:35 | 750K | |
![[ ]](/icons/compressed.gif) | lewis_c_s_narnia_7_hu_doc.zip | 2007-03-24 02:52 | 750K | |
![[ ]](/icons/unknown.gif) | Doris Egan - Ivory kapuja.rtf | 2006-07-19 06:41 | 749K | |
![[ ]](/icons/compressed.gif) | csernai_zoltan_ozonviz_balladaja.zip | 2007-03-24 02:52 | 748K | |
![[ ]](/icons/compressed.gif) | Csernai Zoltán - Az özonviz balladaja.zip | 2007-02-21 16:51 | 748K | |
![[ ]](/icons/compressed.gif) | Csernai_Ozonviz_legendaja.zip | 2007-03-24 02:52 | 748K | |
![[ ]](/icons/compressed.gif) | Vonnegut,Kurt-Viragvasarnap.zip | 2007-03-24 03:01 | 748K | |
![[ ]](/icons/compressed.gif) | marton_bela_a_ceresz_foglyai_hu_doc.zip | 2007-03-24 02:57 | 745K | |
![[ ]](/icons/compressed.gif) | ROBUR_08.doc.zip | 2007-03-24 03:00 | 745K | |
![[ ]](/icons/compressed.gif) | fayard_colin_j_nyugatveg_kronikai_hu_rtf_nncl2820-6e4v1.zip | 2007-03-24 02:52 | 745K | |
![[ ]](/icons/compressed.gif) | krudy_gyula_a_musketas.zip | 2007-03-24 02:56 | 745K | |
![[ ]](/icons/compressed.gif) | ludlum_robert_parsifal_mozaik_hu_rtf_nncl1382-507v2.zip | 2007-03-24 02:59 | 744K | |
![[ ]](/icons/compressed.gif) | Carl Sagan.zip | 2007-03-24 02:52 | 744K | |
![[ ]](/icons/layout.gif) | Dragonlance - Legendák - 3. Ikrek hatalma.pdf | 2007-01-21 15:53 | 743K | |
![[ ]](/icons/unknown.gif) | vegjatek.rtf | 2007-11-14 08:03 | 743K | |
![[ ]](/icons/layout.gif) | Dragonlance - Legendák - 1. A múlt és jövö ura.pdf | 2007-01-21 15:51 | 743K | |
![[ ]](/icons/compressed.gif) | bartus_laszlo_fesz_van_hu_pdf_nncl2179-63fv1.zip | 2007-03-24 02:50 | 743K | |
![[ ]](/icons/layout.gif) | crown_empire_1_-_a_demon_ebredese.pdf | 2007-01-20 17:02 | 742K | |
![[ ]](/icons/compressed.gif) | Herbert-Anderson - A butleri_dzsihad_hu_doc.zip | 2006-05-28 00:24 | 742K | |
![[ ]](/icons/compressed.gif) | ROBUR_16.doc.zip | 2007-03-24 03:00 | 742K | |
![[ ]](/icons/compressed.gif) | jokai_mor_egy_magyar_nabob_pdf.zip | 2007-03-24 02:56 | 742K | |
![[ ]](/icons/compressed.gif) | jokai_mor_egy_magyar_nabob.zip | 2007-03-24 02:56 | 742K | |
![[ ]](/icons/compressed.gif) | helprin_mark_teli_mese_hu_rtf.zip | 2007-03-24 02:57 | 742K | |
![[ ]](/icons/unknown.gif) | Xsany Cracker.doc | 2007-03-19 20:12 | 741K | |
![[ ]](/icons/compressed.gif) | scott_walter_ivanhoe_rtf.zip | 2007-03-24 03:01 | 741K | |
![[ ]](/icons/compressed.gif) | king_stephen_hasznos_holmik_hu_doc.zip | 2007-03-24 03:00 | 739K | |
![[ ]](/icons/compressed.gif) | Stephen King - Hasznos_holmik_hu_doc.zip | 2006-05-28 01:37 | 739K | |
![[ ]](/icons/unknown.gif) | nemere_istvan_az_atlantisz_alapitvany_hu.doc | 2005-11-07 18:07 | 739K | |
![[ ]](/icons/compressed.gif) | zsoldos_peter_a_viking_visszater.zip | 2007-03-24 03:01 | 738K | |
![[ ]](/icons/compressed.gif) | dumas_alexandre_husz_ev_mulva_hu_rtf.zip | 2007-03-24 02:49 | 736K | |
![[ ]](/icons/compressed.gif) | adams_douglas_az_Elet_a_Vilagmindenseg_meg_Minden.zip | 2007-03-24 02:53 | 735K | |
![[ ]](/icons/compressed.gif) | brown_dan_a_da_vinci_kod_hu_rtf_nncl1587-551v2.zip | 2007-03-24 02:52 | 735K | |
![[ ]](/icons/unknown.gif) | outfuzet.ace | 2007-03-24 02:52 | 735K | |
![[ ]](/icons/compressed.gif) | ROBUR_12.doc.zip | 2007-03-24 03:00 | 733K | |
![[ ]](/icons/compressed.gif) | Mai Portugal elbeszelok-A madarember.zip | 2007-03-24 02:57 | 733K | |
![[ ]](/icons/unknown.gif) | crispin a c a hutt jatszma.rtf | 2007-03-24 02:54 | 732K | |
![[ ]](/icons/compressed.gif) | faludy_gyorgy_pokolbeli_vig_napjaim_rtf_nncl2832-6e7v1.zip | 2007-03-24 02:55 | 732K | |
![[ ]](/icons/compressed.gif) | Malnasi Bartok Gyorgy-Bohm Karoly.zip | 2007-03-24 02:57 | 732K | |
![[ ]](/icons/compressed.gif) | king_stephen_alomcsapda_hu_doc.zip | 2007-03-24 03:00 | 731K | |
![[ ]](/icons/compressed.gif) | Stephen King - Álomcsapda_hu_doc.zip | 2006-05-28 01:25 | 731K | |
![[ ]](/icons/compressed.gif) | hamilton_laurell_k_bunos_vagyak_hu_doc.zip | 2007-03-24 02:57 | 731K | |
![[ ]](/icons/compressed.gif) | heym_stefan_sasok_es_griffmadarak_hu_rtf.zip | 2007-03-24 03:00 | 731K | |
![[ ]](/icons/compressed.gif) | fleischer_leonore_rain_man_hu_pdf.zip | 2007-03-24 02:57 | 730K | |
![[ ]](/icons/compressed.gif) | Robert N Charrette-Sose kezdj a sarkannyal.zip | 2007-03-24 02:59 | 730K | |
![[ ]](/icons/compressed.gif) | paulini_bela_emlekirataim_hu_doc.zip | 2007-03-24 02:58 | 729K | |
![[ ]](/icons/layout.gif) | gus2.pdf | 2007-11-14 09:13 | 728K | |
![[ ]](/icons/compressed.gif) | cornwell_bernard_excalibur_3_hu_rtf.zip | 2007-03-24 02:50 | 728K | |
![[ ]](/icons/compressed.gif) | uris_leon_meghalsz_tengereresz_hu_doc_nncl2822-6e4v1.zip | 2007-03-24 02:57 | 728K | |
![[ ]](/icons/compressed.gif) | asimov_isaac_az_alapitvany_pereme_rtf.zip | 2007-03-24 02:55 | 728K | |
![[ ]](/icons/unknown.gif) | gibson_william_mona_lisa_overdrive.rtf | 2007-11-14 09:49 | 728K | |
![[ ]](/icons/layout.gif) | jeffrey_stone_-_ghouzm_gyongyei.pdf | 2006-07-12 13:52 | 727K | |
![[ ]](/icons/compressed.gif) | 6 David_ Bischoff - A kiralyno neveben.zip | 2007-03-23 19:32 | 727K | |
![[ ]](/icons/layout.gif) | Halálkapu - 4. Elf csillag 2.pdf | 2007-01-21 15:53 | 727K | |
![[ ]](/icons/compressed.gif) | Michael Crichton - Nagy vonatrablás.zip | 2007-04-15 03:58 | 727K | |
![[ ]](/icons/unknown.gif) | bilincsben.rtf | 2004-10-09 05:12 | 727K | |
![[ ]](/icons/compressed.gif) | George R. R. Martin - Tüz és jég dala - 1.Trónok harca.zip | 2007-03-23 05:03 | 724K | |
![[ ]](/icons/compressed.gif) | Stanislaw Lem - Éden.zip | 2007-03-26 16:30 | 723K | |
![[ ]](/icons/compressed.gif) | nemere_istvan_kalozok_az_urben_hu_rtf.zip | 2007-03-24 02:58 | 723K | |
![[ ]](/icons/compressed.gif) | weis_hickman_sarkanyszarny_1_hu_rtf.zip | 2007-03-24 03:01 | 723K | |
![[ ]](/icons/compressed.gif) | merle_robert_jo_varosunk_parizs_hu_doc.zip | 2007-03-24 02:59 | 723K | |
![[ ]](/icons/compressed.gif) | Douglas Adams-Galaxis utikalauz stopposoknak.zip | 2007-03-24 02:53 | 722K | |
![[ ]](/icons/compressed.gif) | nemeskurty_istvan_bornemisza_peter_kisertesei_hu_djvu_nncl2602-6aev0.zip | 2007-03-24 02:58 | 722K | |
![[ ]](/icons/compressed.gif) | fable_vavyan_tiz_kicsi_kommandos_hu_rtf_nncl2954-6fav1.zip | 2007-03-24 03:01 | 722K | |
![[ ]](/icons/unknown.gif) | nemere_istvan_allatkert_a_kozmoszban_hu_nncl3298-73ev1.doc | 2006-08-03 16:48 | 722K | |
![[ ]](/icons/compressed.gif) | beevor_antony_a_spanyol_polgarhaboru_hu_rtf_nncl3219-722v1.zip | 2007-03-24 02:49 | 721K | |
![[ ]](/icons/compressed.gif) | g33.zip | 2007-08-04 14:40 | 721K | |
![[ ]](/icons/compressed.gif) | Lenard Sandor-Volgy a vilag vegen s mas tortenetek.zip | 2007-03-24 02:57 | 720K | |
![[TXT]](/icons/text.gif) | A Hold ... Arca.TXT | 2007-03-24 02:57 | 720K | |
![[ ]](/icons/compressed.gif) | weis_hickman_tuztenger_2_hu_rtf_nncl2692-6c4v1.zip | 2007-03-24 03:01 | 720K | |
![[ ]](/icons/compressed.gif) | Metagalaktika 4.zip | 2007-03-24 02:57 | 719K | |
![[ ]](/icons/unknown.gif) | salvatore_ra_klonok_tamadasa.rtf | 2007-03-24 02:54 | 718K | |
![[ ]](/icons/unknown.gif) | Klonok t mad sa.rtf | 2004-11-23 12:18 | 718K | |
![[TXT]](/icons/text.gif) | albaryu_esther_sarkanyhaboruk.txt | 2007-03-24 02:54 | 718K | |
![[ ]](/icons/unknown.gif) | 08 - Jan Van Den Boomen - S éjre vált a nap.doc | 2007-03-24 02:54 | 717K | |
![[ ]](/icons/compressed.gif) | Homerosz-ILLIASZ.zip | 2007-03-24 02:55 | 716K | |
![[ ]](/icons/unknown.gif) | PIPER.DOC | 2007-11-14 06:29 | 715K | |
![[ ]](/icons/compressed.gif) | fawcett_harrison_a_katedralis_legendaja_hu_rtf_nncl3222-722v2.zip | 2007-03-24 02:55 | 715K | |
![[ ]](/icons/compressed.gif) | Wayne Chapman - Karnevál I-II.zip | 2006-05-30 22:16 | 712K | |
![[ ]](/icons/compressed.gif) | simon_seymour_a_szamitogepes_detektiv_hu_doc.zip | 2007-03-24 03:00 | 711K | |
![[ ]](/icons/compressed.gif) | laszlo_endre_sziriusz_es_az_emberke.zip | 2007-03-24 02:57 | 709K | |
![[ ]](/icons/compressed.gif) | Tollam szivarvanyba martom.zip | 2007-03-24 02:53 | 708K | |
![[ ]](/icons/compressed.gif) | donaldson_stephen_a_karhozat_uranak_atka.zip | 2007-03-24 03:00 | 708K | |
![[TXT]](/icons/text.gif) | card_orson_scott_multfigyelok.txt | 2007-11-14 03:59 | 708K | |
![[ ]](/icons/compressed.gif) | merle_robert_a_pirkadat_hu_doc.zip | 2007-03-24 02:59 | 708K | |
![[ ]](/icons/compressed.gif) | berkesi_andras_sello_a_pecsetgyurun_hu_doc_nncl2344-667v2.zip | 2007-03-24 02:50 | 708K | |
![[ ]](/icons/compressed.gif) | merle_robert_szenvedelyes_szeretet_hu_doc.zip | 2007-03-24 02:59 | 706K | |
![[ ]](/icons/compressed.gif) | pais_istvan_bibliai_erdekessegek_hu_rtf.zip | 2007-03-24 02:58 | 706K | |
![[ ]](/icons/compressed.gif) | smith_wilbur_kek_horizont_hu_rtf_nncl2592-6adv1.zip | 2007-03-24 03:01 | 705K | |
![[ ]](/icons/compressed.gif) | grisham_john_siralomhaz_hu_rtf.zip | 2007-03-24 02:56 | 705K | |
![[ ]](/icons/compressed.gif) | 02. Alan Dean Foster - Bolygó neve halál.zip | 2007-03-23 19:30 | 704K | |
![[ ]](/icons/compressed.gif) | hoffmann_wilhelm_hannibal_hu_rtf.zip | 2007-03-24 03:01 | 704K | |
![[ ]](/icons/compressed.gif) | cronin_a_j_a_kalapos_kastelya_hu_doc.zip | 2007-03-24 02:49 | 704K | |
![[ ]](/icons/compressed.gif) | tamas_mihaly_ket_part_kozt_fut_a_viz_hu_pdf.zip | 2007-03-24 03:00 | 703K | |
![[ ]](/icons/compressed.gif) | 5. Predator Nathan Acher - Jég és vér.zip | 2007-03-23 19:32 | 703K | |
![[ ]](/icons/compressed.gif) | Stone, Jeffrey - A hajnal_kiralynoje.zip | 2007-03-26 19:08 | 703K | |
![[ ]](/icons/compressed.gif) | lorre_charles_az_ellopott_legionista_hu_rtf_nncl2654-6bbv1.zip | 2007-03-24 02:52 | 700K | |
![[ ]](/icons/unknown.gif) | daley_brian_a_birodalmi_flotta.rtf | 2007-03-24 02:54 | 700K | |
![[ ]](/icons/compressed.gif) | charriere_henri_pillango_hu_doc.zip | 2007-03-24 02:55 | 700K | |
![[ ]](/icons/unknown.gif) | az_utolso_ember.rtf | 2007-11-14 06:45 | 699K | |
![[ ]](/icons/compressed.gif) | hamilton_laurell_k_sapadt_hold_hu_doc_nncl2626-6b9v1.zip | 2007-03-24 02:57 | 698K | |
![[ ]](/icons/compressed.gif) | berkesi_andras_siratofal_hu_txt_nncl2345-667v1.zip | 2007-03-24 02:50 | 698K | |
![[TXT]](/icons/text.gif) | Nemere Istvan - A Hegy.htm | 2007-03-24 02:58 | 697K | |
![[ ]](/icons/unknown.gif) | tigris_tigris.rtf | 2007-11-14 09:03 | 697K | |
![[ ]](/icons/compressed.gif) | morris_dave_tnt4_atlantisz_hadmuvelet_hu_doc.zip | 2007-03-24 02:52 | 697K | |
![[ ]](/icons/compressed.gif) | adams_douglas_a_ketseg_lazaca_hu_doc_nncl2796-6e0v1.zip | 2007-03-24 02:53 | 696K | |
![[ ]](/icons/compressed.gif) | herbert_anderson_a_gepitro_hadjarat_hu_rtf.zip | 2007-03-24 02:52 | 695K | |
![[ ]](/icons/compressed.gif) | griffin_w_e_b_a_haboru_katonai_4_hu_rtf_nncl3288-73ev1.zip | 2007-03-24 03:01 | 693K | |
![[ ]](/icons/compressed.gif) | Laszlo Endre-Sziriusz es az emberke.zip | 2007-03-24 02:57 | 691K | |
![[ ]](/icons/compressed.gif) | frazer_james_george_az_aranyag_hu_rtf_nncl1825-605v2.zip | 2007-03-24 02:55 | 691K | |
![[ ]](/icons/compressed.gif) | clancy_tom_kokainhaboru_hu_rtf.zip | 2007-03-24 03:00 | 690K | |
![[ ]](/icons/unknown.gif) | DickElektronikus.rtf | 2007-11-14 08:31 | 688K | |
![[ ]](/icons/compressed.gif) | cunningham_elaine_a_varazslo_lanya_hu_doc_nncl2194-642v1.zip | 2007-03-24 02:53 | 688K | |
![[ ]](/icons/compressed.gif) | ROBUR_07.doc.zip | 2007-03-24 03:00 | 688K | |
![[ ]](/icons/unknown.gif) | weis_hickman_sarkanyszarny_2.rtf | 2007-03-26 02:21 | 688K | |
![[ ]](/icons/compressed.gif) | grenwood-grubb_cormyr_a_regeny_hu_rtf_nncl2583-6aav1.zip | 2007-03-24 02:53 | 688K | |
![[ ]](/icons/unknown.gif) | lee_carroll_-_kryon_3.doc | 2007-03-24 02:53 | 688K | |
![[ ]](/icons/compressed.gif) | verne_jules_a_premvadaszok_rtf.zip | 2007-03-24 02:56 | 687K | |
![[ ]](/icons/compressed.gif) | dante_alighieri_isteni_szinjatek_pdf.zip | 2007-03-24 02:52 | 686K | |
![[ ]](/icons/compressed.gif) | moricz_zsigmond_eletem_regenye_rtf.zip | 2007-03-24 02:58 | 686K | |
![[ ]](/icons/compressed.gif) | fawcett_harrison_best_of_brett_shaw_hu_rtf_nncl2375-671v1.zip | 2007-03-24 02:55 | 686K | |
![[ ]](/icons/compressed.gif) | mikszath_kalman_ket_valasztas_magyarorszagon_pdf.zip | 2007-03-24 02:58 | 685K | |
![[ ]](/icons/compressed.gif) | Giovanni Boccaccio-Dekameron.zip | 2007-03-24 02:55 | 684K | |
![[ ]](/icons/compressed.gif) | mg4.zip | 2007-08-04 15:32 | 684K | |
![[ ]](/icons/compressed.gif) | Munhausen-Teleport tanacsado.zip | 2007-03-24 02:58 | 683K | |
![[ ]](/icons/compressed.gif) | grass_gunter_raklepesben_hu_pdf.zip | 2007-03-24 02:55 | 683K | |
![[ ]](/icons/compressed.gif) | weis_hickman_a_tavaszi_hajnal_sarkanyai_hu_doc_nncl2475-68ev1.zip | 2007-03-24 03:01 | 682K | |
![[ ]](/icons/compressed.gif) | merle_robert_libben_a_szoknya_hu_doc.zip | 2007-03-24 02:59 | 681K | |
![[ ]](/icons/compressed.gif) | mora_ferenc_mondak_es_mesek.pdf.zip | 2007-03-24 02:58 | 681K | |
![[ ]](/icons/compressed.gif) | krudy_gyula_a_podolini_kisertet.zip | 2007-03-24 02:56 | 680K | |
![[ ]](/icons/compressed.gif) | calvino_italo_eleink_hu_html.zip | 2007-03-24 02:55 | 679K | |
![[ ]](/icons/compressed.gif) | jozsef_attila_osszes_koltemenye_pdf.zip | 2007-03-24 02:55 | 679K | |
![[ ]](/icons/compressed.gif) | benedek_istvan_csineva_hu_rtf.zip | 2007-03-24 02:50 | 679K | |
![[ ]](/icons/compressed.gif) | oquinn_charlize_kristalypiramis_hu_html.zip | 2007-03-24 02:52 | 677K | |
![[ ]](/icons/compressed.gif) | ROBUR_15.doc.zip | 2007-03-24 03:00 | 676K | |
![[ ]](/icons/compressed.gif) | Tamasi Aron valogatott novellai.zip | 2007-03-24 02:55 | 676K | |
![[ ]](/icons/unknown.gif) | chapman_wayne_keleti_szel.rtf | 2007-03-24 02:54 | 675K | |
![[ ]](/icons/compressed.gif) | Nemet-Magyar_Magyar-Nemet szotar.zip | 2007-03-24 03:00 | 675K | |
![[ ]](/icons/compressed.gif) | ROBUR_13.doc.zip | 2007-03-24 03:00 | 675K | |
![[ ]](/icons/compressed.gif) | morris_dave_tnt6_vegtelen_egbolt_hu_doc.zip | 2007-03-24 02:52 | 673K | |
![[ ]](/icons/compressed.gif) | polgar_simko_pragai_sorkalauz_hu_djvu.zip | 2007-03-24 02:58 | 673K | |
![[ ]](/icons/compressed.gif) | mikszath_kalman_nemzetes_uraimek_pdf.zip | 2007-03-24 02:58 | 673K | |
![[ ]](/icons/compressed.gif) | feuchtwanger_lion_capet_ozvegye_hu_djvu.zip | 2007-03-24 02:57 | 673K | |
![[ ]](/icons/compressed.gif) | beauvoir_simone_de_egy_johazbol_valo_urilany_emlekei_hu_doc_nncl2466-68ev1.zip | 2007-03-24 03:00 | 673K | |
![[ ]](/icons/unknown.gif) | 0004.rtf | 2007-11-14 08:58 | 671K | |
![[ ]](/icons/layout.gif) | Új vámpir történetek - 2. Vittorio_a_vampir.pdf | 2007-01-21 15:37 | 671K | |
![[ ]](/icons/compressed.gif) | Bolcsessegek konyve 2.zip | 2007-03-24 02:52 | 669K | |
![[ ]](/icons/compressed.gif) | makkai_sandor_sarga_vihar_hu_rtf.zip | 2007-03-24 02:57 | 668K | |
![[ ]](/icons/unknown.gif) | ujonc_a_vilagurben.rtf | 2007-11-14 04:22 | 666K | |
![[ ]](/icons/layout.gif) | Armageddon.pdf | 2007-01-21 16:47 | 665K | |
![[ ]](/icons/unknown.gif) | apati_fekete_gen.doc | 2007-11-14 09:49 | 664K | |
![[ ]](/icons/compressed.gif) | fekete_istvan_ballago_ido_hu_doc_nncl1971-61av1.zip | 2007-03-24 02:57 | 663K | |
![[ ]](/icons/compressed.gif) | emery_clayton_vegso_aldozat_hu_doc_nncl3147-70bv1.zip | 2007-03-24 02:52 | 663K | |
![[ ]](/icons/compressed.gif) | baker_berberick_az_egi_ej_konnyei_hu_doc.zip | 2007-03-24 02:49 | 663K | |
![[ ]](/icons/compressed.gif) | merle_robert_csikoeveink_hu_doc.zip | 2007-03-24 02:59 | 662K | |
![[ ]](/icons/layout.gif) | Halálkapu - 3. Elf csillag 1.pdf | 2007-01-21 15:53 | 660K | |
![[ ]](/icons/compressed.gif) | weis_hickman_tuztenger_1_hu_rtf_nncl2607-6b0v1.zip | 2007-03-24 03:01 | 660K | |
![[ ]](/icons/unknown.gif) | az_eden_szokokutjai.rtf | 2007-11-14 04:42 | 659K | |
![[ ]](/icons/compressed.gif) | feist_wurts_a_birodalom_urnoje_2_hu_doc_nncl2407-67bv1.zip | 2007-03-24 02:54 | 659K | |
![[ ]](/icons/compressed.gif) | hunyady_jozsef_aranyhorda_hu_rtf.zip | 2007-03-24 02:55 | 658K | |
![[ ]](/icons/layout.gif) | gus3.pdf | 2007-11-14 05:23 | 657K | |
![[ ]](/icons/compressed.gif) | ykpdf_gyilkos.zip | 2007-03-24 02:54 | 657K | |
![[ ]](/icons/compressed.gif) | pilinszky_janos_beszelgetesek_html.zip | 2007-03-24 02:58 | 657K | |
![[ ]](/icons/unknown.gif) | acelbarlangok.rtf | 2007-11-13 23:56 | 656K | |
![[ ]](/icons/unknown.gif) | iii - a két torony.rtf | 2007-03-20 14:45 | 656K | |
![[ ]](/icons/unknown.gif) | larry_niven-alompark.rtf | 2007-11-14 05:08 | 655K | |
![[ ]](/icons/compressed.gif) | Feist Wurts - A birodalom_urnoje_2_hu_doc.zip.zip | 2007-03-26 14:39 | 655K | |
![[ ]](/icons/compressed.gif) | nathanson_e_m_a_piszkos_tizenketto_hu_rtf.zip | 2007-03-24 02:53 | 654K | |
![[ ]](/icons/compressed.gif) | 01. Otthon.zip | 2007-03-26 18:33 | 654K | |
![[ ]](/icons/compressed.gif) | king_stephen_remulet_a_sivatagban_hu_doc_nncl2368-66dv1.zip | 2007-03-24 03:00 | 652K | |
![[ ]](/icons/compressed.gif) | Roberto Bolona-A nemenklideszi geometria tortenete.zip | 2007-03-24 03:00 | 652K | |
![[ ]](/icons/compressed.gif) | may_karl_winnetou.zip | 2007-03-24 02:56 | 651K | |
![[ ]](/icons/compressed.gif) | Dan Brown - Digitalis erőd hu -doc.zip | 2006-05-10 07:04 | 650K | |
![[ ]](/icons/compressed.gif) | ROBUR_05.doc.zip | 2007-03-24 03:00 | 650K | |
![[ ]](/icons/compressed.gif) | Démonvilág - 02. Démontolvaj.zip | 2007-03-20 13:25 | 648K | |
![[ ]](/icons/layout.gif) | Dragonlance - Legendák - 4. Háború.pdf | 2007-01-21 15:51 | 648K | |
![[ ]](/icons/compressed.gif) | ROBUR_02.doc.zip | 2007-03-24 03:00 | 647K | |
![[ ]](/icons/compressed.gif) | brooks_terry_shannara_az_elso_kiraly_hu_doc_nncl2513-695v1.zip | 2007-03-24 03:00 | 647K | |
![[ ]](/icons/compressed.gif) | hassel_sven_a_komisszar_hu_rtf.zip | 2007-03-24 03:00 | 646K | |
![[ ]](/icons/unknown.gif) | X_magazin_13.doc | 2007-03-24 03:01 | 645K | |
![[ ]](/icons/compressed.gif) | fleming_gherbod_asszamita_hu_doc_nncl2961-6fav1.zip | 2007-03-24 02:55 | 644K | |
![[ ]](/icons/unknown.gif) | nemere_istvan_pokoljaras_hu_rtf.rtf | 2005-12-02 13:26 | 644K | |
![[ ]](/icons/compressed.gif) | 69_Titkos_Tanitas_3.zip | 2007-03-24 02:55 | 644K | |
![[ ]](/icons/compressed.gif) | king_stephen_straub_peter_a_talizman_hu_rtf.zip | 2007-03-24 03:00 | 644K | |
![[ ]](/icons/compressed.gif) | hamilton_laurell_k_a_neveto_holttest_hu_doc.zip | 2007-03-24 02:57 | 644K | |
![[ ]](/icons/compressed.gif) | feist_wurts_a_birodalom_szolgaloja_2_hu_doc_nncl2405-67bv1.zip | 2007-03-24 02:54 | 644K | |
![[ ]](/icons/compressed.gif) | king_j_robert_verszovetseg_hu_doc.zip | 2007-03-24 02:55 | 643K | |
![[ ]](/icons/unknown.gif) | masodik.rtf | 2007-11-14 09:47 | 643K | |
![[ ]](/icons/unknown.gif) | ketteszakitott_elet.rtf | 2007-11-14 05:58 | 643K | |
![[ ]](/icons/compressed.gif) | moldova_gyorgy_a_tekozlo_koldus_html.zip | 2007-03-24 02:58 | 642K | |
![[ ]](/icons/compressed.gif) | ROBUR_03.doc.zip | 2007-03-24 03:00 | 642K | |
![[ ]](/icons/compressed.gif) | rice_anne_boszorkanyok_oraja_2_hu_rtf.zip | 2007-03-24 02:49 | 642K | |
![[ ]](/icons/unknown.gif) | ii - a gyűrű szövetsége.rtf | 2007-03-20 14:22 | 641K | |
![[ ]](/icons/compressed.gif) | merle_robert_a_sziget_hu_doc.zip | 2007-03-24 02:59 | 641K | |
![[ ]](/icons/compressed.gif) | rath-vegh_istvan_az_emberi_butasag_hu_doc_nncl3026-708v1.zip | 2007-03-24 02:59 | 641K | |
![[ ]](/icons/unknown.gif) | X_magazin_11.doc | 2007-03-24 03:01 | 641K | |
![[ ]](/icons/compressed.gif) | Szovegszerkesztesi feladatok Wordben.zip | 2007-03-24 03:00 | 640K | |
![[ ]](/icons/compressed.gif) | ryan_kathleen_setita_hu_doc_nncl2771-6dav1.zip | 2007-03-24 02:56 | 639K | |
![[ ]](/icons/compressed.gif) | boc_istvan_zx81_basic_es_assembler_hu_djvu.zip | 2007-03-24 02:51 | 639K | |
![[ ]](/icons/compressed.gif) | Feist Wurts - A birodalom_szolgaloja_2_hu_doc.zip.zip | 2007-03-26 14:39 | 639K | |
![[ ]](/icons/compressed.gif) | merle_robert_malevil_hu_doc.zip | 2007-03-24 02:59 | 639K | |
![[ ]](/icons/compressed.gif) | merle_robert_allati_elmek_hu_rtf.zip | 2007-03-24 02:59 | 638K | |
![[ ]](/icons/compressed.gif) | king_stephen_vegitelet_1_hu_rtf.zip | 2007-03-24 03:00 | 638K | |
![[ ]](/icons/compressed.gif) | szerb_antal_a_pendragon_legenda_hu_doc_nncl2543-69ev1.zip | 2007-03-24 03:00 | 638K | |
![[ ]](/icons/compressed.gif) | hardy_thomas_egy_tiszta_no_hu_doc_nncl2251_650v1.zip | 2007-03-24 03:00 | 638K | |
![[ ]](/icons/compressed.gif) | doyle_arthur_conan_a_satan_kutyaja_pdf.zip | 2007-03-24 02:49 | 637K | |
![[ ]](/icons/unknown.gif) | Baldurs_gate.rtf | 2007-03-24 02:54 | 637K | |
![[ ]](/icons/unknown.gif) | X_magazin_07.doc | 2007-03-24 03:01 | 637K | |
![[ ]](/icons/compressed.gif) | Conan a kimériai.zip | 2007-03-26 18:25 | 636K | |
![[ ]](/icons/layout.gif) | Halálkapu - 1. Sárkányszarny 1.pdf | 2007-01-21 15:53 | 636K | |
![[ ]](/icons/compressed.gif) | ROBUR_06.doc.zip | 2007-03-24 03:00 | 636K | |
![[ ]](/icons/compressed.gif) | twain_mark_adam_es_eva_naploja_hu_doc.zip | 2007-03-24 02:57 | 636K | |
![[ ]](/icons/unknown.gif) | aldiss_brian_w_foldburok_hu.rtf | 2007-11-14 09:53 | 635K | |
![[ ]](/icons/compressed.gif) | szabo_lorinc_harminchat_ev_1921-1944_html.zip | 2007-03-24 03:00 | 634K | |
![[ ]](/icons/layout.gif) | Tökéletes másolat.pdf | 2007-01-21 16:44 | 634K | |
![[ ]](/icons/compressed.gif) | verne_jules_rejtelmes_sziget_1_hu_doc_nncl3122-706v1.zip | 2007-03-24 02:56 | 634K | |
![[ ]](/icons/compressed.gif) | davis_jim_garfield_es_a_pincerem_hu_doc.zip | 2007-03-24 02:56 | 633K | |
![[ ]](/icons/compressed.gif) | Mika Waltari-TURMS,A HALHATATLAN.zip | 2007-03-24 02:57 | 633K | |
![[ ]](/icons/compressed.gif) | koontz_dean_r_a_sziv_sotet_folyoi_hu_doc_nncl3274-739v1.zip | 2007-03-24 02:52 | 632K | |
![[ ]](/icons/unknown.gif) | RENEGAT.RTF | 2007-03-24 02:54 | 631K | |
![[ ]](/icons/compressed.gif) | karinthy_frigyes.zip | 2007-03-24 02:56 | 631K | |
![[ ]](/icons/layout.gif) | gus1.pdf | 2007-11-14 09:13 | 631K | |
![[ ]](/icons/compressed.gif) | jokai_anna_napok_html.zip | 2007-03-24 02:56 | 631K | |
![[ ]](/icons/compressed.gif) | hubbard_ron_l_haboru_a_foldon_2_hu_doc.zip | 2006-05-28 01:03 | 630K | |
![[ ]](/icons/compressed.gif) | hubbard_l_ron_haboru_a_foldon_2_hu_doc.zip | 2007-03-24 02:57 | 630K | |
![[ ]](/icons/compressed.gif) | dallos_sandor_aranyecset_hu_doc.zip | 2007-03-24 02:52 | 630K | |
![[ ]](/icons/compressed.gif) | warner_rex_julius_caesar_hu_rtf.zip | 2007-03-24 02:59 | 627K | |
![[ ]](/icons/compressed.gif) | hubbard_l_ron_haboru_a_foldon_1_hu_doc.zip | 2007-03-24 02:57 | 627K | |
![[ ]](/icons/compressed.gif) | tamasi_istvan_a_kiatkozott_hu_doc_nncl2123-637v1.zip | 2007-03-24 03:00 | 626K | |
![[ ]](/icons/unknown.gif) | isaac_asimov-gyilkossag_az_urvarosban.rtf | 2007-11-14 05:26 | 626K | |
![[ ]](/icons/compressed.gif) | radnoti_miklos_ikrek_hava_hu_doc.zip | 2007-03-24 02:55 | 625K | |
![[ ]](/icons/unknown.gif) | ember_a_fellegvarban.rtf | 2007-11-14 02:55 | 624K | |
![[ ]](/icons/unknown.gif) | nemere_istvan_titkok_konyve.rtf | 2004-05-02 19:23 | 623K | |
![[ ]](/icons/compressed.gif) | jeffrey_stone_-_ghouzm_gyongyei.zip | 2007-04-15 04:05 | 623K | |
![[ ]](/icons/compressed.gif) | Stone, Jeffrey - Ghouzm_gyongyei.zip | 2007-03-26 19:08 | 623K | |
![[ ]](/icons/compressed.gif) | tamasi_aron_szellemi_orseg_html.zip | 2007-03-24 03:00 | 623K | |
![[ ]](/icons/compressed.gif) | John Steinbeck-Edentol keletre.zip | 2007-03-24 02:56 | 623K | |
![[ ]](/icons/compressed.gif) | steinbeck_john_edentol_keletre_rtf.zip | 2007-03-24 02:56 | 623K | |
![[ ]](/icons/compressed.gif) | ROBUR_01.doc.zip | 2007-03-24 03:00 | 623K | |
![[ ]](/icons/unknown.gif) | holdkoros.rtf | 2007-11-14 00:14 | 622K | |
![[ ]](/icons/compressed.gif) | salmon_andre_modigliani_szenvedelyes_elete_hu_html.zip | 2007-03-24 02:49 | 621K | |
![[ ]](/icons/unknown.gif) | 03 - Christopher H Wearmouth - Halálnak született.doc | 2007-03-24 02:54 | 621K | |
![[ ]](/icons/unknown.gif) | osszes19.ace | 2007-03-24 02:56 | 619K | |
![[ ]](/icons/compressed.gif) | huxley_aldous_pont_es_ellenpont_hu_doc_nncl2504-693v1.zip | 2007-03-24 02:49 | 619K | |
![[ ]](/icons/compressed.gif) | Seth könyve.zip | 2007-03-24 02:56 | 618K | |
![[ ]](/icons/compressed.gif) | verne_jules_rejtelmes_sziget_2_hu_doc_nncl3123-706v1.zip | 2007-03-24 02:56 | 618K | |
![[ ]](/icons/compressed.gif) | banks_iain_sotet hatter_elott_hu_doc_nncl2713-6cbv1.zip | 2007-03-24 02:55 | 618K | |
![[ ]](/icons/compressed.gif) | Kozelkep a tavdiagnozisrol.zip | 2007-03-24 02:56 | 618K | |
![[ ]](/icons/unknown.gif) | X_magazin_06.doc | 2007-03-24 03:01 | 618K | |
![[ ]](/icons/compressed.gif) | bulicsov_kir_az_utolso_haboru_hu_rtf.zip | 2007-03-24 02:56 | 617K | |
![[ ]](/icons/compressed.gif) | Kir Bulicsov - Az utolso haboru hu rtf.zip | 2006-05-10 10:10 | 617K | |
![[ ]](/icons/compressed.gif) | asimov_isaac.zip | 2007-03-24 02:55 | 617K | |
![[ ]](/icons/unknown.gif) | Douglas_Adams - Dirk Gently holisztikus nyomozoirodaja dirk01.rtf | 2004-06-21 11:45 | 617K | |
![[ ]](/icons/compressed.gif) | Zsoldos Peter-Tavoli tuz.zip | 2007-03-24 03:01 | 616K | |
![[ ]](/icons/compressed.gif) | hunyady_jozsef_az_egig_ero_var_hu_doc_nncl2684-6c4v1.zip | 2007-03-24 02:55 | 616K | |
![[ ]](/icons/unknown.gif) | Robert Merle-Allati elmek | 2007-03-24 02:59 | 616K | |
![[ ]](/icons/unknown.gif) | cujo.rtf | 2004-11-06 05:12 | 615K | |
![[ ]](/icons/compressed.gif) | kiss_jozsef_laszlo_jo_szelet_kapitany_hu_doc.zip | 2007-03-24 02:56 | 615K | |
![[ ]](/icons/compressed.gif) | ROBUR_10.doc.zip | 2007-03-24 03:00 | 614K | |
![[ ]](/icons/compressed.gif) | crichton_michael_az_atprogramozott_ember_hu_html.zip | 2007-03-24 02:57 | 614K | |
![[ ]](/icons/compressed.gif) | Michael Crichton - Az atprogramozott ember hu html.zip | 2007-02-21 16:47 | 614K | |
![[ ]](/icons/unknown.gif) | 2061_harmadik_urodisszea.rtf | 2007-11-14 06:06 | 613K | |
![[ ]](/icons/compressed.gif) | Batfai Norbert-Odisszea az Univerzumban.zip | 2007-03-24 02:50 | 612K | |
![[ ]](/icons/compressed.gif) | koestler_arthur_nyilvesszo_a_vegtelenbe_hu_doc_nncl3241-72av1.zip | 2007-03-24 02:49 | 612K | |
![[ ]](/icons/compressed.gif) | esterhazy_peter_a_szabadsag_nehez_mamora_html.zip | 2007-03-24 02:53 | 612K | |
![[ ]](/icons/compressed.gif) | fussel_paul_osztalyletran_amerikaban_hu_pdf.zip | 2007-03-24 02:58 | 611K | |
![[ ]](/icons/compressed.gif) | mora_ferenc_csicseri_tortenet.pdf.zip | 2007-03-24 02:58 | 611K | |
![[ ]](/icons/compressed.gif) | dobai_peter_vadon_hu_rtf_nncl1445-515v2.zip | 2007-03-24 02:53 | 610K | |
![[ ]](/icons/unknown.gif) | shan_darren_demontolvaj_hu_nncl3578-780v1.rtf | 2007-03-30 20:10 | 610K | |
![[ ]](/icons/compressed.gif) | smith_wilbur_most_kell_meghalnod_hu_rtf_nncl1755-5d2.zip | 2007-03-24 03:01 | 609K | |
![[ ]](/icons/compressed.gif) | lem_stanislaw_summa_technologiae_hu_html.zip | 2007-03-24 03:00 | 609K | |
![[ ]](/icons/compressed.gif) | Stanislaw Lem - Summa_technologiae_hu_html.zip | 2006-05-29 04:26 | 609K | |
![[ ]](/icons/compressed.gif) | S Lem-Summa Technologiae.zip | 2007-03-24 03:00 | 609K | |
![[ ]](/icons/compressed.gif) | feist_wurts_a_birodalom_szolgaloja_1_hu_doc_nncl2404-67bv1.zip | 2007-03-24 02:54 | 609K | |
![[ ]](/icons/compressed.gif) | hobb_robin_az_orgyilkos_tanitvanya_hu_rtf_nncl2250-64fv2.zip | 2007-03-24 03:00 | 609K | |
![[ ]](/icons/compressed.gif) | cronin_a_j_reztabla_a_kapu_alatt_hu_doc.zip | 2007-03-24 02:49 | 608K | |
![[ ]](/icons/compressed.gif) | krekovics_ferenc_aranyfenyu_napok_hu_pdf.zip | 2007-03-24 02:56 | 608K | |
![[ ]](/icons/compressed.gif) | grosser_karlheinz_a_babiloni_hu_doc.zip | 2007-03-24 02:56 | 607K | |
![[ ]](/icons/compressed.gif) | slaughter_frank_g_a_frontsebesz_hu_doc_nncl2496-691v1.zip | 2007-03-24 02:54 | 607K | |
![[ ]](/icons/compressed.gif) | smith_wilbur_a_hetedik_tekercs_hu_rtf.zip | 2007-03-24 03:01 | 607K | |
![[ ]](/icons/unknown.gif) | X_magazin_14.doc | 2007-03-24 03:01 | 607K | |
![[ ]](/icons/compressed.gif) | 00281pdf.zip | 2005-07-07 14:48 | 607K | |
![[ ]](/icons/unknown.gif) | holdrenges.rtf | 2007-11-14 03:58 | 607K | |
![[ ]](/icons/compressed.gif) | Ivan Jefremov-A borotva ele.zip | 2007-03-24 02:55 | 606K | |
![[ ]](/icons/compressed.gif) | Feist Wurts - A birodalom_szolgaloja_1_hu_doc.zip.zip | 2007-03-26 14:39 | 606K | |
![[ ]](/icons/compressed.gif) | asimov_isaac_alapitvany_es_fold_doc_javitott.zip | 2007-03-24 02:55 | 606K | |
![[ ]](/icons/unknown.gif) | osszes70.ace | 2007-03-24 02:56 | 604K | |
![[ ]](/icons/compressed.gif) | weis_hickman_a_nyari_tuz_sarkanyai_hu_rtf_nncl2177-63ev2.zip | 2007-03-24 03:01 | 603K | |
![[ ]](/icons/compressed.gif) | tamasi_aron_abel_hu_doc.zip | 2007-03-24 03:00 | 603K | |
![[ ]](/icons/compressed.gif) | sienkiewicz_henryk_tuzzel-vassal_rtf.zip | 2007-03-24 02:55 | 603K | |
![[ ]](/icons/unknown.gif) | matanal.ace | 2007-03-24 02:52 | 603K | |
![[ ]](/icons/unknown.gif) | Leslie L Laticel - A köddé vált kolostor.doc | 2007-03-24 02:57 | 603K | |
![[ ]](/icons/unknown.gif) | ALGERNON.rtf | 2007-11-14 09:01 | 602K | |
![[ ]](/icons/unknown.gif) | HELSTÁB ÁKOS - danador.rtf | 2005-07-07 10:19 | 601K | |
![[ ]](/icons/compressed.gif) | anderson_poul_majd_ha_az_orion_folszall_hu_rtf_nncl2964-6fcv1.zip | 2007-03-24 02:58 | 601K | |
![[ ]](/icons/compressed.gif) | Isaac Asimov - Alapítvány sorozat - Az Alapitvany es fold.zip | 2006-05-17 04:37 | 601K | |
![[ ]](/icons/compressed.gif) | prus_boleslaw_a_farao_hu_txt.zip | 2007-03-24 02:52 | 601K | |
![[ ]](/icons/compressed.gif) | jokai_mor_es_megis_mozog_a_fold_html.zip | 2007-03-24 02:56 | 600K | |
![[ ]](/icons/unknown.gif) | daley_brian_a_csillagrombolok.rtf | 2007-03-24 02:54 | 600K | |
![[ ]](/icons/compressed.gif) | jefremov_ivan_a_borotva_ele_hu_rtf.zip | 2007-03-24 02:55 | 599K | |
![[ ]](/icons/unknown.gif) | Az utolsó háború.ace | 2007-03-24 02:56 | 598K | |
![[ ]](/icons/compressed.gif) | jokai_mor_eletembol.zip | 2007-03-24 02:56 | 598K | |
![[ ]](/icons/compressed.gif) | dick_philip_k_a_halal_utvesztoje_hu_rtf.zip | 2007-03-24 02:58 | 598K | |
![[ ]](/icons/compressed.gif) | demonhercegno_hu_rtf.zip | 2007-03-24 02:54 | 596K | |
![[ ]](/icons/compressed.gif) | harr_jonathan_zavaros_vizeken_hu_doc.zip | 2007-03-24 02:56 | 596K | |
![[ ]](/icons/compressed.gif) | barabasi_albert_laszlo_behalozva_hu_doc.zip | 2007-03-24 02:49 | 596K | |
![[ ]](/icons/compressed.gif) | Albert-Laszlo Barabasi-BEHALOZVA.zip | 2007-03-24 02:49 | 596K | |
![[ ]](/icons/compressed.gif) | cornwell_bernard_excalibur_1_hu_rtf.zip | 2007-03-24 02:50 | 596K | |
![[ ]](/icons/unknown.gif) | az_utolso_haboru.rtf | 2007-11-14 06:51 | 594K | |
![[ ]](/icons/compressed.gif) | fekete_istvan_kittenberger_kalman_elete_hu_rtf.zip | 2007-03-24 02:57 | 594K | |
![[ ]](/icons/compressed.gif) | puzo_mario_a_keresztapa_hu_doc_nncl2362-66bv1.zip | 2007-03-24 02:57 | 594K | |
![[ ]](/icons/unknown.gif) | X_magazin_03.doc | 2007-03-24 03:01 | 594K | |
![[ ]](/icons/unknown.gif) | vilag.rtf | 2007-11-14 08:35 | 593K | |
![[ ]](/icons/compressed.gif) | ROBUR_09.doc.zip | 2007-03-24 03:00 | 592K | |
![[ ]](/icons/compressed.gif) | tolkien_a_gyuruk_ura_a_gyuru_szovetsege_hu_doc.zip | 2007-03-24 02:54 | 592K | |
![[ ]](/icons/compressed.gif) | weinberg_robert_verhaboru.zip | 2007-03-24 03:00 | 591K | |
![[ ]](/icons/compressed.gif) | carsac_francis_a_vilagur_robinsonjai_hu_doc.zip | 2007-03-24 02:54 | 591K | |
![[ ]](/icons/unknown.gif) | Az Őrület Kapuja - (Through the Fringe of Madness).pd | 2007-05-03 07:34 | 591K | |
![[ ]](/icons/compressed.gif) | Robert N Charrette-Jol valaszd meg az ellensegeidet.zip | 2007-03-24 02:59 | 590K | |
![[ ]](/icons/compressed.gif) | macbride_allen_roger_utopia_hu_doc_nncl2394-674v1.zip | 2007-03-24 03:00 | 589K | |
![[ ]](/icons/compressed.gif) | goethe_johann_wolfgang_von_faust_pdf.zip | 2007-03-24 02:56 | 589K | |
![[ ]](/icons/unknown.gif) | x_magazin_10_hu.doc | 2007-03-24 03:01 | 589K | |
![[ ]](/icons/compressed.gif) | ransome_arthur_fecske-volgy_hu_doc_nncl3097-706v1.zip | 2007-03-24 02:49 | 588K | |
![[ ]](/icons/layout.gif) | Hegylakó.pdf | 2007-01-21 10:16 | 588K | |
![[ ]](/icons/compressed.gif) | welskopf_heinrich_liselotte_a_nagy_medve_fiai_hu_rtf.zip | 2007-03-24 02:57 | 587K | |
![[ ]](/icons/compressed.gif) | feist-forstchen_nagyrabecsult_ellensegem_hu_rtf_nncl2229-64bv1.zip | 2007-03-24 02:54 | 587K | |
![[ ]](/icons/compressed.gif) | Feist, Raymond E - RL1_Nagyrabecsült_ellenségem.zip | 2007-03-26 14:40 | 587K | |
![[ ]](/icons/compressed.gif) | esterhazy_peter_termelesi-regeny_html.zip | 2007-03-24 02:53 | 587K | |
![[ ]](/icons/compressed.gif) | ROBUR_14.doc.zip | 2007-03-24 03:00 | 585K | |
![[ ]](/icons/compressed.gif) | Lewis C.S.- Narnia 6 hu.doc.zip | 2007-03-26 16:35 | 585K | |
![[ ]](/icons/compressed.gif) | lewis_c_s_narnia_6_hu_doc.zip | 2007-03-24 02:52 | 584K | |
![[ ]](/icons/compressed.gif) | shelley_mary_frankenstein_pdf.zip | 2007-03-24 02:57 | 584K | |
![[ ]](/icons/compressed.gif) | L Baldwin-Nagy emberek nagy szerelmei.zip | 2007-03-24 02:57 | 584K | |
![[ ]](/icons/compressed.gif) | mora_ferenc_a_hatrongyosi_kakasok.pdf.zip | 2007-03-24 02:58 | 583K | |
![[ ]](/icons/compressed.gif) | ROBUR_11.doc.zip | 2007-03-24 03:00 | 583K | |
![[ ]](/icons/layout.gif) | Az elveszett frigyláda fosztogatói.pdf | 2007-01-21 10:06 | 583K | |
![[ ]](/icons/compressed.gif) | feist_raymond_e_stirling_s_sebes_jimmy_hu_doc_nncl2357-66av1.zip | 2007-03-24 02:54 | 583K | |
![[ ]](/icons/compressed.gif) | Jules Verne-Rejtelmes sziget.zip | 2007-03-24 02:56 | 581K | |
![[ ]](/icons/compressed.gif) | orwell_george_legszomj_hu_doc.zip | 2007-03-24 02:54 | 581K | |
![[ ]](/icons/compressed.gif) | grisham_john_az_itelet_elado_hu_rtf.zip | 2007-03-24 02:56 | 580K | |
![[ ]](/icons/unknown.gif) | stackpole_michael_a_zsivanykommando.rtf | 2007-03-24 02:54 | 580K | |
![[ ]](/icons/unknown.gif) | W. Hamilton Green - Mars 1910.rtf | 2007-11-14 06:08 | 580K | |
![[ ]](/icons/compressed.gif) | csokonai_osszes_versei_html.zip | 2007-03-24 02:55 | 580K | |
![[ ]](/icons/compressed.gif) | conrad_joseph_nostromo_hu_rtf_nncl2262-651v1.zip | 2007-03-24 02:56 | 579K | |
![[ ]](/icons/unknown.gif) | harry_harrison-a_technikolor_idogep.rtf | 2007-11-14 08:59 | 578K | |
![[ ]](/icons/compressed.gif) | weis_hickman_elf_csillag_2_hu_rtf_nncl2538-69cv1.zip | 2007-03-24 03:01 | 578K | |
![[ ]](/icons/compressed.gif) | cunningham_elaine_kusza_halok_hu_doc_nncl3148-70bv1.zip | 2007-03-24 02:53 | 578K | |
![[ ]](/icons/compressed.gif) | Feist, Raymond E - Sebes Jimmy hu doc.zip.zip | 2007-03-26 14:40 | 577K | |
![[ ]](/icons/compressed.gif) | lamb_harold_vilaghodito_nagy_sandor_hu_doc_nncl2559-6a5v1.zip | 2007-03-24 02:55 | 577K | |
![[ ]](/icons/compressed.gif) | clancy_tom_a_gonosz_birodalma_hu_rtf.zip | 2007-03-24 03:00 | 577K | |
![[ ]](/icons/unknown.gif) | X_magazin_12.doc | 2007-03-24 03:01 | 577K | |
![[ ]](/icons/compressed.gif) | szabo_lorinc_harminchat_ev_1945-1957_html.zip | 2007-03-24 03:00 | 576K | |
![[ ]](/icons/unknown.gif) | a_galaktika_kupolaja.rtf | 2007-11-14 04:30 | 576K | |
![[ ]](/icons/compressed.gif) | duane_diane_alkony_az_algemronon_hu_doc_nncl3211-722v1.zip | 2007-03-24 02:52 | 575K | |
![[ ]](/icons/compressed.gif) | feist_wurts_a_birodalom_urnoje_1_hu_doc_nncl2406-67bv1.zip | 2007-03-24 02:54 | 575K | |
![[ ]](/icons/unknown.gif) | mukator.doc | 2007-11-14 04:33 | 575K | |
![[ ]](/icons/compressed.gif) | vidal_gore_julianus_hu_rtf.zip | 2007-03-24 02:55 | 574K | |
![[ ]](/icons/compressed.gif) | radnoti_miklos_orpheus_nyomaban_hu_pdf_nncl2313-65ev1.zip | 2007-03-24 02:55 | 574K | |
![[ ]](/icons/unknown.gif) | eurhajo.doc | 2007-11-14 06:10 | 573K | |
![[ ]](/icons/unknown.gif) | A gyermekkor vége.rtf | 2007-11-14 09:38 | 573K | |
![[ ]](/icons/compressed.gif) | cook_robin_halaltusa_hu_doc_nncl2530-69cv1.zip | 2007-03-24 03:00 | 573K | |
![[ ]](/icons/unknown.gif) | X_magazin_08.doc | 2007-03-24 03:01 | 573K | |
![[ ]](/icons/compressed.gif) | illyes_gyula_szives_kalauz_html.zip | 2007-03-24 02:55 | 572K | |
![[ ]](/icons/compressed.gif) | gibson_sterling_a_gepezet_hu_doc_nncl2247-64fv2.zip | 2007-03-24 03:01 | 570K | |
![[ ]](/icons/compressed.gif) | hugo_vicor_a_nyomorultak_2_hu_rtf.zip | 2007-03-24 03:01 | 570K | |
![[ ]](/icons/compressed.gif) | Feist Wurts - A birodalom_urnoje_1_hu_doc.zip.zip | 2007-03-26 14:39 | 570K | |
![[ ]](/icons/compressed.gif) | chapman_wayne_karneval_hu_rtf_nncl2884-6f3v1.zip | 2007-03-24 03:01 | 570K | |
![[ ]](/icons/compressed.gif) | 11. Jövö látomása.zip | 2007-03-26 19:01 | 569K | |
![[ ]](/icons/unknown.gif) | Margaret Weis és Don Perrin_Halálbrigád (Káosz háború 1.).doc | 2005-02-26 00:08 | 569K | |
![[ ]](/icons/compressed.gif) | zahn_timothy_a_jovo_latomasa.zip | 2007-03-24 02:54 | 569K | |
![[ ]](/icons/compressed.gif) | Timothy Zahn - A jovo_latomasa_hu_rtf.zip | 2006-05-29 08:01 | 569K | |
![[ ]](/icons/compressed.gif) | jefremov_ivan_az_andromeda-kod_rtf.zip | 2007-03-24 02:55 | 569K | |
![[ ]](/icons/compressed.gif) | andromeda.zip | 2006-08-24 21:45 | 569K | |
![[ ]](/icons/compressed.gif) | Ivan Jefremov-Az Andromeda-kod.zip | 2007-03-24 02:55 | 568K | |
![[ ]](/icons/unknown.gif) | X_magazin_01.doc | 2007-03-24 03:01 | 568K | |
![[ ]](/icons/unknown.gif) | az_ido_folyosoi.rtf | 2007-11-14 05:06 | 568K | |
![[ ]](/icons/compressed.gif) | titan.zip | 2007-03-23 19:11 | 568K | |
![[ ]](/icons/compressed.gif) | Robert A Heinlein - Angyali udvozlet hu rtf.zip | 2007-03-23 13:50 | 566K | |
![[ ]](/icons/compressed.gif) | wiesenthal_simon_az_igazsag_malmai_hu_doc_nncl3125-706v1.zip | 2007-03-24 03:00 | 566K | |
![[ ]](/icons/unknown.gif) | nemere_istvan_kilephetsz_testedbol.rtf | 2004-03-28 23:22 | 565K | |
![[ ]](/icons/compressed.gif) | dick_philip_k_a_kozmosz_babjai_hu_pdf.zip | 2007-03-24 02:58 | 565K | |
![[ ]](/icons/compressed.gif) | hunyady_jozsef_a_kiraly_arnyeka_hu_rtf.zip | 2007-03-24 02:55 | 565K | |
![[ ]](/icons/unknown.gif) | Helstáb kalandor akadémia.doc | 2005-07-07 10:24 | 564K | |
![[ ]](/icons/unknown.gif) | rama.rtf | 2007-11-14 08:36 | 564K | |
![[ ]](/icons/unknown.gif) | Virágot Algernonnak.rtf | 2007-03-24 02:52 | 563K | |
![[ ]](/icons/unknown.gif) | a_sarkany_szeme.rtf | 2004-06-19 18:33 | 563K | |
![[ ]](/icons/compressed.gif) | mora_ferenc_kincskereso_kiskodmon.pdf.zip | 2007-03-24 02:58 | 563K | |
![[ ]](/icons/compressed.gif) | dallos_sandor_a_nap_szerelmese_hu_doc.zip | 2007-03-24 02:52 | 563K | |
![[ ]](/icons/compressed.gif) | king_ross_ex_libris_hu_rtf_nncl2848-6ebv1.zip | 2007-03-24 03:00 | 563K | |
![[ ]](/icons/unknown.gif) | sztrugackij_a_b_stalker_hu.rtf | 2007-11-14 03:27 | 562K | |
![[ ]](/icons/compressed.gif) | dumas_alexandre_a_harom_testor_rtf.zip | 2007-03-24 02:49 | 562K | |
![[ ]](/icons/layout.gif) | Halálos fegyver.pdf | 2007-04-15 16:32 | 562K | |
![[ ]](/icons/unknown.gif) | izzo_krom.rtf | 2007-11-14 04:54 | 561K | |
![[ ]](/icons/compressed.gif) | Isaac Asimov - Robottortenelem.zip | 2007-03-22 05:30 | 561K | |
![[ ]](/icons/unknown.gif) | dick_philip_k_palmer_eldritsch_harom_stigmaja_hu.rtf | 2007-11-14 09:56 | 561K | |
![[ ]](/icons/compressed.gif) | robertson_morgan_a_titan_vegzete_hu_doc.zip | 2007-03-24 02:58 | 561K | |
![[ ]](/icons/compressed.gif) | jokai_mor_akik_ketszer_halnak_meg_html.zip | 2007-03-24 02:56 | 560K | |
![[ ]](/icons/unknown.gif) | mezitelen_nap.rtf | 2007-11-14 05:23 | 560K | |
![[ ]](/icons/compressed.gif) | sztrugackij_a_b_nehez_istennek_lenni_a_hetfo_szombaton_kezdodoik_hu_rtf.zip | 2007-03-24 02:49 | 560K | |
![[ ]](/icons/compressed.gif) | Sztrugackij, Arkagyij és Borisz - Nehez istennek lenni a hetfo szombaton kezdodik.zip | 2007-02-21 16:44 | 560K | |
![[ ]](/icons/compressed.gif) | greenwood_ed_elminster_egy_magus_szuletese_hu_doc.zip | 2007-03-24 02:53 | 560K | |
![[ ]](/icons/compressed.gif) | hillaby_john_gyalogszerrel_a_rudolf_tohoz_hu_rtf.zip | 2007-03-24 02:56 | 560K | |
![[ ]](/icons/compressed.gif) | jokai_mor_egy_az_isten.zip | 2007-03-24 02:56 | 560K | |
![[ ]](/icons/compressed.gif) | duane_diane_vihar_eldalanal_hu_doc_nncl3212-722v1.zip | 2007-03-24 02:52 | 559K | |
![[ ]](/icons/compressed.gif) | uris_leon_a_kiralyno_torvenyszeke_hu_doc_nncl3117-706v1.zip | 2007-03-24 02:57 | 559K | |
![[ ]](/icons/compressed.gif) | babel_iszaak_lovashadsereg_hu_doc.zip | 2007-03-24 02:55 | 558K | |
![[ ]](/icons/unknown.gif) | ÚJ ÉG, ÚJ FÖLD.ace | 2007-03-24 02:56 | 558K | |
![[ ]](/icons/compressed.gif) | Isaak Asimov-Robottortenetek 1-2.zip | 2007-03-24 02:55 | 558K | |
![[ ]](/icons/compressed.gif) | uris_leon_mitla-szoros_hu_doc_nncl3119-706v1.zip | 2007-03-24 02:57 | 558K | |
![[ ]](/icons/unknown.gif) | nemere_istvan_a_kozmosz_lovagjai.doc | 2007-03-24 02:58 | 558K | |
![[ ]](/icons/compressed.gif) | Lewis C.S.- Narnia 5 hu.doc.zip | 2007-03-26 16:35 | 557K | |
![[ ]](/icons/compressed.gif) | irving_john_garp_szerint_a_vilag_hu_rtf_nncl1955-614v2.zip | 2007-03-24 02:56 | 557K | |
![[TXT]](/icons/text.gif) | A Kl n-00-Antol˘gia.html | 2006-09-19 19:57 | 557K | |
![[ ]](/icons/compressed.gif) | burke_james_tudashalo_hu_html.zip | 2007-03-24 02:55 | 557K | |
![[ ]](/icons/compressed.gif) | lewis_c_s_narnia_5_hu_doc.zip | 2007-03-24 02:52 | 557K | |
![[ ]](/icons/unknown.gif) | dolog.rtf | 2007-11-14 05:18 | 557K | |
![[ ]](/icons/unknown.gif) | nemere_istvan_aranybolygo.rtf | 2004-05-05 08:49 | 556K | |
![[ ]](/icons/compressed.gif) | adams_douglas_galaxis_utikalauz_stopposoknak.zip | 2007-03-24 02:53 | 556K | |
![[ ]](/icons/compressed.gif) | verne_jules_cirkuszkocsival_rtf.zip | 2007-03-24 02:56 | 556K | |
![[ ]](/icons/compressed.gif) | Mika waltari-Szinuhe.zip | 2007-03-24 02:57 | 556K | |
![[ ]](/icons/compressed.gif) | weiser_franz_klinger_walter_vilag_koruli_utja_hu_rtf_nncl2276-654v1.zip | 2007-03-24 02:54 | 555K | |
![[ ]](/icons/compressed.gif) | krudy_gyula_az_elso_habsburg.zip | 2007-03-24 02:56 | 555K | |
![[ ]](/icons/unknown.gif) | voros_oroszlan_1.rtf | 2007-11-14 07:03 | 555K | |
![[ ]](/icons/compressed.gif) | ludlum_robert_a_skorpio_illuzio_hu_rtf.zip | 2007-03-24 02:59 | 555K | |
![[TXT]](/icons/text.gif) | A Kl n-04-Setita.html | 2006-09-19 20:46 | 554K | |
![[ ]](/icons/compressed.gif) | Ivan Jefremov - A borotva éle.zip | 2007-03-26 15:30 | 554K | |
![[ ]](/icons/compressed.gif) | barker_clive_korbacs_hu_html.zip | 2007-03-24 02:52 | 554K | |
![[ ]](/icons/compressed.gif) | Clive Barker - Korbács.zip | 2006-05-30 22:08 | 554K | |
![[ ]](/icons/unknown.gif) | clarke_arthur_c__3001_vegso_urodisszeia.rtf | 2007-11-14 03:39 | 554K | |
![[ ]](/icons/compressed.gif) | gribbin_john_schrodinger_kiscicai_es_a_valosag_keresese_hu_sxw.zip | 2007-03-24 02:56 | 553K | |
![[ ]](/icons/unknown.gif) | Platon-Az allam | 2007-03-24 02:58 | 553K | |
![[ ]](/icons/compressed.gif) | mcbain_ed_mar_megint_a_suket_hu_rtf.zip | 2007-03-24 02:53 | 553K | |
![[ ]](/icons/unknown.gif) | X_magazin_02.doc | 2007-03-24 03:01 | 553K | |
![[ ]](/icons/compressed.gif) | Abu-Hamid Mohamed-Atevejgesbol kivezeto ut.zip | 2007-03-24 02:53 | 552K | |
![[ ]](/icons/compressed.gif) | merle_robert_a_balvany_hu_doc.zip | 2007-03-24 02:59 | 552K | |
![[ ]](/icons/compressed.gif) | christie_agatha_a_titokzatos_stylesi_eset_fuggony_hu_doc_nncl2852-6ebv1.zip | 2007-03-24 02:49 | 551K | |
![[ ]](/icons/compressed.gif) | si_naj_an_vizparti_tortenet_2_hu_rtf_nncl2414-67bv1.zip | 2007-03-24 03:00 | 551K | |
![[ ]](/icons/compressed.gif) | Metagalaktika 1.zip | 2007-03-24 02:57 | 551K | |
![[ ]](/icons/compressed.gif) | mikszath_kalman_a_ven_gazember_pdf.zip | 2007-03-24 02:57 | 551K | |
![[ ]](/icons/compressed.gif) | zahn_timothy_a_jovo_latomasa_hu_rtf.zip | 2006-05-31 08:56 | 550K | |
![[ ]](/icons/unknown.gif) | Marton Béla - Utazás a Vénuszra (text only).rtf | 2007-11-13 22:17 | 550K | |
![[TXT]](/icons/text.gif) | A Kl n-07-Asszamita.html | 2006-09-19 21:04 | 550K | |
![[ ]](/icons/unknown.gif) | tuzzel-vassal.ace | 2007-03-24 02:52 | 549K | |
![[ ]](/icons/compressed.gif) | Robert N Charrette-Keresd a magad igazat.zip | 2007-03-24 02:59 | 549K | |
![[ ]](/icons/unknown.gif) | X_magazin_09.doc | 2007-03-24 03:01 | 549K | |
![[ ]](/icons/unknown.gif) | virtualfeny.rtf | 2007-11-14 04:57 | 548K | |
![[ ]](/icons/unknown.gif) | doyle_arthur_conan_az_elveszett_vilag.rtf | 2007-11-14 08:51 | 548K | |
![[ ]](/icons/unknown.gif) | Herbert George Wells - Világok harca.rtf | 2006-07-19 19:42 | 547K | |
![[ ]](/icons/unknown.gif) | sztrugackij_a_b_a_kolyok.rtf | 2007-11-14 02:32 | 547K | |
![[ ]](/icons/compressed.gif) | harbinson w a_millennium_hu_doc.zip | 2006-05-17 22:35 | 546K | |
![[ ]](/icons/compressed.gif) | harbinson_w_a_millennium_hu_doc.zip | 2007-03-24 03:01 | 546K | |
![[ ]](/icons/unknown.gif) | AMBRUS~1.DOC | 2007-03-19 19:43 | 545K | |
![[ ]](/icons/compressed.gif) | Szepes Mária - A voros oroszlan rtf.zip | 2007-02-21 16:51 | 545K | |
![[ ]](/icons/compressed.gif) | Frederik Pohl-Az atjaro.zip | 2007-03-24 02:54 | 544K | |
![[ ]](/icons/compressed.gif) | ady_endre_osszes_koltemeny_html.zip | 2007-03-24 02:55 | 544K | |
![[ ]](/icons/compressed.gif) | asimov_isaac_az_alapitvany_pereme_doc_javitott.zip | 2007-03-24 02:55 | 544K | |
![[ ]](/icons/unknown.gif) | osero.ace | 2007-03-24 02:52 | 543K | |
![[ ]](/icons/compressed.gif) | Stone, Jeffrey - Gyemantvaros.zip | 2007-03-26 19:08 | 543K | |
![[ ]](/icons/unknown.gif) | skorpio.rtf | 2004-04-25 17:34 | 543K | |
![[ ]](/icons/unknown.gif) | alapitvany.rtf | 2007-11-14 03:07 | 543K | |
![[ ]](/icons/layout.gif) | A pecsétgyűrű.pdf | 2007-04-15 16:44 | 543K | |
![[ ]](/icons/compressed.gif) | roger_macbride_allen_utopia.zip | 2007-08-04 15:20 | 543K | |
![[ ]](/icons/compressed.gif) | Asimov nyomán - Macbride, Roger Allen - Utopia.zip | 2007-02-21 16:35 | 543K | |
![[ ]](/icons/compressed.gif) | heinlein_robert_angyali_udvozlet_hu_rtf.zip | 2007-03-24 02:59 | 543K | |
![[ ]](/icons/compressed.gif) | illyes_gyula_naplojegyzetek_1946-1960_html.zip | 2007-03-24 02:55 | 543K | |
![[ ]](/icons/layout.gif) | Dragonlance - Legendák - 6. Az ikrek próbája.pdf | 2007-01-21 15:52 | 542K | |
![[ ]](/icons/compressed.gif) | cook_robin_kromoszoma_hu_doc.zip | 2007-03-24 02:53 | 541K | |
![[ ]](/icons/compressed.gif) | Hal Clement-Az elveszett raketa.zip | 2007-03-24 02:55 | 540K | |
![[ ]](/icons/compressed.gif) | Legendák és enigmák 3.zip | 2007-04-06 11:04 | 540K | |
![[ ]](/icons/compressed.gif) | gardonyi_geza_egri_csillagok_rtf.zip | 2007-03-24 02:54 | 540K | |
![[ ]](/icons/compressed.gif) | rowling_j_k_harry_potter_es_a_felver_herceg_hu_rtf_nncl1807-5fev3.zip | 2007-03-24 02:55 | 539K | |
![[ ]](/icons/compressed.gif) | herbert_frank_dune_kaptalanhaz_hu_doc.zip | 2007-03-24 02:54 | 538K | |
![[ ]](/icons/compressed.gif) | Frank Herbert - Kaptalanhaz.zip | 2007-02-21 16:36 | 538K | |
![[ ]](/icons/unknown.gif) | Douglas Adams - Jobbára ártalmatlan.rtf | 2006-07-19 18:58 | 538K | |
![[ ]](/icons/unknown.gif) | Kviddics évszázadai.rtf | 2007-03-09 00:28 | 537K | |
![[ ]](/icons/compressed.gif) | heller_joseph_isten_tudja_hu_rtf_nncl2252_650v1.zip | 2007-03-24 02:56 | 537K | |
![[ ]](/icons/compressed.gif) | Karoli Gaspar-Biblia 2.zip | 2007-03-24 02:56 | 537K | |
![[ ]](/icons/compressed.gif) | hunyady_jozsef_oroszlan_es_godolye_hu_doc_nncl2978-701v1.zip | 2007-03-24 02:55 | 537K | |
![[TXT]](/icons/text.gif) | DARKELF.TXT | 2007-03-24 02:54 | 537K | |
![[ ]](/icons/compressed.gif) | jokai_mor_az_elet_komediasai_html.zip | 2007-03-24 02:56 | 536K | |
![[ ]](/icons/compressed.gif) | kurti_andras_a_maganyos_villa_titka_hu_doc.zip | 2007-03-24 02:57 | 535K | |
![[ ]](/icons/compressed.gif) | Star Trek Voyager 1.zip | 2007-03-26 18:56 | 535K | |
![[ ]](/icons/compressed.gif) | smith_wilbur_a_bosszu_hu_rtf.zip | 2007-03-24 03:01 | 534K | |
![[ ]](/icons/compressed.gif) | zweig_stefan_a_tegnap_vilaga_hu_doc_nncl2159-63cv1.zip | 2007-03-24 03:00 | 534K | |
![[ ]](/icons/compressed.gif) | Isaac Asimov - A hajnal bolygo robotjai.zip | 2007-03-21 21:42 | 533K | |
![[ ]](/icons/compressed.gif) | Isaac Asimov - Robottörténetek 1-2.zip | 2007-03-21 21:16 | 533K | |
![[ ]](/icons/compressed.gif) | rstory.zip | 2007-08-04 15:04 | 533K | |
![[ ]](/icons/compressed.gif) | asimov_isaac_robottortenetek_1-2.zip | 2007-03-24 02:55 | 533K | |
![[ ]](/icons/compressed.gif) | maupassant_mont-oriol-er_25f5s_mint_a_halal-az_ember_szive_rtf.zip | 2007-03-24 02:55 | 533K | |
![[ ]](/icons/compressed.gif) | griffin_eric_tremere_hu_doc_nncl2997-704v1.zip | 2007-03-24 02:53 | 533K | |
![[ ]](/icons/compressed.gif) | Démonvilág - 01. Démonmester.zip | 2007-03-20 13:25 | 532K | |
![[ ]](/icons/compressed.gif) | clancy_tom_a_kardinalis_hu_rtf.zip | 2007-03-24 03:00 | 532K | |
![[ ]](/icons/compressed.gif) | si_naj_an_vizparti_tortenet_1_hu_rtf_nncl2331-665v1.zip | 2007-03-24 03:00 | 532K | |
![[ ]](/icons/compressed.gif) | nance_john_j_vakito_villanas_hu_doc_nncl2709-6cav1.zip | 2007-03-24 02:56 | 532K | |
![[ ]](/icons/compressed.gif) | weis_hickman_elf_csillag_1_hu_rtf_nncl2511-695v1.zip | 2007-03-24 03:01 | 532K | |
![[ ]](/icons/compressed.gif) | mckenna_juliet_e_ketelu_fegyver_1_hu_doc_nncl2760-6d9v1.zip | 2007-03-24 02:56 | 531K | |
![[ ]](/icons/compressed.gif) | feist-rosenberg_gyilkossag_lamutban_hu_doc_nncl2228-64bv1.zip | 2007-03-24 02:54 | 531K | |
![[ ]](/icons/compressed.gif) | hobb_robin_az_orgyilkos_kuldetese_2_hu_rtf_nncl2376-671v2.zip | 2007-03-24 03:00 | 531K | |
![[ ]](/icons/compressed.gif) | mckenna_juliet_e_ketelu_fegyver_2_hu_doc_nncl2766-6d9v1.zip | 2007-03-24 02:56 | 531K | |
![[ ]](/icons/compressed.gif) | Feist, Raymond E - RL2_Gyilkosság_LaMutban.zip | 2007-03-26 14:40 | 531K | |
![[ ]](/icons/compressed.gif) | Gibson, William - Trendvadasz.zip | 2007-02-21 16:49 | 530K | |
![[ ]](/icons/compressed.gif) | herriot_james_allatorvosi_palyam_kezdeten_hu_doc.zip | 2007-03-24 02:55 | 530K | |
![[ ]](/icons/compressed.gif) | mora_ferenc_titulasz_bankoja.pdf.zip | 2007-03-24 02:58 | 529K | |
![[ ]](/icons/compressed.gif) | ket.eletem.egy.halalom.zip | 2007-02-21 16:40 | 528K | |
![[ ]](/icons/unknown.gif) | baljos_arnyak.rtf | 2007-03-24 02:54 | 528K | |
![[ ]](/icons/unknown.gif) | 4. Terry Brooks-Balj˘s rnyak.rtf | 2007-01-05 01:31 | 528K | |
![[ ]](/icons/compressed.gif) | Douglas Adams-Viszlat,es kosz a halakat.zip | 2007-03-24 02:53 | 528K | |
![[ ]](/icons/compressed.gif) | molnar_gabor_a_csendes_halal_demona_hu_doc_nncl2911-6f3v1.zip | 2007-03-24 02:58 | 528K | |
![[ ]](/icons/compressed.gif) | mg1.zip | 2007-08-04 15:34 | 527K | |
![[ ]](/icons/compressed.gif) | hailey_arthur_keseru_pirula_hu_doc.zip | 2007-03-24 02:49 | 527K | |
![[ ]](/icons/compressed.gif) | tamasi_aron_gondolat_es_arvasag_html.zip | 2007-03-24 03:00 | 527K | |
![[ ]](/icons/compressed.gif) | white_robin_a_tajgai_tigris_hu_doc_nncl3265-732v1.zip | 2007-03-24 02:58 | 527K | |
![[ ]](/icons/compressed.gif) | lemez.zip | 2007-03-24 02:56 | 526K | |
![[ ]](/icons/compressed.gif) | degener_volker_w_ordogok_hangszalagon_hu_pdf.zip | 2007-03-24 03:01 | 525K | |
![[ ]](/icons/compressed.gif) | denning_troy_tul_a_magas_uton_hu_doc_nncl3149-70bv1.zip | 2007-03-24 03:00 | 525K | |
![[ ]](/icons/compressed.gif) | herriot_james_a_repulo_allatorvos_hu_doc.zip | 2007-03-24 02:55 | 525K | |
![[ ]](/icons/compressed.gif) | doyle_arthur_conan_a_berill_fejek_pdf.zip | 2007-03-24 02:49 | 525K | |
![[ ]](/icons/compressed.gif) | adams_douglas_viszlat_es_kosz_a_halakat.zip | 2007-03-24 02:53 | 523K | |
![[ ]](/icons/compressed.gif) | hunyady_jozsef_hollos_vitez_hu_rtf.zip | 2007-03-24 02:55 | 523K | |
![[ ]](/icons/compressed.gif) | griffin_w_e_b_a_tengereszgyalogosok_7_hu_rtf_nncl3291-73ev1.zip | 2007-03-24 03:01 | 523K | |
![[ ]](/icons/compressed.gif) | sienkiewicz_henryk_quo_vadis_rtf.zip | 2007-03-24 02:55 | 523K | |
![[ ]](/icons/compressed.gif) | tung_jue_ami_a_nyugati_utazasbol_kimaradt_hu_pdf.zip | 2007-03-24 03:00 | 522K | |
![[ ]](/icons/compressed.gif) | silverberg_robert_lord_valentine_kastelya_hu_rtf.zip | 2007-03-24 02:59 | 522K | |
![[ ]](/icons/compressed.gif) | mora_ferenc_diobel_kiralyfi.pdf.zip | 2007-03-24 02:58 | 522K | |
![[ ]](/icons/compressed.gif) | shelby_graham_a_satan_szettorte_lancat_farkas_a_kertek_alatt_hu_rtf_nncl3302-73ev1.zip | 2007-03-24 02:55 | 522K | |
![[ ]](/icons/compressed.gif) | albaryu_esther_eltemetett_gyozelmek_hu_rtf.zip | 2007-03-24 02:53 | 521K | |
![[ ]](/icons/compressed.gif) | weis_perrin_halalbrigad_hu_doc.zip | 2007-03-24 03:01 | 521K | |
![[ ]](/icons/compressed.gif) | Weis-Perrin halalbrigád hu doc.zip | 2006-05-29 07:46 | 521K | |
![[ ]](/icons/compressed.gif) | rice_anne_boszorkanyok_oraja_hu_rtf.zip | 2007-03-24 02:49 | 521K | |
![[ ]](/icons/unknown.gif) | Stargate - D. Devlin & R. Emmerich - Csillagkapu.rtf | 2003-12-15 18:37 | 521K | |
![[ ]](/icons/compressed.gif) | king_stephen_titkos_ablak_titkos_kert_1-es_2_perccel_ejfel_utan_doc_hu_nncl2237-64cv1.zip | 2007-03-24 03:00 | 521K | |
![[ ]](/icons/compressed.gif) | heller_joseph_a_22_es_csapdaja_hu_rtf.zip | 2007-03-24 02:56 | 521K | |
![[ ]](/icons/compressed.gif) | goldenlane_j_a_josno_hercege_hu_doc_nncl3213-722v1.zip | 2007-03-24 02:55 | 521K | |
![[ ]](/icons/compressed.gif) | Dosztojevszkij--Bun es bunhodes.zip | 2007-03-24 02:53 | 520K | |
![[ ]](/icons/unknown.gif) | Az ür legmélyén.rtf | 2007-11-14 05:36 | 519K | |
![[ ]](/icons/compressed.gif) | Larry Niven - Álompark.zip | 2007-03-26 17:46 | 519K | |
![[ ]](/icons/compressed.gif) | HARCOM-adolf hitler.zip | 2007-03-24 02:49 | 519K | |
![[ ]](/icons/unknown.gif) | idgyujt.ace | 2007-03-24 02:52 | 518K | |
![[ ]](/icons/compressed.gif) | Metagalaktika 9.zip | 2007-03-24 02:57 | 518K | |
![[ ]](/icons/compressed.gif) | merle_robert_az_elet_rozsai_hu_doc.zip | 2007-03-24 02:59 | 518K | |
![[ ]](/icons/compressed.gif) | A filozofia tortenete bevezetes.zip | 2007-03-24 02:49 | 517K | |
![[ ]](/icons/compressed.gif) | Merle - Ime a kiraly.zip | 2005-06-09 13:57 | 517K | |
![[ ]](/icons/compressed.gif) | koontz_dean_r_idegenek_hu_txt.zip | 2007-03-24 02:52 | 517K | |
![[ ]](/icons/compressed.gif) | sienkiewicz_henryk_a_kislovag_rtf.zip | 2007-03-24 02:55 | 517K | |
![[TXT]](/icons/text.gif) | Atjaro.txt | 2007-11-14 04:40 | 517K | |
![[ ]](/icons/compressed.gif) | stone_jeffrey_ghouzm_gyongyei_hu_doc.zip | 2007-03-24 02:58 | 517K | |
![[ ]](/icons/compressed.gif) | swift_jonathan_gulliver_kalandos_utazasai.zip | 2007-03-24 02:56 | 516K | |
![[TXT]](/icons/text.gif) | Wayne Chapman - A Halál Havában.txt | 2007-03-24 02:54 | 516K | |
![[ ]](/icons/compressed.gif) | grady_james_a_sotetseg_folyoja_hu_doc.zip | 2007-03-24 02:55 | 516K | |
![[ ]](/icons/compressed.gif) | stackpole_michael_a_a_krytos_csapda_hu_doc.zip | 2007-03-24 02:54 | 515K | |
![[ ]](/icons/compressed.gif) | hamilton_laurell_k_ego_aldozatok_hu_rtf_nncl2449-68Dv1.zip | 2007-03-24 02:57 | 515K | |
![[ ]](/icons/compressed.gif) | scott_walter_kenilworth_rtf.zip | 2007-03-24 03:01 | 514K | |
![[ ]](/icons/compressed.gif) | welskopf_heinrich_liselotte_tokei_ihto_visszater_hu_rtf.zip | 2007-03-24 02:57 | 514K | |
![[ ]](/icons/compressed.gif) | balzac_honore_de_kurtizanok_tundoklese_es_nyomorusaga_rtf.zip | 2007-03-24 02:55 | 514K | |
![[ ]](/icons/compressed.gif) | GRAVES-A Vitez Belizar.zip | 2007-03-24 02:59 | 513K | |
![[ ]](/icons/compressed.gif) | killens_john_aztan_mennydorgest_hallottunk.zip | 2007-03-24 02:56 | 513K | |
![[ ]](/icons/compressed.gif) | ryan_cornelius_messze_volt_a_hid_hu_rtf.zip | 2007-03-24 02:52 | 512K | |
![[ ]](/icons/compressed.gif) | le_carre_john_kettos_szerepben_hu_rtf.zip | 2007-03-24 02:56 | 512K | |
![[ ]](/icons/compressed.gif) | eastlake_william_a_muvesz_arckepe_hu_pdf.zip | 2007-03-24 03:01 | 512K | |
![[ ]](/icons/compressed.gif) | bushnell_candace_szex_es_new_york_hu_doc_nncl2116-636v1.zip | 2007-03-24 02:52 | 512K | |
![[ ]](/icons/compressed.gif) | shelby_graham_sotet_lovagok_hiu_kiralyok_hu_rtf_nncl3303-73ev1.zip | 2007-03-24 02:55 | 512K | |
![[ ]](/icons/unknown.gif) | terra.rtf | 2004-04-26 00:02 | 511K | |
![[ ]](/icons/compressed.gif) | eckhart_mester_a_teremtes_konyvenek_magyarazata_hu_html.zip | 2007-03-24 02:53 | 511K | |
![[ ]](/icons/compressed.gif) | Echart mester-A teremtes konyvenek magyarazata.zip | 2007-03-24 02:53 | 511K | |
![[ ]](/icons/compressed.gif) | paral_vladimir_a_kepzelet_kinja_hu_doc.zip | 2007-03-24 03:01 | 510K | |
![[ ]](/icons/compressed.gif) | fleming_gherbod_ventrue_hu_doc_nncl2778-6dbv1.zip | 2007-03-24 02:55 | 510K | |
![[ ]](/icons/unknown.gif) | kisokos.ace | 2007-03-24 02:56 | 510K | |
![[ ]](/icons/unknown.gif) | X_magazin_04.doc | 2007-03-24 03:01 | 510K | |
![[ ]](/icons/compressed.gif) | feuchtwanger_lion_balgak_bolcsessege_hu_doc.zip | 2007-03-24 02:57 | 509K | |
![[ ]](/icons/compressed.gif) | jokai_mor_a_kiskiralyok_html.zip | 2007-03-24 02:56 | 509K | |
![[ ]](/icons/unknown.gif) | X_magazin_15.doc | 2007-03-24 03:01 | 509K | |
![[ ]](/icons/compressed.gif) | simon_seymour_a_szamitogepes_detektiv_hu_pdf.zip | 2007-03-24 03:00 | 508K | |
![[ ]](/icons/compressed.gif) | ROBUR_04.doc.zip | 2007-03-24 03:00 | 508K | |
![[ ]](/icons/unknown.gif) | 2001.rtf | 2007-11-14 04:02 | 508K | |
![[ ]](/icons/compressed.gif) | frost_david_ballepesek_konyve_hu_rtf.zip | 2007-03-24 02:52 | 508K | |
![[ ]](/icons/compressed.gif) | Fehérmágia - ALICE A. BAILEY.zip | 2006-06-01 01:25 | 508K | |
![[ ]](/icons/unknown.gif) | tzona.ace | 2007-03-24 02:52 | 508K | |
![[ ]](/icons/unknown.gif) | rejtelmes_oceanok.rtf | 2004-04-14 09:12 | 508K | |
![[ ]](/icons/compressed.gif) | paszternak_borisz_doktor_zsivago_hu_txt_nncl2040-62av1.zip | 2007-03-24 02:52 | 507K | |
![[ ]](/icons/compressed.gif) | jokai_mor_szeretve_a_verpadig_html.zip | 2007-03-24 02:56 | 506K | |
![[ ]](/icons/layout.gif) | Dragonlance - Legendák - 5. Pusztulás.pdf | 2007-01-20 17:26 | 506K | |
![[ ]](/icons/compressed.gif) | Bolcsessegek konyve 1.zip | 2007-03-24 02:52 | 506K | |
![[ ]](/icons/compressed.gif) | graves_robert_a_vitez_belizar_hu_rtf.zip | 2007-03-24 02:59 | 506K | |
![[ ]](/icons/compressed.gif) | verne_jules_nemo_kapitany_rtf.zip | 2007-03-24 02:56 | 506K | |
![[ ]](/icons/compressed.gif) | Jules Verne-Nemo kapitany.zip | 2007-03-24 02:56 | 506K | |
![[ ]](/icons/unknown.gif) | asimov_isaac_a_halal_fuvallata.rtf | 2007-11-14 05:23 | 505K | |
![[ ]](/icons/compressed.gif) | kiyosaki_robert_t_gazdag_papa_szegeny_papa_hu_html.zip | 2007-03-24 03:00 | 505K | |
![[TXT]](/icons/text.gif) | nncl | 2007-11-14 07:45 | 504K | |
![[ ]](/icons/compressed.gif) | grisham_john_a_csodatevo_hu_rtf.zip | 2007-03-24 02:56 | 504K | |
![[ ]](/icons/compressed.gif) | maclean_alistair_navarone_agyui_hu_rtf.zip | 2007-03-24 02:49 | 504K | |
![[ ]](/icons/unknown.gif) | v - a király visszatér.rtf | 2007-03-20 14:51 | 503K | |
![[ ]](/icons/unknown.gif) | oroklet_tolvaja.rtf | 2007-11-14 05:10 | 503K | |
![[ ]](/icons/compressed.gif) | ceccoli_paolo_a_tortenelem_atlasza_keresztes_hadjaratok_hu_rtf.zip | 2007-03-24 02:58 | 503K | |
![[ ]](/icons/compressed.gif) | Michael Crichton - Ködsárkányok.zip | 2007-04-15 03:58 | 502K | |
![[ ]](/icons/compressed.gif) | hailey_arthur_bankemberek_hu_rtf.zip | 2007-03-24 02:49 | 502K | |
![[ ]](/icons/compressed.gif) | Bankemberek.zip | 2007-03-24 02:49 | 502K | |
![[ ]](/icons/compressed.gif) | doctorow_e_l_isten_varosa_hu_doc_nncl2781-6dcv1.zip | 2007-03-24 02:53 | 502K | |
![[ ]](/icons/compressed.gif) | Rowling, J.K - Harry Potter 2 és a Titkok Kamrája txt.zip | 2007-03-20 05:11 | 502K | |
![[ ]](/icons/compressed.gif) | graves_robert_isten_hozzad_anglia_hu_doc_nncl1965-614v1.zip | 2007-03-24 02:59 | 502K | |
![[ ]](/icons/compressed.gif) | willocks_tim_lazadas_a_zold_folyoban_hu_doc_nncl2446-68bv1.zip | 2007-03-24 03:00 | 501K | |
![[ ]](/icons/unknown.gif) | korbacs.ace | 2007-03-24 02:52 | 501K | |
![[ ]](/icons/compressed.gif) | dosztojevszkij_fjodor_bun_es_bunhodes_rtf.zip | 2007-03-24 02:53 | 501K | |
![[ ]](/icons/compressed.gif) | jokai_mor_a_locsei_feher_asszony_doc.zip | 2007-03-24 02:56 | 499K | |
![[ ]](/icons/compressed.gif) | apollinaire_guillaume_tizenegyezer_vesszo_hu_pdf.zip | 2007-03-24 02:55 | 499K | |
![[ ]](/icons/compressed.gif) | updike_john_parok_hu_rtf.zip | 2007-03-24 02:56 | 499K | |
![[ ]](/icons/unknown.gif) | iv - a két torony.rtf | 2007-03-20 14:35 | 499K | |
![[ ]](/icons/unknown.gif) | p_20020711.ace | 2007-03-24 02:52 | 497K | |
![[TXT]](/icons/text.gif) | A Kl n-06-Lasombra.html | 2006-09-19 20:41 | 497K | |
![[ ]](/icons/unknown.gif) | davids_paul_es_hollace_a_hutt_visszavag.rtf | 2007-03-24 02:54 | 497K | |
![[ ]](/icons/compressed.gif) | rice_anne_taltos_hu_rtf.zip | 2007-03-24 02:49 | 497K | |
![[ ]](/icons/compressed.gif) | merle_robert_francia_historia_hu_doc.zip | 2007-03-24 02:59 | 496K | |
![[TXT]](/icons/text.gif) | heinlein_robert_a_galaxis_polgara_hu.html | 2007-11-14 05:38 | 496K | |
![[ ]](/icons/unknown.gif) | osszes61.ace | 2007-03-24 02:56 | 496K | |
![[ ]](/icons/compressed.gif) | Olasz-Magyar,Magyar-Olasz szo.zip | 2007-03-24 03:00 | 496K | |
![[ ]](/icons/compressed.gif) | moldova_gyorgy_europa_hatso_udvara_html.zip | 2007-03-24 02:58 | 496K | |
![[ ]](/icons/compressed.gif) | Katona LAszlo--Narancsliget.zip | 2007-03-24 02:56 | 496K | |
![[ ]](/icons/unknown.gif) | p_20020609.ace | 2007-03-24 02:52 | 496K | |
![[ ]](/icons/compressed.gif) | hamilton_laurell_k_veres_csontok_hu_rtf.zip | 2007-03-24 02:57 | 496K | |
![[ ]](/icons/compressed.gif) | szellemidezes_hu_rtf.zip | 2007-03-24 02:52 | 496K | |
![[ ]](/icons/compressed.gif) | vonnegut_kurt_az_otos_szamu_vagohid_pdf.zip | 2007-03-24 02:57 | 496K | |
![[ ]](/icons/compressed.gif) | FARKAS HENRIK-IgaZ-aktak[vilagegyetem titkai].zip | 2007-03-24 02:54 | 495K | |
![[ ]](/icons/compressed.gif) | taxil_leo_a_szorakoztato_biblia_hu_rtf.zip | 2007-03-24 02:57 | 495K | |
![[ ]](/icons/unknown.gif) | pacioli.ace | 2007-03-24 02:52 | 495K | |
![[ ]](/icons/compressed.gif) | ludlum_robert_a_fantom_hu_rtf.zip | 2007-03-24 02:59 | 494K | |
![[ ]](/icons/compressed.gif) | mg9.zip | 2007-08-04 15:25 | 494K | |
![[ ]](/icons/compressed.gif) | gaspar_andras_ket_eletem_egy_halalom_hu_rtf_nncl2501-692v1.zip | 2007-03-24 02:54 | 494K | |
![[ ]](/icons/compressed.gif) | Harmadik tipusú találkozások.zip | 2007-03-26 19:06 | 493K | |
![[ ]](/icons/unknown.gif) | idojaror.rtf | 2007-11-14 05:43 | 493K | |
![[ ]](/icons/unknown.gif) | sargasso.rtf | 2007-11-13 22:41 | 493K | |
![[ ]](/icons/unknown.gif) | shan_darren_demonmester_hu_nncl3182-70fv0.rtf | 2007-03-30 20:11 | 493K | |
![[ ]](/icons/compressed.gif) | szalay_lenke_barat_erkezik_a_hazhoz_hu_doc_nncl3029-708v1.zip | 2007-03-24 03:00 | 493K | |
![[ ]](/icons/compressed.gif) | johnson_eyvind_kegyes_urunk_carolus_hu_doc.zip | 2007-03-24 02:53 | 491K | |
![[ ]](/icons/compressed.gif) | cook_robin_ragaly_hu_doc.zip | 2007-03-24 02:53 | 491K | |
![[ ]](/icons/compressed.gif) | Stephen Donaldson - A Kárhozat Urának átka.zip | 2007-03-23 21:46 | 491K | |
![[TXT]](/icons/text.gif) | osszian.htm | 2007-11-14 06:05 | 490K | |
![[ ]](/icons/compressed.gif) | sztrugackij_a_b_a_karhozott_varos_hu_rtf.zip | 2007-03-24 02:49 | 490K | |
![[ ]](/icons/compressed.gif) | Sztrugackij, Arkagyij és Borisz - A karhozott_varos_hu_rtf.zip | 2007-02-21 16:51 | 490K | |
![[ ]](/icons/compressed.gif) | peretti_frank_e_ez_elet_sotetsege_hu_rtf_nncl2181-63f.zip | 2007-03-24 02:54 | 489K | |
![[TXT]](/icons/text.gif) | A Kl n-13-Nosferatu.html | 2006-09-19 21:19 | 489K | |
![[ ]](/icons/compressed.gif) | pilinszky_janos_osszes_versei_html.zip | 2007-03-24 02:58 | 489K | |
![[TXT]](/icons/text.gif) | A Kl n-11-Brujah.html | 2006-09-19 20:21 | 489K | |
![[ ]](/icons/unknown.gif) | az_orbitron-terv.rtf | 2007-11-14 02:05 | 488K | |
![[ ]](/icons/unknown.gif) | birodalmi_fold.rtf | 2007-11-14 09:07 | 488K | |
![[ ]](/icons/compressed.gif) | jokai_mor_a_koszivu_ember_fiai_html.zip | 2007-03-24 02:56 | 488K | |
![[ ]](/icons/compressed.gif) | illyes_gyula_hetvenhet_magyar_nepmese_html.zip | 2007-03-24 02:55 | 487K | |
![[ ]](/icons/compressed.gif) | Passuth Laszlo-Megszolal a sirvilag.zip | 2007-03-24 02:58 | 487K | |
![[ ]](/icons/compressed.gif) | illyes_gyula_beatrice_aprodjai_html.zip | 2007-03-24 02:55 | 487K | |
![[ ]](/icons/compressed.gif) | dumas_alexandre_emlekeim_hu_rtf.zip | 2007-03-24 02:49 | 486K | |
![[ ]](/icons/compressed.gif) | mikszath_kalman_a_fekete_varos_doc.zip | 2007-03-24 02:57 | 486K | |
![[ ]](/icons/unknown.gif) | Raymond Silva - Cagliostro rejtelmes élete.rtf | 2006-07-20 09:51 | 486K | |
![[ ]](/icons/compressed.gif) | vuillemin_alain_a_diktator_hu_html_nncl2419-67bv1.zip | 2007-03-24 02:49 | 486K | |
![[ ]](/icons/unknown.gif) | Nemere Istvan - Lenni vagy elni.rtf | 2005-05-11 08:30 | 485K | |
![[ ]](/icons/compressed.gif) | dekany_andras_a_fekete_herceg_hu_doc_nncl2886-6f3v1.zip | 2007-03-24 02:52 | 485K | |
![[ ]](/icons/compressed.gif) | kovacs_szt_zoltan_a_labfulesek_bolygojan_hu_html.zip | 2007-03-24 02:56 | 485K | |
![[ ]](/icons/unknown.gif) | X_magazin_05.doc | 2007-03-24 03:01 | 485K | |
![[ ]](/icons/compressed.gif) | kuchler_manfred_markus_a_magus_hu_pdf.zip | 2007-03-24 02:57 | 484K | |
![[ ]](/icons/compressed.gif) | krudy_gyula_szent_margit.zip | 2007-03-24 02:56 | 483K | |
![[ ]](/icons/compressed.gif) | dekany_andras_mexikoi_legenyek_hu_doc_nncl2144-638v2.zip | 2007-03-24 02:52 | 483K | |
![[ ]](/icons/compressed.gif) | lem_stanislaw_magellan_felho_hu_doc_nncl3200-718v1.zip | 2007-03-24 03:00 | 482K | |
![[ ]](/icons/compressed.gif) | moldova_gyorgy_bun_az_elet_html.zip | 2007-03-24 02:58 | 482K | |
![[ ]](/icons/compressed.gif) | Kovai Lorinc-A vegzet tenyeren.zip | 2007-03-24 02:56 | 482K | |
![[ ]](/icons/compressed.gif) | king_stephen_remauto_hu_doc.zip | 2007-03-24 03:00 | 482K | |
![[ ]](/icons/compressed.gif) | Stephen King - A remauto_hu_doc.zip | 2006-05-29 00:08 | 482K | |
![[ ]](/icons/compressed.gif) | tolkien_a_gyuruk_ura_a_ket_torony_hu_doc.zip | 2007-03-24 02:54 | 481K | |
![[ ]](/icons/unknown.gif) | nemere_istvan_az_ido_vandorai.rtf | 2004-04-30 10:18 | 481K | |
![[ ]](/icons/compressed.gif) | gardonyi_geza_tukorkepeim_rtf.zip | 2007-03-24 02:54 | 481K | |
![[ ]](/icons/compressed.gif) | london_jack_martin_eden_hu_doc_nncl1998-61dv1.zip | 2007-03-24 02:55 | 481K | |
![[ ]](/icons/compressed.gif) | szepes_maria_a_voros_oroszlan.zip | 2007-03-24 03:00 | 480K | |
![[ ]](/icons/unknown.gif) | vadak_kozott.rtf | 2004-04-24 09:40 | 480K | |
![[ ]](/icons/compressed.gif) | herbert_frank_dune_isten_csaszara_hu_doc.zip | 2007-03-24 02:54 | 480K | |
![[ ]](/icons/compressed.gif) | Frank Herbert - Istencsaszar.zip | 2007-02-21 16:49 | 480K | |
![[ ]](/icons/compressed.gif) | heywood_joseph_hozd_el_nekem_hitlert_hu_txt.zip | 2007-03-24 02:56 | 480K | |
![[ ]](/icons/unknown.gif) | avery_dale_han_solo_es_a_fejvadaszok.rtf | 2007-03-24 02:54 | 479K | |
![[ ]](/icons/compressed.gif) | Fekete Gyula-A kek sziget.zip | 2007-03-24 02:54 | 478K | |
![[ ]](/icons/unknown.gif) | OTVENEDIK.ZIP | 2007-03-24 02:58 | 478K | |
![[ ]](/icons/compressed.gif) | fekete_gyula_a_kek_sziget_hu_rtf.zip | 2007-03-24 02:54 | 478K | |
![[ ]](/icons/compressed.gif) | paral_vladimir_teljesult_kivansagok_vasara_hu_doc.zip | 2007-03-24 03:01 | 477K | |
![[ ]](/icons/compressed.gif) | E M Nathanson-Egy piszkos haboru.zip | 2007-03-24 02:53 | 477K | |
![[ ]](/icons/compressed.gif) | kovai_lorinc_cezarok_kertje_hu_txt.zip | 2007-03-24 02:56 | 477K | |
![[ ]](/icons/compressed.gif) | moldova_gyorgy_szabadits_meg_a_gonosztol_html.zip | 2007-03-24 02:58 | 476K | |
![[ ]](/icons/compressed.gif) | garcia_marquez_gabriel_szaz_ev_magany_hu_nncl19-3f2v2.zip | 2007-03-24 02:54 | 475K | |
![[ ]](/icons/compressed.gif) | molnar_gabor_hogaszom_az_amazonason_hu_rtf.zip | 2007-03-24 02:58 | 475K | |
![[ ]](/icons/compressed.gif) | cusack_dymphna_hohullam_berlinben_hu_doc.zip | 2007-03-24 02:53 | 475K | |
![[ ]](/icons/compressed.gif) | Clifford D Simak - A város.zip | 2007-03-26 18:53 | 474K | |
![[ ]](/icons/compressed.gif) | muller_peter_lomb_es_gyoker_hu_doc_nncl3215-722v1.zip | 2007-03-24 02:58 | 474K | |
![[ ]](/icons/compressed.gif) | paolini_cristopher_eragon_1_az_orokseg_hu_rtf_nncl2457-68ev5.zip | 2007-03-24 02:52 | 473K | |
![[ ]](/icons/compressed.gif) | arany_janos_osszes_balladai_rtf.zip | 2007-03-24 02:55 | 473K | |
![[ ]](/icons/compressed.gif) | gogol_holt_lelkek.doc.zip | 2007-03-24 02:58 | 472K | |
![[ ]](/icons/compressed.gif) | resnick_mike_agyarak_hu_doc.zip | 2007-03-24 02:57 | 472K | |
![[ ]](/icons/compressed.gif) | white_th_udv_neked_arthur_nagy_kiraly_hu_txt.zip | 2007-03-24 03:00 | 471K | |
![[ ]](/icons/compressed.gif) | nathanson_e_m_egy_piszkos_haboru.zip | 2007-03-24 02:53 | 471K | |
![[ ]](/icons/compressed.gif) | mora_ferenc_a_kortemuzsika.pdf.zip | 2007-03-24 02:58 | 470K | |
![[ ]](/icons/compressed.gif) | 05. Ezüst erek.zip | 2007-03-26 18:33 | 470K | |
![[ ]](/icons/unknown.gif) | ero.rtf | 2007-11-14 06:26 | 470K | |
![[ ]](/icons/compressed.gif) | illyes_gyula_petofi_sandor_html.zip | 2007-03-24 02:55 | 470K | |
![[TXT]](/icons/text.gif) | chapman_wayne_keleti_szel.txt | 2007-03-24 02:54 | 470K | |
![[ ]](/icons/compressed.gif) | salvatore_r_a_ezust_erek_hu_rtf.zip | 2006-05-29 05:55 | 470K | |
![[ ]](/icons/unknown.gif) | boldogsag.rtf | 2007-11-14 08:52 | 470K | |
![[ ]](/icons/compressed.gif) | wharton_william_apa_hu_rtf.zip | 2007-03-24 03:01 | 470K | |
![[ ]](/icons/compressed.gif) | csernai_zoltan_titok_a_vilag_tetejen.zip | 2007-03-24 02:52 | 470K | |
![[ ]](/icons/compressed.gif) | Csernai Zoltan-Titkok a vilag tetejenI.zip | 2007-03-24 02:52 | 470K | |
![[ ]](/icons/compressed.gif) | Csernai Zoltán -Titok a vilag tetejen.zip | 2007-02-21 16:44 | 470K | |
![[ ]](/icons/compressed.gif) | cook_robin_halalos_kockazat_hu_doc.zip | 2007-03-24 03:00 | 470K | |
![[ ]](/icons/compressed.gif) | haslinger_josef_operabal_hu_doc_nncl1035-451v2.zip | 2007-03-24 02:56 | 469K | |
![[ ]](/icons/compressed.gif) | knaak_richard_a_halalszarny_hu_doc.zip | 2007-03-24 02:59 | 469K | |
![[ ]](/icons/compressed.gif) | scott_walter_a_fekete_torpe_pdf.zip | 2007-03-24 03:01 | 469K | |
![[ ]](/icons/compressed.gif) | forsyth_frederick_az_ordog_alternativaja_hu_rtf.zip | 2007-03-24 02:54 | 469K | |
![[ ]](/icons/compressed.gif) | herbert_frank_vedett_nok_a_feher_pestis_hu_rtf.zip | 2007-03-24 02:54 | 469K | |
![[ ]](/icons/compressed.gif) | Frank Herbet - Vedett nok A feher pestis hu rtf.zip | 2006-05-28 00:40 | 469K | |
![[ ]](/icons/compressed.gif) | F Forsyth-A Sakal napja.zip | 2007-03-24 02:54 | 469K | |
![[ ]](/icons/compressed.gif) | a_marslakok_masodik_invazioja_hu_doc.zip | 2007-08-04 14:51 | 468K | |
![[ ]](/icons/layout.gif) | 00556.pdf | 2007-03-24 02:52 | 468K | |
![[ ]](/icons/compressed.gif) | benyovszky_moric_madagaszkar_pdf.zip | 2007-03-24 02:50 | 468K | |
![[ ]](/icons/compressed.gif) | Frederick Forsyth-A haboru kutyai.zip | 2007-03-24 02:54 | 468K | |
![[ ]](/icons/compressed.gif) | si_naj_an_vizparti_tortenet_3_hu_rtf_nncl2435-688v1.zip | 2007-03-24 03:00 | 468K | |
![[ ]](/icons/compressed.gif) | 15. Ezer ork.zip | 2007-03-26 18:34 | 468K | |
![[ ]](/icons/compressed.gif) | salvatore_r_a_ezer_ork_hu_rtf.zip | 2006-05-29 05:51 | 468K | |
![[ ]](/icons/compressed.gif) | forsyth_frederick_a_haboru_kutyai_hu_rtf.zip | 2007-03-24 02:54 | 467K | |
![[ ]](/icons/compressed.gif) | heller_joseph_valami_tortent_hu_html.zip | 2007-03-24 02:56 | 467K | |
![[ ]](/icons/compressed.gif) | feher_tibor_konyves_kiraly_hu_doc.zip | 2007-03-24 02:54 | 467K | |
![[ ]](/icons/compressed.gif) | Alfred Eduard Brehm-Az allatok vilaga.zip | 2007-03-24 02:49 | 467K | |
![[ ]](/icons/compressed.gif) | fable_vavyan_ki_fekudt_az_agyamban_hu_rtf_nncl3315-73Ev1.zip | 2007-03-24 03:01 | 467K | |
![[ ]](/icons/unknown.gif) | mccay_bill_stargate_bosszu.rtf | 2004-03-31 09:40 | 467K | |
![[TXT]](/icons/text.gif) | A Kl n-10-Giovanni.html | 2006-09-19 20:02 | 466K | |
![[ ]](/icons/compressed.gif) | ronaszegi_miklos_a_nagy_jatszma_hu_doc_nncl1412-50bv1.zip | 2007-03-24 03:00 | 466K | |
![[ ]](/icons/compressed.gif) | vonnegut_kurt_bajnokok_reggelije.zip | 2007-03-24 02:57 | 466K | |
![[ ]](/icons/compressed.gif) | Kurt Vonnegut - Bajnokok reggelije.zip | 2006-08-24 21:46 | 466K | |
![[ ]](/icons/unknown.gif) | osszes20.ace | 2007-03-24 02:56 | 465K | |
![[ ]](/icons/compressed.gif) | herriot_james_egy_allatorvos_tortenetei_hu_doc.zip | 2007-03-24 02:55 | 465K | |
![[ ]](/icons/compressed.gif) | dekany_andras_kossuth_lajos_tengeresze_hu_rtf_nncl2568-6a6v2.zip | 2007-03-24 02:52 | 465K | |
![[ ]](/icons/compressed.gif) | MORT-Terry Pratchett.zip | 2007-03-24 03:00 | 465K | |
![[ ]](/icons/unknown.gif) | vi - a király visszatér.rtf | 2007-03-20 14:39 | 465K | |
![[ ]](/icons/compressed.gif) | Rowling,Joanne K-Herry Potter es a tuz serlege.zip | 2007-03-24 02:55 | 465K | |
![[ ]](/icons/unknown.gif) | atleontisz.rtf | 2007-11-14 07:35 | 465K | |
![[ ]](/icons/compressed.gif) | Walter M Miller Jr-Hozsanna neked,Leibowitz.zip | 2007-03-24 03:01 | 464K | |
![[ ]](/icons/compressed.gif) | forsyth_frederick_a_sakal_napja_hu_rtf.zip | 2007-03-24 02:54 | 464K | |
![[ ]](/icons/compressed.gif) | rowling_j_k_harry_potter_es_a_tuz_serlege_hu_rtf.zip | 2007-03-24 02:55 | 463K | |
![[ ]](/icons/compressed.gif) | Rowling, J.K - Harry Potter 4 és a Tűz Serlege hu rtf.zip | 2006-05-31 08:14 | 463K | |
![[ ]](/icons/compressed.gif) | topol_eduard_a_birodalom_szethullasa_hu_rtf.zip | 2007-03-24 02:53 | 463K | |
![[ ]](/icons/compressed.gif) | zola_emile_lourdes_rtf.zip | 2007-03-24 02:53 | 463K | |
![[ ]](/icons/compressed.gif) | lll_a_fold_alatti_piramis.zip | 2007-03-20 00:18 | 463K | |
![[ ]](/icons/compressed.gif) | illyes_gyula_naplojegyzetek_1929-1945_html.zip | 2007-03-24 02:55 | 462K | |
![[ ]](/icons/compressed.gif) | macbride_allen_roger_inferno_hu_doc_nncl2083-635v1.zip | 2007-03-24 03:00 | 462K | |
![[ ]](/icons/compressed.gif) | allen_roger_macbridge_inferno_hu_doc_nncl2083-635v1.zip | 2007-03-24 03:00 | 462K | |
![[ ]](/icons/compressed.gif) | pirincci_akif_barsonytalpon_oson_a_halal_hu_doc.zip | 2007-03-24 02:49 | 462K | |
![[ ]](/icons/compressed.gif) | stone_irving_a_napsugar_fia_hu_html.zip | 2007-03-24 02:55 | 462K | |
![[ ]](/icons/unknown.gif) | asimov_isaac_alapitvany_es_birodalom.rtf | 2007-11-13 23:14 | 462K | |
![[ ]](/icons/unknown.gif) | a.d.foster_alien.rtf | 2007-11-14 04:18 | 462K | |
![[ ]](/icons/unknown.gif) | a_b_cee_a_roppencs.hu_doc.zip2 | 2007-03-24 03:00 | 461K | |
![[ ]](/icons/compressed.gif) | rice_anne_interju_a_vampirral_hu_rtf.zip | 2007-03-24 02:49 | 461K | |
![[ ]](/icons/layout.gif) | gus4.pdf | 2007-11-14 09:01 | 461K | |
![[ ]](/icons/compressed.gif) | mohas_livia_az_oroszlanos_kert_hu_doc.zip | 2007-03-24 02:58 | 461K | |
![[ ]](/icons/unknown.gif) | kupola.rtf | 2007-03-24 02:58 | 461K | |
![[ ]](/icons/unknown.gif) | Nemere István - A kupolaváros titka.rtf | 2006-07-19 20:59 | 461K | |
![[ ]](/icons/compressed.gif) | goldenlane_j_a_szelhamos_es_a_varazslo_hu_doc_nncl2904-6f3v1.zip | 2007-03-24 02:55 | 461K | |
![[ ]](/icons/compressed.gif) | Merle - Jo varosunk Parizs.zip | 2005-06-09 13:57 | 461K | |
![[ ]](/icons/compressed.gif) | CHAPLIN-Életem.zip | 2007-03-24 02:52 | 460K | |
![[ ]](/icons/unknown.gif) | bill_a_galaktika_hose.rtf | 2007-11-14 03:33 | 460K | |
![[ ]](/icons/compressed.gif) | Merle - A pirkadat.zip | 2005-06-09 13:56 | 460K | |
![[ ]](/icons/compressed.gif) | about_edmund_egy_jegyzo_orra_hu_pdf.zip | 2007-03-24 02:49 | 460K | |
![[ ]](/icons/compressed.gif) | mora_ferenc_georgikon.pdf.zip | 2007-03-24 02:58 | 460K | |
![[ ]](/icons/compressed.gif) | asimov_isaac_a_csillagok_akar_a_por_doc.zip | 2007-03-24 02:55 | 458K | |
![[ ]](/icons/compressed.gif) | Guinnes Rekordok Konyve 1492.zip | 2007-03-24 02:55 | 458K | |
![[ ]](/icons/compressed.gif) | zola_emile_germinal_rtf.zip | 2007-03-24 02:53 | 457K | |
![[ ]](/icons/compressed.gif) | Merle - Szenvedélyes szeretet.zip | 2005-06-09 14:04 | 457K | |
![[TXT]](/icons/text.gif) | A lélek hosszú, sötét teadélutánja.htm | 2007-03-24 02:53 | 457K | |
![[ ]](/icons/compressed.gif) | rice_anne_a_mumia_hu_rtf.zip | 2007-03-24 02:49 | 456K | |
![[ ]](/icons/compressed.gif) | kesey_ken_szall_a_kakukk_feszkere_hu_rtf_nncl2087-635v1.zip | 2007-03-24 02:56 | 456K | |
![[ ]](/icons/unknown.gif) | nemere_istvan_a_kozmosz_korbacsa_hu_nncl656-3d3v3.rtf | 2006-07-13 17:58 | 456K | |
![[ ]](/icons/compressed.gif) | baruske_heinz_gronland_a_fold_legnagyobb_szigete_hu_doc_nncl1327-4e7v2.zip | 2007-03-24 02:55 | 456K | |
![[ ]](/icons/unknown.gif) | kahn_james_a_jedi_visszater.rtf | 2007-03-24 02:54 | 455K | |
![[ ]](/icons/unknown.gif) | 3. James Kahn - A jedi visszat'r.rtf | 2007-01-05 01:33 | 455K | |
![[ ]](/icons/unknown.gif) | VI.RTF | 2007-11-13 22:24 | 455K | |
![[ ]](/icons/compressed.gif) | koontz_dean_r_a_rossz_hely_hu_rtf_nncl2312-65ev1.zip | 2007-03-24 02:52 | 455K | |
![[ ]](/icons/compressed.gif) | salinger_j_d_zabhegyezo.zip | 2007-03-24 02:55 | 455K | |
![[ ]](/icons/compressed.gif) | charteris_leslie_az_angyal_hu_rtf.zip | 2007-03-24 02:57 | 454K | |
![[ ]](/icons/compressed.gif) | graves_robert_claudius_az_isten_hu_rtf.zip | 2007-03-24 02:59 | 454K | |
![[ ]](/icons/compressed.gif) | hiaasen_carl_hurrikan_hu_doc_nncl2108-636v1.zip | 2007-03-24 02:52 | 454K | |
![[ ]](/icons/compressed.gif) | merle_robert_uvegfal_mogott_hu_doc.zip | 2007-03-24 02:59 | 454K | |
![[ ]](/icons/compressed.gif) | follett_james_a_trojai_hu_rtf.zip | 2007-03-24 02:55 | 454K | |
![[ ]](/icons/compressed.gif) | vicsek_ferenc_a_bomlas_melege_hu_doc.zip | 2007-03-24 03:01 | 454K | |
![[ ]](/icons/compressed.gif) | Sztrugackij, Arkagyij és Borisz - Stalker.zip | 2007-02-21 16:49 | 453K | |
![[ ]](/icons/compressed.gif) | ronaszegi_miklos_hinaros_tenger_hu_doc.zip | 2007-03-24 03:00 | 453K | |
![[ ]](/icons/compressed.gif) | crichton_michael_szornyek_szigete_hu_doc.zip | 2007-03-24 02:57 | 453K | |
![[ ]](/icons/compressed.gif) | sheldon_sidney_es_ratort_a_sotetseg_hu_rtf.zip | 2007-03-24 03:00 | 453K | |
![[ ]](/icons/compressed.gif) | X-szárnyúak - 6. Vasököl.zip | 2007-03-26 19:02 | 453K | |
![[ ]](/icons/compressed.gif) | follett_ken_kaland_afganisztanban_hu_rtf.zip | 2007-03-24 02:56 | 453K | |
![[ ]](/icons/compressed.gif) | 50.zip | 2007-08-04 15:31 | 452K | |
![[ ]](/icons/compressed.gif) | allston_aaron_vasokol_hu_doc.zip | 2006-05-31 08:51 | 452K | |
![[ ]](/icons/compressed.gif) | frost_david_ballepesek_konyve_hu_html.zip | 2007-03-24 02:52 | 452K | |
![[ ]](/icons/compressed.gif) | dickens_charles_a_jarndyce-orokosok_rtf.zip | 2007-03-24 02:52 | 452K | |
![[ ]](/icons/compressed.gif) | ordas_ivan_simonyi_obester_hu_doc.zip | 2007-03-24 02:58 | 451K | |
![[ ]](/icons/compressed.gif) | koontz_dean_r_az_arc_hu_doc_nncl3296-73ev1.zip | 2007-03-24 02:52 | 451K | |
![[ ]](/icons/compressed.gif) | fehermagia.zip | 2007-03-24 02:53 | 451K | |
![[ ]](/icons/compressed.gif) | Alice A Bailey-Ertekezes a feher magiarol vagy a tanitvany utja.zip | 2007-03-24 02:49 | 451K | |
![[ ]](/icons/compressed.gif) | banks_iain_m_fegyver_a_kezben_hu_doc_nncl2758-6d9v1.zip | 2007-03-24 02:55 | 451K | |
![[ ]](/icons/compressed.gif) | king_stephen_a_ragyogas_hu_rtf.zip | 2007-03-24 03:00 | 451K | |
![[ ]](/icons/compressed.gif) | fleming_gherbod_gangrel_hu_doc_nncl2769-6dav1.zip | 2007-03-24 02:55 | 450K | |
![[ ]](/icons/compressed.gif) | Frank Herbert-DUNE Eretnekei.zip | 2007-03-24 02:54 | 450K | |
![[ ]](/icons/compressed.gif) | rice_anne_a_testtolvaj_meseje_hu_rtf.zip | 2007-03-24 02:49 | 449K | |
![[ ]](/icons/compressed.gif) | karczag_gyorgy_zugo_nyilak_hu_rtf_nncl739-3f1v1.zip | 2007-03-24 02:56 | 449K | |
![[ ]](/icons/compressed.gif) | ronaszegi_miklos_a kiralyno_kaloza_hu_rtf_nncl2221-649v1.zip | 2007-03-24 03:00 | 449K | |
![[ ]](/icons/compressed.gif) | stirling_s_m_a_hasonmas_hu_rtf_nncl2272-652v1.zip | 2007-03-24 03:00 | 449K | |
![[ ]](/icons/unknown.gif) | osszes71.ace | 2007-03-24 02:56 | 448K | |
![[ ]](/icons/compressed.gif) | coover_robert_az_utolso_itelet_west_condonban_hu_txt.zip | 2007-03-24 02:59 | 448K | |
![[ ]](/icons/compressed.gif) | knopp_guido_hitler_segedei_hu_rtf.zip | 2007-03-24 02:55 | 448K | |
![[ ]](/icons/compressed.gif) | tolsztoj_feltamadas_rtf.zip | 2007-03-24 02:57 | 448K | |
![[ ]](/icons/compressed.gif) | Antonie de Sain-Exuperi--Citadella.zip | 2007-03-24 03:00 | 448K | |
![[ ]](/icons/compressed.gif) | follett_ken_sasok_szarnyan_hu_rtf.zip | 2007-03-24 02:56 | 448K | |
![[SND]](/icons/sound2.gif) | p_20020408.ace | 2007-03-24 02:52 | 447K | |
![[ ]](/icons/unknown.gif) | Lovagi próbák és a finálé - A páncélzat begyűjtés | 2007-05-03 07:30 | 447K | |
![[ ]](/icons/compressed.gif) | feher_klara_a_tenger_1_kotet_hu_doc_nncl3015-708v1.zip | 2007-03-24 02:54 | 447K | |
![[ ]](/icons/compressed.gif) | 16. Magányos Drow.zip | 2007-03-26 18:34 | 447K | |
![[ ]](/icons/compressed.gif) | salvatore_r_a_a_maganyos_drow_hu_rtf.zip | 2006-05-29 05:37 | 447K | |
![[ ]](/icons/compressed.gif) | mcallister_brian_atkozottak_hu_rtf_nncl2722-6cdv1.zip | 2007-03-24 02:52 | 447K | |
![[ ]](/icons/compressed.gif) | stendhal_voros_es_fekete_rtf.zip | 2007-03-24 03:00 | 447K | |
![[ ]](/icons/compressed.gif) | krudy_gyula_nn.zip | 2007-03-24 02:56 | 446K | |
![[ ]](/icons/compressed.gif) | heller_joseph_gold_a_mennybe_megy_hu_rtf.zip | 2007-03-24 02:56 | 446K | |
![[ ]](/icons/compressed.gif) | Riado a naprendszerben-sci-fi irodalom.zip | 2007-03-24 02:59 | 446K | |
![[ ]](/icons/compressed.gif) | 3. Predator 3 Kyle Sternhagen - Predator 2017.zip | 2007-03-23 19:32 | 446K | |
![[ ]](/icons/layout.gif) | szelvagtazok.pdf | 2007-04-15 15:32 | 445K | |
![[ ]](/icons/unknown.gif) | fenykorben.rtf | 2007-11-14 02:07 | 445K | |
![[ ]](/icons/unknown.gif) | Stargate - S. Harrington - Második találkozás a halállal.rtf | 2007-02-25 15:49 | 445K | |
![[TXT]](/icons/text.gif) | csillagok.TXT | 2007-03-24 02:54 | 445K | |
![[ ]](/icons/compressed.gif) | lll_siva_ujra_tancol.zip | 2007-03-20 00:15 | 445K | |
![[ ]](/icons/compressed.gif) | vonnegut_kurt_utopia_14_hu_html.zip | 2007-03-24 02:57 | 445K | |
![[ ]](/icons/compressed.gif) | Kurt Vonnegut - Utopia_14_hu_html.zip | 2006-05-29 07:33 | 445K | |
![[ ]](/icons/compressed.gif) | jokai_mor_szabadsag_a_ho_alatt_html.zip | 2007-03-24 02:56 | 445K | |
![[ ]](/icons/compressed.gif) | 13. A szilánk szolgája.zip | 2007-03-26 18:34 | 445K | |
![[ ]](/icons/compressed.gif) | engel_pal_beilleszkedes_europaba_hu_rtf.zip | 2007-03-24 02:53 | 445K | |
![[ ]](/icons/compressed.gif) | jokai_mor_aranyember_rtf.zip | 2007-03-24 02:56 | 445K | |
![[ ]](/icons/compressed.gif) | vonnegut_kurt_a_hazatlan_ember_hu_doc_nncl2808-6e0v1.zip | 2007-03-24 02:57 | 444K | |
![[TXT]](/icons/text.gif) | A Kl n-12-Tremere.html | 2006-09-19 20:23 | 444K | |
![[ ]](/icons/compressed.gif) | szechenyi_zsigmond_denaturalt_afrika_hu_rtf_nncl2114-636v1.zip | 2007-03-24 03:00 | 444K | |
![[ ]](/icons/unknown.gif) | Kurt Vonnegut,JR-Bajnok reggelije | 2007-03-24 02:57 | 444K | |
![[ ]](/icons/unknown.gif) | lee_carroll_-_kryon_3.rtf | 2007-03-24 02:53 | 443K | |
![[ ]](/icons/compressed.gif) | robbins_david_patkanyhaboru_hu_rtf_nncl2648-6bav1.zip | 2007-03-24 02:52 | 443K | |
![[ ]](/icons/compressed.gif) | illyes_gyula_hunok_parisban_html.zip | 2007-03-24 02:55 | 443K | |
![[ ]](/icons/compressed.gif) | london_jack_a_majak_kincse_hu_doc.zip | 2007-03-24 02:55 | 443K | |
![[ ]](/icons/compressed.gif) | mora_ferenc_konnyes_konyv.pdf.zip | 2007-03-24 02:58 | 443K | |
![[ ]](/icons/compressed.gif) | styron_william_fekudj_le_sotetben_hu_rtf.zip | 2007-03-24 03:01 | 442K | |
![[ ]](/icons/compressed.gif) | herriot_james_minden_elo_az_eg_alatt_hu_doc.zip | 2007-03-24 02:55 | 442K | |
![[ ]](/icons/compressed.gif) | Tencsenyi-Waldapfel Imre-MITOLOGIA.zip | 2007-03-24 03:00 | 442K | |
![[ ]](/icons/compressed.gif) | frost_david_ballepesek_konyve_hu_txt.zip | 2007-03-24 02:52 | 442K | |
![[ ]](/icons/compressed.gif) | preston_child_az_eltunt_varos_hu_doc_nncl3151-70bv1.zip | 2007-03-24 02:57 | 441K | |
![[ ]](/icons/unknown.gif) | amaszkokunnepe.doc | 2007-04-15 16:55 | 441K | |
![[ ]](/icons/compressed.gif) | salvatore_r_a_a_szilank_szolgaja_hu_rtf.zip | 2006-05-29 05:44 | 440K | |
![[ ]](/icons/compressed.gif) | ludlum-lynds_a_hadesz_faktor_hu_rtf_nncl1903-612v4.zip | 2007-03-24 02:59 | 440K | |
![[ ]](/icons/compressed.gif) | tailor_martha_szivbenulas_hu_doc_nncl3175-70bv1.zip | 2007-03-24 02:57 | 440K | |
![[ ]](/icons/compressed.gif) | cook_robin_vektor_hu_doc.zip | 2007-03-24 03:00 | 440K | |
![[ ]](/icons/compressed.gif) | Nagyfeszültség.zip | 2007-03-24 02:49 | 440K | |
![[ ]](/icons/compressed.gif) | zweig_stefan_stuart_maria_hu_doc_nncl2232-64cv1.zip | 2007-03-24 03:00 | 439K | |
![[ ]](/icons/compressed.gif) | hobb_robin_az_orgyilkos_kuldetese_1_hu_rtf_nncl2329-665v2.zip | 2007-03-24 03:00 | 439K | |
![[ ]](/icons/compressed.gif) | hailey_arthur_nagyfeszultseg_hu_rtf.zip | 2007-03-24 02:49 | 439K | |
![[ ]](/icons/compressed.gif) | Autóváros.zip | 2007-03-24 02:49 | 438K | |
![[ ]](/icons/compressed.gif) | moldova_gyorgy_a_szent_tehen_html.zip | 2007-03-24 02:58 | 438K | |
![[ ]](/icons/compressed.gif) | twain_mark_elet_a_mississippin_hu_rtf.zip | 2007-03-24 02:57 | 438K | |
![[ ]](/icons/compressed.gif) | hassel_sven_gestapo_hu_rtf_nncl1991-61bv1.zip | 2007-03-24 03:00 | 437K | |
![[ ]](/icons/compressed.gif) | Alan O'Connor - Hollóidők.zip | 2007-04-06 11:05 | 437K | |
![[ ]](/icons/compressed.gif) | Wolfgang Jeschke-A teremtes utolso napja.zip | 2007-03-24 03:01 | 437K | |
![[ ]](/icons/compressed.gif) | hughes_ted_a_vasember_hu_doc.zip | 2007-03-24 03:00 | 437K | |
![[ ]](/icons/unknown.gif) | 02 - Alan O'Connor - A halál hét arca.doc | 2007-03-24 02:54 | 437K | |
![[ ]](/icons/compressed.gif) | krudy_gyula_szindbad_a_hajos.zip | 2007-03-24 02:57 | 436K | |
![[ ]](/icons/compressed.gif) | kurti_andras_az_utolso_alkimista_hu_doc.zip | 2007-03-24 02:57 | 436K | |
![[ ]](/icons/unknown.gif) | valaszd.rtf | 2007-11-14 06:38 | 436K | |
![[ ]](/icons/compressed.gif) | Alien 2.zip | 2007-03-24 02:49 | 436K | |
![[ ]](/icons/compressed.gif) | Terence H White-Udv neked,Arthur,nagy kiraly.zip | 2007-03-24 03:00 | 436K | |
![[ ]](/icons/compressed.gif) | jokai_mor_enyim_tied_ove_html.zip | 2007-03-24 02:56 | 435K | |
![[ ]](/icons/compressed.gif) | bisztray_gyula_jokedvu_magyar_tudosok_hu_rtf.zip | 2007-03-24 02:51 | 435K | |
![[ ]](/icons/compressed.gif) | Merle - Libben a szoknya.zip | 2005-06-09 13:57 | 435K | |
![[ ]](/icons/compressed.gif) | hassel_sven_bajtarsak_hu_rtf.zip | 2007-03-24 03:00 | 435K | |
![[ ]](/icons/unknown.gif) | Nemere István - Az utolsó bolygó.rtf | 2006-07-19 21:00 | 434K | |
![[TXT]](/icons/text.gif) | A Kl n-08-Ravnos.html | 2006-09-19 21:07 | 434K | |
![[ ]](/icons/compressed.gif) | kertesz_imre_a_kudarc_pdf.zip | 2007-03-24 02:56 | 434K | |
![[ ]](/icons/compressed.gif) | cronin_a_j_a_mennyorszag_kulcsa_hu_doc.zip | 2007-03-24 02:49 | 434K | |
![[ ]](/icons/unknown.gif) | osszes21.ace | 2007-03-24 02:56 | 434K | |
![[ ]](/icons/compressed.gif) | jones_james_a_vekony_voros_vonal_hu_txt_nncl2330-665v1.zip | 2007-03-24 02:55 | 434K | |
![[ ]](/icons/unknown.gif) | ordog.ace | 2007-03-24 02:52 | 433K | |
![[ ]](/icons/compressed.gif) | kurti_andras_a_zi_harom_kuldetese_hu_doc.zip | 2007-03-24 02:57 | 433K | |
![[ ]](/icons/compressed.gif) | Frank Herbert - A Dűne eretnekei.zip | 2007-03-26 14:46 | 433K | |
![[ ]](/icons/compressed.gif) | petofi_sandor_a_hoher_kotele_pdf.zip | 2007-03-24 02:55 | 433K | |
![[ ]](/icons/compressed.gif) | king_stephen_allattemeto_hu_rtf_nncl2465-68ev2.zip | 2007-03-24 03:00 | 433K | |
![[ ]](/icons/compressed.gif) | brown_dale_az_eg_urai_hu_rtf.zip | 2007-03-24 02:52 | 433K | |
![[ ]](/icons/compressed.gif) | ludlum_robert_a_holcroft_szovetseg_hu_rtf.zip | 2007-03-24 02:59 | 433K | |
![[ ]](/icons/unknown.gif) | A röppencs.ZIP | 2007-03-24 02:52 | 433K | |
![[ ]](/icons/compressed.gif) | hailey_arthur_autovaros_hu_rtf.zip | 2007-03-24 02:49 | 432K | |
![[ ]](/icons/compressed.gif) | jokai_mor_aranyember_doc.zip | 2007-03-24 02:56 | 432K | |
![[ ]](/icons/compressed.gif) | follett_ken_a_tu_a_szenakazalban_hu_rtf.zip | 2007-03-24 02:56 | 432K | |
![[ ]](/icons/unknown.gif) | a_b_cee_star_why_hu_doc.zip2 | 2007-03-24 03:00 | 432K | |
![[ ]](/icons/compressed.gif) | weis_hickman_az_oszi_alkony_sarkanyai_hu_rtf.zip | 2007-03-24 03:01 | 432K | |
![[ ]](/icons/unknown.gif) | osszes74.ace | 2007-03-24 02:56 | 432K | |
![[ ]](/icons/compressed.gif) | werfel_franz_bernadette_hu_txt.zip | 2007-03-24 02:54 | 431K | |
![[ ]](/icons/compressed.gif) | pirsig_robert_a_zen_es_a_motorkerekparapolas_muveszete_rtf.zip | 2007-03-24 02:59 | 431K | |
![[ ]](/icons/compressed.gif) | berger_john_g_hu_doc.zip | 2007-03-24 02:56 | 431K | |
![[ ]](/icons/compressed.gif) | hasek_jaroslav_dekameron_hu_doc_nncl3061-706v1.zip | 2007-03-24 02:56 | 431K | |
![[ ]](/icons/unknown.gif) | szep_uj_vilag.rtf | 2007-11-14 02:43 | 431K | |
![[ ]](/icons/unknown.gif) | brunner_john_teljes_napfogyatkozas.rtf | 2007-11-14 09:46 | 431K | |
![[ ]](/icons/compressed.gif) | gibson_william_trendvadasz_hu_doc_nncl2502-692v1.zip | 2007-03-24 03:01 | 431K | |
![[ ]](/icons/compressed.gif) | dilov_ljuben_az_ikarosz_utja_hu_rtf.zip | 2007-03-24 02:57 | 431K | |
![[ ]](/icons/compressed.gif) | kiss_jozsef_laszlo_parancsolsz_egy_kezigranatot_hu_rtf.zip | 2007-03-24 02:56 | 430K | |
![[ ]](/icons/compressed.gif) | Arthur király.zip | 2007-03-24 02:49 | 430K | |
![[ ]](/icons/unknown.gif) | ogg2b.doc | 2007-11-14 09:09 | 430K | |
![[TXT]](/icons/text.gif) | Dirk Gently Hollisztikus nyomozóirodája.txt | 2007-03-24 02:53 | 430K | |
![[ ]](/icons/unknown.gif) | 04 - Jan Van den Boomen - Lágy szélben lazacszin hold alatt.doc | 2007-04-02 22:08 | 430K | |
![[ ]](/icons/compressed.gif) | asimov_isaac_acelbarlangok_hu_rtf.zip | 2007-03-24 02:55 | 429K | |
![[ ]](/icons/compressed.gif) | Isaac Asimov - Alapítvány sorozat - Acélbarlangok rtf.zip | 2006-05-10 06:49 | 429K | |
![[ ]](/icons/compressed.gif) | Paolini, Christoper - Eragon az örökség.zip | 2007-03-20 13:02 | 429K | |
![[ ]](/icons/compressed.gif) | makkai_sandor_ordogszeker_hu_rtf.zip | 2007-03-24 02:57 | 429K | |
![[TXT]](/icons/text.gif) | a_bolygo_neve_halal.txt | 2007-11-14 04:13 | 429K | |
![[TXT]](/icons/text.gif) | Stephen King-A setét torony 1.htm | 2007-02-13 02:39 | 429K | |
![[ ]](/icons/unknown.gif) | 08 - A farkas-szellem gyermekei (Mese).doc | 2007-03-24 02:54 | 429K | |
![[ ]](/icons/compressed.gif) | knittel_john_abdel_kadir_hu_doc.zip | 2007-03-24 02:56 | 428K | |
![[ ]](/icons/compressed.gif) | Jurij Ritheu-Amikor a bálnák elmennek.zip | 2007-03-24 02:56 | 428K | |
![[ ]](/icons/compressed.gif) | christie_agatha_temetni_veszelyes_hu_doc.zip | 2007-03-24 02:49 | 428K | |
![[ ]](/icons/compressed.gif) | mikszath_kalman_a_jo_palocok_pdf.zip | 2007-03-24 02:57 | 427K | |
![[ ]](/icons/compressed.gif) | sztrugackij_a_b_santa_sors_hu_rtf.zip | 2007-03-24 02:49 | 427K | |
![[ ]](/icons/compressed.gif) | Sztrugackij, Arkagyij és Borisz - Santa_sors_hu_rtf.zip | 2007-02-21 16:39 | 427K | |
![[ ]](/icons/compressed.gif) | kahn_james_a_jedi_visszater.zip | 2007-03-24 02:55 | 427K | |
![[ ]](/icons/compressed.gif) | babits_mihaly_osszegyujtott_versei_html.zip | 2007-03-24 02:55 | 427K | |
![[ ]](/icons/compressed.gif) | Joanne K Rowling-Harry Potter es a Titkok kamraja.zip | 2007-03-24 02:55 | 427K | |
![[ ]](/icons/unknown.gif) | osszes65.ace | 2007-03-24 02:56 | 427K | |
![[ ]](/icons/compressed.gif) | Lang Attila D-Nicky.zip | 2007-03-24 02:57 | 426K | |
![[ ]](/icons/compressed.gif) | steinbeck_john_erik_a_gyumolcs_rtf.zip | 2007-03-24 02:56 | 426K | |
![[ ]](/icons/compressed.gif) | mora_ferenc_rab_ember_fiai.pdf.zip | 2007-03-24 02:58 | 426K | |
![[ ]](/icons/compressed.gif) | hassel_sven_lanctalpak_hu_rtf.zip | 2007-03-24 03:00 | 426K | |
![[ ]](/icons/unknown.gif) | csendesbolygo.rtf | 2007-11-14 08:04 | 426K | |
![[ ]](/icons/compressed.gif) | clarke_arthur_c_foldfeny_hu_doc_nncl2468-68ev1.zip | 2007-03-24 02:49 | 425K | |
![[ ]](/icons/compressed.gif) | riado.zip | 2007-08-04 14:28 | 425K | |
![[ ]](/icons/compressed.gif) | hamilton_laurell_k_telihold_kavezo_hu_rtf.zip | 2007-03-24 02:57 | 424K | |
![[ ]](/icons/compressed.gif) | harrington_william_az_ezredes_hu_doc.zip | 2007-03-24 03:01 | 424K | |
![[ ]](/icons/unknown.gif) | ZILAHY.DOC | 2007-03-24 02:59 | 424K | |
![[ ]](/icons/compressed.gif) | Merle - Malevil.zip | 2005-06-09 14:04 | 423K | |
![[ ]](/icons/compressed.gif) | marai_sandor_naplo_1945_1957_hu_rtf_nncl2586-6aav1.zip | 2007-03-24 02:57 | 423K | |
![[ ]](/icons/compressed.gif) | foster_alan_dean_catalysator_hu_doc_nncl3004-704v1.zip | 2007-03-24 02:49 | 423K | |
![[ ]](/icons/compressed.gif) | mcallister_brian_kitaszitottak_hu_rtf_nncl2732-6d3v1.zip | 2007-03-24 02:52 | 422K | |
![[ ]](/icons/compressed.gif) | lolita.zip | 2007-03-24 03:01 | 422K | |
![[ ]](/icons/compressed.gif) | jokai_mor_a_lelekidomar_html.zip | 2007-03-24 02:56 | 422K | |
![[ ]](/icons/unknown.gif) | alien_3.rtf | 2007-11-14 03:04 | 422K | |
![[ ]](/icons/compressed.gif) | a_b_cee_a_roppencs.hu_doc.zip | 2007-03-24 02:49 | 422K | |
![[ ]](/icons/compressed.gif) | darlton_clark_hadesz_a_szamuzottek_vilaga_hu_doc_nncl2605-6b0v1.zip | 2007-03-24 02:52 | 422K | |
![[ ]](/icons/compressed.gif) | herbert_frank_dune_gyermekei_hu_rtf.zip | 2007-03-24 02:54 | 421K | |
![[ ]](/icons/layout.gif) | tt2005_a_profeta.pdf | 2007-04-15 16:38 | 421K | |
![[ ]](/icons/compressed.gif) | Michael Crichton - Szörnyek szigete hu doc.zip | 2007-02-21 16:48 | 421K | |
![[ ]](/icons/compressed.gif) | wagner_r.zip | 2007-03-24 02:58 | 421K | |
![[ ]](/icons/compressed.gif) | drake_david_a_tor_hu_doc.zip | 2007-03-24 02:52 | 421K | |
![[ ]](/icons/compressed.gif) | wilder_thornton_a_teremtes_nyolcadik_napja_hu_rtf_nncl1889-610v2.zip | 2007-03-24 03:00 | 420K | |
![[ ]](/icons/compressed.gif) | bulgakov_mihail_a_mester_es_margarita_hu_rtf.zip | 2007-03-24 02:57 | 420K | |
![[ ]](/icons/compressed.gif) | Mihail Bulgakov-A mester es Margarita.zip | 2007-03-24 02:57 | 420K | |
![[ ]](/icons/compressed.gif) | Isaac Asimov - Robotok és birodalom.zip | 2007-03-22 05:30 | 420K | |
![[ ]](/icons/compressed.gif) | fust_milan_osszes_versei_html.zip | 2007-03-24 02:54 | 420K | |
![[ ]](/icons/compressed.gif) | christe_agatha_az_ackyord_gyilkossag_hu_doc.zip | 2007-03-24 02:49 | 420K | |
![[ ]](/icons/compressed.gif) | moricz_zsigmond_valogatott_elbeszelesek_rtf.zip | 2007-03-24 02:58 | 420K | |
![[ ]](/icons/compressed.gif) | Merle - Csikoeveink.zip | 2005-06-09 13:57 | 420K | |
![[ ]](/icons/compressed.gif) | gorkij_maxim_inasevek-az_en_egyetemeimrtf.zip | 2007-03-24 02:57 | 419K | |
![[ ]](/icons/compressed.gif) | Isaac Asimov-Alapitvany Pereme 1-2.zip | 2007-03-24 02:55 | 419K | |
![[ ]](/icons/compressed.gif) | merle_robert_liliom_es_bibor_hu_txt.zip | 2007-03-24 02:59 | 419K | |
![[ ]](/icons/compressed.gif) | archer_jeffrey_parbaj_hu_rtf_nncl2023-623v1.zip | 2007-03-24 02:56 | 419K | |
![[ ]](/icons/compressed.gif) | doyle_arthur_conan_sherlock_holmes_emlekiratai_hu_doc_nncl2833-6e8v1.zip | 2007-03-24 02:49 | 418K | |
![[ ]](/icons/compressed.gif) | Stone, Jeffrey - Az éj_istene.zip | 2007-03-26 19:08 | 418K | |
![[ ]](/icons/compressed.gif) | Legendák és enigmák 1.zip | 2007-04-06 11:04 | 418K | |
![[ ]](/icons/compressed.gif) | koontz_dean_r_a_retteges_ajtaja_hu_doc_nncl2532-69cv1.zip | 2007-03-24 02:52 | 418K | |
![[ ]](/icons/compressed.gif) | conrad_joseph_az_arnyeksav_hu_doc_nncl2604-6aev1.zip | 2007-03-24 02:56 | 418K | |
![[ ]](/icons/compressed.gif) | nabokov_vladimir_lolita.zip | 2007-03-24 03:01 | 417K | |
![[ ]](/icons/compressed.gif) | stover_matthew_star_wars_a_sith-ek_bosszuja_hu_rtf.zip | 2007-03-24 02:54 | 417K | |
![[ ]](/icons/compressed.gif) | salgari_emilio_a_fekete_kaloz_hu_doc.zip | 2007-03-24 02:53 | 417K | |
![[ ]](/icons/unknown.gif) | farmer_philip_jose_fenevadak_hu_rtf.rtf | 2007-11-14 06:58 | 417K | |
![[ ]](/icons/compressed.gif) | mikszath_kalman_a_sipsirica_pdf.zip | 2007-03-24 02:57 | 417K | |
![[ ]](/icons/compressed.gif) | tolkien_a_gyuruk_ura_a_kiraly_visszater_hu_doc.zip | 2007-03-24 02:54 | 416K | |
![[ ]](/icons/compressed.gif) | mikszath_kalman_tot_atyafiak_pdf.zip | 2007-03-24 02:58 | 416K | |
![[ ]](/icons/compressed.gif) | heller_david_kedves_isten_hu_doc.zip | 2007-03-24 02:53 | 416K | |
![[ ]](/icons/compressed.gif) | harrer_heinrich_het_ev_tibetben_hu_doc.zip | 2007-03-24 02:55 | 416K | |
![[ ]](/icons/compressed.gif) | Robert James Waller-Madison megye hidjai.zip | 2007-03-24 02:59 | 416K | |
![[ ]](/icons/unknown.gif) | osszes33.ace | 2007-03-24 02:56 | 416K | |
![[ ]](/icons/compressed.gif) | Samanpech-Mine Myo.zip | 2007-03-24 02:53 | 415K | |
![[ ]](/icons/compressed.gif) | mcallister_brian_tulelok_hu_rtf_nncl2686-6c4v1.zip | 2007-03-24 02:52 | 415K | |
![[ ]](/icons/compressed.gif) | lanoux_armand_watrin_ornagy_hu_doc_nncl1919-614v1.zip | 2007-03-24 02:49 | 415K | |
![[ ]](/icons/compressed.gif) | jokai_anna_az_egyuttlet-a_tove_es_a_gallya_html.zip | 2007-03-24 02:56 | 415K | |
![[ ]](/icons/compressed.gif) | jokai_mor_a_locsei_feher_asszony_rtf.zip | 2007-03-24 02:56 | 414K | |
![[ ]](/icons/unknown.gif) | Douglas Adams - Az Elet, a Vilagmindenseg, meg Minden.rtf | 2002-09-19 09:03 | 414K | |
![[ ]](/icons/compressed.gif) | merle_robert_majomabece_hu_doc.zip | 2007-03-24 02:59 | 414K | |
![[ ]](/icons/compressed.gif) | london_jack_a_nap_fia_hu_doc_nncl2488-68ev1.zip | 2007-03-24 02:55 | 414K | |
![[ ]](/icons/compressed.gif) | muller_peter_kigyo_es_kereszt_hu_doc_nncl3204-719v1.zip | 2007-03-24 02:58 | 414K | |
![[ ]](/icons/compressed.gif) | shelby_philip_ezermester_hu_rtf_nncl3152-70bv1.zip | 2007-03-24 02:58 | 414K | |
![[ ]](/icons/compressed.gif) | jokai_mor_karpathy_zoltan_html.zip | 2007-03-24 02:56 | 414K | |
![[ ]](/icons/compressed.gif) | jokai_mor_nevtelen_var_rtf.zip | 2007-03-24 02:56 | 414K | |
![[ ]](/icons/compressed.gif) | cook_robin_vaksag_hu_doc.zip | 2007-03-24 03:00 | 414K | |
![[ ]](/icons/compressed.gif) | mora_ferenc_hannibal_foltamasztasa.pdf.zip | 2007-03-24 02:58 | 414K | |
![[ ]](/icons/unknown.gif) | LANDO.RTF | 2007-03-24 02:54 | 413K | |
![[ ]](/icons/compressed.gif) | Weores Sandor-Psyche.zip | 2007-03-24 02:55 | 413K | |
![[ ]](/icons/compressed.gif) | Makrai Tibor Istvan-Tuleloiskola.zip | 2007-03-24 02:57 | 413K | |
![[ ]](/icons/compressed.gif) | Hamvas Bela-A baberliget,Hexakumion.zip | 2007-03-24 02:53 | 413K | |
![[ ]](/icons/compressed.gif) | augustinus_vallomasok.zip | 2007-03-24 02:49 | 412K | |
![[ ]](/icons/compressed.gif) | Augustinus-Vallomasok.zip | 2007-03-24 02:49 | 412K | |
![[ ]](/icons/compressed.gif) | feynman_richard_p_trefal_feynman_ur_hu_rtf_nncl2509-694v1.zip | 2007-03-24 02:59 | 412K | |
![[ ]](/icons/compressed.gif) | carlson_kathy_szexvadaszok_hu_doc_nncl3258-732v1.zip | 2007-03-24 02:56 | 412K | |
![[ ]](/icons/compressed.gif) | hobb_robin_a_kiraly_orgyilkosa_hu_rtf_nncl2282-65cv2.zip | 2007-03-24 03:00 | 412K | |
![[ ]](/icons/layout.gif) | Utazások.pdf | 2007-04-15 16:46 | 412K | |
![[ ]](/icons/unknown.gif) | osszes24.ace | 2007-03-24 02:56 | 412K | |
![[ ]](/icons/compressed.gif) | moldova_gyorgy_szent_imre_indulo-elhuzodo_szuzesseg_html.zip | 2007-03-24 02:58 | 411K | |
![[ ]](/icons/compressed.gif) | london_jack_messze_foldon_rtf.zip | 2007-03-24 02:55 | 411K | |
![[ ]](/icons/unknown.gif) | osszes37.ace | 2007-03-24 02:56 | 411K | |
![[ ]](/icons/compressed.gif) | fitzgerald_f_scott_az_olomkristaly_hu_doc_nncl2896-6f3v1.zip | 2007-03-24 02:54 | 411K | |
![[ ]](/icons/compressed.gif) | szabo_magda_regimodi_tortenet_html.zip | 2007-03-24 03:00 | 410K | |
![[ ]](/icons/compressed.gif) | Carson McCullers-Maganyos vadasz a sziv.zip | 2007-03-24 02:52 | 410K | |
![[ ]](/icons/compressed.gif) | crichton_michael_idovonal_hu_rtf.zip | 2007-03-24 02:57 | 410K | |
![[ ]](/icons/compressed.gif) | Michael Crichton - Idővonal hu rtf.zip | 2007-02-21 16:17 | 410K | |
![[ ]](/icons/compressed.gif) | merle_robert_madrapur_hu_doc.zip | 2007-03-24 02:59 | 409K | |
![[ ]](/icons/compressed.gif) | Isaac Asimov - Alapítvány sorozat - Alapitvany es fold hu rtf.zip | 2006-05-10 07:16 | 409K | |
![[ ]](/icons/compressed.gif) | keyes_daniel_szep_almokat_billy_hu_doc_nncl3020-708v1.zip | 2007-03-24 02:52 | 409K | |
![[ ]](/icons/compressed.gif) | lll_a_kicsik.zip | 2007-03-20 00:17 | 409K | |
![[ ]](/icons/compressed.gif) | marai_sandor_egy_polgar_vallomasai_hu_rtf_nncl2498-692v1.zip | 2007-03-24 02:57 | 409K | |
![[ ]](/icons/compressed.gif) | Isaac Asimov-Alapitvany es Fold.zip | 2007-03-24 02:55 | 409K | |
![[ ]](/icons/unknown.gif) | Helstáb Wonk.doc | 2005-07-07 10:32 | 409K | |
![[ ]](/icons/compressed.gif) | farkashazy_tivadar_a_kek_mauritius_hu_txt_nncl3176-70dv1.zip | 2007-03-24 02:54 | 408K | |
![[ ]](/icons/compressed.gif) | griffin_w_e_b_a_haboru_katonai_5_hu_rtf_nncl3289-73ev1.zip | 2007-03-24 03:01 | 408K | |
![[ ]](/icons/compressed.gif) | morrell_david_a_rozsa_szovetsege_hu_rtf.zip | 2007-03-24 02:52 | 408K | |
![[ ]](/icons/compressed.gif) | zola_emile_a_patkanyfogo_rtf.zip | 2007-03-24 02:53 | 408K | |
![[ ]](/icons/compressed.gif) | balzac_honore_de_chabert_ezredes_es_mas_elbeszelesek_rtf.zip | 2007-03-24 02:55 | 407K | |
![[ ]](/icons/compressed.gif) | roger_macbride_allen_inferno.zip | 2007-08-04 14:21 | 407K | |
![[TXT]](/icons/text.gif) | A Kl n-02-Tzimisce.html | 2006-09-19 21:00 | 406K | |
![[ ]](/icons/compressed.gif) | king_stephen_a_tuzgyujto_hu_rtf.zip | 2007-03-24 03:00 | 406K | |
![[ ]](/icons/compressed.gif) | Stephen King - A tuzgyujto_hu_rtf.zip | 2006-05-28 01:13 | 406K | |
![[ ]](/icons/compressed.gif) | mccullers_carson_maganyos_vadasz_a_sziv_hu_rtf.zip | 2007-03-24 02:52 | 406K | |
![[TXT]](/icons/text.gif) | A Kl n-05-Venture.html | 2006-09-19 21:02 | 406K | |
![[ ]](/icons/compressed.gif) | marai_sandor_naplo_1958_1967_hu_rtf_nncl2662-6c0v1.zip | 2007-03-24 02:57 | 406K | |
![[ ]](/icons/compressed.gif) | Carasoni_J-A feher magus.zip | 2007-03-24 02:52 | 406K | |
![[ ]](/icons/compressed.gif) | moricz_zsigmond_tunderkert_rtf.zip | 2007-03-24 02:58 | 406K | |
![[ ]](/icons/compressed.gif) | balzac_honore_de_betti_neni_rtf.zip | 2007-03-24 02:55 | 406K | |
![[ ]](/icons/compressed.gif) | Farley Mowat-A sarkvidek robinzonjai.zip | 2007-03-24 02:54 | 406K | |
![[ ]](/icons/compressed.gif) | may_karl_a_bosszu_hu_rtf.zip | 2007-03-24 02:56 | 406K | |
![[ ]](/icons/compressed.gif) | forsyth_frederick_kozvetito_hu_rtf.zip | 2007-03-24 02:54 | 406K | |
![[ ]](/icons/compressed.gif) | niemayer_stefan_a_nacik_aranya_hu_doc_nncl2957-6fav1.zip | 2007-03-24 03:00 | 405K | |
![[ ]](/icons/compressed.gif) | king_stephen_holtsav_hu_rtf.zip | 2007-03-24 03:00 | 405K | |
![[ ]](/icons/compressed.gif) | erdody_janos_haromkiralyok_szolgaja_hu_rtf.zip | 2007-03-24 02:53 | 405K | |
![[ ]](/icons/compressed.gif) | Merle - A sziget.zip | 2005-06-09 13:57 | 405K | |
![[ ]](/icons/compressed.gif) | foster_alan_dean_a_bolygo_neve_halal_hu_rtf_txt.zip | 2007-03-24 02:49 | 405K | |
![[ ]](/icons/compressed.gif) | Jane Austen-Ertelem es erzelem.zip | 2007-03-24 02:56 | 405K | |
![[ ]](/icons/compressed.gif) | fable_vavyan_mogorva_nyar_hu_rtf_nncl3257-72Bv1 .zip | 2007-03-24 03:01 | 405K | |
![[TXT]](/icons/text.gif) | A Kl n-03-Gangrel.html | 2006-09-19 20:58 | 405K | |
![[ ]](/icons/compressed.gif) | krudy_gyula_kanaan_konyve.zip | 2007-03-24 02:56 | 405K | |
![[ ]](/icons/unknown.gif) | lorinc_l_laszlo_a_fold_alatti_piramis_hu_rtf.zip2 | 2007-03-24 02:57 | 404K | |
![[ ]](/icons/compressed.gif) | molnar_gabor_ahol_az_osveny_veget_er_hu_rtf.zip | 2007-03-24 02:58 | 404K | |
![[ ]](/icons/compressed.gif) | preussler_otfried_krabat_a_fekete_malomban_hu_html.zip | 2007-03-24 02:58 | 404K | |
![[ ]](/icons/unknown.gif) | Marton Béla - Utazás a Vénuszra (text only).doc | 2007-11-14 09:07 | 404K | |
![[ ]](/icons/compressed.gif) | kelle_antal_utban_a_mikromechanika_fele_hu_djvu.zip | 2007-03-24 02:56 | 404K | |
![[ ]](/icons/compressed.gif) | koestler_arthur_parbeszed_a_halallal_hu_rtf_nncl3224-722v1.zip | 2007-03-24 02:49 | 404K | |
![[ ]](/icons/compressed.gif) | pressfield_stephen_a_tuz_kapui_hu_rtf_nncl3180-70ev1.zip | 2007-03-24 03:00 | 403K | |
![[ ]](/icons/compressed.gif) | asimov_isaac_alapitvany_es_fold_rtf.zip | 2007-03-24 02:55 | 403K | |
![[ ]](/icons/compressed.gif) | schroder_devrient_wilhelmine_egy_enekesno_emlekiratai_hu_doc_nncl3244-72av1.zip | 2007-03-24 03:00 | 403K | |
![[ ]](/icons/compressed.gif) | bradley_marion_zimmer_kardok_es_boszorkanysag_hu_doc.zip | 2007-03-24 02:57 | 403K | |
![[ ]](/icons/unknown.gif) | rokacsapda.rtf | 2007-03-24 02:57 | 403K | |
![[ ]](/icons/compressed.gif) | land_jon_hajsza_a_virusert_hu_rtf_nncl2926-6f3v1.zip | 2007-03-24 02:56 | 403K | |
![[ ]](/icons/compressed.gif) | STAR WHY-Szolitson csak Bandinak.zip | 2007-03-24 03:00 | 403K | |
![[ ]](/icons/unknown.gif) | 02 - Raoul Renier - Kráni krónika.doc | 2007-03-24 02:54 | 403K | |
![[ ]](/icons/compressed.gif) | si_naj_an_vizparti_tortenet_2_hu_html_nncl2414-67bv1.zip | 2007-03-24 03:00 | 402K | |
![[ ]](/icons/compressed.gif) | brown_dan_digitalis_erod_hu_doc.zip | 2007-03-24 02:52 | 402K | |
![[TXT]](/icons/text.gif) | mary_shelley_frankenstein.txt | 2007-11-14 08:57 | 401K | |
![[ ]](/icons/unknown.gif) | transz.rtf | 2007-11-13 22:18 | 401K | |
![[ ]](/icons/unknown.gif) | a_nagy_keresztes_hadjarat.rtf | 2007-11-14 05:06 | 401K | |
![[ ]](/icons/compressed.gif) | berkesi_andras_baratok_hu_txt.zip | 2007-03-24 02:50 | 401K | |
![[ ]](/icons/compressed.gif) | kicsik.zip | 2007-03-24 02:57 | 401K | |
![[ ]](/icons/compressed.gif) | king_smith_dick_babe_a_bator_kismalac_hu_html_rtf.zip | 2007-03-24 02:52 | 401K | |
![[ ]](/icons/compressed.gif) | may_karl_a_haramia_hu_rtf.zip | 2007-03-24 02:56 | 401K | |
![[ ]](/icons/compressed.gif) | merle_robert_a_gyermekkiraly_hu_txt.zip | 2007-03-24 02:59 | 401K | |
![[ ]](/icons/unknown.gif) | Nemere István - Műkincsrablók a kisbolygón.rtf | 2006-07-19 21:06 | 400K | |
![[ ]](/icons/unknown.gif) | Douglas Adams - Vendéglő a világ végén.rtf | 2006-07-19 18:59 | 400K | |
![[ ]](/icons/compressed.gif) | Jack Vance - Lyonesse II Shuldrun kertje.zip | 2007-03-26 19:34 | 400K | |
![[ ]](/icons/compressed.gif) | cook_robin_mereg_hu_doc.zip | 2007-03-24 02:53 | 400K | |
![[ ]](/icons/compressed.gif) | king_stephen_halalos_arnyek_hu_rtf.zip | 2007-03-24 03:00 | 399K | |
![[ ]](/icons/compressed.gif) | vance_jack_suldrun_kertje_hu_txt.zip | 2007-03-24 02:55 | 399K | |
![[ ]](/icons/unknown.gif) | MARS.DOC | 2007-11-14 05:59 | 399K | |
![[ ]](/icons/compressed.gif) | dallos_sandor_az_ember_nyomaban_hu_doc.zip | 2007-03-24 02:52 | 399K | |
![[ ]](/icons/unknown.gif) | osszes59.ace | 2007-03-24 02:56 | 398K | |
![[ ]](/icons/compressed.gif) | vidal_gore_washington_dc_hu_doc.zip | 2007-03-24 02:55 | 398K | |
![[ ]](/icons/compressed.gif) | George Orwell - 1984.zip | 2006-05-29 05:11 | 398K | |
![[TXT]](/icons/text.gif) | A Kl n-01-Toreador.html | 2006-09-19 19:58 | 397K | |
![[ ]](/icons/unknown.gif) | Rebrant.rtf | 2006-07-20 09:53 | 397K | |
![[ ]](/icons/compressed.gif) | leiber_fritz_a_vandor_hu_rtf.zip | 2007-03-24 02:54 | 397K | |
![[ ]](/icons/compressed.gif) | parker_daniel_duncan_a_kivalasztott_hu_doc_nncl3299-73ev1.zip | 2007-03-24 02:52 | 397K | |
![[ ]](/icons/compressed.gif) | karinthy_frigyes_betegek_es_bolondok.zip | 2007-03-24 02:56 | 397K | |
![[ ]](/icons/compressed.gif) | Ady Endre versei.zip | 2007-03-24 02:55 | 397K | |
![[ ]](/icons/compressed.gif) | laclos_choderlos_de_veszedelmes_viszonyok_hu_rtf.zip | 2007-03-24 02:52 | 397K | |
![[ ]](/icons/unknown.gif) | zuhanas_a_napba.rtf | 2004-06-19 08:33 | 397K | |
![[ ]](/icons/compressed.gif) | follett_ken_egy_ferfi_szentpetervarrol_hu_rtf.zip | 2007-03-24 02:56 | 397K | |
![[ ]](/icons/compressed.gif) | engel_georg_legio_mindhalalig_hu_doc_nncl2153-639v1.zip | 2007-03-24 02:54 | 397K | |
![[ ]](/icons/compressed.gif) | jokai_anna_4447-tartozik_es_kovetel_html.zip | 2007-03-24 02:56 | 397K | |
![[ ]](/icons/compressed.gif) | allston_aaron_liderc_osztag_hu_doc.zip | 2006-05-31 08:50 | 397K | |
![[ ]](/icons/compressed.gif) | nemere_istvan_a_terido_istenei_hu_doc_nncl2163-63cv2.zip | 2007-03-24 02:58 | 396K | |
![[ ]](/icons/compressed.gif) | kube_mcdowell_isaac_asimov_robotvarosa_hu_doc_nncl3070-706v1.zip | 2007-03-24 02:57 | 396K | |
![[ ]](/icons/compressed.gif) | bellow_saul_henderson_az_esokiraly_hu_rtf_nncl1255-4c7v1.zip | 2007-03-24 03:00 | 396K | |
![[ ]](/icons/compressed.gif) | lorre_charles_csontvaz_kis_hibaval_hu_rtf_nncl2857-6efv1.zip | 2007-03-24 02:52 | 396K | |
![[ ]](/icons/compressed.gif) | jokai_mor_dekameron_html.zip | 2007-03-24 02:56 | 396K | |
![[ ]](/icons/compressed.gif) | Arkagyij Sz,Boris Sz-Piknik a senki foldjen.zip | 2007-03-24 02:49 | 396K | |
![[ ]](/icons/compressed.gif) | Zsoldos Peter-A Viking visszater.zip | 2007-03-24 03:01 | 395K | |
![[ ]](/icons/compressed.gif) | christie_agatha_paddinton_1650_hu_doc.zip | 2007-03-24 02:49 | 395K | |
![[ ]](/icons/compressed.gif) | jokai_mor_fekete_gyemantok_rtf.zip | 2007-03-24 02:56 | 394K | |
![[ ]](/icons/compressed.gif) | tolsztoj_szevasztopoli_elbeszelesek_rtf.zip | 2007-03-24 02:57 | 394K | |
![[ ]](/icons/compressed.gif) | Gyurkovics Zoltan-A Capetingek genealogiaja es heraldikaja.zip | 2007-03-24 02:55 | 394K | |
![[ ]](/icons/compressed.gif) | vance_jack_a_zold_gyongy_hu_txt.zip | 2007-03-24 02:55 | 394K | |
![[ ]](/icons/compressed.gif) | nance_john_j_konyortelen_kuldetes_hu_doc_nncl2765-6d9v1.zip | 2007-03-24 02:56 | 394K | |
![[ ]](/icons/compressed.gif) | mayes_frances_napsutotte_toscana_hu_doc_nncl2552-6a2v1.zip | 2007-03-24 02:54 | 394K | |
![[ ]](/icons/compressed.gif) | utazz_velunk_tevekaravannal.zip | 2007-03-24 02:57 | 394K | |
![[ ]](/icons/compressed.gif) | lll_utazz_velunk_tevekaravannal.zip | 2007-03-20 00:09 | 394K | |
![[ ]](/icons/compressed.gif) | Harcjatek_javitott.zip | 2007-08-04 14:41 | 394K | |
![[ ]](/icons/compressed.gif) | a_b_cee_star_why.zip | 2006-05-08 02:19 | 393K | |
![[ ]](/icons/layout.gif) | [KER]- (2) Váratlan vendég.pdf | 2007-04-15 15:46 | 393K | |
![[ ]](/icons/compressed.gif) | szakaly_ferenc_viragkor_es_hanyatlas_hu_rtf.zip | 2007-03-24 03:00 | 393K | |
![[ ]](/icons/compressed.gif) | a_b_cee_star_why_hu_doc.zip | 2007-03-24 02:49 | 393K | |
![[ ]](/icons/compressed.gif) | oates_joyce_carol_norman_es_a_gyilkos_hu_rtf.zip | 2007-03-24 03:00 | 393K | |
![[ ]](/icons/compressed.gif) | Jane Austen-Buszkeseg es balitelet.zip | 2007-03-24 02:56 | 393K | |
![[ ]](/icons/compressed.gif) | Gibson, William - Idoru.zip | 2007-02-21 16:30 | 392K | |
![[ ]](/icons/compressed.gif) | Nemere István - A hidra_hadmuvelet_hu_rtf.zip | 2007-03-26 17:41 | 392K | |
![[ ]](/icons/compressed.gif) | szilvasi_lajos_appassionata_hu_rtf.zip | 2007-03-24 03:00 | 392K | |
![[ ]](/icons/compressed.gif) | simak_clifford_d_az_emberfarkas_elv_hu_rtf.zip | 2007-03-24 02:52 | 392K | |
![[ ]](/icons/layout.gif) | Fajok.pdf | 2007-05-03 06:38 | 392K | |
![[ ]](/icons/compressed.gif) | Conor Gearty-Terror.zip | 2007-03-24 02:52 | 391K | |
![[ ]](/icons/compressed.gif) | capote_truman_hidegverrel_hu_rtf_nncl2152-639v1.zip | 2007-03-24 03:00 | 391K | |
![[ ]](/icons/compressed.gif) | Isaac Asimov - Alapítvány sorozat - Az Alapítvány pereme 1-2 rtf.zip | 2006-05-10 17:06 | 391K | |
![[ ]](/icons/compressed.gif) | Vojth Peter asztrologiai tanulmanyai.zip | 2007-03-24 03:01 | 391K | |
![[ ]](/icons/compressed.gif) | gibson.zip | 2007-03-24 03:01 | 391K | |
![[ ]](/icons/compressed.gif) | garber_joseph_r_fuggoleges_rohanas_hu_rtf.zip | 2007-03-24 02:56 | 391K | |
![[ ]](/icons/compressed.gif) | Isaac Asimov - A félvér elbeszélések.zip | 2007-03-21 21:38 | 391K | |
![[ ]](/icons/compressed.gif) | cook_robin_szoktetes_hu_doc.zip | 2007-03-24 03:00 | 390K | |
![[ ]](/icons/compressed.gif) | jokai_anna_ne_feljetek_html.zip | 2007-03-24 02:56 | 390K | |
![[ ]](/icons/compressed.gif) | koontz_dean_r_virrasztok_hu_rtf_nncl2430-683v2.zip | 2007-03-24 02:52 | 390K | |
![[ ]](/icons/compressed.gif) | anderson_poul_a_torott_kard_hu_doc.zip | 2007-03-24 02:54 | 390K | |
![[ ]](/icons/compressed.gif) | Poul Anderson - A törött kard doc.zip | 2006-05-30 22:05 | 390K | |
![[ ]](/icons/compressed.gif) | mora_ferenc_kemenysepro_zsirafok.pdf.zip | 2007-03-24 02:58 | 390K | |
![[ ]](/icons/unknown.gif) | osszes28.ace | 2007-03-24 02:56 | 390K | |
![[ ]](/icons/compressed.gif) | archer_jeffrey_a_tekozlo_lany_hu_rtf_nncl2448-68dv1.zip | 2007-03-24 02:56 | 389K | |
![[TXT]](/icons/text.gif) | crichton_michael_az_atprogramozott_ember.htm | 2007-11-14 09:30 | 389K | |
![[ ]](/icons/compressed.gif) | taylor_susan_g_indian_ver_hu_doc_nncl2210-648v1.zip | 2007-03-24 03:00 | 388K | |
![[ ]](/icons/compressed.gif) | fable_vavyan_my_fair_lord_hu_txt_nncl2428-683v1.zip | 2007-03-24 03:01 | 388K | |
![[ ]](/icons/compressed.gif) | Alan Dean Foster-A DOLOG.zip | 2007-03-24 02:49 | 388K | |
![[ ]](/icons/layout.gif) | az_abbitmester_nyomában.pdf | 2007-04-15 16:36 | 388K | |
![[ ]](/icons/compressed.gif) | molnar_gabor_makk_es_jaguar_hu_rtf.zip | 2007-03-24 02:58 | 388K | |
![[ ]](/icons/unknown.gif) | wilson_mark_f_terminator_a_leszamolas_hu_rtf.zip2 | 2007-03-24 03:00 | 387K | |
![[ ]](/icons/compressed.gif) | sandstone_gabriel_a_remeny_sirhantja_hu_rtf.zip | 2007-03-24 02:54 | 387K | |
![[ ]](/icons/compressed.gif) | brin_david_az_alapitvany_gyozelme_hu_rtf.zip | 2007-03-24 02:52 | 387K | |
![[ ]](/icons/compressed.gif) | Isaac Asimov nyomaban-Az Alapitvany gyozelme.zip | 2007-03-24 02:55 | 387K | |
![[ ]](/icons/compressed.gif) | Asimov nyomán - Brin - Az Alapítvány győzelme.zip | 2006-12-06 13:42 | 387K | |
![[ ]](/icons/compressed.gif) | verne_jules_sandor_matyas_rtf.zip | 2007-03-24 02:56 | 387K | |
![[ ]](/icons/compressed.gif) | si_naj_an_vizparti_tortenet_1_hu_html_nncl2331-665v1.zip | 2007-03-24 03:00 | 387K | |
![[ ]](/icons/compressed.gif) | lowy_arpad_valogatott_versei_hu_doc_nncl2423-681v1.zip | 2007-03-24 02:57 | 386K | |
![[ ]](/icons/compressed.gif) | pohl_frederik_tul_a_kek_esemenyhorizonton.zip | 2007-03-24 02:54 | 386K | |
![[ ]](/icons/compressed.gif) | csukas_istvan_koltok_ehkoppon_html.zip | 2007-03-24 02:57 | 386K | |
![[TXT]](/icons/text.gif) | A Kl n-09-Malk v.html | 2006-09-19 20:02 | 386K | |
![[ ]](/icons/compressed.gif) | molnar_gabor_jaguarorszagban_hu_rtf.zip | 2007-03-24 02:58 | 386K | |
![[ ]](/icons/compressed.gif) | forbes_colin_duh_hu_rtf_nncl2106-636v1.zip | 2007-03-24 02:52 | 385K | |
![[ ]](/icons/compressed.gif) | follett_ken_alattunk_az_ocean_hu_rtf.zip | 2007-03-24 02:56 | 385K | |
![[ ]](/icons/compressed.gif) | lee_harper_ne_bantsatok_a_feketerigot_hu_rtf.zip | 2007-03-24 02:55 | 385K | |
![[ ]](/icons/compressed.gif) | hamilton_laurell_k_gyilkos_tanc_hu_rtf.zip | 2007-03-24 02:57 | 385K | |
![[ ]](/icons/compressed.gif) | koontz_dean_r_a_tulelo_hu_rtf_nncl2392-674v2.zip | 2007-03-24 02:52 | 385K | |
![[ ]](/icons/compressed.gif) | orwell_george_hodolat_katalonianak_hu_rtf_nncl3227-722v1.zip | 2007-03-24 02:54 | 385K | |
![[ ]](/icons/compressed.gif) | Bradley, Marion Zimmer - Vilagokhaza.zip | 2007-02-21 16:48 | 385K | |
![[ ]](/icons/compressed.gif) | jokai_mor_a_mi_lengyelunk_html.zip | 2007-03-24 02:56 | 385K | |
![[ ]](/icons/compressed.gif) | Ljuben Dilov - Az Ikárosz útja.zip | 2007-03-23 21:46 | 385K | |
![[ ]](/icons/compressed.gif) | gallo_max_a_gyilkosok_ejszakaja_hu_doc_nncl2019-622v2.zip | 2007-03-24 02:57 | 385K | |
![[ ]](/icons/compressed.gif) | Seneca-Jatek az isteni Claudius halalarol.zip | 2007-03-24 03:00 | 385K | |
![[ ]](/icons/compressed.gif) | berkesi_kardos_kopjasok_hu_txt.zip | 2007-03-24 02:50 | 384K | |
![[ ]](/icons/unknown.gif) | majmok.rtf | 2007-11-14 06:11 | 384K | |
![[ ]](/icons/compressed.gif) | cook_robin_laz_hu_doc.zip | 2007-03-24 03:00 | 383K | |
![[ ]](/icons/compressed.gif) | druon_maurice_finom_familiak_hu_doc.zip | 2007-03-24 02:57 | 383K | |
![[ ]](/icons/compressed.gif) | lorenz_konrad_a_civilizalt_emberiseg_8_halalos_bune_hu_rtf_nncl2156-63bv1.zip | 2007-03-24 02:56 | 383K | |
![[ ]](/icons/compressed.gif) | austen_jane_buszkeseg_es_balitelet_html.zip | 2007-03-24 02:56 | 383K | |
![[ ]](/icons/compressed.gif) | Zsoldos Péter - Távoli tűz rtf.zip | 2007-10-21 15:39 | 382K | |
![[ ]](/icons/compressed.gif) | moricz_zsigmond_a_nagy_fejedelem_rtf.zip | 2007-03-24 02:58 | 382K | |
![[ ]](/icons/compressed.gif) | zsoldos_peter_tavoli_tuz.zip | 2007-03-24 03:01 | 382K | |
![[ ]](/icons/compressed.gif) | Frederik Pohl-Tul a kek esemenyhorizonton.zip | 2007-03-24 02:54 | 382K | |
![[ ]](/icons/compressed.gif) | feher_klara_a_tenger_2_kotet_hu_doc_nncl3016-708v1.zip | 2007-03-24 02:54 | 382K | |
![[ ]](/icons/compressed.gif) | moldova_gyorgy_az_orseg_panasza_html.zip | 2007-03-24 02:58 | 382K | |
![[ ]](/icons/compressed.gif) | ujfizika.zip | 2007-03-24 03:00 | 382K | |
![[ ]](/icons/compressed.gif) | kellermann_bernhard_az_alagut_hu_doc_nncl2049-62av1.zip | 2007-03-24 02:50 | 381K | |
![[ ]](/icons/compressed.gif) | molnar_gabor_biborvisko_hu_rtf_nncl2151-639v1.zip | 2007-03-24 02:58 | 381K | |
![[ ]](/icons/compressed.gif) | knaak_richard_a_tuzokado_sarkany_hu_rtf_nncl2829-6e6v1.zip | 2007-03-24 02:59 | 381K | |
![[ ]](/icons/compressed.gif) | Hoffman Istvan-Magyar nyelvjarasok.zip | 2007-03-24 02:55 | 381K | |
![[ ]](/icons/compressed.gif) | Eduard Topol-A birodalom szethullasa.zip | 2007-03-24 02:53 | 381K | |
![[ ]](/icons/compressed.gif) | nemere_istvan_allatkert_a_kozmoszban_hu_doc_nncl3298-73ev1.zip | 2007-03-24 02:58 | 381K | |
![[ ]](/icons/compressed.gif) | collins_max_allan_helyszinelok_holtjatek_hu_doc_nncl3268-732v1.zip | 2007-03-24 02:57 | 380K | |
![[ ]](/icons/compressed.gif) | ArisztoteleszPolitika.zip | 2007-03-24 02:49 | 380K | |
![[ ]](/icons/compressed.gif) | Merle - Liliom es bibor.zip | 2005-05-20 23:28 | 380K | |
![[ ]](/icons/compressed.gif) | Jean-Pierre Davidts-Talalkozas a kisherceggel.zip | 2007-03-24 02:56 | 380K | |
![[ ]](/icons/unknown.gif) | Douglas, Adams - A lélek hosszú sötét teadélutánja.rtf | 2006-07-19 06:43 | 379K | |
![[ ]](/icons/unknown.gif) | fehermagia.rar | 2007-03-24 02:53 | 379K | |
![[ ]](/icons/compressed.gif) | fekete_istvan_hu_hu_doc.zip | 2007-03-24 02:57 | 379K | |
![[ ]](/icons/unknown.gif) | VÉRSZÍN HOLD ALATT.doc | 2007-04-15 15:48 | 379K | |
![[ ]](/icons/compressed.gif) | wallace_irving_a_mindenhato_hu_rtf_nncl2485-68ev1.zip | 2007-03-24 02:55 | 379K | |
![[ ]](/icons/compressed.gif) | tamasi_aron_jegtoro_matyas_hu_doc.zip | 2007-03-24 03:00 | 379K | |
![[ ]](/icons/compressed.gif) | feher_tibor_liderckiraly_hu_doc.zip | 2007-03-24 02:54 | 378K | |
![[ ]](/icons/compressed.gif) | Andre Swarz-Bart--Igazak ivadeka.zip | 2007-03-24 02:49 | 378K | |
![[ ]](/icons/compressed.gif) | Bradley, Marion Zimmer - Kardok es boszorkanysag hu doc.zip | 2006-05-30 21:34 | 378K | |
![[ ]](/icons/compressed.gif) | moravia_alberto_gyilkossag_a_teniszklubban_hu_doc_nncl2906-6f3v1.zip | 2007-03-24 02:49 | 378K | |
![[ ]](/icons/compressed.gif) | irving_clive_a_tengely_hu_rtf.zip | 2007-03-24 02:52 | 378K | |
![[ ]](/icons/compressed.gif) | fekete_gyula_szerelmesek_bolygoja_hu_doc_nncl3058-706v1.zip | 2007-03-24 02:54 | 378K | |
![[ ]](/icons/compressed.gif) | Frederik Pohl-Csernobil.zip | 2007-03-24 02:54 | 378K | |
![[ ]](/icons/compressed.gif) | lawrence_leslie_l_monszun_hu_rtf.zip | 2007-03-24 02:57 | 378K | |
![[ ]](/icons/compressed.gif) | Feher Tibor-Vasjogar.zip | 2007-03-24 02:54 | 378K | |
![[ ]](/icons/compressed.gif) | pohl_frederik_csernobil_hu_rtf.zip | 2007-03-24 02:54 | 377K | |
![[ ]](/icons/compressed.gif) | Frederik Pohl - Csernobil_hu_rtf.zip | 2006-05-29 05:14 | 377K | |
![[ ]](/icons/compressed.gif) | aszlanyi_karoly_haybodyt_nem_lehet_agyonutni_hu_doc_nncl2956-6fav1.zip | 2007-03-24 02:49 | 377K | |
![[ ]](/icons/compressed.gif) | vance_jack_madouc_hu_txt.zip | 2007-03-24 02:55 | 377K | |
![[ ]](/icons/compressed.gif) | rufus_q_curtius_a_makedon_nagy_sandor_tortenete_hu_doc.zip | 2007-03-24 02:58 | 377K | |
![[ ]](/icons/unknown.gif) | austen_jane_ertelem_es_erzelem.rar | 2007-03-24 02:56 | 377K | |
![[ ]](/icons/compressed.gif) | updike_john_az_eastwicki_boszorkanyok_hu_rtf.zip | 2007-03-24 02:56 | 377K | |
![[ ]](/icons/layout.gif) | Reag mélyén.pdf | 2007-04-15 16:56 | 377K | |
![[ ]](/icons/compressed.gif) | megkerulte_lovakat.zip | 2005-09-13 17:35 | 377K | |
![[ ]](/icons/unknown.gif) | osszes57.ace | 2007-03-24 02:56 | 376K | |
![[ ]](/icons/compressed.gif) | zola_emile_tisztes_urihaz_rtf.zip | 2007-03-24 02:53 | 376K | |
![[ ]](/icons/compressed.gif) | fable_vavyan_a_halal_zsoldjaban_hu_rtf_nncl3188-710v1.zip | 2007-03-24 03:01 | 376K | |
![[ ]](/icons/unknown.gif) | A 2 Vatikani Zsinat okmanyai.ZIP | 2007-03-24 02:53 | 376K | |
![[ ]](/icons/compressed.gif) | sagan_carl_korok_es_demonok_hu_html.zip | 2007-03-24 02:52 | 376K | |
![[ ]](/icons/compressed.gif) | lyn-bian_aster_hu_rtf.zip | 2007-03-24 02:58 | 376K | |
![[ ]](/icons/unknown.gif) | ASTER-Q.G..F.LYN-A.F.BIAN.ZIP | 2007-03-24 02:58 | 376K | |
![[ ]](/icons/compressed.gif) | foldrajz.zip | 2007-03-24 02:54 | 376K | |
![[ ]](/icons/compressed.gif) | vonnegut_kurt_viragvasarnap_hu_rtf.zip | 2007-03-24 02:57 | 376K | |
![[ ]](/icons/compressed.gif) | mann_thomas_valogatott_elbeszelesek_rtf.zip | 2007-03-24 03:00 | 376K | |
![[TXT]](/icons/text.gif) | sikfold.htm | 2007-11-14 06:14 | 375K | |
![[ ]](/icons/compressed.gif) | szanto_gyorgy_aranyagacska_hu_rtf.zip | 2007-03-24 03:00 | 375K | |
![[ ]](/icons/compressed.gif) | Michael Crichton - Preda.zip | 2005-09-13 17:32 | 375K | |
![[ ]](/icons/compressed.gif) | Jack Vance - Lyonesse I A zöld gyöngy.zip | 2007-03-26 19:34 | 375K | |
![[ ]](/icons/compressed.gif) | capote_truman_hidegverrel_hu_html_nncl2152-639v1.zip | 2007-03-24 03:00 | 375K | |
![[ ]](/icons/compressed.gif) | mccullers_carson_egy_aranyszem_tukreben_hu_rtf.zip | 2007-03-24 02:52 | 375K | |
![[ ]](/icons/compressed.gif) | Carson McCULLERS-Egy aranyszem tukreben.zip | 2007-03-24 02:52 | 375K | |
![[ ]](/icons/compressed.gif) | stone_jeffrey_latogato_a_sotetsegbol_hu_doc_nncl2807-6e0v1.zip | 2007-03-24 02:58 | 374K | |
![[ ]](/icons/compressed.gif) | maclean_alistair_zsilip_hu_rtf_nncl2624-6b2v1.zip | 2007-03-24 02:49 | 374K | |
![[ ]](/icons/compressed.gif) | forster_e_m_szellem_a_hazban_hu_doc.zip | 2007-03-24 02:53 | 374K | |
![[ ]](/icons/compressed.gif) | miksz.zip | 2007-08-04 15:19 | 373K | |
![[ ]](/icons/compressed.gif) | Niven.zip | 2005-01-23 15:26 | 373K | |
![[ ]](/icons/compressed.gif) | George R. R. Martin - Homokkirályok és más elbeszélések.zip | 2005-01-23 15:12 | 373K | |
![[ ]](/icons/compressed.gif) | Laclos,Choderlos de-Veszedelmes viszonyok.zip | 2007-03-24 02:57 | 373K | |
![[ ]](/icons/unknown.gif) | yan2.rtf | 2007-11-14 05:51 | 373K | |
![[ ]](/icons/compressed.gif) | king_stephen_bilincsben_hu_rtf.zip | 2007-03-24 03:00 | 373K | |
![[ ]](/icons/compressed.gif) | lengyel_denes_regi_magyar_mondak_hu_rtf.zip | 2007-03-24 02:57 | 373K | |
![[ ]](/icons/unknown.gif) | chapman_wayne_a_halal_havaban_hu_doc.zip2 | 2007-03-24 03:01 | 372K | |
![[ ]](/icons/compressed.gif) | walter_georges_attila_fiai_hu_rtf_nncl2618-6b1v1.zip | 2007-03-24 02:54 | 372K | |
![[ ]](/icons/compressed.gif) | Jack Vance - Lyonesse III Madouc.zip | 2007-03-26 19:34 | 372K | |
![[ ]](/icons/compressed.gif) | Gogol,Nyikolaj Vasziljevics-Holt lelkek.zip | 2007-03-24 02:55 | 372K | |
![[ ]](/icons/compressed.gif) | kahn_james_idofolyo_hu_rtf_nncl2138-698v1.zip | 2007-03-24 02:55 | 372K | |
![[ ]](/icons/compressed.gif) | cooper_james_fenimore_de_a_kem_rtf.zip | 2007-03-24 02:52 | 371K | |
![[ ]](/icons/compressed.gif) | Diego-Huarto de Mendoza-Lazarillo De Tormes.zip | 2007-03-24 02:52 | 371K | |
![[ ]](/icons/compressed.gif) | Lazar Ervin-A feher tigris.zip | 2007-03-24 02:57 | 371K | |
![[ ]](/icons/unknown.gif) | FURDES.DOC | 2007-03-24 02:55 | 371K | |
![[ ]](/icons/compressed.gif) | graham_heather_farkasok_ura_hu_doc.zip | 2007-03-24 02:55 | 371K | |
![[ ]](/icons/compressed.gif) | mackie_mary_a_lo_nepe_hun_rtf_nncl211-286v1.zip | 2007-03-24 02:57 | 370K | |
![[ ]](/icons/compressed.gif) | griffin_w_e_b_a_haboru_katonai_2_hu_rtf_nncl3287-73ev1.zip | 2007-03-24 03:01 | 370K | |
![[ ]](/icons/compressed.gif) | forbes_colin_orveny_hu_rtf_nncl2141-638v1.zip | 2007-03-24 02:52 | 370K | |
![[ ]](/icons/compressed.gif) | kosztolanyi_dezso_osszegyujtott_versei_html.zip | 2007-03-24 02:55 | 370K | |
![[ ]](/icons/compressed.gif) | mendoza_lazarillo_de_tormes_hu_doc.zip | 2007-03-24 02:57 | 370K | |
![[ ]](/icons/compressed.gif) | moravia_alberto_kisregenyek_hu_html.zip | 2007-03-24 02:49 | 370K | |
![[ ]](/icons/unknown.gif) | a_birodalom_visszavag.rtf | 2007-03-24 02:54 | 370K | |
![[ ]](/icons/unknown.gif) | 2. Donald F. Glut - A birodalom visszav g.rtf | 2007-01-05 01:33 | 370K | |
![[ ]](/icons/compressed.gif) | christie_agatha_nyaralo_gyilkosok_hu_doc.zip | 2007-03-24 02:49 | 369K | |
![[ ]](/icons/compressed.gif) | heinlein_robert_a_csillagkozi_invazio_hu_doc_nncl3143-70bv1.zip | 2007-03-24 02:59 | 369K | |
![[TXT]](/icons/text.gif) | dick_philip_k_kizokkent_ido.html | 2007-11-14 09:56 | 369K | |
![[ ]](/icons/compressed.gif) | lll_ganesa_gyemantjai.zip | 2007-03-20 00:15 | 369K | |
![[ ]](/icons/compressed.gif) | balint_agnes_mazsola_hu_pdf.zip | 2007-03-24 02:52 | 369K | |
![[ ]](/icons/compressed.gif) | Merle - A gyermekkiraly.zip | 2005-05-20 23:25 | 369K | |
![[ ]](/icons/compressed.gif) | Dan Brown - Angyalok és démonok.zip | 2007-03-20 12:55 | 369K | |
![[ ]](/icons/compressed.gif) | strieber_whitley_verfarkasok_hu_doc.zip | 2007-03-24 02:54 | 369K | |
![[ ]](/icons/compressed.gif) | faludy_gyorgy_pokolbeli_napjaim_utan_html.zip | 2007-03-24 02:55 | 369K | |
![[ ]](/icons/compressed.gif) | kubasik_christopher_a_vagyodas_gyuruje_hu_rtf.zip | 2007-03-24 02:52 | 369K | |
![[ ]](/icons/compressed.gif) | mann_thomas_egy_szelhamos_vallomasai_rtf.zip | 2007-03-24 03:00 | 369K | |
![[ ]](/icons/compressed.gif) | Mamuce Szoszeki-Macska vagyok.zip | 2007-03-24 02:57 | 369K | |
![[ ]](/icons/compressed.gif) | Harry Benjamin-Tokeletes latas.zip | 2007-03-24 02:55 | 368K | |
![[ ]](/icons/compressed.gif) | jekely_endre_fogakkal_es_karmokkal_hu_doc_nncl2453-68ev1.zip | 2007-03-24 02:56 | 368K | |
![[ ]](/icons/unknown.gif) | austen_jane_buszkeseg_es_balitelet_doc.rar | 2007-03-24 02:56 | 368K | |
![[ ]](/icons/compressed.gif) | verne_jules_hatteras_kapitany_rtf.zip | 2007-03-24 02:56 | 368K | |
![[ ]](/icons/compressed.gif) | mora_ferenc_mindenki_janoskaja.pdf.zip | 2007-03-24 02:58 | 368K | |
![[ ]](/icons/unknown.gif) | Douglas Adams - Viszlát és kösz a halakat.rtf | 2006-07-19 06:44 | 368K | |
![[ ]](/icons/compressed.gif) | Graves-En,Claudius.zip | 2007-03-24 02:59 | 368K | |
![[ ]](/icons/compressed.gif) | cook_robin_szelutes_doc_hu_nncl2133-638v1.zip | 2007-03-24 03:00 | 368K | |
![[ ]](/icons/compressed.gif) | Vavyan Fable-Jegtanc.zip | 2007-03-24 03:01 | 367K | |
![[ ]](/icons/compressed.gif) | brown_dale_a_bombazo_hu_rtf.zip | 2007-03-24 02:52 | 367K | |
![[ ]](/icons/compressed.gif) | graves_robert_en_claudius_hu_rtf.zip | 2007-03-24 02:59 | 367K | |
![[ ]](/icons/compressed.gif) | cook_robin_muhiba_hu_rtf.zip | 2007-03-24 03:00 | 367K | |
![[ ]](/icons/compressed.gif) | harris_thomas_fekete_vasarnap_hu_rtf_nncl2925-6f3v1.zip | 2007-03-24 03:00 | 367K | |
![[ ]](/icons/compressed.gif) | marai_sandor_naplo_1968_75_hu_rtf_nncl2973-6fcv1.zip | 2007-03-24 02:57 | 367K | |
![[ ]](/icons/compressed.gif) | homerosz_iliasz.zip | 2007-03-24 02:55 | 367K | |
![[ ]](/icons/compressed.gif) | rasmussen_knud_thulei_utazas_hu_html_nncl2967-6fcv1.zip | 2007-03-24 02:56 | 367K | |
![[ ]](/icons/unknown.gif) | Buddha elete-Szidhaortha Gantama.ZIP | 2007-03-24 02:53 | 367K | |
![[ ]](/icons/compressed.gif) | poitras_tucker_bonnie_a_csend_hangjai_hu_doc_nncl2162-63cv1.zip | 2007-03-24 02:52 | 366K | |
![[ ]](/icons/compressed.gif) | griffin_w_e_b_a_haboru_katonai_6_hu_rtf_nncl3290-73ev1.zip | 2007-03-24 03:01 | 366K | |
![[ ]](/icons/compressed.gif) | crichton_michael_preda_hu_doc.zip | 2007-03-24 02:57 | 366K | |
![[ ]](/icons/compressed.gif) | Jan van den Boomen - Morgena könnyei.zip | 2007-04-06 11:06 | 366K | |
![[ ]](/icons/compressed.gif) | a_tanu.zip | 2007-03-24 02:49 | 366K | |
![[ ]](/icons/compressed.gif) | carcaterra_lorenzo_pokoli_lecke_hu_doc_nncl2188-641v1.zip | 2007-03-24 02:57 | 366K | |
![[ ]](/icons/compressed.gif) | berkesi_andras_szol_a_kakas_mar_hu_txt_nncl2347-667v1.zip | 2007-03-24 02:50 | 366K | |
![[ ]](/icons/compressed.gif) | Feher Bela-Zoldvendeglo.zip | 2007-03-24 02:54 | 366K | |
![[ ]](/icons/compressed.gif) | mauriac_francois_viperafeszek_hu_rtf.zip | 2007-03-24 02:54 | 366K | |
![[ ]](/icons/compressed.gif) | rice_anne_a_karhozottak_kiralynoje_hu_rtf_nncl3186-710v1.zip | 2007-03-24 02:49 | 365K | |
![[ ]](/icons/compressed.gif) | lowell_joan_a_tenger_csodababaja_hu_rtf.zip | 2007-03-24 02:56 | 365K | |
![[ ]](/icons/compressed.gif) | clarke_arthur_c_2010_masodik_urodisszea_hu_rtf.zip | 2007-03-24 02:49 | 365K | |
![[ ]](/icons/unknown.gif) | onvalo.ace | 2007-03-24 02:52 | 365K | |
![[ ]](/icons/unknown.gif) | redivivus_tuzet_ker.rtf | 2007-11-14 04:42 | 365K | |
![[ ]](/icons/compressed.gif) | Császári Vér.zip | 2007-03-24 02:54 | 365K | |
![[ ]](/icons/compressed.gif) | malamud_bernard_a_lakok_isteni_kegyelem_hu_rtf_nncl2045-62av1.zip | 2007-03-24 02:50 | 365K | |
![[ ]](/icons/compressed.gif) | hassel_sven_monte_cassino_hu_rtf.zip | 2007-03-24 03:00 | 365K | |
![[ ]](/icons/compressed.gif) | follett_ken_a_harmadik_iker_hu_rtf.zip | 2007-03-24 02:56 | 364K | |
![[ ]](/icons/compressed.gif) | chapman_wayne_garmacor_cimere_hu_rtf_nncl2682-6c4v1.zip | 2007-03-24 03:01 | 364K | |
![[ ]](/icons/compressed.gif) | hassel_sven_karhozottak_legioja_hu_rtf.zip | 2007-03-24 03:00 | 364K | |
![[ ]](/icons/compressed.gif) | forbes_colin_a_kreml_ugynoke_hu_txt.zip | 2007-03-24 02:52 | 364K | |
![[ ]](/icons/compressed.gif) | David Attenborugh-Az elo bolygo.zip | 2007-03-24 02:52 | 364K | |
![[ ]](/icons/compressed.gif) | marsh_evelyn_a_pokol_tornaca_hu_doc.zip | 2007-03-24 02:53 | 364K | |
![[ ]](/icons/compressed.gif) | grey_zane_vadnyugaton_hu_rtf.zip | 2007-03-24 03:01 | 363K | |
![[ ]](/icons/compressed.gif) | Robin Cook-Koma.zip | 2007-03-24 03:00 | 363K | |
![[ ]](/icons/compressed.gif) | orczy_emma_a_voros_pimpernel_hu_doc.zip | 2007-03-24 02:58 | 363K | |
![[ ]](/icons/compressed.gif) | utazas_a_venuszra.zip | 2007-02-21 16:25 | 363K | |
![[ ]](/icons/compressed.gif) | pohl_frederik_talalkozas_a_hicsikkel_hu_rtf_nncl2942-6f3v1.zip | 2007-03-24 02:54 | 363K | |
![[ ]](/icons/unknown.gif) | KÍnai kancsó.DOC | 2007-03-24 02:55 | 363K | |
![[ ]](/icons/compressed.gif) | christie_agatha_rejtely_az_antillakon_hu_doc_nncl2679-6c3v1.zip | 2007-03-24 02:49 | 363K | |
![[ ]](/icons/compressed.gif) | radiokabare_hu_doc.zip | 2007-03-24 03:00 | 363K | |
![[ ]](/icons/layout.gif) | Üldözési mánia - (The Lady of Paranoia).pdf | 2007-05-03 07:39 | 363K | |
![[ ]](/icons/compressed.gif) | knittel_john_el_hakim_hu_doc.zip | 2007-03-24 02:56 | 363K | |
![[ ]](/icons/compressed.gif) | ganesa_gyemantjai.zip | 2007-03-24 02:57 | 362K | |
![[ ]](/icons/compressed.gif) | asimov_isaac_az_istenek_is_hu_doc.zip | 2007-03-24 02:55 | 362K | |
![[ ]](/icons/unknown.gif) | vegallomas.rtf | 2007-11-14 08:58 | 362K | |
![[ ]](/icons/compressed.gif) | fable_vavyan_vis_major_hu_txt_nncl2429-683v2.zip | 2007-03-24 03:01 | 361K | |
![[ ]](/icons/compressed.gif) | king_stephen_a_napkutya_hu_rtf.zip | 2007-03-24 03:00 | 361K | |
![[ ]](/icons/compressed.gif) | koszegi_imre_a_jezsuitak_vegnapjai_hu_doc.zip | 2007-03-24 02:56 | 361K | |
![[ ]](/icons/compressed.gif) | herzog_arthur_alkuszok_hu_rtf.zip | 2007-03-24 02:49 | 361K | |
![[ ]](/icons/compressed.gif) | rostand_edmond_cyrano_de_bergerac_pdf.zip | 2007-03-24 02:53 | 361K | |
![[ ]](/icons/compressed.gif) | asimov_isaac_halalos_itelet_pdf.zip | 2007-03-24 02:55 | 361K | |
![[ ]](/icons/compressed.gif) | jokai_mor_politikai_divatok_rtf.zip | 2007-03-24 02:56 | 361K | |
![[ ]](/icons/compressed.gif) | Isaac Asimov - (N2) Novellák.zip | 2006-12-13 23:43 | 360K | |
![[ ]](/icons/compressed.gif) | levy_marc_ha_igaz_lenne_hu_rtf.zip | 2007-03-24 02:57 | 360K | |
![[ ]](/icons/compressed.gif) | garcia_marquez_gabriel_szerelem_kolera_idejen_hu_txt.zip | 2007-03-24 02:54 | 360K | |
![[ ]](/icons/compressed.gif) | moldova_gyorgy_malom_a_pokolban-a_valtozasok_orei_html.zip | 2007-03-24 02:58 | 360K | |
![[ ]](/icons/compressed.gif) | rakoczi_ferenc_emlekiratok_pdf.zip | 2007-03-24 02:58 | 360K | |
![[ ]](/icons/compressed.gif) | Marlo Morgan-Vid hiret az orokevalonak.zip | 2007-03-24 02:57 | 360K | |
![[ ]](/icons/compressed.gif) | griffin_eric_tzimisce_hu_doc_nncl2770-6dav1.zip | 2007-03-24 02:53 | 360K | |
![[ ]](/icons/compressed.gif) | harris_thomas_hannibal_hu_rtf.zip | 2007-03-24 03:00 | 360K | |
![[ ]](/icons/unknown.gif) | P. S. York Dzsungelláz.doc | 2005-07-07 12:10 | 360K | |
![[ ]](/icons/compressed.gif) | cook_robin_koma_hu_rtf.zip | 2007-03-24 03:00 | 360K | |
![[ ]](/icons/compressed.gif) | brown_robin_megalodon_hu_doc.zip | 2007-03-24 03:00 | 360K | |
![[ ]](/icons/compressed.gif) | Hoyle, Fred - Osszian küldetése.zip | 2006-05-28 00:45 | 360K | |
![[ ]](/icons/compressed.gif) | vonnegut_kurt_hokusz_pokusz_hu_html.zip | 2007-03-24 02:57 | 360K | |
![[ ]](/icons/unknown.gif) | 4. Torz csillagok.rtf | 2007-03-06 02:18 | 360K | |
![[ ]](/icons/compressed.gif) | Wayne Chapman - Két hold.zip | 2007-03-23 05:21 | 359K | |
![[ ]](/icons/unknown.gif) | kalozok_az_urben.rtf | 2007-03-24 02:58 | 359K | |
![[ ]](/icons/unknown.gif) | Nemere István - Kalózok az űrben.rtf | 2006-07-19 21:06 | 359K | |
![[ ]](/icons/compressed.gif) | zalka_miklos_zugnak_a_harangok_hu_doc_nncl3133-706v1.zip | 2007-03-24 03:01 | 359K | |
![[ ]](/icons/compressed.gif) | crichton_michael_a_gomb_hu_rtf.zip | 2007-03-24 02:57 | 359K | |
![[ ]](/icons/compressed.gif) | Michael Crichton - A gömb hu rtf.zip | 2006-05-10 17:52 | 359K | |
![[ ]](/icons/compressed.gif) | molnar_gabor_az_arany_gobi_kosivatagaban_hu_rtf_nncl2136-638v1.zip | 2007-03-24 02:58 | 358K | |
![[ ]](/icons/unknown.gif) | osszes67.ace | 2007-03-24 02:56 | 358K | |
![[ ]](/icons/compressed.gif) | wallace_lewis_ben_hur_hu_doc_nncl3194-711v1.zip | 2007-03-24 02:57 | 358K | |
![[ ]](/icons/compressed.gif) | hawkwood_ryan_arnyjatek_hu_doc_nncl3293-73ev1.zip | 2007-03-24 03:00 | 358K | |
![[ ]](/icons/compressed.gif) | macbride_allen_roger_kaliban_hu_rtf_nncl2393-674v1.zip | 2007-03-24 03:00 | 358K | |
![[ ]](/icons/compressed.gif) | Arthur C. Clarke - A jövo korvonalai.zip | 2007-02-21 16:37 | 357K | |
![[ ]](/icons/compressed.gif) | John Crisham-A CEG.zip | 2007-03-24 02:56 | 357K | |
![[ ]](/icons/compressed.gif) | grisham_john_a_ceg_hu_rtf.zip | 2007-03-24 02:56 | 357K | |
![[ ]](/icons/unknown.gif) | 0005.rtf | 2007-11-14 05:26 | 357K | |
![[ ]](/icons/compressed.gif) | griffin_w_e_b_a_haboru_katonai_1_hu_rtf_nncl3286-73ev1.zip | 2007-03-24 03:01 | 357K | |
![[ ]](/icons/compressed.gif) | dickens_charles_twist_oliver_rtf.zip | 2007-03-24 02:52 | 356K | |
![[ ]](/icons/compressed.gif) | jokai_mor_szerelem_bolondjai_html.zip | 2007-03-24 02:56 | 356K | |
![[ ]](/icons/compressed.gif) | aldiss_brian_w_irasai.zip | 2007-03-24 02:52 | 356K | |
![[ ]](/icons/compressed.gif) | Francia-Magyar,Magyar-Francia szotar.zip | 2007-03-24 03:00 | 355K | |
![[ ]](/icons/compressed.gif) | fekete_istvan_teli_berek_hu_rtf.zip | 2007-03-24 02:57 | 355K | |
![[ ]](/icons/compressed.gif) | devlin_emmerich_molstad_a_fuggetlenseg_napja_hu_rtf.zip | 2007-03-24 02:52 | 355K | |
![[ ]](/icons/compressed.gif) | marai_sandor_naplo_1943_44_hu_rtf_nncl2541-69dv1.zip | 2007-03-24 02:57 | 355K | |
![[ ]](/icons/compressed.gif) | beckett_simon_a_halal_kemiaja_hu_rtf_nncl2797-6e0v1.zip | 2007-03-24 03:00 | 355K | |
![[TXT]](/icons/text.gif) | Nemere Istvan - A Hegy.txt | 2007-03-24 02:58 | 355K | |
![[ ]](/icons/compressed.gif) | merle_robert_armany_es_cselszoves_hu_txt.zip | 2007-03-24 02:59 | 355K | |
![[ ]](/icons/compressed.gif) | Updike-A kentaur.zip | 2007-03-24 03:00 | 355K | |
![[ ]](/icons/compressed.gif) | wallace_edgar_a_zold_ijasz_hu_doc.zip | 2007-03-24 02:53 | 355K | |
![[ ]](/icons/compressed.gif) | tolsztoj_bal_utan_rtf.zip | 2007-03-24 02:57 | 355K | |
![[ ]](/icons/unknown.gif) | nostrada.ace | 2007-03-24 02:52 | 354K | |
![[ ]](/icons/compressed.gif) | nemere_istvan_szoktetes_a_gestapotol_hu_rtf.zip | 2007-03-24 02:58 | 354K | |
![[ ]](/icons/compressed.gif) | Nemere István - Szoktetes_a_gestapotol_hu_rtf.zip | 2006-05-31 06:31 | 354K | |
![[ ]](/icons/compressed.gif) | shelby_graham_a_penge_ele_hu_rtf_nncl3301-73ev1.zip | 2007-03-24 02:55 | 354K | |
![[ ]](/icons/compressed.gif) | lll_monszun.zip | 2007-03-20 00:14 | 354K | |
![[ ]](/icons/compressed.gif) | Ian Watson - Az Urgardista.zip | 2007-03-26 19:45 | 354K | |
![[ ]](/icons/compressed.gif) | jacoby_arnold_senor_kon-tiki_hu_html_nncl2909-6f3v1.zip | 2007-03-24 02:49 | 354K | |
![[ ]](/icons/compressed.gif) | moran_daniel_keys_a_gyuru_hu_txt.zip | 2007-03-24 02:52 | 353K | |
![[ ]](/icons/compressed.gif) | clarke_arthur_c_a_nagy_zatonyok_kisertete_hu_rtf_nncl2746-6d7v1.zip | 2007-03-24 02:49 | 353K | |
![[ ]](/icons/compressed.gif) | berkesi_andras_jatek_a_tisztesseggel_hu_txt.zip | 2007-03-24 02:50 | 353K | |
![[ ]](/icons/compressed.gif) | hailey_arthur_detektivek_hu_rtf.zip | 2007-03-24 02:49 | 353K | |
![[ ]](/icons/compressed.gif) | sabatini_rafael_blood_kapitany_viszontagsagai_hu_rtf_nncl2267-651v1.zip | 2007-03-24 02:58 | 353K | |
![[ ]](/icons/compressed.gif) | maclean_alistair_a_halal_folyo_hu_rtf.zip | 2007-03-24 02:49 | 353K | |
![[ ]](/icons/compressed.gif) | christie_agatha_gyilkossag_meghirdetve_hu_doc.zip | 2007-03-24 02:49 | 353K | |
![[ ]](/icons/compressed.gif) | kishon_efrajim_a_zanyja_krausz_hu_doc_nncl3069-706v1.zip | 2007-03-24 02:53 | 353K | |
![[ ]](/icons/unknown.gif) | bear_greg_alapitvany_es_kaosz.ZIP | 2007-03-24 02:55 | 353K | |
![[ ]](/icons/compressed.gif) | niven_barnes_alompark_hu_rtf.zip | 2007-03-24 02:58 | 353K | |
![[ ]](/icons/compressed.gif) | MacLean-A halal folyo.zip | 2007-03-24 02:57 | 353K | |
![[ ]](/icons/compressed.gif) | John Griham-A pelikan ugyirat.zip | 2007-03-24 02:56 | 352K | |
![[ ]](/icons/compressed.gif) | Sámánok.zip | 2007-03-24 03:00 | 352K | |
![[ ]](/icons/compressed.gif) | deighton_len_isten_veled_mickey_mouse_hu_rtf.zip | 2007-03-24 02:57 | 352K | |
![[ ]](/icons/compressed.gif) | hailey_arthur_hotel_hu_rtf.zip | 2007-03-24 02:49 | 352K | |
![[ ]](/icons/unknown.gif) | holdv.ace | 2007-03-24 02:52 | 352K | |
![[ ]](/icons/compressed.gif) | camus_albert_kozony_pdf.zip | 2007-03-24 02:49 | 351K | |
![[ ]](/icons/compressed.gif) | forsyth_frederick_a_negyedik_jegyzokonyv_hu_rtf.zip | 2007-03-24 02:54 | 351K | |
![[ ]](/icons/compressed.gif) | marsbeli.zip | 2007-08-04 14:49 | 351K | |
![[ ]](/icons/compressed.gif) | bradbury_ray_marsbeli_kronikak.zip | 2007-03-24 02:59 | 351K | |
![[ ]](/icons/compressed.gif) | twain_mark_jeanne_darc_hu_rtf.zip | 2007-03-24 02:57 | 351K | |
![[ ]](/icons/compressed.gif) | colette_gigi_hu_rtf_nncl2135-638v1.zip | 2007-03-24 02:52 | 351K | |
![[ ]](/icons/compressed.gif) | Zsoldos Péter - A Viking visszatér.doc.zip | 2006-05-31 07:32 | 351K | |
![[ ]](/icons/compressed.gif) | gorkij_maxim_mezitlabasok_rtf.zip | 2007-03-24 02:57 | 351K | |
![[ ]](/icons/compressed.gif) | jokai_mor_mire_megvenulunk_html.zip | 2007-03-24 02:56 | 350K | |
![[ ]](/icons/compressed.gif) | updike_john_a_kentaur_hu_rtf.zip | 2007-03-24 02:56 | 350K | |
![[ ]](/icons/compressed.gif) | hawkwood_ryan_farkasenek_hu_doc_nncl3294-73ev1.zip | 2007-03-24 03:00 | 350K | |
![[ ]](/icons/compressed.gif) | doctorow_e_l_vocsok_to_hu_rtf.zip | 2007-03-24 02:53 | 350K | |
![[ ]](/icons/compressed.gif) | fast_howard_spartacus_hu_rtf.zip | 2007-03-24 02:55 | 350K | |
![[ ]](/icons/compressed.gif) | z_vincze_gyorgy_a_cikoritak_bolygoja_hu_doc.zip | 2007-03-24 03:01 | 350K | |
![[ ]](/icons/compressed.gif) | cronin_a_j_vetlen_vetkes_hu_doc.zip | 2007-03-24 02:49 | 349K | |
![[ ]](/icons/unknown.gif) | Paul Bruton-A joga titkos tanitasai | 2007-03-24 02:58 | 349K | |
![[ ]](/icons/unknown.gif) | osszes04.ace | 2007-03-24 02:56 | 349K | |
![[ ]](/icons/compressed.gif) | Doom a pokol kapui.zip | 2007-03-23 21:39 | 349K | |
![[ ]](/icons/compressed.gif) | Daniel F Josh K-DOOM apokol kapui.zip | 2007-03-24 02:52 | 349K | |
![[ ]](/icons/compressed.gif) | mohas_livia_rokavadaszat_hu_rtf.zip | 2007-03-24 02:58 | 349K | |
![[ ]](/icons/compressed.gif) | Tandari Eva-Kirandulas a pokolba 1-2.zip | 2007-03-24 03:00 | 349K | |
![[ ]](/icons/compressed.gif) | zahn_timothy_az_utolso_parancs_hu_rtf.zip | 2006-05-31 07:57 | 349K | |
![[ ]](/icons/compressed.gif) | Timothy Zahn - Az utolsoparancs.zip | 2006-05-29 07:10 | 349K | |
![[ ]](/icons/compressed.gif) | mcmurtry_larry_cadillac_jack_hu_rtf.zip | 2007-03-24 02:57 | 349K | |
![[ ]](/icons/compressed.gif) | aszody_janos_akcioban_az_interpol_hu_doc_nncl2731-6d3v3.zip | 2007-03-24 02:49 | 348K | |
![[ ]](/icons/unknown.gif) | osszes58.ace | 2007-03-24 02:56 | 348K | |
![[ ]](/icons/compressed.gif) | twain_mark_oneletrajz_rtf.zip | 2007-03-24 02:57 | 348K | |
![[ ]](/icons/compressed.gif) | vojnovics_vlagyimir_csonkin_kozlegeny_hu_html.zip | 2007-03-24 03:01 | 348K | |
![[ ]](/icons/compressed.gif) | hamilton_laurell_k_a_karhozottak_cirkusza_hu_rtf.zip | 2007-03-24 02:57 | 348K | |
![[ ]](/icons/compressed.gif) | asimov_isaac_az_alapitvany_elott.zip | 2007-03-24 02:55 | 348K | |
![[ ]](/icons/compressed.gif) | jokai_mor_a_magyar_nep_elce_html.zip | 2007-03-24 02:56 | 348K | |
![[ ]](/icons/unknown.gif) | Christopher H Wearmouth - Halálnak született.doc | 2007-03-24 02:54 | 348K | |
![[ ]](/icons/compressed.gif) | faux_pierre_orult_ejszakak_hu_pdf.zip | 2007-03-24 02:58 | 348K | |
![[ ]](/icons/compressed.gif) | molnar_gabor_ejbe_zuhant_evek_hu_rtf.zip | 2007-03-24 02:58 | 348K | |
![[ ]](/icons/compressed.gif) | lorincz_l_laszlo_a_nagy_kupola_szegyene_hu_rtf.zip | 2007-03-24 02:57 | 347K | |
![[ ]](/icons/compressed.gif) | london_jack_tengeri_farkas_hu_doc.zip | 2007-03-24 02:55 | 347K | |
![[ ]](/icons/compressed.gif) | Stephen King - Holtsáv.zip | 2007-03-26 15:34 | 347K | |
![[ ]](/icons/compressed.gif) | jokai_mor_a_regi_jo_tablabirak_html.zip | 2007-03-24 02:56 | 347K | |
![[ ]](/icons/compressed.gif) | fable_vavyan_jegtanc.zip | 2007-03-24 03:01 | 347K | |
![[ ]](/icons/compressed.gif) | Merle - A balvany.zip | 2005-06-09 13:56 | 347K | |
![[ ]](/icons/compressed.gif) | greene_graham_utazasok_nagynenemmel_hu_rtf.zip | 2007-03-24 02:55 | 346K | |
![[ ]](/icons/compressed.gif) | mora_ferenc_nekopogi_kovacs.pdf.zip | 2007-03-24 02:58 | 346K | |
![[ ]](/icons/unknown.gif) | Bujocska.doc | 2007-04-15 15:33 | 346K | |
![[ ]](/icons/unknown.gif) | osszes43.ace | 2007-03-24 02:56 | 346K | |
![[ ]](/icons/unknown.gif) | smith_l_neil_lando_calrissian_es_oseon_tuzvihara.rtf | 2007-03-24 02:54 | 346K | |
![[ ]](/icons/compressed.gif) | dezsi_csaba_andras_zappa_hu_doc_nncl2588-6acv1.zip | 2007-03-24 02:52 | 345K | |
![[ ]](/icons/compressed.gif) | borsody_bevilaqua_bela_regi_magyar_vilagjarok_hu_doc.zip | 2007-03-24 02:52 | 345K | |
![[ ]](/icons/compressed.gif) | read_piers_paul_eletben_maradtak_doc_hu.zip | 2007-03-24 02:58 | 345K | |
![[ ]](/icons/compressed.gif) | smith_wilbur_kialts_ra_az_ordogre_hu_rtf.zip | 2007-03-24 03:01 | 345K | |
![[ ]](/icons/compressed.gif) | thury_zsuzsa_a_francia_kislany_hu_doc_nncl3109-706v1.zip | 2007-03-24 03:00 | 345K | |
![[ ]](/icons/unknown.gif) | 1. Bennünk lakó szörnyeteg.rtf | 2007-03-06 02:19 | 345K | |
![[ ]](/icons/compressed.gif) | jokai_mor_szegeny_gazdagok_html.zip | 2007-03-24 02:56 | 344K | |
![[ ]](/icons/compressed.gif) | Mika Waltari-Az orszag titka.zip | 2007-03-24 02:57 | 344K | |
![[ ]](/icons/compressed.gif) | sztrugackij_a_b_ujonc_a_vilagurben_hu_rtf.zip | 2007-03-24 02:49 | 344K | |
![[ ]](/icons/compressed.gif) | Sztrugackij, Arkagyij és Borisz - Ujonc_a_vilagurben_hu_rtf.zip | 2007-02-21 16:46 | 344K | |
![[ ]](/icons/unknown.gif) | idovonal.ace | 2007-03-24 02:52 | 344K | |
![[ ]](/icons/unknown.gif) | a_halal_utvesztoje.rtf | 2007-11-14 04:10 | 344K | |
![[ ]](/icons/compressed.gif) | sotet_erok_ebredese.zip | 2007-03-24 02:54 | 343K | |
![[ ]](/icons/compressed.gif) | nemere_istvan_a_titan_terv_hu_doc_nncl2169_63cv1.zip | 2007-03-24 02:58 | 343K | |
![[ ]](/icons/compressed.gif) | chapman_wayne_a_halal_havaban_hu_doc.zip | 2007-03-24 02:54 | 343K | |
![[ ]](/icons/compressed.gif) | Wayne Chapman - A halál havában hu doc.zip | 2006-05-10 08:30 | 343K | |
![[ ]](/icons/unknown.gif) | Az Élet, A Világmindenség, Meg Minden.doc | 2007-03-24 02:53 | 343K | |
![[ ]](/icons/compressed.gif) | digitalis.zip | 2007-03-24 02:55 | 343K | |
![[ ]](/icons/compressed.gif) | gyorgy_peter_digitalis_eden_hu_rtf.zip | 2007-03-24 02:55 | 343K | |
![[ ]](/icons/compressed.gif) | marai_sandor_ami_a_naplobol_kimaradt_1950_52_hu_rtf_nncl2837-6e8v1.zip | 2007-03-24 02:57 | 343K | |
![[ ]](/icons/compressed.gif) | mauriac_francois_regenyek_hu_rtf.zip | 2007-03-24 02:54 | 342K | |
![[ ]](/icons/compressed.gif) | illyes_gyula_kora_tavasz-mint_a_darvak_html.zip | 2007-03-24 02:55 | 342K | |
![[ ]](/icons/compressed.gif) | illyes_gyula_pusztak_nepe-ebed_a_kastelyban_html.zip | 2007-03-24 02:55 | 342K | |
![[ ]](/icons/compressed.gif) | herbert_frank_dune_isten-csaszara.zip | 2007-03-24 02:54 | 342K | |
![[ ]](/icons/compressed.gif) | Frank Herbert-DUNE ISTEN-CSASZARA.zip | 2007-03-24 02:54 | 342K | |
![[ ]](/icons/compressed.gif) | morrell_david_elszantan_hu_rtf.zip | 2007-03-24 02:52 | 342K | |
![[ ]](/icons/compressed.gif) | jokai_mor_torok_vilag_magyarorszagon_html.zip | 2007-03-24 02:56 | 342K | |
![[ ]](/icons/compressed.gif) | lorinc_l_laszlo_a_fold_alatti_piramis_hu_rtf.zip | 2007-03-24 02:53 | 342K | |
![[ ]](/icons/compressed.gif) | Lőrinc L. László - A föld alatti piramis.zip | 2007-03-24 02:57 | 342K | |
![[ ]](/icons/unknown.gif) | osszes46.ace | 2007-03-24 02:56 | 342K | |
![[ ]](/icons/compressed.gif) | hassel_sven_gyalogoshadosztaly_hu_rtf.zip | 2007-03-24 03:00 | 342K | |
![[ ]](/icons/compressed.gif) | F hoyle-J elliot-andromeda.zip | 2007-03-24 02:54 | 341K | |
![[ ]](/icons/compressed.gif) | boll_heinrich_biliard_fel_tizkor_doc_nncl1983-61bv2.zip | 2007-03-24 02:55 | 341K | |
![[ ]](/icons/compressed.gif) | dekany_andras_robinson_utolso_kalandja_hu_rtf.zip | 2007-03-24 02:52 | 341K | |
![[ ]](/icons/compressed.gif) | fable-bell_a_pepita macska_hu_rtf_nncl3210-71Fv1.zip | 2007-03-24 03:01 | 341K | |
![[ ]](/icons/unknown.gif) | osszes68.ace | 2007-03-24 02:56 | 341K | |
![[ ]](/icons/compressed.gif) | greene_graham_brightoni_szikla_hu_rtf.zip | 2007-03-24 02:55 | 341K | |
![[ ]](/icons/compressed.gif) | mikszath_kalman_gavallerok_pdf.zip | 2007-03-24 02:58 | 340K | |
![[ ]](/icons/compressed.gif) | koontz_dean_r_egi_jel_hu_rtf_nncl2471-68ev1.zip | 2007-03-24 02:52 | 340K | |
![[ ]](/icons/compressed.gif) | greenfield_irving_torpedotamadas_hu_doc_nncl2077-62cv2.0.zip | 2007-03-24 02:55 | 340K | |
![[ ]](/icons/compressed.gif) | hassel_sven_eltorolni_parizst_hu_rtf.zip | 2007-03-24 03:00 | 340K | |
![[ ]](/icons/compressed.gif) | hoyle_elliot_andromeda_hu_rtf.zip | 2007-03-24 02:54 | 340K | |
![[ ]](/icons/compressed.gif) | Hoyle, Elliot - Andromeda_hu_rtf.zip | 2007-02-21 16:38 | 340K | |
![[ ]](/icons/compressed.gif) | le_carre_john_egy_nemet_kisvaros_hu_doc.zip | 2007-03-24 02:56 | 340K | |
![[ ]](/icons/compressed.gif) | london_jack_az_eneklo_kutya_hu_doc.zip | 2007-03-24 02:55 | 340K | |
![[ ]](/icons/unknown.gif) | webster_malcolm_a_jedi_hatalma.rtf | 2007-03-24 02:54 | 340K | |
![[ ]](/icons/compressed.gif) | zola_emile_a_kegyelmes_ur_rtf.zip | 2007-03-24 02:53 | 339K | |
![[ ]](/icons/compressed.gif) | keyes_daniel_billy_milligan_haborui_hu_doc_nncl3019-708v1.zip | 2007-03-24 02:52 | 339K | |
![[ ]](/icons/unknown.gif) | Kurt Vonnegut-Ej anyank | 2007-03-24 02:57 | 339K | |
![[ ]](/icons/compressed.gif) | lll_az_ejszaka_doktora.zip | 2007-03-20 00:18 | 339K | |
![[ ]](/icons/compressed.gif) | dubnov_simon_a_zsidosag_tortenete_hu_doc_nncl3049-706v1.zip | 2007-03-24 03:00 | 339K | |
![[ ]](/icons/compressed.gif) | zahn_timothy_sotet_erok_ebredese_hu_rtf.zip | 2007-03-24 03:00 | 338K | |
![[ ]](/icons/compressed.gif) | king_stephen_ejszakai_muszak_hu_rtf.zip | 2007-03-24 03:00 | 338K | |
![[ ]](/icons/compressed.gif) | Stephen King - Éjszakai_muszak_hu_rtf.zip | 2006-05-28 01:29 | 338K | |
![[ ]](/icons/compressed.gif) | maclean_alistair_ofelsege_hadihajoja_hu_rtf.zip | 2007-03-24 02:49 | 338K | |
![[ ]](/icons/compressed.gif) | stone_jeffrey_gyemantvaros_hu_doc.zip | 2007-03-24 02:58 | 338K | |
![[ ]](/icons/compressed.gif) | Stone, Jeffrey - Gyemantvaros_hu_doc.zip | 2006-05-29 06:30 | 338K | |
![[ ]](/icons/unknown.gif) | 01 - Wayne Chapman - Prófécia.doc | 2007-03-24 02:54 | 338K | |
![[ ]](/icons/unknown.gif) | I K Taimni - A Jóga tudománya.rar | 2007-03-24 02:53 | 338K | |
![[ ]](/icons/compressed.gif) | Kovai Lorinc-Porta Nomentana.zip | 2007-03-24 02:56 | 338K | |
![[ ]](/icons/compressed.gif) | hobb_robin_a_nep_orgyilkosa_hu_rtf_nncl2328-665v2.zip | 2007-03-24 03:00 | 338K | |
![[ ]](/icons/unknown.gif) | folyam.ace | 2007-03-24 02:52 | 338K | |
![[ ]](/icons/compressed.gif) | coonts_stephen_az_utolso_bevetes_hu_rtf.zip | 2007-03-24 03:00 | 338K | |
![[ ]](/icons/compressed.gif) | A tavol-keleti mesterek tanitasa.zip | 2007-03-24 02:53 | 337K | |
![[ ]](/icons/compressed.gif) | szentmihalyi_szabo_peter_urkrimi_latogato_hu_doc_nncl2220-649v1.zip | 2007-03-24 03:00 | 337K | |
![[ ]](/icons/unknown.gif) | alan_dean_foster-kristalykonnyek.rtf | 2007-11-14 06:25 | 337K | |
![[ ]](/icons/compressed.gif) | remarque_erich_maria_harom_bajtars_hu_doc.zip | 2007-03-24 02:53 | 337K | |
![[ ]](/icons/compressed.gif) | harris_thomas_a_voros_sarkany_hu_rtf.zip | 2007-03-24 03:00 | 337K | |
![[ ]](/icons/unknown.gif) | osszes69.ace | 2007-03-24 02:56 | 337K | |
![[ ]](/icons/compressed.gif) | ILF-PETROV-Aranyborju.zip | 2007-03-24 02:55 | 337K | |
![[ ]](/icons/compressed.gif) | gibson_william_idoru_hu_rtf_nncl2575-6a7v1.zip | 2007-03-24 03:01 | 336K | |
![[ ]](/icons/compressed.gif) | golding_william_beavatas_hu_rtf.zip | 2007-03-24 03:01 | 336K | |
![[ ]](/icons/compressed.gif) | vizelyi_gabor_edentol_nyugatra_hu_txt_nncl2365-66dv2.zip | 2007-03-24 03:01 | 336K | |
![[ ]](/icons/compressed.gif) | Stanislaw Lem - Pirx pilóta kalandjai.zip | 2006-05-31 08:49 | 336K | |
![[ ]](/icons/compressed.gif) | Garry Douglas-Hegylako.zip | 2007-03-24 02:54 | 336K | |
![[ ]](/icons/compressed.gif) | lem_stanislaw_pirx_pilota_kalandjai.zip | 2007-03-24 03:00 | 336K | |
![[ ]](/icons/compressed.gif) | otcenasek_jan_romeo_julia_es_a_sotetseg_hu_doc_nncl2249-64fv1.zip | 2007-03-24 02:56 | 336K | |
![[ ]](/icons/compressed.gif) | bradley_marion_zimmer_a_vilagok_haza_hu_doc_nncl3139-70bv1.zip | 2007-03-24 02:57 | 336K | |
![[ ]](/icons/compressed.gif) | moldova_gyorgy_akit_a_mozdony_fustje_megcsapott_html.zip | 2007-03-24 02:58 | 336K | |
![[ ]](/icons/compressed.gif) | Clifford D Simak-A varos.zip | 2007-03-24 02:52 | 336K | |
![[ ]](/icons/compressed.gif) | geron_frank_sivatagi_kommando_hu_rtf.zip | 2007-03-24 02:54 | 336K | |
![[ ]](/icons/compressed.gif) | 09. Utolsó parancs.zip | 2007-03-26 19:01 | 336K | |
![[ ]](/icons/compressed.gif) | twain_mark_egy_gyilkossag_egy_rejtely_es_egy_hazassag_hu_pdf.zip | 2007-03-24 02:57 | 335K | |
![[ ]](/icons/compressed.gif) | hornby_nick_pop_csajok_satobbi_hu_doc.zip | 2007-03-24 02:58 | 335K | |
![[ ]](/icons/compressed.gif) | wells_h_g_a_szerencse_kerekei_mr_polly_rtf.zip | 2007-03-24 02:55 | 335K | |
![[ ]](/icons/compressed.gif) | Nemere István - Skorpio_hu_rtf.zip | 2007-03-26 17:42 | 335K | |
![[ ]](/icons/compressed.gif) | iser_wolfgang_the_act_of_reading_en_html.zip | 2007-03-24 03:01 | 335K | |
![[ ]](/icons/compressed.gif) | John Updike-Az Eastwicki boszorkanyok.zip | 2007-03-24 02:56 | 335K | |
![[ ]](/icons/compressed.gif) | albaryu_esther_sarkanyhaboruk_hu_rtf.zip | 2007-03-24 02:53 | 335K | |
![[ ]](/icons/compressed.gif) | ronaszegi_miklos_a_rettenetes_kartal_hu_rtf.zip | 2007-03-24 03:00 | 335K | |
![[ ]](/icons/compressed.gif) | gaiman_pratchett_elveszett_profeciak_hu_rtf.zip | 2007-03-24 02:54 | 334K | |
![[ ]](/icons/compressed.gif) | gaiman-pratchett_elveszett_profeciak_hu_rtf.zip | 2007-03-24 02:58 | 334K | |
![[ ]](/icons/compressed.gif) | Mark Twain-Egy jenki Arthur király udvarában.zip | 2007-03-24 02:57 | 334K | |
![[ ]](/icons/compressed.gif) | Robert N. Cherette - Sose Küzdj Sárkánnyal.zip | 2006-05-31 07:34 | 334K | |
![[ ]](/icons/compressed.gif) | si_naj_an_vizparti_tortenet_3_hu_html_nncl2435-688v1.zip | 2007-03-24 03:00 | 334K | |
![[ ]](/icons/compressed.gif) | Isaac Asimov - Kavics az égben.zip | 2007-03-22 05:29 | 334K | |
![[ ]](/icons/compressed.gif) | Terry Prachett - Bűbájos bajok.zip | 2007-03-26 18:19 | 334K | |
![[ ]](/icons/compressed.gif) | Terry Prathett-Bubajos bajok.zip | 2007-03-24 03:00 | 334K | |
![[ ]](/icons/unknown.gif) | Douglas Adams - Galaxis utikalauz stopposoknak.rtf | 2006-07-19 06:43 | 334K | |
![[ ]](/icons/unknown.gif) | tolkienmesek.rtf | 2007-03-24 02:54 | 334K | |
![[ ]](/icons/compressed.gif) | asimov_isaac_kavics_az_egben_hu_rtf.zip | 2007-03-24 02:55 | 333K | |
![[ ]](/icons/unknown.gif) | feszger.ace | 2007-03-24 02:52 | 333K | |
![[ ]](/icons/unknown.gif) | hp.ace | 2007-03-24 02:52 | 333K | |
![[ ]](/icons/compressed.gif) | Isaac Asimov - Alapítvány sorozat - Az Alapítvány előtt hu html.zip | 2006-05-10 08:22 | 333K | |
![[ ]](/icons/binary.gif) | g164.exe | 2007-08-04 15:07 | 333K | |
![[ ]](/icons/compressed.gif) | szalay_karoly_a_satan_helytartoja_hu_rtf.zip | 2007-03-24 03:00 | 333K | |
![[ ]](/icons/compressed.gif) | csernai_zoltan_delfinkaland_hu_doc.zip | 2007-03-24 02:52 | 333K | |
![[ ]](/icons/compressed.gif) | puzo_mario_a_negyedik_k_hu_html.zip | 2007-03-24 02:57 | 333K | |
![[ ]](/icons/compressed.gif) | pirx.zip | 2007-08-04 14:40 | 333K | |
![[ ]](/icons/compressed.gif) | rowling_j_k_harry_potter_es_a_titkok_kamraja_hu_doc.zip | 2007-03-24 02:55 | 333K | |
![[ ]](/icons/compressed.gif) | Rowling, J.K - Harry Potter 2 és a Titkok Kamrája hu doc.zip | 2006-05-29 05:22 | 333K | |
![[ ]](/icons/compressed.gif) | mcbain_ed_osszerakos_jatek_hu_doc_nncl1973-61av1.zip | 2007-03-24 02:53 | 332K | |
![[ ]](/icons/compressed.gif) | juhasz_gyula_osszes_versei.zip | 2007-03-24 02:56 | 332K | |
![[ ]](/icons/compressed.gif) | banks_iain_a_jatekmester_hu_rtf_nncl2322-663v1.zip | 2007-03-24 02:55 | 332K | |
![[ ]](/icons/compressed.gif) | pokolba_tarto_vonat.zip | 2007-08-04 14:41 | 332K | |
![[ ]](/icons/compressed.gif) | Timothy Zahn - Kobraharcosok.zip | 2006-05-31 09:01 | 332K | |
![[ ]](/icons/compressed.gif) | beckman_thea_amazonkiralyfi.zip | 2007-03-24 03:00 | 332K | |
![[ ]](/icons/compressed.gif) | durrell_gerald_aranydeneverek_es_rozsaszin_galambok_hu_rtf_nncl2514-695v1.zip | 2007-03-24 02:54 | 332K | |
![[ ]](/icons/compressed.gif) | Hamvas Bela-otezer ev bolcsessege.zip | 2007-03-24 02:53 | 332K | |
![[ ]](/icons/compressed.gif) | aesopus_allatmesek.zip | 2007-03-24 02:55 | 332K | |
![[ ]](/icons/compressed.gif) | dekany_andras_kalozok_balnak_tengerek_hu_rtf_nncl2889-6f3v1.zip | 2007-03-24 02:52 | 331K | |
![[ ]](/icons/unknown.gif) | Jeffrey Stone_Gy'm ntv ros.doc | 2005-02-22 08:39 | 331K | |
![[ ]](/icons/compressed.gif) | ludlum_robert_a_parizs_opcio_hu_txt_nncl3261-732v1.zip | 2007-03-24 02:59 | 331K | |
![[ ]](/icons/compressed.gif) | Thomas Harris-Hannibál.zip | 2007-03-24 03:00 | 331K | |
![[ ]](/icons/compressed.gif) | lucas_csillagok_haboruja.zip | 2007-02-21 16:16 | 330K | |
![[ ]](/icons/compressed.gif) | brust_steven_a_lerombolt_palota_hu_rtf_nncl2952-6f3v1.zip | 2007-03-24 03:00 | 330K | |
![[ ]](/icons/compressed.gif) | vachss_andrew_meghalni_boldogan_hu_doc.zip | 2007-03-24 02:49 | 330K | |
![[ ]](/icons/compressed.gif) | druon_maurice_a_orszagveszto_hu_doc_nncl2818-6e4v1.zip | 2007-03-24 02:57 | 330K | |
![[ ]](/icons/unknown.gif) | holdba.ace | 2007-03-24 02:52 | 330K | |
![[ ]](/icons/compressed.gif) | Isaac Asimov - Az Istenek is hu doc.zip | 2006-05-10 10:01 | 330K | |
![[ ]](/icons/compressed.gif) | szavcsenko_vlagyimir_monomah_sapkaja_hu_rtf_nncl1986-61bv1.zip | 2007-03-24 03:01 | 330K | |
![[ ]](/icons/compressed.gif) | Isaac Asimov - (N1) Novellák.zip | 2006-12-13 23:30 | 330K | |
![[ ]](/icons/compressed.gif) | niven_pournell_szalka_isten_szemeben_hu_txt.zip | 2007-03-24 02:57 | 330K | |
![[ ]](/icons/compressed.gif) | lll_a_nagy_meszarlas.zip | 2007-03-20 00:16 | 329K | |
![[ ]](/icons/compressed.gif) | twain_mark_egy_jenki_arthur_kiraly_udvaraban.zip | 2007-03-24 02:57 | 329K | |
![[ ]](/icons/unknown.gif) | f451.rtf | 2007-11-14 06:07 | 329K | |
![[ ]](/icons/compressed.gif) | ross_thomas_dupla_vagy_semmi_hu_rtf.zip | 2007-03-24 03:00 | 329K | |
![[ ]](/icons/compressed.gif) | vonnegut_kurt_idoomlas_hu_html.zip | 2007-03-24 02:57 | 329K | |
![[ ]](/icons/compressed.gif) | hicks_e_es_j_salamon_beavato_mesei_2_hu_doc.zip | 2007-03-24 02:53 | 329K | |
![[ ]](/icons/compressed.gif) | Jennifer Lynch-Laura Palmer naploja.zip | 2007-03-24 02:56 | 329K | |
![[ ]](/icons/compressed.gif) | Kapcsolat.zip | 2007-03-23 05:11 | 328K | |
![[ ]](/icons/compressed.gif) | greene_graham_az_emberi_tenyezo_hu_doc.zip | 2007-03-24 02:55 | 328K | |
![[ ]](/icons/unknown.gif) | az_ej_kardja.rtf | 2005-06-05 19:40 | 328K | |
![[ ]](/icons/compressed.gif) | Carl Sagan-A kapcsolat.zip | 2007-03-24 02:52 | 328K | |
![[ ]](/icons/compressed.gif) | orwell_george_burmai_napok.zip | 2007-03-24 02:54 | 328K | |
![[ ]](/icons/compressed.gif) | George Orwell-Burmai napok.zip | 2007-03-24 02:54 | 328K | |
![[ ]](/icons/compressed.gif) | greene_graham_a_kezdet_es_a_veg_hu_rtf.zip | 2007-03-24 02:55 | 328K | |
![[ ]](/icons/compressed.gif) | fust_milan_a_felesegem_tortenete_html.zip | 2007-03-24 02:54 | 328K | |
![[TXT]](/icons/text.gif) | piknik.txt | 2007-11-14 05:04 | 328K | |
![[ ]](/icons/compressed.gif) | follett_ken_kulcs_a_manderley_hazhoz_hu_rtf.zip | 2007-03-24 02:56 | 327K | |
![[ ]](/icons/compressed.gif) | zahn_timothy_kobraharcosok.zip | 2007-03-24 03:00 | 327K | |
![[ ]](/icons/compressed.gif) | moorcock_michael_corum_kardjai_hu_rtf.zip | 2007-03-24 02:54 | 327K | |
![[ ]](/icons/compressed.gif) | moorcock_michael_corum_kardjai.zip | 2007-03-24 02:57 | 327K | |
![[ ]](/icons/compressed.gif) | Thea Beckman - Amazonkirályfi.zip | 2007-03-21 19:20 | 327K | |
![[ ]](/icons/compressed.gif) | jokai_mor_a_harom_marvanyfej_html.zip | 2007-03-24 02:56 | 327K | |
![[ ]](/icons/compressed.gif) | clarke_arthur_c_2001_elveszett_vilagai_hu_doc_nncl2134-638v1.zip | 2007-03-24 02:49 | 327K | |
![[ ]](/icons/compressed.gif) | toelcke_werner_a_mutet_hu_doc_nncl1045-453v1.zip | 2007-03-24 03:01 | 327K | |
![[ ]](/icons/compressed.gif) | maclean_alistair_apokalipszis_hu_doc.zip | 2007-03-24 02:49 | 327K | |
![[ ]](/icons/compressed.gif) | esterhazy_peter_a_kitomott_hattyu_html.zip | 2007-03-24 02:53 | 326K | |
![[ ]](/icons/compressed.gif) | gobolyos_n_laszlo_jim_morrison_hu_rtf_nncl158-27av1.zip | 2007-03-24 02:55 | 326K | |
![[ ]](/icons/compressed.gif) | szalay_lenke_te_mar_nagylany_vagy_mogyoro_hu_doc_nncl3107-706v1.zip | 2007-03-24 03:00 | 326K | |
![[ ]](/icons/compressed.gif) | Larry Niven Steven Barnes-Alompark.zip | 2007-03-24 02:57 | 325K | |
![[ ]](/icons/compressed.gif) | mcbain_ed_ki_oli_meg_a_ladyt_hu_rtf.zip | 2007-03-24 02:53 | 325K | |
![[ ]](/icons/compressed.gif) | mcmurtry_larry_becezo_szavak_hu_rtf.zip | 2007-03-24 02:57 | 325K | |
![[TXT]](/icons/text.gif) | rma.htm | 2007-11-14 02:32 | 325K | |
![[ ]](/icons/compressed.gif) | watson_francis_medici_katalin_elete_es_kora_hu_rtf.zip | 2007-03-24 02:54 | 325K | |
![[ ]](/icons/compressed.gif) | zola_emile_allat_az_emberben_rtf.zip | 2007-03-24 02:53 | 325K | |
![[ ]](/icons/compressed.gif) | gardonyi_geza_lathatatlan_ember_rtf.zip | 2007-03-24 02:54 | 325K | |
![[ ]](/icons/compressed.gif) | Isaac Asimov - Szivélyes Fahrenheit.zip | 2007-03-22 05:30 | 324K | |
![[ ]](/icons/compressed.gif) | defoe_daniel_moll_flanders_hu_rtf.zip | 2007-03-24 02:52 | 324K | |
![[ ]](/icons/compressed.gif) | Frank Herbert - Dűne Isten-császára.zip | 2007-03-26 14:46 | 324K | |
![[ ]](/icons/compressed.gif) | Szalontai Rezso-Kempelen,a varazslo.zip | 2007-03-24 03:00 | 324K | |
![[ ]](/icons/unknown.gif) | pokolba.ace | 2007-03-24 02:52 | 324K | |
![[ ]](/icons/unknown.gif) | A Lóhajsza.doc | 2007-04-15 16:29 | 324K | |
![[ ]](/icons/compressed.gif) | clavell_james_patkanykiraly_hu_rtf.zip | 2007-03-24 02:55 | 323K | |
![[ ]](/icons/compressed.gif) | a_nagy_meszarlas.zip | 2007-03-24 02:57 | 323K | |
![[ ]](/icons/compressed.gif) | szf.zip | 2007-08-04 15:11 | 323K | |
![[ ]](/icons/compressed.gif) | scott_walter_a_lammermoori_nasz_rtf.zip | 2007-03-24 03:01 | 323K | |
![[ ]](/icons/compressed.gif) | junger_sebastian_viharzona_hu_rtf_nncl3223-722v1.zip | 2007-03-24 03:00 | 323K | |
![[ ]](/icons/compressed.gif) | Szivejes Fahrenheit-17 SCI-FI remekmu.zip | 2007-03-24 03:00 | 323K | |
![[ ]](/icons/compressed.gif) | Sir Arthur Conan Doyle--A satan kutyalya.zip | 2007-03-24 03:00 | 323K | |
![[ ]](/icons/unknown.gif) | Robert Merle-Mestersegm a halal | 2007-03-24 02:59 | 323K | |
![[ ]](/icons/compressed.gif) | mcgowan_hands_ne_sirass_torzsormester_hu_rtf_nncl1894-611v1.zip | 2007-03-24 02:59 | 323K | |
![[ ]](/icons/compressed.gif) | twain_mark_huckleberry_finn_kalandjai_hu_doc.zip | 2007-03-24 02:57 | 323K | |
![[ ]](/icons/compressed.gif) | bernard_eric_kommandosok_ejtoernyosok_es_a_tobbiek_hu_doc_nncl2851-6ebv1.zip | 2007-03-24 02:53 | 322K | |
![[ ]](/icons/compressed.gif) | Orson Scott Card-A holtak szoszoloja.zip | 2007-03-24 02:58 | 322K | |
![[ ]](/icons/compressed.gif) | Isaac Asimov - Az istenek is.zip | 2006-12-14 01:13 | 322K | |
![[ ]](/icons/compressed.gif) | A buvos bolt es mas elbeszelesek-H G WELLS.zip | 2007-03-24 02:55 | 322K | |
![[ ]](/icons/compressed.gif) | Frederik Pohl - Tul a kek esemenyhorizonton.zip | 2007-02-21 16:50 | 322K | |
![[ ]](/icons/compressed.gif) | jokai_mor_szep_mikhal_html.zip | 2007-03-24 02:56 | 322K | |
![[ ]](/icons/compressed.gif) | jokai_mor_rakoczy_fia_html.zip | 2007-03-24 02:56 | 322K | |
![[ ]](/icons/compressed.gif) | moravia_alberto_a_kozonyosok_hu_doc.zip | 2007-03-24 02:49 | 322K | |
![[ ]](/icons/compressed.gif) | dickens_charles_ket_varos_rtf.zip | 2007-03-24 02:52 | 322K | |
![[ ]](/icons/compressed.gif) | wells_h_g_a_buvos_bolt_rtf.zip | 2007-03-24 02:55 | 322K | |
![[ ]](/icons/compressed.gif) | mutzelburg_dumas_a_vilag_ura_1_hu_rtf_nncl2932-6f3v1.zip | 2007-03-24 02:49 | 322K | |
![[ ]](/icons/compressed.gif) | Merle - Az elet rozsai.zip | 2005-06-09 13:57 | 322K | |
![[ ]](/icons/compressed.gif) | merle_robert_vedett_ferfiak_hu_rtf.zip | 2007-03-24 02:59 | 321K | |
![[ ]](/icons/compressed.gif) | Merle, Robert_Védett férfiak - rtf.zip | 2006-06-01 04:22 | 321K | |
![[ ]](/icons/compressed.gif) | jokai_mor_cikkek_a_forradalom_evebol_html.zip | 2007-03-24 02:56 | 321K | |
![[ ]](/icons/compressed.gif) | SW - alkonybolygó.zip | 2007-03-26 19:02 | 321K | |
![[ ]](/icons/compressed.gif) | hambly_barbara_alkonybolygo_hu_rtf.zip | 2007-03-24 02:49 | 321K | |
![[ ]](/icons/compressed.gif) | alkonybolygo.zip | 2007-03-24 02:54 | 321K | |
![[ ]](/icons/compressed.gif) | christie_agatha_nemezis_hu_doc_nncl3276-73cv1.zip | 2007-03-24 02:49 | 321K | |
![[TXT]](/icons/text.gif) | nemere_istvan_tul_a_pluton.txt | 2005-08-16 18:46 | 320K | |
![[ ]](/icons/unknown.gif) | 1_urvadasz.rtf | 2007-11-14 08:50 | 320K | |
![[ ]](/icons/compressed.gif) | Thomas N S,Fank M R---A Prometheusvalsag.zip | 2007-03-24 03:00 | 320K | |
![[ ]](/icons/compressed.gif) | Kiberiáda.zip | 2007-03-24 03:00 | 320K | |
![[ ]](/icons/compressed.gif) | marai_sandor_ami_a_naplobol_kimaradt_1953-55_hu_rtf_nncl2979-701v1.zip | 2007-03-24 02:57 | 320K | |
![[ ]](/icons/compressed.gif) | Orson Scott Card - A Holtak Szószólója.zip | 2006-05-29 05:01 | 320K | |
![[ ]](/icons/compressed.gif) | gibson_william_a_holnap_tegnapja__hu_doc_nncl3278-73ev1.zip | 2007-03-24 03:01 | 319K | |
![[ ]](/icons/compressed.gif) | Jared Diamond-Miert elvezet a szex.zip | 2007-03-24 02:56 | 319K | |
![[ ]](/icons/compressed.gif) | dos_passos_john_manhattani_kalauz_hu_rtf_nncl1447-515v2.zip | 2007-03-24 02:56 | 319K | |
![[ ]](/icons/compressed.gif) | fa_nandor_a_szent_jupat_700_napja_hu_doc.zip | 2007-03-24 02:54 | 319K | |
![[ ]](/icons/layout.gif) | Uwel nevében.pdf | 2007-04-15 16:46 | 319K | |
![[ ]](/icons/compressed.gif) | jozsef_attila_osszes_koltemenye_rtf.zip | 2007-03-24 02:55 | 319K | |
![[ ]](/icons/compressed.gif) | feher_tibor_tuzon_vizen_at_hu_rtf.zip | 2007-03-24 02:54 | 318K | |
![[ ]](/icons/compressed.gif) | grisham_john_a_pelikan_ugyirat_hu_rtf.zip | 2007-03-24 02:56 | 318K | |
![[ ]](/icons/compressed.gif) | foldi_pal_a_trafalgari_csata_hu_rtf.zip | 2007-03-24 02:54 | 318K | |
![[ ]](/icons/unknown.gif) | albaryu_esther_sarkanyhaboruk_hu_rtf.zip2 | 2007-03-24 02:54 | 318K | |
![[ ]](/icons/compressed.gif) | smith_wilbur_elsotetult_nap_hu_doc_nncl1885-610v1.zip | 2007-03-24 03:01 | 318K | |
![[ ]](/icons/compressed.gif) | Isaac Asimov - Gyilkos idő.zip | 2007-03-22 05:29 | 318K | |
![[ ]](/icons/compressed.gif) | lengyel_balazs_ezustgaras_hu_rtf.zip | 2007-03-24 02:57 | 318K | |
![[ ]](/icons/compressed.gif) | thomas_donald_michael_a_feher_hotel_hu_doc_nncl1461-51av1.zip | 2007-03-24 02:52 | 318K | |
![[ ]](/icons/compressed.gif) | caldwell_john_a_kaosz_viragai_hu_doc_nncl2149-638v1.zip | 2007-03-24 02:58 | 318K | |
![[ ]](/icons/compressed.gif) | goethe_johann_wolfgang_von_werther_szerelme_es_halala_pdf.zip | 2007-03-24 02:56 | 317K | |
![[ ]](/icons/compressed.gif) | cussler_clive_sarkany_hu_doc_nncl1988-61bv1.zip | 2007-03-24 02:52 | 317K | |
![[ ]](/icons/compressed.gif) | zsoldos_peter_a_holtak_nem_vetnek_arnyekot_doc.zip | 2007-03-24 03:01 | 317K | |
![[ ]](/icons/compressed.gif) | man_john_dzsingisz_kan_hu_txt_nncl2472-695v1.zip | 2007-03-24 02:56 | 317K | |
![[ ]](/icons/compressed.gif) | forester_cecil_scott_ofelsege_kapitanya_2_hu_rtf.zip | 2007-03-24 02:52 | 317K | |
![[ ]](/icons/compressed.gif) | orwell_george_a_wigani_molo_hu_rtf_nncl3243-72av1.zip | 2007-03-24 02:54 | 316K | |
![[ ]](/icons/compressed.gif) | 08. Sötét erök ébredése.zip | 2007-03-26 19:01 | 316K | |
![[ ]](/icons/compressed.gif) | moricz_zsigmond_rozsa_sandor_osszevonja_szemoldoket_.zip | 2007-03-24 02:58 | 316K | |
![[ ]](/icons/compressed.gif) | bourgeon_roger_ben_hur_fia_hu_rtf_nncl2635-6b9v1.zip | 2007-03-24 03:00 | 316K | |
![[ ]](/icons/compressed.gif) | 04. IV. Csillagok háborúja.zip | 2007-03-26 19:01 | 316K | |
![[ ]](/icons/compressed.gif) | wain_alan_feher_halal_hu_rtf.zip | 2007-03-24 02:49 | 316K | |
![[ ]](/icons/compressed.gif) | conrad_joseph_nyugati_szemmel_hu_html_nncl2881-6f3v1.zip | 2007-03-24 02:56 | 315K | |
![[ ]](/icons/compressed.gif) | rowling_j_k_harry_potter_es_a_bolcsek_kove_hu_doc.zip | 2007-03-24 02:55 | 315K | |
![[ ]](/icons/compressed.gif) | Rowling, J.K - Harry Potter 1 és a Bölcsek Köve. hu.doc.zip | 2006-05-29 05:19 | 315K | |
![[ ]](/icons/compressed.gif) | king_stephen_tortura_hu_rtf.zip | 2007-03-24 03:00 | 315K | |
![[ ]](/icons/compressed.gif) | dali_salvador_elrejtett_arcok.zip | 2007-03-24 03:00 | 315K | |
![[ ]](/icons/compressed.gif) | knaak_richard_a_diablo1_hu_rtf.zip | 2007-03-24 02:54 | 315K | |
![[ ]](/icons/compressed.gif) | Merle - Francia historia.zip | 2005-06-09 13:57 | 315K | |
![[ ]](/icons/compressed.gif) | andersen_hans_christian_mesei_1_rtf.zip | 2007-03-24 02:57 | 314K | |
![[ ]](/icons/compressed.gif) | Karinthy Frigyes-Tanar ur kerem.zip | 2007-03-24 02:56 | 314K | |
![[ ]](/icons/unknown.gif) | osszes75.ace | 2007-03-24 02:56 | 314K | |
![[ ]](/icons/compressed.gif) | mutzelburg_dumas_a_vilag_ura_2_hu_rtf_nncl2933-6f3v1.zip | 2007-03-24 02:49 | 314K | |
![[ ]](/icons/compressed.gif) | cussler_clive_emeld_ki_a_titanicot_hu_rtf.zip | 2007-03-24 02:52 | 314K | |
![[ ]](/icons/compressed.gif) | 10. Múlt kisértése.zip | 2007-03-26 19:01 | 314K | |
![[ ]](/icons/layout.gif) | Kacaj.pdf | 2007-04-15 15:36 | 314K | |
![[ ]](/icons/compressed.gif) | Isaac Asimov - Others.zip | 2004-06-21 11:44 | 314K | |
![[ ]](/icons/compressed.gif) | a_mult_kisertete.zip | 2007-03-24 02:54 | 314K | |
![[ ]](/icons/compressed.gif) | asimov_isaac_others.zip | 2007-03-24 02:55 | 314K | |
![[ ]](/icons/compressed.gif) | niven_larry_idon_kivuli_vilag_hu_rtf.zip | 2007-03-24 02:58 | 314K | |
![[ ]](/icons/compressed.gif) | Larry Niven - Idon_kivuli_vilag_hu_rtf.zip | 2006-05-29 04:57 | 314K | |
![[ ]](/icons/compressed.gif) | molnar_gabor_az_oriaskigyok_foldjen_hu_rtf.zip | 2007-03-24 02:58 | 314K | |
![[ ]](/icons/compressed.gif) | bogati_peter_az_utolso_ember_hu_rtf.zip | 2007-03-24 02:51 | 314K | |
![[ ]](/icons/compressed.gif) | Bogáti Péter -Az utolso ember hu rtf.zip | 2007-02-21 16:29 | 314K | |
![[ ]](/icons/compressed.gif) | Revay jozsef--Szazarcu okor.zip | 2007-03-24 02:59 | 313K | |
![[ ]](/icons/compressed.gif) | Merle - Armany es cselszoves.zip | 2005-05-21 16:32 | 313K | |
![[ ]](/icons/compressed.gif) | marsh_evelyn_a_ketarcu_gyilkos_hu_doc.zip | 2007-03-24 02:53 | 313K | |
![[ ]](/icons/compressed.gif) | smith_wilbur_a_tigris_szeme_hu_rtf.zip | 2007-03-24 03:01 | 313K | |
![[ ]](/icons/layout.gif) | Ingatlanok listája - Megvásárolható házak listája.pdf | 2007-05-03 06:53 | 313K | |
![[ ]](/icons/unknown.gif) | 01 - A hosszúéletűek (Tekercsek).doc | 2007-03-24 02:54 | 313K | |
![[ ]](/icons/unknown.gif) | salamon beavato mesei 2-Esther es Jerry Hicks | 2007-03-24 03:00 | 313K | |
![[ ]](/icons/compressed.gif) | szabo_magda_a_danaida_html.zip | 2007-03-24 03:00 | 313K | |
![[ ]](/icons/unknown.gif) | osszes51.ace | 2007-03-24 02:56 | 312K | |
![[ ]](/icons/compressed.gif) | hassel_sven_pokoljaras_hu_rtf.zip | 2007-03-24 03:00 | 312K | |
![[ ]](/icons/compressed.gif) | aldiss.zip | 2007-08-04 15:35 | 312K | |
![[ ]](/icons/compressed.gif) | Brian W Aldiss - Elbeszélések.zip | 2005-06-22 15:32 | 312K | |
![[ ]](/icons/compressed.gif) | le_guin_ursula_k_atuan_sirjai_hu_rtf.zip | 2007-03-24 03:00 | 312K | |
![[ ]](/icons/compressed.gif) | Ursula K Le Guin - Atuan_sirjai_hu_rtf.zip | 2006-05-29 00:19 | 312K | |
![[ ]](/icons/unknown.gif) | Vavyan Fable-Vismajor.ZIP | 2007-03-24 03:01 | 312K | |
![[ ]](/icons/compressed.gif) | John Fowles-A lepkegyujto.zip | 2007-03-24 02:56 | 312K | |
![[ ]](/icons/unknown.gif) | 4_jupiter.rtf | 2007-11-14 09:15 | 312K | |
![[ ]](/icons/compressed.gif) | Jan van den Boomen - Jó széllel toroni partra.zip | 2007-04-06 11:05 | 312K | |
![[ ]](/icons/compressed.gif) | zahn_timothy_a_mult_kisertete_hu_rtf.zip | 2006-05-31 07:57 | 312K | |
![[ ]](/icons/compressed.gif) | Timothy Zahn - Mult_kisertete_hu_rtf.zip | 2006-05-29 08:03 | 312K | |
![[ ]](/icons/compressed.gif) | mcbain_ed_villam_hu_doc_nncl2410-67bv1.zip | 2007-03-24 02:53 | 311K | |
![[ ]](/icons/compressed.gif) | marsh_evelyn_a_siva_olelese_hu_doc.zip | 2007-03-24 02:53 | 311K | |
![[ ]](/icons/compressed.gif) | scortia-robinson_a_prometheus_valsag_hu_rtf.zip | 2007-03-24 03:00 | 311K | |
![[ ]](/icons/compressed.gif) | fekete_istvan_zsellerek_hu_rtf.zip | 2007-03-24 02:57 | 311K | |
![[ ]](/icons/compressed.gif) | cook_robin_fertozes_hu_txt_nncl2363-66dv1.zip | 2007-03-24 03:00 | 311K | |
![[ ]](/icons/compressed.gif) | defoe_daniel_roxana_avagy_a_szerencses_kedves_hu_rtf.zip | 2007-03-24 02:52 | 311K | |
![[ ]](/icons/unknown.gif) | ubevetes.ace | 2007-03-24 02:52 | 311K | |
![[ ]](/icons/compressed.gif) | alex_joe_ordogi_jatszma_hu_rtf.zip | 2007-03-24 02:56 | 311K | |
![[ ]](/icons/compressed.gif) | korda_istvan_a_nagy_ut_hu_html.zip | 2007-03-24 02:56 | 310K | |
![[ ]](/icons/compressed.gif) | Lucius Annaeus Seneca-Vigasztalasok.zip | 2007-03-24 02:57 | 310K | |
![[ ]](/icons/compressed.gif) | Holdkórosok temet_je.zip | 2007-03-24 02:59 | 310K | |
![[ ]](/icons/compressed.gif) | 07. Birodalom örökösei.zip | 2007-03-26 19:01 | 310K | |
![[ ]](/icons/compressed.gif) | zahn_timothy_a_birodalom_orokosei_hu_rtf.zip | 2006-05-31 07:55 | 310K | |
![[ ]](/icons/compressed.gif) | Timothy Zahn - A birodalom_orokosei_hu_rtf.zip | 2006-05-29 07:56 | 310K | |
![[ ]](/icons/compressed.gif) | festa_campanile_pasquale_a_lator_hu_doc_nncl2078-62cv1.zip | 2007-03-24 02:58 | 309K | |
![[ ]](/icons/compressed.gif) | krudy_gyula_az_utitars.zip | 2007-03-24 02:56 | 309K | |
![[ ]](/icons/compressed.gif) | fowles_john_a_lepkegyujto_hu_rtf.zip | 2007-03-24 02:56 | 309K | |
![[ ]](/icons/compressed.gif) | a_nyikorgo_idegen_hu_rtf.zip | 2007-08-04 14:51 | 309K | |
![[ ]](/icons/unknown.gif) | Paul Bruton-India titkai | 2007-03-24 02:58 | 309K | |
![[ ]](/icons/compressed.gif) | wodehouse_p_g_hubele_samuel_hu_doc_nncl3128-706v1.zip | 2007-03-24 02:58 | 308K | |
![[ ]](/icons/compressed.gif) | gergely_mihaly_a_kozmosz_15_torvenye_hu_doc_nncl2517-695v1.zip | 2007-03-24 02:54 | 308K | |
![[ ]](/icons/compressed.gif) | M de Cervantes Seeaverdra-Don Quijote.zip | 2007-03-24 02:57 | 308K | |
![[ ]](/icons/compressed.gif) | cherryh_c_j_a_pokol_legioi_hu_txt.zip | 2007-03-24 02:52 | 308K | |
![[ ]](/icons/compressed.gif) | brand_max_a_bajkevero_kolyok_hu_rtf.zip | 2007-03-24 02:57 | 308K | |
![[ ]](/icons/compressed.gif) | cervantes_don_quijote_html.zip | 2007-03-24 02:52 | 308K | |
![[ ]](/icons/compressed.gif) | Doris Egan-Ivory kapuja.zip | 2007-03-24 02:53 | 307K | |
![[ ]](/icons/compressed.gif) | pokoljaras.zip | 2007-08-04 14:23 | 307K | |
![[ ]](/icons/compressed.gif) | wodehouse_p_g_nyari_zivatar_hu_doc_nncl3131-706v1.zip | 2007-03-24 02:58 | 307K | |
![[ ]](/icons/compressed.gif) | Csernai Zoltan-ATLEONTISZ.zip | 2007-03-24 02:52 | 307K | |
![[ ]](/icons/unknown.gif) | 6_aszteroidak.rtf | 2007-11-14 09:10 | 307K | |
![[ ]](/icons/compressed.gif) | Feher Klara-Gyilkossag a Capa-obolben.zip | 2007-03-24 02:54 | 307K | |
![[ ]](/icons/compressed.gif) | moricz_zsigmond_rozsa_sandor_a_lovat_ugratja_rtf.zip | 2007-03-24 02:58 | 307K | |
![[ ]](/icons/compressed.gif) | thury_zsuzsa_a_tuzpiros_uveggomb_hu_doc_nncl3110-706v1.zip | 2007-03-24 03:00 | 307K | |
![[ ]](/icons/compressed.gif) | Isaac Asimov-Alapitvany es Birodalom.zip | 2007-03-24 02:55 | 307K | |
![[ ]](/icons/compressed.gif) | merle_robert_veszedelem_es_dicsoseg_hu_txt_nncl1908-614v2.zip | 2007-03-24 02:59 | 307K | |
![[ ]](/icons/compressed.gif) | marai_sandor_ami_a_naplobol_kimaradt_1949_hu_rtf_nncl2795-6dev1.zip | 2007-03-24 02:57 | 307K | |
![[ ]](/icons/compressed.gif) | blood.zip | 2007-02-21 16:18 | 306K | |
![[ ]](/icons/compressed.gif) | bear_greg_a_ver_zeneje.zip | 2007-03-24 02:55 | 306K | |
![[ ]](/icons/compressed.gif) | egan_doris_ivory_kapuja_hu_rtf.zip | 2007-03-24 02:53 | 306K | |
![[ ]](/icons/compressed.gif) | salvatore_r_a_kristalyszilank_hu_rtf.zip | 2006-05-29 06:07 | 306K | |
![[ ]](/icons/unknown.gif) | 2_venusz.rtf | 2007-11-13 21:44 | 306K | |
![[ ]](/icons/compressed.gif) | szabo_magda_megmaradt_szobotkanak_html.zip | 2007-03-24 03:00 | 305K | |
![[ ]](/icons/compressed.gif) | updike_john_az_ido_vege_fele_hu_html.zip | 2007-03-24 02:56 | 305K | |
![[ ]](/icons/compressed.gif) | lorincz_l_laszlo_az_ejszaka_doktora_hu_rtf.zip | 2007-03-24 02:57 | 305K | |
![[ ]](/icons/compressed.gif) | ziergiebel_herbert_a_sebhelyes_arcu_hu_rtf_nncl2308-65ev1.zip | 2007-03-24 02:55 | 305K | |
![[ ]](/icons/compressed.gif) | 04. Kristályszilánk.zip | 2007-03-26 18:33 | 305K | |
![[ ]](/icons/compressed.gif) | doyle_arthur_conan_az_agra_kincse_hu_doc_nncl2773-6dbv1.zip | 2007-03-24 02:49 | 305K | |
![[ ]](/icons/compressed.gif) | Hevesi Andras-Jelky Andras kalandjai.zip | 2007-03-24 02:55 | 305K | |
![[ ]](/icons/compressed.gif) | sethfield_christopher_a_stratega_hu_rtf.zip | 2007-03-24 03:00 | 305K | |
![[ ]](/icons/compressed.gif) | reid_thomas_mayne_a_fej_nelkuli_lovas_hu_rtf.zip | 2007-03-24 03:00 | 305K | |
![[ ]](/icons/compressed.gif) | heym_stefan_david_kiraly_kronikaja_hu_rtf.zip | 2007-03-24 03:00 | 305K | |
![[ ]](/icons/compressed.gif) | racz_zsuzsa_allitsatok_meg_terezanyut_hu_doc_nncl2730-6d2v1.zip | 2007-03-24 02:58 | 305K | |
![[ ]](/icons/compressed.gif) | Michael Moorcock - Corum kardjai.zip | 2007-03-26 17:37 | 305K | |
![[ ]](/icons/compressed.gif) | Kalibán.zip | 2007-03-24 02:55 | 305K | |
![[ ]](/icons/unknown.gif) | alakok.rtf | 2007-03-24 02:55 | 304K | |
![[ ]](/icons/compressed.gif) | gardonyi_geza_hosszuhaju_veszedelem_rtf.zip | 2007-03-24 02:54 | 304K | |
![[ ]](/icons/compressed.gif) | Dashiell Hammett-Az atok.zip | 2007-03-24 02:52 | 304K | |
![[ ]](/icons/compressed.gif) | jokai_anna_jakob_lajtorjaja_html.zip | 2007-03-24 02:56 | 304K | |
![[ ]](/icons/compressed.gif) | liptak_gabor_aranyhid_hu_rtf.zip | 2007-03-24 02:57 | 304K | |
![[ ]](/icons/compressed.gif) | dante_alighieri_pokol_pdf.zip | 2007-03-24 02:52 | 304K | |
![[ ]](/icons/compressed.gif) | jokai_mor_utleirasok_html.zip | 2007-03-24 02:56 | 304K | |
![[ ]](/icons/compressed.gif) | soucek_ludvik_A Fekete Bolygó Testvérei.zip | 2007-03-26 18:55 | 304K | |
![[ ]](/icons/compressed.gif) | Szatmari Sandor-Kazohinia.zip | 2007-03-24 03:00 | 304K | |
![[ ]](/icons/compressed.gif) | marsh_evelyn_a_halal_csak_egyszer_csenget_hu_doc.zip | 2007-03-24 02:53 | 304K | |
![[ ]](/icons/layout.gif) | A Bakarasznyi Bögöly Átka.pdf | 2007-04-15 15:43 | 304K | |
![[ ]](/icons/compressed.gif) | daniell_tina_sotet_sziv.zip | 2007-03-24 03:00 | 304K | |
![[ ]](/icons/compressed.gif) | John Braine--Hely a teton.zip | 2007-03-24 02:56 | 304K | |
![[ ]](/icons/compressed.gif) | marsh_evelyn_remulet_a_katedralisban_hu_doc.zip | 2007-03-24 02:53 | 304K | |
![[ ]](/icons/unknown.gif) | 5_szaturn.rtf | 2007-11-14 05:01 | 303K | |
![[ ]](/icons/compressed.gif) | Terry Pratchett-Egyenjogu ritusok.zip | 2007-03-24 03:00 | 303K | |
![[ ]](/icons/compressed.gif) | erdody_janos_mesterdalnokok_varosa_hu_rtf.zip | 2007-03-24 02:53 | 303K | |
![[ ]](/icons/compressed.gif) | braine_john_hely_a_teton_hu_rtf.zip | 2007-03-24 02:56 | 303K | |
![[ ]](/icons/compressed.gif) | de_camp_l_sprague_manotorony_hu_rtf.zip | 2007-03-24 02:57 | 303K | |
![[ ]](/icons/compressed.gif) | defoe_daniel_robinson_crusoe.zip | 2007-03-24 02:52 | 303K | |
![[ ]](/icons/compressed.gif) | marai_sandor_ami_a_naplobol_kimaradt_1945_1946_hu_rtf_nncl2561-6a5v1.zip | 2007-03-24 02:57 | 303K | |
![[ ]](/icons/compressed.gif) | Thornton Wilder-Kabala.zip | 2007-03-24 03:00 | 303K | |
![[ ]](/icons/compressed.gif) | laczko_geza_innen_es_tul_hu_doc_nncl2522-696v1.zip | 2007-03-24 02:57 | 303K | |
![[ ]](/icons/unknown.gif) | g164.ace | 2007-03-24 02:52 | 302K | |
![[ ]](/icons/layout.gif) | Monsters Manual (A-H).pdf | 2007-05-03 06:42 | 302K | |
![[ ]](/icons/compressed.gif) | deighton_len_a_guernica_csoport_hu_rtf_nncl2273-654v1.zip | 2007-03-24 02:57 | 302K | |
![[ ]](/icons/compressed.gif) | dumas_alexandre_a_javai_orvos_hu_rtf.zip | 2007-03-24 02:49 | 302K | |
![[ ]](/icons/unknown.gif) | osszes38.ace | 2007-03-24 02:56 | 302K | |
![[ ]](/icons/compressed.gif) | higgins_jack_hurrikan_hu_rtf_nncl2616-6b1v1.zip | 2007-03-24 02:55 | 302K | |
![[ ]](/icons/compressed.gif) | Albaryu-Sarkanyhaboru.zip | 2007-03-24 02:53 | 302K | |
![[ ]](/icons/compressed.gif) | gyilkosido.zip | 2007-08-04 14:42 | 302K | |
![[ ]](/icons/compressed.gif) | koszegi_imre_isteni_beatrice_hu_doc.zip | 2007-03-24 02:56 | 302K | |
![[ ]](/icons/compressed.gif) | aragon_luis_a_bazeli_harangok_hu_rtf.zip | 2007-03-24 02:57 | 302K | |
![[ ]](/icons/compressed.gif) | hammett_dashiell_az_atok_hu_rtf.zip | 2007-03-24 02:52 | 302K | |
![[ ]](/icons/compressed.gif) | Az Islam vallastanitasai--40 hagyomany.zip | 2007-03-24 02:53 | 302K | |
![[ ]](/icons/compressed.gif) | asimov_isaac_elojatek_az_alapitvanyhoz_hu_rtf.zip | 2007-03-24 02:55 | 302K | |
![[ ]](/icons/compressed.gif) | Isaac Asimov - Alapítvány sorozat - Előjatek_az_alapitvanyhoz_hu_rtf.zip | 2006-05-10 07:21 | 302K | |
![[TXT]](/icons/text.gif) | brown_fredric_marslakok_mars_haza.txt | 2007-11-14 06:48 | 301K | |
![[ ]](/icons/compressed.gif) | india titkai.zip | 2007-03-24 02:58 | 301K | |
![[ ]](/icons/compressed.gif) | kertesz_imre_sorstalansag_pdf.zip | 2007-03-24 02:56 | 301K | |
![[ ]](/icons/compressed.gif) | Legendák és enigmák 2.zip | 2007-04-06 11:04 | 301K | |
![[ ]](/icons/layout.gif) | j_k_rowling_-_legendas_allatok_es_megfigyelesuk.pdf | 2007-01-20 16:39 | 301K | |
![[ ]](/icons/compressed.gif) | smith_wilbur_aranybanya_hu_rtf_nncl1084-465v1.zip | 2007-03-24 03:01 | 300K | |
![[ ]](/icons/compressed.gif) | morris_desmond_a_csupasz_majom_hu_doc_nncl2397-674v1.zip | 2007-03-24 02:52 | 300K | |
![[ ]](/icons/compressed.gif) | may_karl_az_olajkiraly_hu_rtf.zip | 2007-03-24 02:56 | 300K | |
![[ ]](/icons/compressed.gif) | nemere_istvan_skorpio_hu_rtf.zip | 2007-03-24 02:58 | 300K | |
![[IMG]](/icons/image2.gif) | Margaret Weis és Don Perrin_Halálbrigád (Káosz háború 1.) borító.JPG | 2005-02-20 07:56 | 300K | |
![[ ]](/icons/compressed.gif) | block_lawrence_bergyilkos_a_celkeresztben_hu_rtf_nncl2137-638v1.zip | 2007-03-24 02:57 | 300K | |
![[ ]](/icons/compressed.gif) | dumas_alexandre_maria_antoanette_lovagjai_rtf.zip | 2007-03-24 02:49 | 300K | |
![[ ]](/icons/unknown.gif) | Thomas Harris-Vörös sárkány.ZIP | 2007-03-24 03:00 | 300K | |
![[ ]](/icons/unknown.gif) | Kevin J Anderson 's Rebecca Moesta - urnyakad'mia.RTF | 2006-07-19 20:31 | 300K | |
![[ ]](/icons/compressed.gif) | orwell_george_1984.zip | 2007-03-24 02:54 | 300K | |
![[ ]](/icons/unknown.gif) | KURTI_~1.DOC | 2007-11-14 02:23 | 300K | |
![[ ]](/icons/compressed.gif) | chipendale_jt_a_nagy_vilagregatta_hu_rtf.zip | 2007-03-24 02:55 | 299K | |
![[ ]](/icons/compressed.gif) | J T Chipendale-Nagy vilag---Regatta.zip | 2007-03-24 02:55 | 299K | |
![[ ]](/icons/compressed.gif) | sethfield_christopher_megtorlas_hu_doc.zip | 2007-03-24 03:00 | 299K | |
![[ ]](/icons/compressed.gif) | Ryan Hawkwood - Farkasének.zip | 2007-04-06 11:07 | 299K | |
![[ ]](/icons/layout.gif) | Monsters Manual (I-Z).pdf | 2007-05-03 06:45 | 299K | |
![[ ]](/icons/compressed.gif) | Roland Morgen - Sárkányháború.zip | 2007-04-06 11:07 | 299K | |
![[ ]](/icons/compressed.gif) | r_szekely_julianna_aki_bujt_aki_nem_hu_rtf_nncl2484-68ev1.zip | 2007-03-24 03:00 | 299K | |
![[TXT]](/icons/text.gif) | urpestis.txt | 2007-11-14 08:59 | 299K | |
![[ ]](/icons/compressed.gif) | verne_jules_a_franklin_kifut_a_tengerre_rtf.zip | 2007-03-24 02:56 | 299K | |
![[ ]](/icons/compressed.gif) | asimov_isaac_halalos_itelet_rtf.zip | 2007-03-24 02:55 | 299K | |
![[ ]](/icons/compressed.gif) | asimov_isaac_halalos_itelet_hu_rtf.zip | 2007-08-04 15:34 | 299K | |
![[ ]](/icons/compressed.gif) | Isaac Asimov - Halálos ítélet.zip | 2006-12-06 13:38 | 299K | |
![[ ]](/icons/compressed.gif) | wallace_edgar_a_scotland_yard_es_a_gumiemberek_hu_rtf.zip | 2007-03-24 02:53 | 299K | |
![[ ]](/icons/compressed.gif) | DFAliensvsPredator.zip | 2007-03-24 02:49 | 299K | |
![[ ]](/icons/compressed.gif) | peiper_joachim_keselyuk_berlin_felett_hu_rtf.zip | 2007-03-24 02:56 | 298K | |
![[ ]](/icons/compressed.gif) | knittel_john_therese_hu_rtf_nncl2258-651v1.zip | 2007-03-24 02:56 | 298K | |
![[ ]](/icons/compressed.gif) | Jan van den Boomen - Fekete vizek.zip | 2007-04-06 11:05 | 298K | |
![[ ]](/icons/compressed.gif) | kleist_heinrich_von_eljegyzes_santo_domingon_hu_html.zip | 2007-03-24 02:55 | 298K | |
![[ ]](/icons/unknown.gif) | Halálszárny.doc | 2007-03-24 02:52 | 298K | |
![[ ]](/icons/compressed.gif) | zola_emile_mouret_abbe_vetke_rtf.zip | 2007-03-24 02:53 | 298K | |
![[ ]](/icons/compressed.gif) | Orson Scott Card - Múltfigyelők.zip | 2007-03-19 18:44 | 298K | |
![[ ]](/icons/compressed.gif) | sheldon_sidney_angyalok_duhe_hu_rtf.zip | 2007-03-24 03:00 | 298K | |
![[ ]](/icons/compressed.gif) | Timothy Zahn - Sotet_erok_ebredese_hu_rtf.zip | 2006-05-29 08:05 | 298K | |
![[ ]](/icons/compressed.gif) | verne_jules_utazas_a_holdba_rtf.zip | 2007-03-24 02:56 | 298K | |
![[ ]](/icons/compressed.gif) | castaneda_carlos_belulrol_izzo_tuz_hu_html.zip | 2007-03-24 02:52 | 298K | |
![[ ]](/icons/compressed.gif) | nyaralj_velunk_az_altaj_hegysegben.zip | 2007-03-24 02:57 | 298K | |
![[ ]](/icons/compressed.gif) | lll_nyaralj_velunk_az_altaj.zip | 2007-03-20 00:11 | 298K | |
![[ ]](/icons/compressed.gif) | koontz_dean_r_hideg_tuz_hu_txt_nncl3214-722v1.zip | 2007-03-24 02:52 | 297K | |
![[ ]](/icons/compressed.gif) | fekete_istvan_bogancs_hu_rtf.zip | 2007-03-24 02:57 | 297K | |
![[ ]](/icons/compressed.gif) | koontz_dean_r_a_halottlato_hu_doc_nncl3242-72av1.zip | 2007-03-24 02:52 | 297K | |
![[ ]](/icons/compressed.gif) | baldwin_louis_nagy_emberek_nagy_szerelmei_hu_rtf.zip | 2007-03-24 02:57 | 297K | |
![[ ]](/icons/layout.gif) | Nhil Bhog.pdf | 2007-03-24 02:54 | 297K | |
![[ ]](/icons/compressed.gif) | wodehouse_p_g_rengeteg_penz_hu_doc_nncl3132-706v1.zip | 2007-03-24 02:58 | 297K | |
![[ ]](/icons/compressed.gif) | beljajev_alekszandr_dowell_professzor_feje_hu_rtf.zip | 2007-03-24 02:49 | 296K | |
![[ ]](/icons/compressed.gif) | Beljajev, Alekszandr - Dowell professzor feje hu rtf.zip | 2006-05-30 18:03 | 296K | |
![[ ]](/icons/compressed.gif) | zola_emile_a_hajsza_rtf.zip | 2007-03-24 02:53 | 296K | |
![[ ]](/icons/compressed.gif) | rice_anne_pandora_hu_rtf.zip | 2006-05-29 05:16 | 296K | |
![[ ]](/icons/compressed.gif) | fable_vavyan_edes_mint_a_bun_hu_rtf.zip | 2007-03-24 03:01 | 296K | |
![[ ]](/icons/compressed.gif) | gorkij_maxim_az_anya_rtf.zip | 2007-03-24 02:57 | 296K | |
![[ ]](/icons/compressed.gif) | cook_rick_varazslo_atok_hu_rtf.zip | 2007-03-24 02:59 | 296K | |
![[ ]](/icons/compressed.gif) | Raoul Renier - Acél és oroszlán.zip | 2007-04-06 11:06 | 296K | |
![[ ]](/icons/compressed.gif) | illyes_gyula_a_szentlelek_karavanja_html.zip | 2007-03-24 02:55 | 296K | |
![[ ]](/icons/unknown.gif) | 05 - Wayne Chapman & Ed Fisher - Odalent.doc | 2007-03-24 02:54 | 296K | |
![[ ]](/icons/compressed.gif) | hawke_simon_kitaszitott_hu_rtf_nncl2463-68ev1.zip | 2007-03-24 03:00 | 295K | |
![[ ]](/icons/compressed.gif) | chandler_raymond_a_kicsi_nover_hu_rtf.zip | 2007-03-24 02:59 | 295K | |
![[ ]](/icons/compressed.gif) | Regény - 1. Alkony bolygó.zip | 2007-03-26 19:02 | 295K | |
![[ ]](/icons/compressed.gif) | heyerdahl_thor_tutajjal_a_csendes_oceanon_hu_rtf.zip | 2007-03-24 03:00 | 295K | |
![[ ]](/icons/compressed.gif) | moore_michael_hulye_feher_ember_hu_rtf.zip | 2007-03-24 02:57 | 294K | |
![[ ]](/icons/compressed.gif) | Nagyszekely Istvan-Jin es Jang.zip | 2007-03-24 02:58 | 294K | |
![[ ]](/icons/compressed.gif) | chapman_wayne_a_ket_hold_hu_rtf_nncl2706-6cav1.zip | 2007-03-24 03:01 | 294K | |
![[ ]](/icons/unknown.gif) | Robert Merle-Vedett ferfiak | 2007-03-24 02:59 | 294K | |
![[ ]](/icons/layout.gif) | A régi-új védelmi rendszer - (A Better Mousetrap).pdf | 2007-05-03 07:35 | 294K | |
![[ ]](/icons/compressed.gif) | Petrov,Jevgenyij-Tizenket szek.zip | 2007-03-24 02:58 | 294K | |
![[ ]](/icons/compressed.gif) | deitz_tom_a_szelek_uranak_vegzete_hu_rtf.zip | 2007-03-24 03:00 | 294K | |
![[ ]](/icons/unknown.gif) | Dante-Isteni szinjatek.ZIP | 2007-03-24 02:52 | 294K | |
![[ ]](/icons/unknown.gif) | a_psziborgok_almai.rtf | 2007-11-14 02:19 | 294K | |
![[ ]](/icons/compressed.gif) | zola_emile_parizs_gyomra_rtf.zip | 2007-03-24 02:53 | 294K | |
![[ ]](/icons/unknown.gif) | aranyhalo.rtf | 2007-03-24 02:58 | 294K | |
![[ ]](/icons/compressed.gif) | berkesi_andras_ha_az_igazsagra_eskudtel_hu_txt.zip | 2007-03-24 02:50 | 294K | |
![[ ]](/icons/compressed.gif) | moricz_zsigmond_a_nap_arnyeka_rtf.zip | 2007-03-24 02:58 | 293K | |
![[ ]](/icons/compressed.gif) | Goldziher Ignac-Az Iszlam kulturaja.zip | 2007-03-24 02:53 | 293K | |
![[ ]](/icons/compressed.gif) | jeschke_wolfgang_midas_meamone_szeme_hu_rtf_ncl2551-6a2v1.zip | 2007-03-24 03:01 | 293K | |
![[ ]](/icons/compressed.gif) | fekete_istvan_tuskevar_hu_rtf.zip | 2007-03-24 02:57 | 293K | |
![[ ]](/icons/compressed.gif) | Herbert W. Franke - Az orchideák bolygója.zip | 2006-05-31 06:14 | 293K | |
![[ ]](/icons/compressed.gif) | marsh_evelyn_afrodite_sikolya_hu_doc.zip | 2007-03-24 02:53 | 293K | |
![[ ]](/icons/unknown.gif) | john_gregory_betancourt-klanhaboru.rtf | 2007-11-14 09:03 | 293K | |
![[ ]](/icons/layout.gif) | a_verengzes_kardja.pdf | 2007-04-15 15:32 | 293K | |
![[ ]](/icons/compressed.gif) | szava_istvan_a_menlo_parki_varazslo_hu_doc.zip | 2007-03-24 03:00 | 293K | |
![[ ]](/icons/compressed.gif) | jokai_mor_de_kar_megvenulni_html.zip | 2007-03-24 02:56 | 293K | |
![[ ]](/icons/compressed.gif) | galaktika_102_hu_doc.zip | 2007-08-04 15:18 | 293K | |
![[ ]](/icons/compressed.gif) | deighton_len_ragyogj_ragyogj_kicsi_kem_hu_doc_nncl2905-6f3v1.zip | 2007-03-24 02:57 | 293K | |
![[ ]](/icons/compressed.gif) | diderot_denis_fecsego_csecsebecsek_hu_rtf_nncl2674-6c2v1.zip | 2007-03-24 02:52 | 292K | |
![[ ]](/icons/compressed.gif) | Terry Prachett-A MAGIA SZINE.zip | 2007-03-24 03:00 | 292K | |
![[ ]](/icons/compressed.gif) | marsh_evelyn_hideg_oleles_hu_doc.zip | 2007-03-24 02:53 | 292K | |
![[ ]](/icons/compressed.gif) | Zsoldos Péter - A holtak nem vetnek árnyékot.doc.zip | 2006-05-30 19:54 | 292K | |
![[ ]](/icons/unknown.gif) | 3_merkur.rtf | 2007-11-14 09:15 | 292K | |
![[ ]](/icons/layout.gif) | Börtönsziget.pdf | 2007-04-15 16:23 | 292K | |
![[ ]](/icons/compressed.gif) | sherman_james_r_phd_csinald!_hu_doc.zip | 2007-03-24 02:55 | 292K | |
![[ ]](/icons/compressed.gif) | cook_robin_invazio_hu_rtf.zip | 2007-03-24 02:53 | 292K | |
![[ ]](/icons/compressed.gif) | cook_robin_invazio.zip | 2007-03-24 03:00 | 292K | |
![[ ]](/icons/compressed.gif) | Krupkat_gunther_amikor_meghaltak_az_istenek_hu_rtf.zip | 2006-05-29 00:15 | 291K | |
![[ ]](/icons/compressed.gif) | Gunter Krupkat-Amikor meghaltak az istenek.zip | 2007-03-24 02:55 | 291K | |
![[ ]](/icons/compressed.gif) | christie_agatha_halal_a_felhok_kozott_hu_rtf.zip | 2007-03-24 02:49 | 291K | |
![[ ]](/icons/unknown.gif) | pokoljaras.ace | 2007-03-24 02:52 | 291K | |
![[ ]](/icons/compressed.gif) | szabo_magda_abigel_hu_doc_nncl3027-708v1.zip | 2007-03-24 03:00 | 291K | |
![[ ]](/icons/compressed.gif) | Terry Prachhett-A magia fenye.zip | 2007-03-24 03:00 | 291K | |
![[ ]](/icons/compressed.gif) | benedek_istvan_semmelweis_hu_rtf_nncl2590-6adv1.zip | 2007-03-24 02:50 | 291K | |
![[ ]](/icons/unknown.gif) | John Brunner_Kozmosz Hienai.rtf | 2007-11-14 04:16 | 291K | |
![[ ]](/icons/compressed.gif) | Szilmarilok.zip | 2007-02-21 16:24 | 291K | |
![[ ]](/icons/compressed.gif) | maclean_alistair_orulet_hu_doc_nncl2623-6b2v1.zip | 2007-03-24 02:49 | 291K | |
![[ ]](/icons/compressed.gif) | Ashenden,a hirszerzo-W.S.Maugman.zip | 2007-03-24 03:01 | 291K | |
![[ ]](/icons/compressed.gif) | dante_alighieri_isteni_szinjatek_rtf.zip | 2007-03-24 02:52 | 291K | |
![[ ]](/icons/compressed.gif) | dick_philip_k_kulonvelemeny_hu_rtf_nncl2421-67cv1.0.zip | 2007-03-24 02:58 | 290K | |
![[ ]](/icons/compressed.gif) | schomburgk_hans_a_vadon_erverese_hu_doc_nncl2142-638v1.zip | 2007-03-24 02:55 | 290K | |
![[ ]](/icons/compressed.gif) | mese.zip | 2007-03-24 02:57 | 290K | |
![[ ]](/icons/unknown.gif) | osszes05.ace | 2007-03-24 02:56 | 290K | |
![[ ]](/icons/compressed.gif) | Magyar Torvenytar 1000-1526.zip | 2007-03-24 02:57 | 290K | |
![[ ]](/icons/compressed.gif) | Arthur Herzog-CET.zip | 2007-03-24 02:49 | 290K | |
![[ ]](/icons/compressed.gif) | orban_dezso_az_ezustflotta_kincse_hu_doc.zip | 2007-03-24 02:58 | 290K | |
![[ ]](/icons/compressed.gif) | branch_pamela_minden_hetfon_gyilkossag_hu_rtf.zip | 2007-03-24 02:58 | 290K | |
![[ ]](/icons/compressed.gif) | lll_a_karvaly_arnyekaban.zip | 2007-03-20 00:16 | 290K | |
![[ ]](/icons/compressed.gif) | maugham_w_somerset_ashenden_a_hirszerzo_hu_rtf.zip | 2007-03-24 03:00 | 290K | |
![[ ]](/icons/compressed.gif) | sienkiewicz_henryk_sivatagon_es_vadonban_rtf.zip | 2007-03-24 02:55 | 289K | |
![[ ]](/icons/compressed.gif) | muller_peter_boldogsag_hu_doc.zip | 2007-03-24 02:58 | 289K | |
![[ ]](/icons/compressed.gif) | Merle - Üvegfal mögött.zip | 2005-06-09 14:05 | 289K | |
![[ ]](/icons/compressed.gif) | bogati_peter_a_mahagoni_ember_hu_rtf.zip | 2007-03-24 02:52 | 289K | |
![[ ]](/icons/compressed.gif) | cook_robin_szfinx_hu_rtf.zip | 2007-03-24 03:00 | 289K | |
![[ ]](/icons/compressed.gif) | howard_robert_e_a_zsoldos_barbar_hu_rtf.zip | 2007-03-24 02:59 | 289K | |
![[ ]](/icons/compressed.gif) | HARCJATEK sci-fi antologia.zip | 2007-03-24 02:55 | 289K | |
![[ ]](/icons/compressed.gif) | steinbeck_john_csatangolasok_charleyval_hu_rtf.zip | 2007-03-24 02:56 | 289K | |
![[ ]](/icons/unknown.gif) | GREK.DOC | 2007-11-14 06:35 | 289K | |
![[ ]](/icons/compressed.gif) | leonard_elmore_szoljatok_a_kopcosnek_hu_doc_nncl2284-65cv1.zip | 2007-03-24 02:53 | 288K | |
![[ ]](/icons/compressed.gif) | Merle - Vedett ferfiak.zip | 2005-06-09 14:05 | 288K | |
![[ ]](/icons/compressed.gif) | nemere_istvan_pokoljaras_hu_rtf.zip | 2007-03-24 02:58 | 288K | |
![[ ]](/icons/compressed.gif) | Cherryh, C J - A pokol legioi hu txt.zip | 2006-05-10 08:45 | 288K | |
![[ ]](/icons/compressed.gif) | herzog_arthur_cet_hu_rtf.zip | 2007-03-24 02:49 | 288K | |
![[ ]](/icons/unknown.gif) | rejtely.doc | 2007-03-24 02:58 | 288K | |
![[ ]](/icons/compressed.gif) | christie_agatha_holttest_a_konyvtarszobaban_hu_doc.zip | 2007-03-24 02:49 | 288K | |
![[ ]](/icons/compressed.gif) | fekete_istvan_hajnal_badanyban_hu_rtf.zip | 2007-03-24 02:57 | 288K | |
![[ ]](/icons/compressed.gif) | salvatore_r_a_a_sotetseg_ostroma_hu_rtf.zip | 2006-05-29 05:39 | 288K | |
![[ ]](/icons/compressed.gif) | 09. A sötétség ostroma.zip | 2007-03-26 18:33 | 288K | |
![[ ]](/icons/compressed.gif) | asimov_isaac_kaliban.zip | 2007-03-24 02:55 | 288K | |
![[ ]](/icons/compressed.gif) | wells_h_g_kipps_rtf.zip | 2007-03-24 02:55 | 288K | |
![[ ]](/icons/compressed.gif) | moldova_gyorgy_tel_tabornok_html.zip | 2007-03-24 02:58 | 287K | |
![[ ]](/icons/compressed.gif) | zahn_timothy_a_birodalom_orokosei_hu.zip | 2007-03-24 03:00 | 287K | |
![[ ]](/icons/compressed.gif) | zahn_timothy_a_birodalom_orokosei.zip | 2006-05-10 22:59 | 287K | |
![[ ]](/icons/compressed.gif) | gwylin_gwyn_a_szorakozott_varazslo_hu_doc.zip | 2007-03-24 02:55 | 287K | |
![[ ]](/icons/compressed.gif) | cook_robin_halalfelelem_hu_doc_nncl2176-63ev1.zip | 2007-03-24 03:00 | 287K | |
![[ ]](/icons/compressed.gif) | marsh_evelyn_a_gyogyito_buddha_hu_doc.zip | 2007-03-24 02:53 | 286K | |
![[ ]](/icons/compressed.gif) | Arthur Ransome-Peter Duck.zip | 2007-03-24 02:49 | 286K | |
![[ ]](/icons/unknown.gif) | osszes16.ace | 2007-03-24 02:56 | 286K | |
![[ ]](/icons/compressed.gif) | green_simon_r_minden_a_gyoztese_hu_rtf.zip | 2007-03-24 03:00 | 286K | |
![[ ]](/icons/compressed.gif) | Ryan Hawkwood - Árnyjáték.zip | 2007-04-06 11:07 | 286K | |
![[ ]](/icons/unknown.gif) | 03 - Jan van Den Boomen - Homokszem, mint megannyi.doc | 2007-03-24 02:54 | 286K | |
![[ ]](/icons/compressed.gif) | card_orson_scott_multfigyelok_hu_txt.zip | 2007-03-24 02:58 | 286K | |
![[ ]](/icons/compressed.gif) | szentivanyi_jeno_fegyverdorges_es_tengerar_hu_rtf.zip | 2007-03-24 03:00 | 286K | |
![[ ]](/icons/compressed.gif) | carroll_lewis_alice_tukororszagban_pdf.zip | 2007-03-24 02:57 | 286K | |
![[ ]](/icons/compressed.gif) | gemmel_david_kiraly_a_kapun_tulrol_hu_rtf.zip | 2007-03-24 02:52 | 286K | |
![[ ]](/icons/compressed.gif) | foster_alan_dean_kiberritus_hu_rtf.zip | 2007-03-24 02:49 | 286K | |
![[ ]](/icons/compressed.gif) | Foster, Alan Dean - Kiberritus_hu_rtf.zip | 2007-02-21 16:33 | 286K | |
![[ ]](/icons/compressed.gif) | Frederick Forsyth-Odessa Ugyirat.zip | 2007-03-24 02:54 | 286K | |
![[ ]](/icons/compressed.gif) | Alan Dean Foster-Kiberritus.zip | 2007-03-24 02:49 | 286K | |
![[ ]](/icons/compressed.gif) | forsyth_frederick_odessa_ugyirat_hu_rtf.zip | 2007-03-24 02:54 | 285K | |
![[ ]](/icons/compressed.gif) | sztrugackij_a_b_erdei_kanyarulatnal_hu_rtf.zip | 2007-03-24 02:49 | 285K | |
![[ ]](/icons/compressed.gif) | Tamasi Aron-Ragyog egy csillag.zip | 2007-03-24 02:55 | 285K | |
![[ ]](/icons/unknown.gif) | 1.a_hajnal_lovagja.rtf | 2005-06-06 21:29 | 285K | |
![[ ]](/icons/compressed.gif) | ronaszegi_miklos_az_indian_hercegno_hu_rtf_nncl2785-6dcv1.zip | 2007-03-24 03:00 | 285K | |
![[ ]](/icons/compressed.gif) | salvatore_r_a_a_csend_pengei_hu_rtf.zip | 2006-05-29 05:31 | 285K | |
![[ ]](/icons/compressed.gif) | clarke_arthur_c_holdrenges_hu_rtf.zip | 2007-03-24 02:49 | 285K | |
![[ ]](/icons/compressed.gif) | clarke_arthur_c_holdrenges_hu_doc.zip | 2007-03-24 02:49 | 285K | |
![[ ]](/icons/compressed.gif) | greene_graham_az_isztambuli_vonat_hu_rtf.zip | 2007-03-24 02:55 | 285K | |
![[ ]](/icons/compressed.gif) | 11. A csend pengéi.zip | 2007-03-26 18:33 | 285K | |
![[ ]](/icons/compressed.gif) | gardner_erle_stanley_a_baglyok_nem_pislognak_hu_rtf.zip | 2007-03-24 02:53 | 285K | |
![[ ]](/icons/compressed.gif) | A baglyok nem pislognak-E S Gardner.zip | 2007-03-24 02:53 | 285K | |
![[ ]](/icons/compressed.gif) | faulkner_william_zsivanyok_hu_rtf_nncl2265-651v1.zip | 2007-03-24 03:01 | 285K | |
![[ ]](/icons/compressed.gif) | geller_uri_a_siker_titka_hu_rtf.zip | 2007-03-24 03:00 | 284K | |
![[ ]](/icons/compressed.gif) | sethfield_christopher_tulelok_haboruja_halaloszto_2029_hu_rtf_nncl2371-66dv1.zip | 2007-03-24 03:00 | 284K | |
![[ ]](/icons/compressed.gif) | homerosz_odusszea.zip | 2007-03-24 02:55 | 284K | |
![[ ]](/icons/compressed.gif) | hedervari_peter_a_javai_tekercsek_hu_doc_nncl2924-6f3v1.zip | 2007-03-24 02:55 | 284K | |
![[ ]](/icons/compressed.gif) | cook_robin_eletjel_hu_txt_nncl2351-667v1.zip | 2007-03-24 03:00 | 284K | |
![[ ]](/icons/compressed.gif) | feher_tibor_biborvaros_hu_doc_nncl3017-708v1.zip | 2007-03-24 02:54 | 284K | |
![[ ]](/icons/compressed.gif) | golding_william_a_legyek_ura_hu_rtf.zip | 2007-03-24 03:01 | 284K | |
![[ ]](/icons/compressed.gif) | Merle - Allati elmek.zip | 2005-06-09 13:57 | 284K | |
![[ ]](/icons/unknown.gif) | osszes52.ace | 2007-03-24 02:56 | 283K | |
![[ ]](/icons/unknown.gif) | osszes42.ace | 2007-03-24 02:56 | 283K | |
![[ ]](/icons/compressed.gif) | mansfield_michael_tuzliderc_hu_doc_nncl2056-62av2.zip | 2007-03-24 02:57 | 283K | |
![[ ]](/icons/compressed.gif) | verne_jules_vilagfelfordulas_rtf.zip | 2007-03-24 02:56 | 283K | |
![[ ]](/icons/compressed.gif) | doyle_arthur_conan_sherlock_holmes_kalandjai_hu_rtf.zip | 2007-03-24 02:49 | 283K | |
![[ ]](/icons/compressed.gif) | clarke_arthur_c_isten_porolye_hu_rtf.zip | 2007-03-24 02:49 | 283K | |
![[ ]](/icons/compressed.gif) | Arthur C. Clarke - Isten pörölye hu rtf.zip | 2006-05-10 17:33 | 283K | |
![[ ]](/icons/compressed.gif) | rivers_gayle_a_profi_hu_rtf.zip | 2007-03-24 02:54 | 283K | |
![[ ]](/icons/compressed.gif) | balzac_honore_de_cesar_birotteau_nagysaga_es_bukasa_rtf.zip | 2007-03-24 02:55 | 282K | |
![[ ]](/icons/compressed.gif) | le_guin_ursula_k_a_sotetseg_balkeze_hu_rtf.zip | 2007-03-24 03:00 | 282K | |
![[ ]](/icons/compressed.gif) | maupassant_a_szepfiu_rtf.zip | 2007-03-24 02:55 | 282K | |
![[ ]](/icons/compressed.gif) | centkiewicz_centkiewicz_tumbo_kalandjai_hu_doc_nncl3041-706v1.zip | 2007-03-24 02:49 | 282K | |
![[ ]](/icons/compressed.gif) | benedek_elek_magyar_mesek_hu_rtf.zip | 2007-03-24 02:57 | 282K | |
![[ ]](/icons/compressed.gif) | moldova_gyorgy_a_naplo_html.zip | 2007-03-24 02:58 | 282K | |
![[ ]](/icons/compressed.gif) | collins_max_allan_helyszinelok_floridai_amokfutas_hu_doc_nncl3267-732v1.zip | 2007-03-24 02:57 | 282K | |
![[ ]](/icons/compressed.gif) | bischoff_david_a_kiralyno_neveben_hu_rtf.zip | 2007-03-24 02:49 | 282K | |
![[ ]](/icons/compressed.gif) | Seth megszólal.zip | 2007-03-24 02:56 | 282K | |
![[ ]](/icons/compressed.gif) | fekete_istvan_csi_hu_html.zip | 2007-03-24 02:57 | 282K | |
![[ ]](/icons/compressed.gif) | Dale Avery - A renagát.zip | 2007-04-06 11:05 | 282K | |
![[ ]](/icons/compressed.gif) | nietzsche_frigyes_imigyen_szola_zarathustra_hu_rtf.zip | 2007-03-24 02:54 | 282K | |
![[ ]](/icons/compressed.gif) | Csillaguzott_szereto.zip | 2007-03-24 03:00 | 281K | |
![[ ]](/icons/compressed.gif) | marsh_evelyn_menekules_hu_doc.zip | 2007-03-24 02:53 | 281K | |
![[ ]](/icons/compressed.gif) | 03. Menedék.zip | 2007-03-26 18:33 | 281K | |
![[ ]](/icons/compressed.gif) | salvatore_r_a_menedek_hu_rtf.zip | 2006-05-29 06:09 | 281K | |
![[ ]](/icons/compressed.gif) | asimov_isaac_az_ur_aramlatai_hu_rtf.zip | 2007-03-24 02:55 | 281K | |
![[ ]](/icons/compressed.gif) | marsh_evelyn_az_alarc_lehull_hu_doc.zip | 2007-03-24 02:53 | 280K | |
![[ ]](/icons/compressed.gif) | dery_tibor_kepzelt_riport_egy_a_felfulu_hu_rtf_nncl2696-6c6v1.zip | 2007-03-24 02:52 | 280K | |
![[ ]](/icons/layout.gif) | Rak_hu_naggol.pdf | 2007-04-15 16:51 | 280K | |
![[ ]](/icons/compressed.gif) | Robert Sheckley-Kozmikus fonyeremeny.zip | 2007-03-24 02:59 | 280K | |
![[TXT]](/icons/text.gif) | 2017 Hőhullám New Yorkban.txt | 2007-03-24 02:57 | 280K | |
![[ ]](/icons/compressed.gif) | dinopark.zip | 2007-08-04 15:06 | 280K | |
![[ ]](/icons/compressed.gif) | ykpdf_nhil_bhog.zip | 2007-03-24 02:54 | 280K | |
![[ ]](/icons/unknown.gif) | egymilliard_evvel_a_vilagvege_elott.rtf | 2007-11-13 23:26 | 280K | |
![[ ]](/icons/compressed.gif) | sos_gyorgy_a_szurke_auto_utasai_hu_doc.zip | 2007-03-24 03:00 | 280K | |
![[ ]](/icons/compressed.gif) | sillitoe_alan_kisregenyek_hu_rtf_nncl2675-6c2v1.zip | 2007-03-24 02:49 | 280K | |
![[ ]](/icons/compressed.gif) | Csernai Zoltan-A Boldogsagcsinalo.zip | 2007-03-24 02:52 | 279K | |
![[ ]](/icons/compressed.gif) | quinnell_a_j_a_zsoldos_hu_rtf_nncl2473-68ev1.zip | 2007-03-24 02:49 | 279K | |
![[ ]](/icons/compressed.gif) | kerouac_jan_gazos_bebi_hu_rtf_nncl1964-614v2.zip | 2007-03-24 02:55 | 279K | |
![[ ]](/icons/compressed.gif) | Robin Cook-A gyotrelem eve.zip | 2007-03-24 03:00 | 279K | |
![[ ]](/icons/compressed.gif) | pardoe_blaine_lee_a_kivonulas_utja_hu_rtf_nncl2054-62av2.zip | 2007-03-24 02:51 | 279K | |
![[ ]](/icons/compressed.gif) | martinov_georgij_tamadas_a_fold_ellen_hu_doc.zip | 2007-03-24 02:54 | 279K | |
![[ ]](/icons/compressed.gif) | molnar_gabor_a_dzsungel_doktora_hu_rtf_nncl2110_636v1.zip | 2007-03-24 02:58 | 279K | |
![[ ]](/icons/compressed.gif) | heinlein_robert_orjarat_a_vilagurben.zip | 2007-03-24 02:59 | 279K | |
![[ ]](/icons/compressed.gif) | 17. Két kard.zip | 2007-03-26 18:34 | 279K | |
![[ ]](/icons/compressed.gif) | Robert Sheckley-Szabadpreda.zip | 2007-03-24 02:59 | 279K | |
![[ ]](/icons/compressed.gif) | Thomas Harris-A baranyok hallgatnak.zip | 2007-03-24 03:00 | 279K | |
![[ ]](/icons/compressed.gif) | esterhazy_peter_egy_kek_haris_html.zip | 2007-03-24 02:53 | 278K | |
![[ ]](/icons/compressed.gif) | kertesz_akos_makra_hu_doc_nncl2573-6a7v1.zip | 2007-03-24 02:56 | 278K | |
![[ ]](/icons/compressed.gif) | feher_klara_foldrengesek_szigete_txt.zip | 2007-03-24 02:54 | 278K | |
![[ ]](/icons/compressed.gif) | ransome_arthur_galambposta_hu_doc_nncl3098-706v1.zip | 2007-03-24 02:49 | 278K | |
![[ ]](/icons/compressed.gif) | harris_thomas_a_baranyok_hallgatnak_hu_rtf.zip | 2007-03-24 03:00 | 278K | |
![[ ]](/icons/compressed.gif) | marsh_evelyn_halalos_dozis_hu_doc.zip | 2007-03-24 02:53 | 278K | |
![[ ]](/icons/compressed.gif) | burgess_anthony_beteg_a_doktor_hu_doc_nncl2052-62av1.zip | 2007-03-24 02:49 | 278K | |
![[ ]](/icons/compressed.gif) | hegedus_hubert_matrozeveim_hu_rtf.zip | 2007-03-24 02:55 | 278K | |
![[ ]](/icons/compressed.gif) | hailey_arthur_a_vegso_diagnozis_hu_txt.zip | 2007-03-24 02:49 | 278K | |
![[ ]](/icons/compressed.gif) | salvatore_r_a_csillagtalan_ej_hu_rtf.zip | 2006-05-29 05:46 | 278K | |
![[ ]](/icons/compressed.gif) | petofi_sandor_ibolyak_pdf.zip | 2007-03-24 02:55 | 278K | |
![[ ]](/icons/unknown.gif) | 01 - Wayne Chapman - Jutalomjáték.doc | 2007-04-02 22:08 | 278K | |
![[ ]](/icons/compressed.gif) | 06. A félszerzet ékköve.zip | 2007-03-26 18:33 | 277K | |
![[ ]](/icons/compressed.gif) | 08. Csillagtalan éj.zip | 2007-03-26 18:33 | 277K | |
![[ ]](/icons/compressed.gif) | salvatore_r_a_a_felszerzet_ekkove_hu_rtf.zip | 2006-05-29 05:34 | 277K | |
![[ ]](/icons/compressed.gif) | rakoczi_ferenc_kialtvanya_pdf.zip | 2007-03-24 02:58 | 277K | |
![[ ]](/icons/compressed.gif) | lamour_louis_ket_szeker_arany_hu_rtf.zip | 2007-03-24 02:57 | 277K | |
![[ ]](/icons/compressed.gif) | Csernai Zoltán - A boldogságcsináló.zip | 2007-03-23 20:20 | 277K | |
![[ ]](/icons/compressed.gif) | csernai_zoltan_boldogsagcsinalo_NNCL143_hu_rtf.zip | 2007-03-24 02:52 | 277K | |
![[ ]](/icons/unknown.gif) | Kozmikus összecsapás.rtf | 2004-07-19 14:05 | 277K | |
![[ ]](/icons/compressed.gif) | Wayne Chapman - Garmacor címere.zip | 2007-03-23 05:20 | 277K | |
![[ ]](/icons/compressed.gif) | berkesi_andras_szelcsend_hu_txt.zip | 2007-03-24 02:50 | 277K | |
![[ ]](/icons/compressed.gif) | 4. Damian Forrestal - Aliens vs Predator, Játék neve halál.zip | 2007-03-23 19:32 | 277K | |
![[ ]](/icons/compressed.gif) | chandler_raymond_kedvesem_isten_veled_hu_rtf.zip | 2007-03-24 02:59 | 277K | |
![[ ]](/icons/unknown.gif) | Zarándoklat és felkészülés - Végigjátszás I. rész | 2007-05-03 07:27 | 277K | |
![[ ]](/icons/compressed.gif) | king_stephen_cujo_hu_rtf.zip | 2007-03-24 03:00 | 277K | |
![[ ]](/icons/compressed.gif) | gibson_william_mona_lisa_overdrive_hu_rtf.zip | 2007-03-24 03:01 | 277K | |
![[ ]](/icons/compressed.gif) | Wiliam Gibson-Mona Lisa overdrive.zip | 2007-03-24 03:01 | 277K | |
![[ ]](/icons/compressed.gif) | marsh_evelyn_torkodbol_a_sikoly_hu_doc.zip | 2007-03-24 02:53 | 277K | |
![[ ]](/icons/compressed.gif) | zappa_moon_unit_amerika_szepsegem_hu_rtf.zip | 2007-03-24 02:58 | 277K | |
![[ ]](/icons/compressed.gif) | Isaac Asimov - Superneutron.zip | 2007-03-22 05:30 | 276K | |
![[ ]](/icons/unknown.gif) | hulye_feher_ember.ace | 2007-03-24 02:52 | 276K | |
![[ ]](/icons/compressed.gif) | manyi_laszlo_a_zold_jaguar_titka_hu_doc_nncl3077-706v1.zip | 2007-03-24 02:57 | 276K | |
![[ ]](/icons/compressed.gif) | jakubovszkij_aszkold_a_galaktika_kupolaja_hu_rtf.zip | 2007-03-24 02:49 | 276K | |
![[ ]](/icons/compressed.gif) | a_galaktika_kupolaja.zip | 2007-08-04 14:29 | 276K | |
![[ ]](/icons/compressed.gif) | marsh_evelyn_lopakodo_halal_hu_doc.zip | 2007-03-24 02:53 | 276K | |
![[ ]](/icons/compressed.gif) | cook_robin_a_gyotrelem_eve_hu_rtf.zip | 2007-03-24 03:00 | 276K | |
![[ ]](/icons/unknown.gif) | orokkevalosag.ace | 2007-03-24 02:52 | 276K | |
![[ ]](/icons/compressed.gif) | lem_stanislaw_szenanatha_hu_rtf.zip | 2007-03-24 03:00 | 275K | |
![[ ]](/icons/compressed.gif) | berkesi_andras_a_13_ugynok_hu_txt.zip | 2007-03-24 02:50 | 275K | |
![[ ]](/icons/compressed.gif) | Robin Cook-Akar az isten.zip | 2007-03-24 03:00 | 275K | |
![[ ]](/icons/compressed.gif) | takats_sandor_buda_ket_aruloja_hu_rtf_nncl2212-648v1.zip | 2007-03-24 03:00 | 275K | |
![[ ]](/icons/compressed.gif) | Pilip K Dick-Transz.zip | 2007-03-24 02:58 | 275K | |
![[ ]](/icons/compressed.gif) | Tovatuno alom.zip | 2007-03-24 02:53 | 275K | |
![[ ]](/icons/compressed.gif) | sethfield_christopher_fempokol_hu_doc.zip | 2007-03-24 03:00 | 275K | |
![[ ]](/icons/compressed.gif) | cook_robin_akar_az_isten_hu_rtf.zip | 2007-03-24 03:00 | 275K | |
![[ ]](/icons/compressed.gif) | balzac_honore_de_a_kalandor_rtf.zip | 2007-03-24 02:55 | 275K | |
![[ ]](/icons/unknown.gif) | AZ UTOLSÓ EMBER.ace | 2007-03-24 02:52 | 275K | |
![[ ]](/icons/compressed.gif) | klatt_edith_renszarvasok_pasztora_hu_doc_nncl2922-6f3v1.zip | 2007-03-24 02:56 | 275K | |
![[ ]](/icons/compressed.gif) | abe_kobo_a_dobozember_hu_rtf_nncl1476-51dv1.zip | 2007-03-24 02:49 | 275K | |
![[ ]](/icons/compressed.gif) | fust_milan_a_mester_en_vagyok_html.zip | 2007-03-24 02:54 | 275K | |
![[ ]](/icons/compressed.gif) | collins_max_allan_maverick_hu_doc_nncl2460-68ev1.zip | 2007-03-24 02:57 | 275K | |
![[ ]](/icons/compressed.gif) | defoe_daniel_jack_ezredes_rtf.zip | 2007-03-24 02:52 | 274K | |
![[ ]](/icons/compressed.gif) | teas_t_o_ojabun_hu_rtf_nncl2314-65ev1.zip | 2007-03-24 03:00 | 274K | |
![[ ]](/icons/compressed.gif) | lll_sindzse_szeme.zip | 2007-03-20 00:17 | 274K | |
![[ ]](/icons/compressed.gif) | reid_thomas_mayne_a_feher_torzsfonok_hu_rtf.zip | 2007-03-24 03:00 | 274K | |
![[ ]](/icons/compressed.gif) | marsh_evelyn_az_orvosi_esku_hu_doc.zip | 2007-03-24 02:53 | 274K | |
![[ ]](/icons/compressed.gif) | osero_h.zip | 2007-03-24 03:00 | 274K | |
![[ ]](/icons/unknown.gif) | osszes44.ace | 2007-03-24 02:56 | 274K | |
![[ ]](/icons/compressed.gif) | dedkova_jarmila_martina_ujra_tancol_hu_doc_nncl3048-706v1.zip | 2007-03-24 02:56 | 274K | |
![[ ]](/icons/compressed.gif) | marks_j_m_osszeeskuves_elmelet_hu_doc.zip | 2007-03-24 02:55 | 273K | |
![[ ]](/icons/compressed.gif) | gLarry Niven-gyuruvilag.zip | 2007-03-24 02:55 | 273K | |
![[ ]](/icons/compressed.gif) | liptak_gabor_amirol_a_vizek_beszelnek_hu_rtf.zip | 2007-03-24 02:57 | 273K | |
![[ ]](/icons/unknown.gif) | gyilkosido.ace | 2007-03-24 02:52 | 273K | |
![[ ]](/icons/compressed.gif) | verne_jules_hodito_robur_rtf.zip | 2007-03-24 02:56 | 273K | |
![[ ]](/icons/compressed.gif) | fekete_istvan_lutra_hu_rtf.zip | 2007-03-24 02:57 | 273K | |
![[ ]](/icons/compressed.gif) | jokai_mor_valogatott_elbeszelesei_html.zip | 2007-03-24 02:56 | 273K | |
![[ ]](/icons/unknown.gif) | hal_clement-csillagfeny.rtf | 2007-11-13 23:18 | 273K | |
![[ ]](/icons/compressed.gif) | sienkiewicz_henryk_orveny_rtf.zip | 2007-03-24 02:55 | 272K | |
![[ ]](/icons/compressed.gif) | verne_jules_a_tizenot_eves_kapitany_rtf.zip | 2007-03-24 02:56 | 272K | |
![[ ]](/icons/compressed.gif) | norton_andre_idoharcosok_hu_rtf.zip | 2007-03-24 02:49 | 272K | |
![[ ]](/icons/compressed.gif) | Norton, Andre - Idoharcosok hu rtf.zip | 2006-05-30 21:35 | 272K | |
![[ ]](/icons/unknown.gif) | A szarvasvadász.rtf | 2007-03-24 02:53 | 272K | |
![[ ]](/icons/compressed.gif) | arisztotelesz_poetika_hu_pdf_nncl2071-62bv1.zip | 2007-03-24 02:49 | 272K | |
![[ ]](/icons/compressed.gif) | shan_darren_a_lelkek_tava_hu_rtf.zip | 2007-03-24 02:52 | 272K | |
![[ ]](/icons/unknown.gif) | 09 - Ed Fisher - Holtak légiója.doc | 2007-03-24 02:54 | 272K | |
![[ ]](/icons/compressed.gif) | saul_john_sotetseg_hu_rtf.zip | 2007-03-24 02:56 | 272K | |
![[ ]](/icons/unknown.gif) | Út a teljességhez.ace | 2007-03-24 03:00 | 272K | |
![[ ]](/icons/compressed.gif) | crispin_a_c_az_orokkevalosag_orzoje_hu_rtf.zip | 2007-03-24 02:49 | 272K | |
![[ ]](/icons/compressed.gif) | Jules Verne-A tizenot eves kapitany.zip | 2007-03-24 02:56 | 271K | |
![[ ]](/icons/compressed.gif) | Gaspar Andras-Ezust felhold blues.zip | 2007-03-24 02:54 | 271K | |
![[ ]](/icons/compressed.gif) | anderson_kevin_j_sotetkard.zip | 2006-05-16 10:15 | 271K | |
![[ ]](/icons/compressed.gif) | Regény - 2. Sötét Kard.zip | 2007-03-26 19:02 | 271K | |
![[ ]](/icons/compressed.gif) | hoyle_fred_osszian_kuldetese_hu_html.zip | 2007-03-24 02:54 | 271K | |
![[ ]](/icons/compressed.gif) | Swedenbor Emanuel-Menny es pokol.zip | 2007-03-24 03:00 | 271K | |
![[ ]](/icons/compressed.gif) | SW - sötétkard.zip | 2007-03-26 19:02 | 271K | |
![[ ]](/icons/compressed.gif) | anderson_kevin_j_sotetkard_hu_rtf.zip | 2006-05-10 06:25 | 271K | |
![[ ]](/icons/compressed.gif) | Sötétkard.zip | 2007-03-24 02:54 | 271K | |
![[ ]](/icons/compressed.gif) | breza_tadeusz_a_hivatal_hu_rtf.zip | 2007-03-24 03:00 | 271K | |
![[ ]](/icons/compressed.gif) | niven_larry_gyuruvilag.zip | 2007-03-24 02:58 | 271K | |
![[ ]](/icons/compressed.gif) | Larry Niven - Gyuruvilag.zip | 2007-02-21 16:34 | 271K | |
![[ ]](/icons/compressed.gif) | cannon_titus_talan_hu_rtf.zip | 2007-03-24 03:00 | 270K | |
![[ ]](/icons/compressed.gif) | gardonyi_geza_isten_rabjai_rtf.zip | 2007-03-24 02:54 | 270K | |
![[ ]](/icons/compressed.gif) | pausztovszkij_konsztantyin_a_pilota_naploja_hu_doc_nncl1559-534v2.zip | 2007-03-24 02:56 | 270K | |
![[ ]](/icons/compressed.gif) | feher_klara_gyilkossag_a_capa_obolben_hu_rtf.zip | 2007-03-24 02:54 | 270K | |
![[ ]](/icons/compressed.gif) | graves_robert_homerosz_leanya_hu_rtf.zip | 2007-03-24 02:59 | 270K | |
![[ ]](/icons/compressed.gif) | Uj Solo - 2. Hutt játszma.zip | 2007-03-26 19:02 | 270K | |
![[ ]](/icons/compressed.gif) | SW - A hutt játszma.zip | 2007-03-26 19:02 | 270K | |
![[ ]](/icons/compressed.gif) | verne_jules_eszak_del_ellen_rtf.zip | 2007-03-24 02:56 | 269K | |
![[ ]](/icons/compressed.gif) | crispin_a_c_a_hutt_jatszma_hu_rtf.zip | 2007-03-24 02:54 | 269K | |
![[ ]](/icons/compressed.gif) | a_hutt_jatszma.zip | 2007-03-24 02:54 | 269K | |
![[ ]](/icons/compressed.gif) | rath-vegh_istvan_a_satan_es_cimborai_hu_rtf.zip | 2007-03-24 02:59 | 269K | |
![[ ]](/icons/compressed.gif) | lem_stanislaw_kiberada.zip | 2007-03-24 03:00 | 269K | |
![[ ]](/icons/compressed.gif) | Stanislaw Lem - Kiberiada.zip | 2006-08-24 22:34 | 269K | |
![[ ]](/icons/compressed.gif) | sindzse_szeme.zip | 2007-03-24 02:57 | 269K | |
![[ ]](/icons/compressed.gif) | herbert_frank_a_dosadi_kisertet_rtf.zip | 2007-03-24 02:54 | 269K | |
![[ ]](/icons/compressed.gif) | Frank Herbert - A Dosadi kisérlet .zip | 2007-02-21 16:30 | 269K | |
![[ ]](/icons/compressed.gif) | asimov_isaac_alapitvany_hu_rtf.zip | 2007-03-24 02:55 | 269K | |
![[ ]](/icons/compressed.gif) | daley_brian_tron_doc.zip | 2007-03-24 02:52 | 269K | |
![[ ]](/icons/compressed.gif) | Tron_doc_javitott.zip | 2007-02-21 16:24 | 269K | |
![[ ]](/icons/compressed.gif) | pohl_frederik_terror_hu_rtf.zip | 2007-03-24 02:54 | 269K | |
![[ ]](/icons/compressed.gif) | Legendák és enigmák 4.zip | 2007-04-06 11:05 | 269K | |
![[ ]](/icons/compressed.gif) | jokai_mor_az_uj_foldesur_html.zip | 2007-03-24 02:56 | 269K | |
![[ ]](/icons/compressed.gif) | jokai_anna_mi_ez_az_alom_html.zip | 2007-03-24 02:56 | 269K | |
![[ ]](/icons/compressed.gif) | Legendák és enigmák 8.zip | 2007-04-06 11:05 | 268K | |
![[ ]](/icons/compressed.gif) | marsh_evelyn_gyilkossag_a_tivoliban_hu_doc.zip | 2007-03-24 02:53 | 268K | |
![[ ]](/icons/compressed.gif) | lambert_eric_huszezer_rablo_hu_rtf_nncl1852-60av1.zip | 2007-03-24 02:53 | 268K | |
![[ ]](/icons/compressed.gif) | BD 1. Érzékeny búcsú a birodalomtól.zip | 2007-03-26 19:01 | 268K | |
![[ ]](/icons/compressed.gif) | parry_richard_vegzetes_virus_hu_rtf_nncl2960-6fav1.zip | 2007-03-24 02:59 | 268K | |
![[ ]](/icons/compressed.gif) | zsigray_julianna_merenylet_napoleon_ellen_hu_rtf.zip | 2007-03-24 03:01 | 268K | |
![[ ]](/icons/compressed.gif) | daley_brian_erzekeny_bucsu_a_birodalomtol_hu_rtf.zip | 2006-05-10 08:39 | 268K | |
![[ ]](/icons/compressed.gif) | daley_brian_erzekeny_bucsu_a_birodalomtol.zip | 2007-03-24 02:54 | 268K | |
![[ ]](/icons/compressed.gif) | werfel_franz_az_elsikkasztott_mennyorszag_hu_txt.zip | 2007-03-24 02:54 | 268K | |
![[ ]](/icons/compressed.gif) | kipling_rudyard_a_maharadzsa_kincse_hu_doc.zip | 2007-03-24 02:56 | 267K | |
![[ ]](/icons/compressed.gif) | marsh_evelyn_krizis_a_korhazban_hu_doc.zip | 2007-03-24 02:53 | 267K | |
![[ ]](/icons/compressed.gif) | saul_john_szorny_hu_rtf.zip | 2007-03-24 02:56 | 267K | |
![[ ]](/icons/compressed.gif) | feher_tibor_a_rodoszi_lovag_hu_rtf.zip | 2007-03-24 02:54 | 267K | |
![[ ]](/icons/compressed.gif) | Kalevala.zip | 2007-03-24 02:56 | 267K | |
![[ ]](/icons/compressed.gif) | remarque_erich_maria_szerelem_es_halal_oraja_hu_rtf_nncl2113-636v1.zip | 2007-03-24 02:53 | 267K | |
![[ ]](/icons/compressed.gif) | stackpole_michael_a_a_bactahaboru_hu_doc.zip | 2007-03-24 02:54 | 267K | |
![[ ]](/icons/compressed.gif) | deveraux_jude_mindorokke_hu_rtf_nncl2865-6efv1.zip | 2007-03-24 02:56 | 267K | |
![[ ]](/icons/compressed.gif) | greene_graham_merenylet_hu_doc.zip | 2007-03-24 02:55 | 267K | |
![[ ]](/icons/compressed.gif) | Graham Greene-Merenylet.zip | 2007-03-24 02:55 | 267K | |
![[ ]](/icons/compressed.gif) | salvatore_robert_a_szamuzott_hu_rtf.zip | 2006-05-29 06:13 | 266K | |
![[ ]](/icons/compressed.gif) | jokai_mor_a_historiai_tarokkparti_html.zip | 2007-03-24 02:56 | 266K | |
![[ ]](/icons/layout.gif) | Mit parancsolsz, édes gazdám.pdf | 2007-04-15 15:02 | 266K | |
![[ ]](/icons/compressed.gif) | wilson_mark_a_boldogsag_kek_szornyetege_hu_rtf.zip | 2007-03-19 19:16 | 266K | |
![[ ]](/icons/compressed.gif) | 02. Száműzött.zip | 2007-03-26 18:33 | 266K | |
![[ ]](/icons/compressed.gif) | rigby_ray_homokdomb_hu_rtf.zip | 2007-03-24 02:59 | 266K | |
![[ ]](/icons/unknown.gif) | Vérengzés Gorvikban.doc | 2007-04-15 16:34 | 266K | |
![[ ]](/icons/compressed.gif) | gibson_william_a_szamlalo_nullara_hu_rtf_nncl2963-6fav1.zip | 2007-03-24 03:01 | 266K | |
![[ ]](/icons/compressed.gif) | Revay Jozsef-A Parduc.zip | 2007-03-24 02:59 | 266K | |
![[ ]](/icons/compressed.gif) | koszegi_imre_a_kincstalalo_hu_doc.zip | 2007-03-24 02:56 | 266K | |
![[ ]](/icons/compressed.gif) | nemere_istvan_badogficko_hu_doc.zip | 2007-03-24 02:58 | 266K | |
![[ ]](/icons/compressed.gif) | forsyth_frederick_profi_munka_hu_rtf_nncl2548-6a2v1.zip | 2007-03-24 02:54 | 266K | |
![[ ]](/icons/compressed.gif) | Rudyard Kipling-A dzsungel konyve.zip | 2007-03-24 02:57 | 266K | |
![[ ]](/icons/compressed.gif) | marsh_evelyn_halal_a_mutoasztalon_hu_doc.zip | 2007-03-24 02:53 | 265K | |
![[ ]](/icons/compressed.gif) | nemere_istvan_aranybolygo_hu_rtf.zip | 2007-03-24 02:58 | 265K | |
![[ ]](/icons/compressed.gif) | marai_sandor_ami_a_naplobol_kimaradt_1948_hu_rtf_nncl2656-6bfv1.zip | 2007-03-24 02:57 | 265K | |
![[ ]](/icons/compressed.gif) | kipling_rudyard_a_dzsungel_konyve.zip | 2007-03-24 02:56 | 265K | |
![[ ]](/icons/compressed.gif) | blum_howard_bujkalo_bunosok_hu_rtf_nncl2876-6f3v1.zip | 2007-03-24 02:55 | 265K | |
![[ ]](/icons/compressed.gif) | malamud_bernard_a_mesterember_hu_rtf.zip | 2007-03-24 02:50 | 265K | |
![[ ]](/icons/compressed.gif) | wodehouse_p_g_forduljon_psmithhez_hu_rtf.zip | 2007-03-24 02:58 | 265K | |
![[ ]](/icons/compressed.gif) | P G Wodehouse-Forduljon Psmithez.zip | 2007-03-24 02:58 | 265K | |
![[ ]](/icons/layout.gif) | nyugodjbekeben.pdf | 2007-04-15 16:04 | 265K | |
![[ ]](/icons/compressed.gif) | Poul Anderson - A tengernép gyermekei.zip | 2007-03-21 19:11 | 265K | |
![[ ]](/icons/compressed.gif) | vachss_andrew_strega_hu_doc.zip | 2007-03-24 02:49 | 265K | |
![[ ]](/icons/compressed.gif) | Orson Scott Card - Végjáték.zip | 2007-03-19 18:46 | 265K | |
![[ ]](/icons/compressed.gif) | Robert N. Cherette - Jól válaszd Meg Az Ellenséget.zip | 2006-05-31 07:33 | 265K | |
![[ ]](/icons/compressed.gif) | bayer_william_a_gyilkos_solyom_hu_rtf_nncl1984-61bv1.zip | 2007-03-24 03:01 | 265K | |
![[ ]](/icons/compressed.gif) | bayer_zsolt_tundertemeto_es_egyeb_novellak_hu_rtf_nncl2505-693v1.zip | 2007-03-24 02:50 | 264K | |
![[ ]](/icons/compressed.gif) | bester_alfred_tigris_tigris_hu_rtf.zip | 2007-03-24 02:49 | 264K | |
![[ ]](/icons/compressed.gif) | Alfred Bester - Tigris tigris.zip | 2006-05-30 19:57 | 264K | |
![[ ]](/icons/compressed.gif) | Orson Scott Card - Vegjatek.zip | 2007-03-26 17:51 | 264K | |
![[ ]](/icons/compressed.gif) | lll_a_nagy_kupola_szegyene.zip | 2007-03-20 00:19 | 264K | |
![[ ]](/icons/compressed.gif) | Legendák és enigmák 6.zip | 2007-04-06 11:05 | 264K | |
![[ ]](/icons/compressed.gif) | laszlo_endre_joholdat_sziriusz_kapitany_hu_doc_nncl3071-706v1.zip | 2007-03-24 02:57 | 264K | |
![[ ]](/icons/compressed.gif) | kubasik_chris_atvaltozva_hu_rtf.zip | 2007-03-24 02:52 | 264K | |
![[ ]](/icons/compressed.gif) | crichton_michael_repulo_koporso_hu_rtf_nncl2882-6f3v1.zip | 2007-03-24 02:57 | 264K | |
![[ ]](/icons/unknown.gif) | npnaplo.ace | 2007-03-24 02:52 | 264K | |
![[ ]](/icons/compressed.gif) | doctorow_e_l_ragtime_hu_rtf.zip | 2007-03-24 02:53 | 264K | |
![[ ]](/icons/compressed.gif) | szerb_antal_utas_es_holdvilag_hu_doc_nncl1845-60av2.zip | 2007-03-24 03:00 | 264K | |
![[ ]](/icons/compressed.gif) | moricz_zsigmond_a_faklya_rtf.zip | 2007-03-24 02:58 | 263K | |
![[ ]](/icons/compressed.gif) | golding_william_a_piramis_hu_rtf.zip | 2007-03-24 03:01 | 263K | |
![[ ]](/icons/compressed.gif) | norton_andre_idoharcosok_3_hu_rtf.zip | 2007-03-24 02:49 | 263K | |
![[ ]](/icons/compressed.gif) | Norton, Andre - Idoharcosok 3 hu rtf.zip | 2006-05-30 21:34 | 263K | |
![[ ]](/icons/compressed.gif) | fast_howard_silas_timberman_hu_rtf.zip | 2007-03-24 02:55 | 263K | |
![[ ]](/icons/unknown.gif) | Hajtóvadászat.doc | 2007-04-15 15:51 | 263K | |
![[ ]](/icons/compressed.gif) | 07. Örökség.zip | 2007-03-26 18:33 | 263K | |
![[ ]](/icons/compressed.gif) | vonnegut_kurt_a_titan_szirenjei_hu_rtf.zip | 2007-03-24 02:57 | 263K | |
![[ ]](/icons/compressed.gif) | JT Chipendale - KEEC A nagy világregatta.zip | 2007-03-23 20:18 | 263K | |
![[ ]](/icons/compressed.gif) | salvatore_r_a_orokseg_hu_rtf.zip | 2006-05-29 06:12 | 263K | |
![[ ]](/icons/compressed.gif) | jarunkova_klara_az_egyetlen_hu_doc_nncl3065-706v1.zip | 2007-03-24 02:56 | 263K | |
![[ ]](/icons/compressed.gif) | moricz_zsigmond_mig_uj_a_szerelem_rtf.zip | 2007-03-24 02:58 | 263K | |
![[ ]](/icons/compressed.gif) | gosling_paula_a_voros_maja_hu_doc.zip | 2007-03-24 02:58 | 263K | |
![[ ]](/icons/compressed.gif) | teas_t_o_a_kard_elen_hu_rtf.zip | 2007-03-24 03:00 | 263K | |
![[ ]](/icons/compressed.gif) | antal_balazs_oreg_hu_html.zip | 2007-03-24 02:49 | 262K | |
![[ ]](/icons/compressed.gif) | mcpherson_stella_buja_zelandia_hu_doc_nncl3263-732v1.zip | 2007-03-24 03:00 | 262K | |
![[ ]](/icons/compressed.gif) | doyle_arthur_conan_sherlock_holmes_kalandjai_rtf.zip | 2007-03-24 02:49 | 262K | |
![[ ]](/icons/compressed.gif) | forester_cecil_scott_ofelsege_kapitanya_hu_rtf.zip | 2007-03-24 02:52 | 262K | |
![[ ]](/icons/compressed.gif) | balzac_honore_de_a_megye_muzsaja-az_arcisi_kepviselo_rtf.zip | 2007-03-24 02:55 | 262K | |
![[ ]](/icons/compressed.gif) | moorcock_michael_harcikutya.zip | 2007-03-24 02:57 | 262K | |
![[ ]](/icons/compressed.gif) | abagnale_frank_w_kapj_el_ha_tudsz_hu_rtf_nncl2874-6f3v1.zip | 2007-03-24 02:54 | 262K | |
![[ ]](/icons/unknown.gif) | 12 - Aquir mágia.doc | 2007-03-24 02:54 | 262K | |
![[ ]](/icons/compressed.gif) | stoker_bram_drakula_grof_valogatott_remtettei_hu_rtf.zip | 2007-03-24 02:52 | 262K | |
![[ ]](/icons/compressed.gif) | marsh_evelyn_vihar_a_korhaz_felett_hu_doc.zip | 2007-03-24 02:53 | 262K | |
![[ ]](/icons/compressed.gif) | maurier_daphne_du_a_francia_kaloz_szeretoje_hu_doc.zip | 2007-03-24 02:52 | 262K | |
![[ ]](/icons/compressed.gif) | macdonald_ross_a_csontketrec_hu_doc_nncl2907-6f3v1.zip | 2007-03-24 03:00 | 262K | |
![[ ]](/icons/compressed.gif) | Joyce Carol Dates-Luxusvilag.zip | 2007-03-24 02:56 | 262K | |
![[ ]](/icons/compressed.gif) | christie_agatha_tiz_kicsi_neger_hu_rtf.zip | 2007-03-24 02:49 | 262K | |
![[ ]](/icons/compressed.gif) | Tamasi Aron-Jegtoro Matyas.zip | 2007-03-24 02:55 | 262K | |
![[ ]](/icons/compressed.gif) | Ivan Jefremov-A mult arnyeka.zip | 2007-03-24 02:55 | 261K | |
![[ ]](/icons/compressed.gif) | Rowling,Joanne K-Harry Potter es az Aszkabani fogoly.zip | 2007-03-24 02:55 | 261K | |
![[ ]](/icons/compressed.gif) | forester_cecil_scott_konvoj_a_lathataron_hu_doc.zip | 2007-03-24 02:52 | 261K | |
![[ ]](/icons/compressed.gif) | betty_blue-00.zip | 2007-03-24 02:58 | 261K | |
![[ ]](/icons/compressed.gif) | gardonyi_geza_ida_regenye_rtf.zip | 2007-03-24 02:54 | 261K | |
![[ ]](/icons/compressed.gif) | alex_joe_szarnyatlan_szarnyalassal_uztem_hu_rtf.zip | 2007-03-24 02:56 | 261K | |
![[ ]](/icons/compressed.gif) | zbych_andrzej_kloss_kapitany_hu_rtf.zip | 2007-03-24 02:49 | 261K | |
![[ ]](/icons/compressed.gif) | Jane Eyre-A Lowoodi arva.zip | 2007-03-24 02:56 | 261K | |
![[ ]](/icons/compressed.gif) | Ottlik Geza-Hajnali haztetok,Minden megvan.zip | 2007-03-24 02:58 | 261K | |
![[ ]](/icons/compressed.gif) | greene_graham_a_csendes_amerikai_hu_rtf.zip | 2007-03-24 02:55 | 261K | |
![[ ]](/icons/unknown.gif) | avery_dale_a_renegat_hu_rtf.zip2 | 2007-03-24 02:54 | 261K | |
![[ ]](/icons/unknown.gif) | chapman_wayne_keleti_szel_hu_rtf.zip2 | 2007-03-24 03:01 | 261K | |
![[ ]](/icons/compressed.gif) | sztrugackij_a_b_bogar_a_hangyabolyban_hu_rtf.zip | 2007-03-24 02:49 | 261K | |
![[ ]](/icons/compressed.gif) | rowling_j_k_harry_potter_es_az_azkabani_fogoly_hu_rtf.zip | 2007-03-24 02:55 | 261K | |
![[ ]](/icons/compressed.gif) | Rowling, J.K - Harry Potter 3 és az Azkabani Fogoly hu rtf.zip | 2006-05-31 08:15 | 261K | |
![[ ]](/icons/compressed.gif) | Csernai Zoltan-Tollaskigyo utolso viszaterese.zip | 2007-03-24 02:52 | 260K | |
![[ ]](/icons/compressed.gif) | brooks_terry_hook_hu_doc.zip | 2007-03-24 03:00 | 260K | |
![[ ]](/icons/compressed.gif) | shan_darren_a_vegzet_fiai_hu_rtf_nncl2424-681v1.zip | 2007-03-24 02:52 | 260K | |
![[ ]](/icons/compressed.gif) | Eotvos Karoly-A Nazarenusok.zip | 2007-03-24 02:53 | 260K | |
![[ ]](/icons/compressed.gif) | kundera_milan_bucsukeringo_hu_doc_nncl2431-683v1.zip | 2007-03-24 02:58 | 260K | |
![[ ]](/icons/compressed.gif) | kialts.farkast.zip | 2007-02-21 16:16 | 260K | |
![[ ]](/icons/compressed.gif) | oates_joyce_carol_luxusvilag_hu_rtf.zip | 2007-03-24 03:00 | 260K | |
![[ ]](/icons/compressed.gif) | card_orson_scott_vegjatek.zip | 2007-03-24 02:58 | 260K | |
![[ ]](/icons/compressed.gif) | 02. II. Klónok támadása.zip | 2007-03-26 19:01 | 260K | |
![[ ]](/icons/compressed.gif) | kiss_jozsef_laszlo_talan_pista_hu_doc_nncl1795-5fbv4.zip | 2007-03-24 02:56 | 260K | |
![[ ]](/icons/compressed.gif) | rathkyng_robert_reszkess_testor_hu_rtf_nncl2269-652v1.zip | 2007-03-24 02:59 | 259K | |
![[ ]](/icons/compressed.gif) | mcbain_ed_varos_a_varosban_hu_doc_nncl2761-6d9v1.zip | 2007-03-24 02:53 | 259K | |
![[ ]](/icons/compressed.gif) | weinberg_robert_a_harmonia_mestere_hu_rtf_nncl2299-65ev1.zip | 2007-03-24 03:00 | 259K | |
![[ ]](/icons/compressed.gif) | jokai_mor_egetvivo_asszonysziv_html.zip | 2007-03-24 02:56 | 259K | |
![[ ]](/icons/compressed.gif) | wodehouse_p_g_az_eletmuvesz_hu_doc_nncl3126-706v1.zip | 2007-03-24 02:58 | 259K | |
![[ ]](/icons/compressed.gif) | austen_jane_ertelem_es_erzelem_html.zip | 2007-03-24 02:56 | 259K | |
![[ ]](/icons/compressed.gif) | Carl Sagan - Kapcsolat.zip | 2007-03-26 18:31 | 259K | |
![[ ]](/icons/compressed.gif) | Philip K Dick - Palmer_eldritch_harom_stigmaja_hu_rtf.zip | 2006-05-17 04:50 | 259K | |
![[ ]](/icons/compressed.gif) | herbert_frank_a_dosadi_kiserlet_hu_html.zip | 2007-03-24 02:54 | 259K | |
![[ ]](/icons/compressed.gif) | ballard_j_g_a_nap_birodalma_hu_rtf.zip | 2007-03-24 02:55 | 258K | |
![[ ]](/icons/compressed.gif) | Frank Herbert-A DOSADI kiserlet.zip | 2007-03-24 02:54 | 258K | |
![[ ]](/icons/layout.gif) | Egérfogó, kissé másként - (Baiting the Trap).pdf | 2007-05-03 07:36 | 258K | |
![[ ]](/icons/compressed.gif) | Jan van den Boomen - Sogron lángjai I.zip | 2007-04-06 11:06 | 258K | |
![[ ]](/icons/compressed.gif) | schreiber_hermann_attila_a_kiraly_hu_doc.zip | 2007-03-24 02:55 | 258K | |
![[ ]](/icons/compressed.gif) | marsh_evelyn_holttest_a_sziklakon_hu_doc.zip | 2007-03-24 02:53 | 258K | |
![[ ]](/icons/compressed.gif) | marsh_evelyn_a_szanatorium_rejtelye_hu_doc.zip | 2007-03-24 02:53 | 258K | |
![[ ]](/icons/compressed.gif) | isherwood_robin_az_utolso_homokszem_hu_rtf_nncl1921-614v2.zip | 2007-03-24 03:00 | 258K | |
![[ ]](/icons/compressed.gif) | harrison_harry_halalvilag_hu_rtf.zip | 2007-03-24 02:55 | 258K | |
![[ ]](/icons/compressed.gif) | Harry Harryson - Halalvilag_hu_rtf.zip | 2006-05-27 23:57 | 258K | |
![[ ]](/icons/unknown.gif) | osszes07.ace | 2007-03-24 02:56 | 258K | |
![[ ]](/icons/compressed.gif) | Rajmond Chandler-Visszajatszas.zip | 2007-03-24 02:58 | 258K | |
![[ ]](/icons/compressed.gif) | blatty_william_peter_az_ordoguzo.zip | 2007-03-24 03:01 | 258K | |
![[ ]](/icons/compressed.gif) | may_karl_a_felver_hu_rtf.zip | 2007-03-24 02:56 | 258K | |
![[ ]](/icons/compressed.gif) | bagley_desmond_forgoszel_hu_htm_nncl2451-68dv1.zip | 2007-03-24 02:52 | 258K | |
![[ ]](/icons/compressed.gif) | greene_graham_a_felelem_miniszteriuma_hu_doc_nncl2245-64cv1.zip | 2007-03-24 02:55 | 258K | |
![[ ]](/icons/compressed.gif) | blatty_william_peter_az_ordoguzo_hu_rtf.zip | 2006-05-10 08:33 | 258K | |
![[ ]](/icons/compressed.gif) | orwell_george_haborus_naplo_hu_rtf_nncl3226-722v1.zip | 2007-03-24 02:54 | 258K | |
![[ ]](/icons/compressed.gif) | Frank Herbet - A Dosadi-kísérlet.zip | 2007-03-26 14:46 | 258K | |
![[ ]](/icons/compressed.gif) | salvatore_r_a_klonok_tamadasa_hu_rtf.zip | 2006-05-29 06:06 | 258K | |
![[ ]](/icons/compressed.gif) | salvatore_r_a_klonok_tamadasa_hu_rtf-20061104172005-jhiRUfSjOD.zip | 2007-04-14 15:25 | 258K | |
![[ ]](/icons/unknown.gif) | arnyekhaboru.doc | 2007-04-15 16:34 | 258K | |
![[ ]](/icons/compressed.gif) | chandler_raymond_visszajatszas_hu_rtf.zip | 2007-03-24 02:59 | 257K | |
![[ ]](/icons/compressed.gif) | cook_robin_mutacio_hu_rtf.zip | 2007-03-24 03:00 | 257K | |
![[ ]](/icons/compressed.gif) | steinbeck_john_kesik_a_szuret_rtf.zip | 2007-03-24 02:56 | 257K | |
![[ ]](/icons/compressed.gif) | Pierre Barbet-A psziborgok almai.zip | 2007-03-24 02:58 | 257K | |
![[ ]](/icons/compressed.gif) | Nietzsche-IM-Ingyen szol a Zarathustra.zip | 2007-03-24 02:54 | 257K | |
![[ ]](/icons/compressed.gif) | dennett_daniel_c_micsoda_elmek_hu_html.zip | 2007-03-24 02:53 | 257K | |
![[ ]](/icons/layout.gif) | Várostrom.pdf | 2007-04-15 15:11 | 257K | |
![[ ]](/icons/compressed.gif) | schuder_rosemarie_az_ordog_malmaban_hu_rtf_nncl743-3f2v1.zip | 2007-03-24 03:00 | 257K | |
![[ ]](/icons/compressed.gif) | pilinszky_janos_szepproza_html.zip | 2007-03-24 02:58 | 257K | |
![[ ]](/icons/compressed.gif) | albaryu_esther_pusztulas_evei_hu_rtf.zip | 2007-03-24 02:53 | 257K | |
![[ ]](/icons/compressed.gif) | djian_philippe_37_2_fok_reggel_(Betty_Blue).zip | 2007-03-24 02:58 | 257K | |
![[ ]](/icons/compressed.gif) | Legendák és enigmák 7.zip | 2007-04-06 11:05 | 257K | |
![[ ]](/icons/compressed.gif) | csernai_zoltan_tollaskigyo_utolso_visszaterese_hu_doc.zip | 2007-03-24 02:52 | 257K | |
![[ ]](/icons/compressed.gif) | Csernai Zoltán - A tollaskigyo utolso visszaterese hu doc.zip | 2007-02-21 16:45 | 257K | |
![[ ]](/icons/compressed.gif) | chandler_raymond_hosszu_alom_hu_rtf.zip | 2007-03-24 02:59 | 257K | |
![[ ]](/icons/compressed.gif) | moldova_gyorgy_egi_szeker_html.zip | 2007-03-24 02:58 | 257K | |
![[ ]](/icons/compressed.gif) | jokai_mor_egy_hirhedt_kalandor.zip | 2007-03-24 02:56 | 256K | |
![[ ]](/icons/compressed.gif) | Raoul Renier - Korona és kehely.zip | 2007-05-16 20:30 | 256K | |
![[ ]](/icons/compressed.gif) | szabo_magda_a_pillanat_html.zip | 2007-03-24 03:00 | 256K | |
![[ ]](/icons/compressed.gif) | Isaac Asimov - Az ur aramlatai hu rtf.zip | 2006-05-10 06:39 | 256K | |
![[ ]](/icons/compressed.gif) | dick_philip_k_palmer_eldritch_harom_stigmaja_hu_rtf.zip | 2007-03-24 02:58 | 256K | |
![[ ]](/icons/compressed.gif) | updike_john_szegenyhazi_vasar_a_farm_hu_html.zip | 2007-03-24 02:56 | 256K | |
![[ ]](/icons/unknown.gif) | osszes22.ace | 2007-03-24 02:56 | 256K | |
![[ ]](/icons/compressed.gif) | lem_stanislaw_eden_hu_rtf.zip | 2007-03-24 03:00 | 256K | |
![[ ]](/icons/layout.gif) | Trainerek és Mesterek - Tanuljunk a mesterektől.pdf | 2007-05-03 06:50 | 256K | |
![[ ]](/icons/compressed.gif) | krupkat_gunther_amikor_meghaltak_az_istenek.zip | 2007-03-24 02:55 | 256K | |
![[ ]](/icons/compressed.gif) | vonnegut_kurt_az_otos_szamu_vagohid_hu_html.zip | 2007-03-24 02:57 | 256K | |
![[ ]](/icons/compressed.gif) | Kurt Vonnegut - Ötos_szamu_vagohid.zip | 2006-05-31 06:27 | 256K | |
![[ ]](/icons/compressed.gif) | vance_jack_folyovilag_hu_rtf.zip | 2007-03-24 02:55 | 256K | |
![[ ]](/icons/compressed.gif) | Jack Vance - Folyovilag_hu_rtf.zip | 2006-05-28 04:43 | 256K | |
![[ ]](/icons/compressed.gif) | 10. A hajnal ösvénye.zip | 2007-03-26 18:33 | 256K | |
![[ ]](/icons/unknown.gif) | Paul bruton-A felsobrendu en | 2007-03-24 02:58 | 256K | |
![[ ]](/icons/compressed.gif) | salvatore_r_a_a_hajnal_osvenye_hu_rtf.zip | 2006-05-28 03:19 | 256K | |
![[ ]](/icons/unknown.gif) | osszes25.ace | 2007-03-24 02:56 | 256K | |
![[ ]](/icons/layout.gif) | Buffy a vámpirok réme - Vámpirlakoma.pdf | 2007-01-21 16:48 | 256K | |
![[ ]](/icons/compressed.gif) | centkiewicz_centkiewicz_tumbo_az_orok_remeny_fia_hu_doc_nncl3040-706v1.zip | 2007-03-24 02:49 | 255K | |
![[ ]](/icons/compressed.gif) | marsh_evelyn_retteges_hu_doc.zip | 2007-03-24 02:53 | 255K | |
![[ ]](/icons/compressed.gif) | greene_graham_titkos_megbizatas_hu_rtf.zip | 2007-03-24 02:55 | 255K | |
![[ ]](/icons/unknown.gif) | orjarat.ace | 2007-03-24 02:52 | 255K | |
![[ ]](/icons/compressed.gif) | palmer_chuck_totalis_annihilacio_hu_doc.zip | 2007-03-24 02:52 | 255K | |
![[ ]](/icons/compressed.gif) | kerouac_jack_uton.zip | 2007-03-24 02:55 | 255K | |
![[ ]](/icons/compressed.gif) | carver_raymond_nem_ok_a_te_ferjed_hu_rtf_nncl2986-701v1.zip | 2007-03-24 02:59 | 255K | |
![[ ]](/icons/compressed.gif) | crosa_ricardo_drotfatyol_halaloszto_2029_hu_rtf_nncl2578-6a7v1.zip | 2007-03-24 02:59 | 255K | |
![[ ]](/icons/compressed.gif) | davids_paul_es_hollace_a_hutt_visszavag_hu_rtf.zip | 2007-03-24 02:54 | 255K | |
![[ ]](/icons/compressed.gif) | davids_paul_es_hollace_a_hutt_visszavag_hu_rtf(1).zip | 2006-05-10 07:07 | 255K | |
![[ ]](/icons/compressed.gif) | a_hutt_visszavag.zip | 2007-03-24 02:54 | 255K | |
![[ ]](/icons/unknown.gif) | nafta.ace | 2007-03-24 02:52 | 254K | |
![[ ]](/icons/compressed.gif) | csukas_istvan_a_felidezett_toronyszoba_html.zip | 2007-03-24 02:57 | 254K | |
![[ ]](/icons/compressed.gif) | CSILLAGKAPU-Stargate.zip | 2007-03-24 02:52 | 254K | |
![[ ]](/icons/compressed.gif) | Lang Attila D---Sophie.zip | 2007-03-24 02:57 | 254K | |
![[ ]](/icons/compressed.gif) | morrell_david_a_modell_hu_rtf.zip | 2007-03-24 02:52 | 254K | |
![[ ]](/icons/compressed.gif) | vance_jack_haldoklo_fold_hu_rtf.zip | 2007-03-24 02:55 | 254K | |
![[ ]](/icons/compressed.gif) | fekete_istvan_gyeplo_nelkul_hu_doc.zip | 2007-03-24 02:57 | 254K | |
![[ ]](/icons/compressed.gif) | de_camp_carter_conan_a_kaloz_hu_rtf.zip | 2007-03-24 02:57 | 254K | |
![[ ]](/icons/compressed.gif) | king_stephen_dolores_hu_rtf.zip | 2007-03-24 03:00 | 254K | |
![[ ]](/icons/compressed.gif) | moricz_zsigmond_a_boldog_ember_rtf.zip | 2007-03-24 02:58 | 254K | |
![[ ]](/icons/compressed.gif) | marsh_evelyn_a_siralyok_repulnek_hu_doc.zip | 2007-03-24 02:53 | 254K | |
![[ ]](/icons/compressed.gif) | bates_h_e_bibor_sivatag_hu_doc.zip | 2007-03-24 02:55 | 253K | |
![[ ]](/icons/unknown.gif) | kkori.ace | 2007-03-24 02:52 | 253K | |
![[ ]](/icons/compressed.gif) | marsh_evelyn_a_sejtsebesz_titka_hu_doc.zip | 2007-03-24 02:53 | 253K | |
![[ ]](/icons/unknown.gif) | odussz.ace | 2007-03-24 02:52 | 253K | |
![[ ]](/icons/compressed.gif) | nemere_istvan_a_kozmosz_lovagjai_hu_doc.zip | 2007-03-24 02:58 | 253K | |
![[ ]](/icons/unknown.gif) | hivatal.ace | 2007-03-24 02:52 | 253K | |
![[ ]](/icons/compressed.gif) | fleming_ian_goldfinger_hu_rtf.zip | 2007-03-24 02:55 | 253K | |
![[ ]](/icons/compressed.gif) | szentmihalyi_szabo_peter_a_tokeletes_valtozat_hu_rtf.zip | 2007-03-24 03:00 | 253K | |
![[ ]](/icons/compressed.gif) | A gyűrük ura I.zip | 2007-03-26 19:30 | 253K | |
![[ ]](/icons/compressed.gif) | thury_zsuzsa_mostohatestverek_hu_doc_nncl3111-706v1.zip | 2007-03-24 03:00 | 252K | |
![[ ]](/icons/compressed.gif) | carr_john_dickson_a_london_bridge_rejtelye_hu_rtf.zip | 2007-03-24 02:56 | 252K | |
![[ ]](/icons/compressed.gif) | Davies, Paul - Az utolsó három perc.zip | 2006-05-08 01:11 | 252K | |
![[ ]](/icons/compressed.gif) | varkonyi_nandor_az_elveszett_paradicsom_hu_html.zip | 2007-03-24 03:01 | 252K | |
![[ ]](/icons/compressed.gif) | Varkonyi Nandor-Az elveszet paradicsom.zip | 2007-03-24 03:01 | 252K | |
![[ ]](/icons/compressed.gif) | Wilson Mark F. - Terminator 2. Orgyilkos.zip | 2007-03-26 19:26 | 252K | |
![[ ]](/icons/compressed.gif) | farkas_henrik_igaz_aktak_hu_rtf.zip | 2007-03-24 02:54 | 252K | |
![[ ]](/icons/compressed.gif) | sztrugackij_a_b_a_szazad_ragadozo_targyai_hu_rtf.zip | 2007-03-24 02:49 | 252K | |
![[ ]](/icons/compressed.gif) | callenbach_ernest_ecotopia_hu_doc_nncl2658-6bfv1.zip | 2007-03-24 02:53 | 252K | |
![[ ]](/icons/compressed.gif) | london_jack_a_beszelo_kutya_hu_doc.zip | 2007-03-24 02:55 | 252K | |
![[TXT]](/icons/text.gif) | pacsirta.txt | 2007-03-24 02:55 | 252K | |
![[ ]](/icons/compressed.gif) | bagley_desmond_a_kenyai_kapcsolat_hu_rtf.zip | 2007-03-24 02:52 | 252K | |
![[ ]](/icons/compressed.gif) | brown_dee_a_nagy_lovaskaland_hu_rtf.zip | 2007-03-24 02:52 | 252K | |
![[ ]](/icons/unknown.gif) | Sellei György - Haegemonia.rtf | 2006-07-19 18:13 | 252K | |
![[ ]](/icons/compressed.gif) | W Hamilton Green - Renegátok (A kardok könyve).zip | 2007-04-06 11:07 | 252K | |
![[ ]](/icons/compressed.gif) | moricz_zsigmond_jobb_mint_otthon_rtf.zip | 2007-03-24 02:58 | 251K | |
![[ ]](/icons/compressed.gif) | avery_dale_a_renegat_hu_rtf.zip | 2007-03-24 02:54 | 251K | |
![[ ]](/icons/compressed.gif) | anthony_piers_az_emlekmas_hu_rtf.zip | 2007-03-24 02:58 | 251K | |
![[ ]](/icons/unknown.gif) | merey_Lahor_Xween_bosszuja.rtf | 2007-11-14 08:44 | 251K | |
![[ ]](/icons/compressed.gif) | moldova_gyorgy_a_bal_oroszlan_html.zip | 2007-03-24 02:58 | 251K | |
![[ ]](/icons/compressed.gif) | garfield_brian_revans_hu_rtf_nncl2327-665v1.zip | 2007-03-24 02:52 | 251K | |
![[ ]](/icons/compressed.gif) | saul_john_az_eloskodo_hu_rtf.zip | 2006-05-28 03:44 | 251K | |
![[ ]](/icons/compressed.gif) | marsh_evelyn_az_artatlansag_hu_doc.zip | 2007-03-24 02:53 | 251K | |
![[ ]](/icons/compressed.gif) | jeschke_wolfgang_a_teremtes_utolso_napja_hu_rtf.zip | 2007-03-24 03:01 | 250K | |
![[ ]](/icons/compressed.gif) | Wolfgang Jetchke - A teremtés utolsó napja.zip | 2006-05-18 04:39 | 250K | |
![[ ]](/icons/compressed.gif) | John Brunner-Teljes napfogyatkozas.zip | 2007-03-24 02:56 | 250K | |
![[ ]](/icons/compressed.gif) | molnar_geza_a_magany_atkozott_szombatja_hu_rtf_nncl323-2efv1.zip | 2007-03-24 02:58 | 250K | |
![[ ]](/icons/compressed.gif) | Charles es Mary Lamb-Shakespeare-mesek.zip | 2007-03-24 02:52 | 250K | |
![[ ]](/icons/compressed.gif) | Rejto Jeno - Csontbrigad.doc.zip | 2007-03-24 02:59 | 250K | |
![[ ]](/icons/compressed.gif) | Terry Prachett - Foldvajok_hu_html.zip | 2006-05-28 02:53 | 250K | |
![[ ]](/icons/compressed.gif) | marsh_evelyn_a_rem_hu_doc.zip | 2007-03-24 02:53 | 250K | |
![[ ]](/icons/compressed.gif) | caldwell_john_a_kaosz_kaosza_hu_rtf_nncl2131-638v1.zip | 2007-03-24 02:58 | 250K | |
![[ ]](/icons/compressed.gif) | abe_kabo_a_homok _asszonya_hu_rtf_nncl2190-642v2.zip | 2007-03-24 02:49 | 250K | |
![[ ]](/icons/compressed.gif) | moricz_zsigmond_rab_oroszlan_rtf.zip | 2007-03-24 02:58 | 250K | |
![[ ]](/icons/compressed.gif) | boyd_neil_atyak_pacban_hu_rtf_nncl3249-72av1.zip | 2007-03-24 02:58 | 250K | |
![[ ]](/icons/compressed.gif) | galaktika001.zip | 2007-08-04 14:09 | 250K | |
![[ ]](/icons/compressed.gif) | koontz_dean_r_az_ejszaka_hangjai_hu_doc_nncl3002-704v1.zip | 2007-03-24 02:52 | 250K | |
![[ ]](/icons/compressed.gif) | anderson_paul_az_ido_folyosoi_hu_rtf.zip | 2007-03-24 02:58 | 250K | |
![[ ]](/icons/compressed.gif) | Germanius Gyula-A felhold fako fenyeben.zip | 2007-03-24 02:55 | 249K | |
![[ ]](/icons/compressed.gif) | verne_jules_hector_servadac_rtf.zip | 2007-03-24 02:56 | 249K | |
![[ ]](/icons/compressed.gif) | Huszt Adam-Agytakaritas.zip | 2007-03-24 02:55 | 249K | |
![[ ]](/icons/compressed.gif) | Terry Prachett - A mágia színe.zip | 2007-03-26 18:19 | 249K | |
![[ ]](/icons/compressed.gif) | herbert_james_patkanyok_hu_rtf.zip | 2007-03-24 02:55 | 249K | |
![[ ]](/icons/compressed.gif) | baden_roach_hires_bunugyek_a_boncasztalon_kepek_hu_jpg_nncl3246-72av0.zip | 2007-03-24 02:53 | 249K | |
![[ ]](/icons/compressed.gif) | bischoff_david_ejszakai_vilag_hu_rtf.zip | 2007-03-24 02:53 | 249K | |
![[ ]](/icons/compressed.gif) | warren_clay_minnesota_megvar_hu_rtf_nncl2298-65ev1.zip | 2007-03-24 02:52 | 249K | |
![[ ]](/icons/compressed.gif) | weinberg_robert_ut_a_pokolba_hu_rtf_nncl2300-65ev1.zip | 2007-03-24 03:00 | 249K | |
![[ ]](/icons/compressed.gif) | Gibson, William - Mona Lisa overdrive hu rtf.zip | 2007-02-21 16:34 | 249K | |
![[ ]](/icons/compressed.gif) | sztrugackij_a_b_a_biborszinu_felhok_bolygoja_hu_rtf.zip | 2007-03-24 02:49 | 248K | |
![[ ]](/icons/compressed.gif) | Sztrugackij, Arkagyij és Borisz - A biborszinu_felhok_bolygoja_hu_rtf.zip | 2007-02-21 16:51 | 248K | |
![[ ]](/icons/compressed.gif) | Paul Davies-Egyedul vagyunk a vilagegyetemben.zip | 2007-03-24 02:58 | 248K | |
![[ ]](/icons/compressed.gif) | biggers_earl_derr_charlie_chan_zavarba_jon_hu_rtf.zip | 2007-03-24 02:53 | 248K | |
![[ ]](/icons/compressed.gif) | ryan_cornelius_a_leghosszabb_nap_hu_rtf.zip | 2007-03-24 02:52 | 248K | |
![[ ]](/icons/compressed.gif) | hicks_larry_a_sas_kommando_hu_rtf.zip | 2007-03-24 02:57 | 248K | |
![[ ]](/icons/compressed.gif) | chapman_wayne_csepp_es_tenger_hu_rtf_nncl2645-6bav2.zip | 2007-03-24 03:01 | 248K | |
![[ ]](/icons/compressed.gif) | Terry Prachett - A mágia fénye.zip | 2007-03-26 18:19 | 248K | |
![[ ]](/icons/compressed.gif) | hzona.zip | 2007-08-04 15:19 | 248K | |
![[ ]](/icons/compressed.gif) | Homályzona.zip | 2005-06-22 15:37 | 248K | |
![[ ]](/icons/compressed.gif) | Asotetseg balkeze-Ursula K.Le Guin.zip | 2007-03-24 03:00 | 248K | |
![[ ]](/icons/compressed.gif) | marsh_evelyn_a_csapda_hu_doc.zip | 2007-03-24 02:53 | 248K | |
![[ ]](/icons/compressed.gif) | jokai_mor_a_tengerszemu_holgy_html.zip | 2007-03-24 02:56 | 248K | |
![[ ]](/icons/compressed.gif) | Xsany-Cracker.zip | 2007-03-24 03:01 | 248K | |
![[ ]](/icons/compressed.gif) | bagley_desmond_az_ellenseg_hu_rtf.zip | 2007-03-24 02:52 | 248K | |
![[ ]](/icons/compressed.gif) | groom_winston_gump_&_tsa_hu_doc.zip | 2007-03-24 03:01 | 248K | |
![[ ]](/icons/compressed.gif) | jokai_mor_hetkoznapok_html.zip | 2007-03-24 02:56 | 248K | |
![[ ]](/icons/compressed.gif) | saul_john_ralston_ragadozo_madarak_hu_doc.zip | 2007-03-24 02:56 | 248K | |
![[ ]](/icons/compressed.gif) | Primitiv kulturak,osi hitek,modern genocidium.zip | 2007-03-24 02:58 | 248K | |
![[ ]](/icons/compressed.gif) | fekete_istvan_derengo_hajnal_hu_rtf_nncl2582-6aav1.zip | 2007-03-24 02:57 | 247K | |
![[ ]](/icons/compressed.gif) | 2010 Masodik Urodisszeeia.zip | 2007-03-24 02:49 | 247K | |
![[ ]](/icons/compressed.gif) | king_stephen_a_sarkany_szeme_hu_rtf.zip | 2007-03-24 03:00 | 247K | |
![[ ]](/icons/compressed.gif) | Stephen King - A sarkany_szeme_hu_rtf.zip | 2006-05-18 05:07 | 247K | |
![[ ]](/icons/compressed.gif) | epiktetosz_kezikonyvecske_hu_pdf.zip | 2007-03-24 02:53 | 247K | |
![[ ]](/icons/compressed.gif) | maugham_w_somerset_eletem_hu_doc_nncl2739-6d7v1.zip | 2007-03-24 03:00 | 247K | |
![[ ]](/icons/compressed.gif) | sagan_francoise_jo_reggelt_bubanat_hu_rtf.zip | 2007-03-24 02:54 | 247K | |
![[ ]](/icons/compressed.gif) | teas_t_o_a_nap_szamurajai_hu_rtf_nncl2965-6fcv1.zip | 2007-03-24 03:00 | 247K | |
![[ ]](/icons/compressed.gif) | christie_agatha_a_kutya_se_latta_hu_doc_nncl2764-6d9v1.zip | 2007-03-24 02:49 | 247K | |
![[ ]](/icons/compressed.gif) | price_nancy_egy_agyban_az_ellenseggel_hu_rtf_nncl2918-6f3v1.zip | 2007-03-24 02:58 | 247K | |
![[ ]](/icons/compressed.gif) | winnington_alan_fejvadaszok_hu_doc.zip | 2007-03-24 02:49 | 247K | |
![[ ]](/icons/compressed.gif) | lorincz_l_laszlo_lhaszaig_hosszu_az_ut_hu_rtf.zip | 2007-03-24 02:57 | 246K | |
![[ ]](/icons/layout.gif) | tt2005_tagreosz.pdf | 2007-04-15 16:05 | 246K | |
![[ ]](/icons/compressed.gif) | Terry Prachett - A halál kisinasa.zip | 2007-03-26 18:19 | 246K | |
![[ ]](/icons/compressed.gif) | templeton_edith_gordon_hu_doc_nncl2945-6f3v1.zip | 2007-03-24 02:53 | 246K | |
![[ ]](/icons/compressed.gif) | gosling_paula_bubanat_blues_hu_rtf.zip | 2007-03-24 02:58 | 246K | |
![[ ]](/icons/compressed.gif) | longyear_barry_b_kedves_ellensegem_hu_doc.zip | 2007-03-24 02:50 | 246K | |
![[ ]](/icons/compressed.gif) | Robert N. Chetette - Keresd A Magad Igazát.zip | 2006-05-31 07:34 | 246K | |
![[ ]](/icons/compressed.gif) | keyes_daniel_az_otodik_sally_hu_doc_nncl3068-706v1.zip | 2007-03-24 02:52 | 246K | |
![[ ]](/icons/compressed.gif) | Alexander Dumas-A Feketete Tulipan.zip | 2007-03-24 02:49 | 246K | |
![[ ]](/icons/compressed.gif) | Legendák és enigmák 5.zip | 2007-04-06 11:05 | 246K | |
![[ ]](/icons/compressed.gif) | williams_michael_esku_es_szabalyzat.zip | 2007-03-24 02:57 | 246K | |
![[ ]](/icons/compressed.gif) | Germanius Gyula-Kelet fenyei fele.zip | 2007-03-24 02:55 | 246K | |
![[ ]](/icons/compressed.gif) | marsh_evelyn_tuleles_hu_doc.zip | 2007-03-24 02:53 | 246K | |
![[ ]](/icons/compressed.gif) | Wiliam Gibson-Virtualfeny.zip | 2007-03-24 03:01 | 246K | |
![[ ]](/icons/compressed.gif) | ransome_arthur_teli_szunido_hu_doc_nncl3100-706v1.zip | 2007-03-24 02:49 | 246K | |
![[ ]](/icons/compressed.gif) | durrell_gerald_madarak_vadak_rokonok_hu_rtf.zip | 2007-03-24 02:54 | 246K | |
![[ ]](/icons/compressed.gif) | jokai_mor_erdely_aranykora_html.zip | 2007-03-24 02:56 | 245K | |
![[ ]](/icons/compressed.gif) | gibson_william_virtualfeny_hu_rtf.zip | 2007-03-24 03:01 | 245K | |
![[ ]](/icons/compressed.gif) | Gibson, William - Virtualfeny hu rtf.zip | 2007-02-21 16:35 | 245K | |
![[ ]](/icons/compressed.gif) | chandler_raymond_a_magas_ablak_hu_rtf.zip | 2007-03-24 02:59 | 245K | |
![[ ]](/icons/compressed.gif) | ross_thomas_hitteritoragu_hu_rtf.zip | 2007-03-24 03:00 | 245K | |
![[ ]](/icons/compressed.gif) | hebden_mark_pel_es_a_kopo_hu_html.zip | 2007-03-24 02:57 | 245K | |
![[ ]](/icons/compressed.gif) | wells_h_g_amikor_az_ustokos_eljon_rtf.zip | 2007-03-24 02:55 | 245K | |
![[ ]](/icons/compressed.gif) | jokai_mor_a_gazdag_szegenyek_html.zip | 2007-03-24 02:56 | 245K | |
![[ ]](/icons/compressed.gif) | Jokai Mor-A tengerszemu holgy.zip | 2007-03-24 02:56 | 245K | |
![[ ]](/icons/compressed.gif) | csath_geza_novellai_rtf.zip | 2007-03-24 02:52 | 245K | |
![[ ]](/icons/compressed.gif) | vonnegut_kurt_a_hamvaskek_sarkany_hu_txt.zip | 2007-03-24 02:57 | 245K | |
![[ ]](/icons/compressed.gif) | condon_richard_a_mandzsuriai_jelolt_hu_rtf_nncl2839-6e8v1.zip | 2007-03-24 02:59 | 245K | |
![[ ]](/icons/compressed.gif) | farmer_philip_jose_ordogszem_hu_rtf.zip | 2007-03-24 02:58 | 244K | |
![[ ]](/icons/compressed.gif) | moldova_gyorgy_maganyos_pavilon-az_elbocsatott_legio_html.zip | 2007-03-24 02:58 | 244K | |
![[ ]](/icons/compressed.gif) | Isaac Asimov - Szuperneutron.zip | 2006-12-14 00:05 | 244K | |
![[ ]](/icons/compressed.gif) | mawson_robert_kelj_fel_es_jarj_hu_txt.zip | 2007-03-24 02:59 | 244K | |
![[ ]](/icons/compressed.gif) | Ray BRADBURY-Kaleidoszkop.zip | 2007-03-24 02:59 | 244K | |
![[ ]](/icons/compressed.gif) | fekete_istvan_kele_hu_rtf.zip | 2007-03-24 02:57 | 244K | |
![[ ]](/icons/compressed.gif) | leiber_fritz_kardok_a_halal_ellen_hu_rtf.zip | 2007-03-24 02:54 | 244K | |
![[ ]](/icons/compressed.gif) | castaneda_carlos_mesek_az_erorol_hu_rtf.zip | 2007-03-24 02:52 | 244K | |
![[ ]](/icons/unknown.gif) | Válogatott elbeszélései.RTF | 2007-03-24 02:52 | 244K | |
![[ ]](/icons/compressed.gif) | Wilson Mark F. - Terminator - Invazio_hu_rtf.zip | 2007-03-26 19:26 | 243K | |
![[ ]](/icons/compressed.gif) | burroughs_edgar_rice_tarzan_es_a_hangyaemberek_hu_rtf.zip | 2007-03-24 02:53 | 243K | |
![[ ]](/icons/compressed.gif) | Wilson Mark F. - Terminator 4. A leszámolás.zip | 2007-03-26 19:26 | 243K | |
![[ ]](/icons/compressed.gif) | muller_peter_titkos_tanitasok_hu_txt_nncl2703-6c9v1.zip | 2007-03-24 02:58 | 243K | |
![[ ]](/icons/compressed.gif) | wilson_mark_f_invazio_hu_rtf.zip | 2007-03-24 02:57 | 243K | |
![[ ]](/icons/compressed.gif) | csernai_zoltan_farkaskolykok_es_vizipockok_hu_doc.zip | 2007-03-24 02:52 | 243K | |
![[ ]](/icons/compressed.gif) | berger_phil_veres_korszak_hu_rtf.zip | 2007-03-24 02:58 | 243K | |
![[ ]](/icons/compressed.gif) | koszegi_imre_osszkomfortos_robinson_hu_rtf.zip | 2007-03-24 02:56 | 242K | |
![[ ]](/icons/compressed.gif) | 12. A világ háta.zip | 2007-03-26 18:34 | 242K | |
![[ ]](/icons/compressed.gif) | apuleius_a_magiarol_viragoskert_hu_doc_nncl2647-6bav1.zip | 2007-03-24 02:49 | 242K | |
![[ ]](/icons/compressed.gif) | queen_ellery_gyilkossag_a_spanyol_fokon_hu_rtf_nncl2483-68ev1.zip | 2007-03-24 02:53 | 242K | |
![[ ]](/icons/compressed.gif) | nemere_istvan_az_ido_vandorai_hu_rtf.zip | 2007-03-24 02:58 | 242K | |
![[ ]](/icons/compressed.gif) | wodehouse_p_g_folytassa_jeeves_hu_doc_nncl3127-706v1.zip | 2007-03-24 02:58 | 242K | |
![[ ]](/icons/compressed.gif) | Mark Twain-Koldus es kiralyfi.zip | 2007-03-24 02:57 | 242K | |
![[ ]](/icons/compressed.gif) | gerber_michael_NNCL904.zip | 2006-05-17 06:21 | 242K | |
![[ ]](/icons/compressed.gif) | merle_robert_pallos_es_szerelem_hu_txt_nncl2016-621v1.zip | 2007-03-24 02:59 | 242K | |
![[ ]](/icons/compressed.gif) | carlton_clark_al_arc_hu_doc.zip | 2007-03-24 02:52 | 241K | |
![[ ]](/icons/compressed.gif) | aprily_lajos_osszes_versei_rtf.zip | 2007-03-24 02:55 | 241K | |
![[ ]](/icons/compressed.gif) | 01 - Kantáta.zip | 2007-03-26 18:33 | 241K | |
![[ ]](/icons/compressed.gif) | tracy_honor_szep_kisnaplemente_hu_rtf.zip | 2007-03-24 02:55 | 241K | |
![[ ]](/icons/compressed.gif) | Az éden szökőkútjai.zip | 2007-03-24 02:49 | 241K | |
![[ ]](/icons/compressed.gif) | Poul Anderson - A nagy keresztes hadjárat hu rtf.zip | 2006-05-30 22:04 | 241K | |
![[IMG]](/icons/image2.gif) | hatlap.JPG | 2007-11-14 09:12 | 241K | |
![[ ]](/icons/compressed.gif) | ignacz_rozsa_titania_ebredese_hu_rtf_nncl393-333v1.zip | 2007-03-24 02:55 | 241K | |
![[ ]](/icons/compressed.gif) | szabo_magda_a_csekei_monolog_html.zip | 2007-03-24 03:00 | 241K | |
![[ ]](/icons/compressed.gif) | Anderson - Sötétkard.zip | 2007-03-26 18:58 | 241K | |
![[ ]](/icons/compressed.gif) | BRIAN W ALDISS-amig vilag a vilag.zip | 2007-03-24 02:52 | 241K | |
![[ ]](/icons/compressed.gif) | arkus_jozsef_le_vagyunk_ertekelve_hu_doc.zip | 2007-03-24 02:49 | 241K | |
![[ ]](/icons/unknown.gif) | orchidea.ace | 2007-03-24 02:52 | 241K | |
![[ ]](/icons/compressed.gif) | sztrugackij_a_b_stalker_hu_rtf.zip | 2007-03-24 02:49 | 241K | |
![[ ]](/icons/compressed.gif) | dietz_william_c_a_testor.zip | 2007-03-24 03:01 | 240K | |
![[ ]](/icons/compressed.gif) | redfield_james_a_mennyei_profecia_hu_txt.zip | 2007-03-24 02:55 | 240K | |
![[ ]](/icons/compressed.gif) | apuleius_aranyszamar_hu_rtf_nncl2646-6bav1.zip | 2007-03-24 02:49 | 240K | |
![[ ]](/icons/compressed.gif) | szabo_magda_alarcosbal_hu_doc_nncl3028-708v1.zip | 2007-03-24 03:00 | 240K | |
![[ ]](/icons/compressed.gif) | sienkiewicz_henryk_3_kisregeny_rtf.zip | 2007-03-24 02:55 | 240K | |
![[ ]](/icons/compressed.gif) | bartus_laszlo_fesz_van_hu_txt_nncl2179-63fv1.zip | 2007-03-24 02:50 | 240K | |
![[ ]](/icons/compressed.gif) | mcintyre_vanda_n_az_enterprise_elindul_hu_txt.zip | 2007-03-24 03:01 | 240K | |
![[ ]](/icons/compressed.gif) | albert_gabor_hol_vannak_azok_az_oszlopok_hu_rtf_nncl1672-595v1.zip | 2007-03-24 02:49 | 240K | |
![[ ]](/icons/unknown.gif) | ofelsege_kapitanya.ace | 2007-03-24 02:52 | 240K | |
![[ ]](/icons/unknown.gif) | 06 - A kőfiak (Mese).doc | 2007-03-24 02:54 | 240K | |
![[ ]](/icons/compressed.gif) | A Mars titka.zip | 2007-03-24 02:49 | 240K | |
![[ ]](/icons/compressed.gif) | mesemaraton.zip | 2007-03-24 02:57 | 240K | |
![[ ]](/icons/compressed.gif) | neuromanc.zip | 2007-03-24 03:01 | 240K | |
![[ ]](/icons/compressed.gif) | clarke_arthur_c_a_mars_titka.zip | 2007-03-24 02:49 | 240K | |
![[ ]](/icons/compressed.gif) | Arthur C. Clarke - A mars titka.zip | 2007-02-21 16:50 | 240K | |
![[ ]](/icons/compressed.gif) | szentmihalyi_szabo_peter_halaltanc_hu_doc.zip | 2007-03-24 03:00 | 240K | |
![[ ]](/icons/compressed.gif) | marsh_evelyn_a_kabulat_ara_hu_doc.zip | 2007-03-24 02:53 | 240K | |
![[ ]](/icons/compressed.gif) | maugham_w_somerset_catalina_hu_rtf.zip | 2007-03-24 03:00 | 239K | |
![[ ]](/icons/compressed.gif) | William Somerset Maugham-CATALINA.zip | 2007-03-24 03:01 | 239K | |
![[ ]](/icons/compressed.gif) | ferris_timothy_a_voros_hatar_hu_rtf_nncl2361-66bv1.zip | 2007-03-24 03:00 | 239K | |
![[ ]](/icons/layout.gif) | A kilencek egyike.pdf | 2007-04-15 16:13 | 239K | |
![[ ]](/icons/compressed.gif) | anderson_poul_a_nagy_keresztes_hadjarat_hu_rtf.zip | 2007-03-24 02:58 | 239K | |
![[ ]](/icons/compressed.gif) | burroughs_edgar_rice_tarzan_dzsungel_tortenetei_hu_rtf.zip | 2007-03-24 02:53 | 239K | |
![[ ]](/icons/compressed.gif) | hoyle_fred_geoffrey_az_ur_legmelyen_hu_rtf.zip | 2007-03-24 02:54 | 239K | |
![[ ]](/icons/compressed.gif) | Hoyle, Fred és Geoffrey - Az űr legmelyen hu .rtf.zip | 2007-02-21 16:47 | 239K | |
![[ ]](/icons/unknown.gif) | ej_istene.rtf | 2005-07-07 17:21 | 239K | |
![[ ]](/icons/compressed.gif) | belkom_edo_van_orjito_ehseg_hu_doc_nncl2721-6cbv1.zip | 2007-03-24 02:53 | 239K | |
![[ ]](/icons/compressed.gif) | sethfield_christopher_rideg_evek_hu_doc.zip | 2007-03-24 03:00 | 239K | |
![[ ]](/icons/compressed.gif) | lem_stanislaw_az_ur_hangja_hu_rtf.zip | 2007-03-24 03:00 | 239K | |
![[ ]](/icons/compressed.gif) | Stanislaw Lem - Az ur_hangja.zip | 2006-05-28 02:02 | 239K | |
![[ ]](/icons/compressed.gif) | nemere_istvan_zuhanas_a_napba_hu_rtf.zip | 2007-03-24 02:58 | 239K | |
![[ ]](/icons/compressed.gif) | clarke_arthur_c_3001_vegso_urodisszeia_hu_rtf.zip | 2007-03-24 02:49 | 239K | |
![[ ]](/icons/compressed.gif) | sztrugackij_a_b_a_kolyok_hu _rtf.zip | 2007-03-24 02:49 | 238K | |
![[ ]](/icons/compressed.gif) | Sztrugackij, Arkagyij és Borisz - A kolyok.zip | 2007-02-21 16:49 | 238K | |
![[ ]](/icons/unknown.gif) | Nemere Istvan - A Hegy.prc | 2007-03-24 02:58 | 238K | |
![[ ]](/icons/compressed.gif) | bulicsov_kir_ketteszakitott_elet_hu_rtf.zip | 2007-03-24 02:56 | 238K | |
![[ ]](/icons/compressed.gif) | Kir Bulicsov - Ketteszakitott elet hu rtf.zip | 2007-02-21 16:36 | 238K | |
![[ ]](/icons/compressed.gif) | wilson_mark_f_terminator_orgyilkos_hu_rtf.zip | 2007-03-24 02:57 | 238K | |
![[ ]](/icons/compressed.gif) | clarke_arthur_c_az_eden_szokokutjai_hu_rtf.zip | 2007-03-24 02:49 | 238K | |
![[ ]](/icons/compressed.gif) | Arthur C. Clarke - Az eden szokokutjai hu rtf.zip | 2007-02-21 16:25 | 238K | |
![[ ]](/icons/compressed.gif) | coelho_paulo_a_zarandoklat_hu_doc_nncl2244-64dv1.zip | 2007-03-24 02:58 | 237K | |
![[ ]](/icons/compressed.gif) | moldova_gyorgy_a_felelem_kapuja_html.zip | 2007-03-24 02:58 | 237K | |
![[ ]](/icons/compressed.gif) | Isaac Asimov-Masodik alapitvany.zip | 2007-03-24 02:55 | 237K | |
![[ ]](/icons/compressed.gif) | marai_sandor_ami_a_naplobol_kimaradt_1947_hu_rtf_nncl2649-6bav1.zip | 2007-03-24 02:57 | 237K | |
![[ ]](/icons/compressed.gif) | wodehouse_p_g_egy_pelikan_blandingsben_hu_rtf_nncl2305-65ev1.zip | 2007-03-24 02:58 | 237K | |
![[ ]](/icons/compressed.gif) | erdody_janos_krisztina_kiralyno_romaban_hu_rtf.zip | 2007-03-24 02:53 | 237K | |
![[ ]](/icons/compressed.gif) | burroughs_edgar_rice_tarzan_a_fold_melyen_hu_rtf.zip | 2007-03-24 02:53 | 237K | |
![[ ]](/icons/compressed.gif) | devlin_d_emmerich_r_csillagkapu_hu_rtf.zip | 2007-03-24 12:46 | 237K | |
![[ ]](/icons/compressed.gif) | verne_jules_ketevi_vakacio_rtf.zip | 2007-03-24 02:56 | 237K | |
![[ ]](/icons/compressed.gif) | townsend_sue_adrian_mole_ujabb_kinszenvedesei_hu_doc_nncl3050-708v1.zip | 2007-03-24 02:49 | 237K | |
![[ ]](/icons/compressed.gif) | renier_raoul_a_karhozott_hu_rtf_nncl2577-6a7v1.zip | 2007-03-24 02:59 | 237K | |
![[ ]](/icons/compressed.gif) | jokai_mor_oreg_ember_nem_ven_ember_html.zip | 2007-03-24 02:56 | 237K | |
![[ ]](/icons/compressed.gif) | nemere_istvan_a_hidra_hadmuvelet_hu_rtf.zip | 2007-03-24 02:58 | 236K | |
![[ ]](/icons/compressed.gif) | Ramajana.zip | 2007-03-24 02:58 | 236K | |
![[ ]](/icons/compressed.gif) | fekete_istvan_oszi_vasar_hu_rtf_nncl2065-62bv1.zip | 2007-03-24 02:57 | 236K | |
![[ ]](/icons/compressed.gif) | Belley Pal-Kivancsiak klubja.zip | 2007-03-24 02:50 | 236K | |
![[ ]](/icons/compressed.gif) | cooper_james_fenimore_de_borharisnya_rtf.zip | 2007-03-24 02:52 | 236K | |
![[ ]](/icons/compressed.gif) | farkas_marton_a_csaszari_sas_lehull_hu_rtf.zip | 2007-03-24 02:54 | 236K | |
![[ ]](/icons/compressed.gif) | lem_stanislaw_beke_a_foldon_hu_doc_nncl1857-60bv1.zip | 2007-03-24 03:00 | 236K | |
![[ ]](/icons/compressed.gif) | Kurt Vonnegut - A Titan_szirenjei.zip | 2006-05-28 04:52 | 236K | |
![[ ]](/icons/compressed.gif) | Wilson Mark F. - Terminator - Ellencsapas_hu_rtf.zip | 2007-03-26 19:26 | 236K | |
![[ ]](/icons/compressed.gif) | liu_o_oreg_can_koborlasai_hu_rtf.zip | 2007-03-24 02:57 | 236K | |
![[ ]](/icons/compressed.gif) | faludy_gyorgy_jegyzetek_a_kor_margojara_html.zip | 2007-03-24 02:55 | 236K | |
![[ ]](/icons/unknown.gif) | uton.ace | 2007-03-24 02:55 | 236K | |
![[ ]](/icons/compressed.gif) | wilson_mark_f_ellencsapas_hu_rtf.zip | 2007-03-24 02:57 | 236K | |
![[ ]](/icons/compressed.gif) | hicks_larry_becsuletbeli_ugy_hu_rtf.zip | 2007-03-24 02:57 | 236K | |
![[ ]](/icons/compressed.gif) | goethe_johann_wolfgang_von_faust_rtf.zip | 2007-03-24 02:56 | 236K | |
![[ ]](/icons/compressed.gif) | connelly_michael_feny_az_alagut_vegen_hu_txt_nncl2350-667v1.zip | 2007-03-24 02:57 | 236K | |
![[ ]](/icons/compressed.gif) | koontz_dean_r_vegsokig_hu_txt_nncl2408-67bv1.zip | 2007-03-24 02:52 | 236K | |
![[ ]](/icons/compressed.gif) | Buddha szomoru-Lazar Ervin.zip | 2007-03-24 02:53 | 235K | |
![[ ]](/icons/compressed.gif) | caldwell_john_a_kaosz_elszabadul_hu_doc.zip | 2007-03-24 02:58 | 235K | |
![[ ]](/icons/compressed.gif) | braunburg_rudolf_tajfun_hongkong_felett_hu_rtf_nncl2661-6c0v1.zip | 2007-03-24 03:00 | 235K | |
![[ ]](/icons/unknown.gif) | mutacio.ace | 2007-03-24 02:52 | 235K | |
![[ ]](/icons/compressed.gif) | Isaac Asimov - A halhatatlansag halala.zip | 2006-05-31 06:21 | 235K | |
![[ ]](/icons/compressed.gif) | Homokszem csupán.DOC.zip | 2007-03-24 02:49 | 235K | |
![[ ]](/icons/compressed.gif) | lautreamont_maldoror_enekei_hu_html.zip | 2007-03-24 02:57 | 235K | |
![[ ]](/icons/compressed.gif) | miller_arthur_a_bunbeeses_utan_alku_hu_rtf_nncl2042-62av1.zip | 2007-03-24 02:49 | 235K | |
![[ ]](/icons/compressed.gif) | muller_horst_jelek_a_holdrol_hu_doc.zip | 2007-03-24 02:55 | 235K | |
![[ ]](/icons/compressed.gif) | haggard_henry_rider_a_sarga_isten_hu_doc_nncl825-409v2.zip | 2007-03-24 02:55 | 235K | |
![[ ]](/icons/compressed.gif) | Merle - Madrapur.zip | 2005-06-09 14:04 | 235K | |
![[ ]](/icons/compressed.gif) | gibson_william_neuromanc_hu_html.zip | 2007-03-24 03:01 | 235K | |
![[ ]](/icons/compressed.gif) | Gibson, William - Neuromanc hu html.zip | 2007-02-21 16:34 | 235K | |
![[ ]](/icons/layout.gif) | a_harom_csalo.pdf | 2007-04-15 16:23 | 235K | |
![[ ]](/icons/compressed.gif) | Wilson Mark F. - Terminator 1. Démon a jövőből.zip | 2007-03-26 19:26 | 235K | |
![[ ]](/icons/compressed.gif) | warner_rex_periklesz_hu_rtf.zip | 2007-03-24 02:59 | 235K | |
![[ ]](/icons/compressed.gif) | balzac_honore_de_goriot_apo_rtf.zip | 2007-03-24 02:55 | 235K | |
![[ ]](/icons/compressed.gif) | aldiss_brian_w_foldburok_hu_rtf.zip | 2007-03-24 02:52 | 235K | |
![[ ]](/icons/compressed.gif) | Kovai Lorinc-Aki a napba nez.zip | 2007-03-24 02:56 | 234K | |
![[ ]](/icons/compressed.gif) | foster_alan_dean_az_elfelejtett_urhajo_rtf.zip | 2007-03-24 02:49 | 234K | |
![[ ]](/icons/compressed.gif) | Wayne Chapman - Csepp és tenger.zip | 2007-03-23 05:20 | 234K | |
![[ ]](/icons/compressed.gif) | Isaac Asimov - Alapítvány sorozat - Masodik_ alapitvany hu rtf.zip | 2006-05-10 06:52 | 234K | |
![[ ]](/icons/compressed.gif) | asimov_isaac_isaac_asimov_masodik_alapitvany.zip | 2007-03-24 02:55 | 234K | |
![[ ]](/icons/compressed.gif) | Tarr Jozsef-A GINKO.zip | 2007-03-24 03:00 | 234K | |
![[ ]](/icons/compressed.gif) | dickens_charles_karacsonyi_enek_pdf.zip | 2007-03-24 02:52 | 234K | |
![[ ]](/icons/compressed.gif) | verne_jules_15_eves_kapitany.txt.zip | 2007-03-24 02:56 | 234K | |
![[ ]](/icons/compressed.gif) | chapman_wayne_keleti_szel_hu_rtf.zip | 2007-03-24 02:54 | 234K | |
![[ ]](/icons/unknown.gif) | osveny.ace | 2007-03-24 02:52 | 234K | |
![[ ]](/icons/compressed.gif) | Bogdan Istvan-Ofelsege magannyomozoja.zip | 2007-03-24 02:52 | 234K | |
![[ ]](/icons/compressed.gif) | moldova_gyorgy_a_penz_szaga_html.zip | 2007-03-24 02:58 | 234K | |
![[ ]](/icons/compressed.gif) | castaneda_carlos_ixtlani_utazas_hu_html.zip | 2007-03-24 02:52 | 234K | |
![[ ]](/icons/compressed.gif) | hubbard_l_ron_a_csillagok_fele_hu_txt.zip | 2007-03-24 02:57 | 234K | |
![[ ]](/icons/compressed.gif) | utolso_mohikan.ace.zip | 2007-03-24 02:52 | 234K | |
![[ ]](/icons/compressed.gif) | cooper_james_fenimore_de_az_utolso_mohikan_rtf.zip | 2007-03-24 02:52 | 234K | |
![[ ]](/icons/unknown.gif) | g001.ace | 2007-03-24 02:52 | 234K | |
![[ ]](/icons/compressed.gif) | le_guin_ursula_k_a_szigetvilag_varazsloja_hu_rtf.zip | 2007-03-24 03:00 | 234K | |
![[ ]](/icons/compressed.gif) | gordon_sleznik_skrull_hu_rtf.zip | 2007-03-24 02:57 | 233K | |
![[ ]](/icons/compressed.gif) | szabo_magda_mondjak_meg_zsofikanak_hu_doc_nncl3103-706v1.zip | 2007-03-24 03:00 | 233K | |
![[ ]](/icons/compressed.gif) | brdecka_jiri_limonade_joe_hu_rtf.zip | 2007-03-24 02:56 | 233K | |
![[ ]](/icons/compressed.gif) | mailer_norman_a_kemeny_fickok_nem_tancolnak_hu_txt_nncl3262-732v1.zip | 2007-03-24 02:58 | 233K | |
![[ ]](/icons/compressed.gif) | simak_clifford_d_ha_megall_az_ido_hu_rtf_nncl2289-65ev1.zip | 2007-03-24 02:52 | 233K | |
![[ ]](/icons/compressed.gif) | SW - Baljós árnyak.zip | 2007-03-26 19:02 | 233K | |
![[ ]](/icons/compressed.gif) | cook_robin_agy_hu_rtf.zip | 2007-03-24 03:00 | 233K | |
![[ ]](/icons/compressed.gif) | Merle - Majomabece.zip | 2005-06-09 14:04 | 233K | |
![[ ]](/icons/compressed.gif) | baljos_arnyak.zip | 2007-03-24 02:54 | 233K | |
![[ ]](/icons/compressed.gif) | moricz_zsigmond_legy_jo_mindhalalig_rtf.zip | 2007-03-24 02:58 | 233K | |
![[ ]](/icons/compressed.gif) | clarke_arthur_c_2061_harmadik_urodisszea_hu_rtf.zip | 2007-03-24 02:49 | 233K | |
![[ ]](/icons/compressed.gif) | hemingway_ernest_nick_hu_html.zip | 2007-03-24 02:53 | 233K | |
![[ ]](/icons/compressed.gif) | berkesi_andras_magany_hu_txt_nncl2343-667v1.zip | 2007-03-24 02:50 | 233K | |
![[ ]](/icons/compressed.gif) | defoe_daniel_a_londoni_pestis_hu_rtf.zip | 2007-03-24 02:52 | 232K | |
![[ ]](/icons/compressed.gif) | Herbert George Wells-Vilagok harca.zip | 2007-03-24 02:55 | 232K | |
![[ ]](/icons/compressed.gif) | christie_agatha_az_abc_gyilkossagok_hu_rtf.zip | 2007-03-24 02:49 | 232K | |
![[ ]](/icons/compressed.gif) | brooks_terry_baljos_arnyak_hu_rtf.zip | 2007-03-24 02:53 | 232K | |
![[ ]](/icons/compressed.gif) | brooks_terry_baljos_arnyak.zip | 2007-03-24 03:00 | 232K | |
![[ ]](/icons/compressed.gif) | lll_dzsingisz_kan.zip | 2007-03-20 00:13 | 232K | |
![[ ]](/icons/compressed.gif) | niven_pournell_szalka_isten_szemeben_2_hu_txt.zip | 2007-03-24 02:57 | 232K | |
![[ ]](/icons/compressed.gif) | Honore de Balzac-Goriot apo.zip | 2007-03-24 02:55 | 232K | |
![[ ]](/icons/compressed.gif) | jokai_mor_gorogtuz_html.zip | 2007-03-24 02:56 | 232K | |
![[ ]](/icons/unknown.gif) | tuzfolyam.ace | 2007-03-24 02:52 | 232K | |
![[ ]](/icons/compressed.gif) | moricz_zsigmond_rokonok_rtf.zip | 2007-03-24 02:58 | 232K | |
![[ ]](/icons/compressed.gif) | herbert_frank_lelekvadasz_hu_rtf.zip | 2007-03-24 02:54 | 232K | |
![[ ]](/icons/compressed.gif) | Frank Herbet - Lelekvadasz_hu_rtf.zip | 2006-05-18 02:04 | 232K | |
![[ ]](/icons/compressed.gif) | sanders_lawrence_az_afrikai_kapitany_visszater_hu_rtf_nncl2740-6d7v1.zip | 2007-03-24 02:57 | 232K | |
![[ ]](/icons/compressed.gif) | danielsson_bengt_lazadas_a_bounty_hajon_hu_rtf.zip | 2007-03-24 02:50 | 232K | |
![[ ]](/icons/compressed.gif) | waltari_mika_kisregenyek_hu_rtf_nncl2490-690v1.zip | 2007-03-24 02:57 | 231K | |
![[ ]](/icons/compressed.gif) | durrenmatt_friedrich_a_fizilusok_pdf.zip | 2007-03-24 02:54 | 231K | |
![[ ]](/icons/compressed.gif) | eco_umberto_baudolino.zip | 2007-03-24 03:00 | 231K | |
![[ ]](/icons/compressed.gif) | istrati_panait_kyra_kyralina_hu_doc_nncl645-3d0v1.zip | 2007-03-24 02:58 | 231K | |
![[ ]](/icons/compressed.gif) | mcbain_ed_hoseg_hu_doc.zip | 2007-03-24 02:53 | 231K | |
![[ ]](/icons/compressed.gif) | avery_dale_csaszari_ver_hu_rtf.zip | 2007-03-24 02:54 | 231K | |
![[ ]](/icons/compressed.gif) | dick_philip_k_az_ember_a_fellegvarban_hu_rtf.zip | 2007-03-24 02:58 | 231K | |
![[ ]](/icons/compressed.gif) | lll_az_utolso_hvarezmi_nyar.zip | 2007-03-20 00:19 | 231K | |
![[ ]](/icons/compressed.gif) | marsh_evelyn_a_mutet_hu_doc.zip | 2007-03-24 02:53 | 231K | |
![[ ]](/icons/compressed.gif) | king_stephen_vilagnagy_strand_hu_doc.zip | 2007-03-24 03:00 | 231K | |
![[ ]](/icons/compressed.gif) | delblanc_sven_kirandulasok_hu_doc_nncl3281-73ev1.zip | 2007-03-24 03:00 | 231K | |
![[ ]](/icons/compressed.gif) | Foster, Alan Dean - Elfelejtett űrhajó.zip | 2007-02-21 16:45 | 231K | |
![[ ]](/icons/compressed.gif) | jokai_mor_forradalmi_es_csatakepek_html.zip | 2007-03-24 02:56 | 230K | |
![[ ]](/icons/compressed.gif) | Frank Gelon-Atkeles.zip | 2007-03-24 02:54 | 230K | |
![[ ]](/icons/compressed.gif) | Rosemarie Schuder-A boszorkany fia.zip | 2007-03-24 03:00 | 230K | |
![[ ]](/icons/layout.gif) | Függőség - (Addiction).pdf | 2007-05-03 07:38 | 230K | |
![[ ]](/icons/compressed.gif) | monette_paul_havanna_hu_rtf.zip | 2007-03-24 02:58 | 230K | |
![[ ]](/icons/compressed.gif) | gobolyos_n_laszlo_genesis_hu_rtf.zip | 2007-03-24 02:55 | 230K | |
![[ ]](/icons/compressed.gif) | Rejto Jeno - Ezen egy ejszaka.doc.zip | 2007-03-24 02:59 | 230K | |
![[ ]](/icons/compressed.gif) | maclean_alistair_pokol_alaszkaban_hu_rtf.zip | 2007-03-24 02:49 | 230K | |
![[ ]](/icons/compressed.gif) | reed_john_viva_villa_hu_rtf.zip | 2007-03-24 02:56 | 230K | |
![[ ]](/icons/compressed.gif) | steinbeck_john_arthur_kiraly_hu_txt.zip | 2007-03-24 02:56 | 230K | |
![[ ]](/icons/compressed.gif) | mcintyre_vanda_n_az_enterprise_elindul_hu_rtf.zip | 2007-03-24 03:01 | 230K | |
![[ ]](/icons/unknown.gif) | hitteritoragu.ace | 2007-03-24 02:52 | 230K | |
![[ ]](/icons/compressed.gif) | kolozsvari_grandpierre_emil_elmes_mulatsagok_hu_rtf.zip | 2007-03-24 02:56 | 229K | |
![[ ]](/icons/compressed.gif) | szabo_magda_merszi_moszjo_html.zip | 2007-03-24 03:00 | 229K | |
![[ ]](/icons/compressed.gif) | white_steve_csillag_es_horogkereszt_hu_rtf.zip | 2006-05-28 05:04 | 229K | |
![[ ]](/icons/compressed.gif) | jokai_mor_minden_poklokon_keresztul_html.zip | 2007-03-24 02:56 | 229K | |
![[ ]](/icons/compressed.gif) | Vámpír könyvek - 10. A Lelkek Tava.zip | 2007-03-20 13:26 | 229K | |
![[ ]](/icons/compressed.gif) | moricz_zsigmond_az_aszony_beleszol_rtf.zip | 2007-03-24 02:58 | 229K | |
![[ ]](/icons/compressed.gif) | fekete_gyula_kincskereso_pipiter_hu_doc_nncl3057-706v1.zip | 2007-03-24 02:54 | 229K | |
![[ ]](/icons/compressed.gif) | tailor_martha_orjito_kor_hu_doc_nncl2474-68ev1.zip | 2007-03-24 02:57 | 229K | |
![[ ]](/icons/compressed.gif) | mcgivern_william_p_a_nagy_leszamolas_hu_rtf.zip | 2007-03-24 03:01 | 229K | |
![[ ]](/icons/compressed.gif) | daley_brian_a_csillagrombolok_hu_rtf.zip | 2007-03-24 02:52 | 229K | |
![[ ]](/icons/compressed.gif) | a_csillagrombolok.zip | 2007-03-24 02:54 | 229K | |
![[ ]](/icons/compressed.gif) | wozencraft_kim_drog_hu_txt.zip | 2007-03-24 02:56 | 228K | |
![[ ]](/icons/compressed.gif) | Isaac Asimov-Acelbarlangok.zip | 2007-03-24 02:55 | 228K | |
![[ ]](/icons/compressed.gif) | lll_rokacsapda.zip | 2007-03-20 00:16 | 228K | |
![[ ]](/icons/compressed.gif) | taylor_jeremy_bolygofalok_hu_rtf.zip | 2007-03-24 02:56 | 228K | |
![[ ]](/icons/compressed.gif) | geron_frank_atkeles_hu_rtf.zip | 2007-03-24 02:54 | 228K | |
![[ ]](/icons/compressed.gif) | Robin Cook-Jarvany.zip | 2007-03-24 03:00 | 228K | |
![[ ]](/icons/compressed.gif) | buzzati_dino_egy_szerelem_tortenete_hu_rtf.zip | 2007-03-24 02:52 | 228K | |
![[ ]](/icons/compressed.gif) | daley_brian_a_birodalmi_flotta_hu_rtf.zip | 2007-03-24 02:52 | 228K | |
![[ ]](/icons/compressed.gif) | a_birodalmi_flotta.zip | 2007-03-24 02:54 | 228K | |
![[ ]](/icons/compressed.gif) | niedermann_andrew_az_ordog_ugyvedje_hu_rtf.zip | 2007-03-24 02:49 | 228K | |
![[ ]](/icons/unknown.gif) | 02 - Juhász Viktor - Varjúszárnyak.doc | 2007-03-24 02:54 | 228K | |
![[ ]](/icons/compressed.gif) | jokai_mor_az_elatkozott_csalad_html.zip | 2007-03-24 02:56 | 228K | |
![[ ]](/icons/compressed.gif) | forrestal_damien_ninive_hu_rtf.zip | 2007-03-24 02:52 | 228K | |
![[ ]](/icons/compressed.gif) | cook_robin_jarvany_hu_rtf.zip | 2007-03-24 03:00 | 228K | |
![[ ]](/icons/unknown.gif) | Orwell_allatfarm.rtf | 2007-11-14 03:02 | 228K | |
![[ ]](/icons/compressed.gif) | asimov_isaac_a_mezitelen_nap_hu_rtf.zip | 2007-03-24 02:55 | 228K | |
![[ ]](/icons/compressed.gif) | Isaac Asimov - A mezitelen_nap_hu_rtf.zip | 2006-05-10 06:41 | 228K | |
![[ ]](/icons/compressed.gif) | rajnov_bogomil_az_en_ismeretlenem_hu_rtf_nncl2257_651v1.zip | 2007-03-24 02:52 | 228K | |
![[ ]](/icons/compressed.gif) | Rejto Jeno - Piszkos Fred kozbelep.doc.zip | 2007-03-24 02:59 | 228K | |
![[ ]](/icons/compressed.gif) | terido.zip | 2007-03-24 02:49 | 228K | |
![[ ]](/icons/compressed.gif) | az_utolso_hvarezmi_nyar.zip | 2007-03-24 02:57 | 227K | |
![[ ]](/icons/compressed.gif) | hans_kristo_sorben_az_igazsag_hu_rtf.zip | 2007-03-24 02:56 | 227K | |
![[ ]](/icons/unknown.gif) | hollogyuru.rtf | 2007-04-15 16:53 | 227K | |
![[ ]](/icons/compressed.gif) | rath-vegh_istvan_az_ercmadar_hu_rtf.zip | 2007-03-24 02:59 | 227K | |
![[ ]](/icons/compressed.gif) | A halhatatlanság halála.zip | 2007-03-24 02:55 | 227K | |
![[ ]](/icons/compressed.gif) | Terminator_1.zip | 2007-03-24 03:00 | 227K | |
![[ ]](/icons/unknown.gif) | tutaj.ace | 2007-03-24 02:52 | 227K | |
![[ ]](/icons/compressed.gif) | castaneda_carlos_don_juan_tanitasai_hu_rtf.zip | 2007-03-24 02:52 | 227K | |
![[ ]](/icons/compressed.gif) | Hamvas Bela-Scientia sakra 2.zip | 2007-03-24 02:53 | 227K | |
![[ ]](/icons/compressed.gif) | frakes_wisher_terminator_1_hu_rtf.zip | 2007-03-24 03:00 | 227K | |
![[ ]](/icons/compressed.gif) | Frakes Randall - Terminator_1.zip | 2006-05-17 05:50 | 227K | |
![[ ]](/icons/compressed.gif) | schmidt_dan_voros_vertenger_hu_rtf.zip | 2007-03-24 02:52 | 227K | |
![[ ]](/icons/compressed.gif) | aldridge_james_testverem_tom_hu_doc_nncl398-333v1.zip | 2007-03-24 02:55 | 227K | |
![[ ]](/icons/compressed.gif) | gaspar_andras_ezust_felhold_blues_hu_rtf_nncl2861-6efv1.zip | 2007-03-24 02:54 | 227K | |
![[ ]](/icons/compressed.gif) | moricz_zsigmond_uri_muri_rtf.zip | 2007-03-24 02:58 | 227K | |
![[ ]](/icons/unknown.gif) | enemy.rtf | 2007-11-14 05:46 | 227K | |
![[ ]](/icons/compressed.gif) | moldova_gyorgy_sotet_angyal_html.zip | 2007-03-24 02:58 | 226K | |
![[ ]](/icons/layout.gif) | TES CS alapok - Első lépések.pdf | 2007-05-03 06:58 | 226K | |
![[ ]](/icons/compressed.gif) | Wayne Chapman - Keleti szél (első rész).zip | 2007-03-23 05:21 | 226K | |
![[ ]](/icons/compressed.gif) | teas_t_o_a_nindzsa_orokseg_hu_rtf.zip | 2007-03-24 03:00 | 226K | |
![[ ]](/icons/unknown.gif) | ujjaszuletes.ace | 2007-03-24 02:56 | 226K | |
![[ ]](/icons/compressed.gif) | maclean_alistair_hajtovadaszat_hu_rtf.zip | 2007-03-24 02:49 | 226K | |
![[ ]](/icons/compressed.gif) | nagy_bando_andras_uton_utfelen_hu_rtf.zip | 2007-03-24 02:58 | 226K | |
![[ ]](/icons/compressed.gif) | Alistair MacLean-Kemek a sasfeszekben.zip | 2007-03-24 02:49 | 226K | |
![[ ]](/icons/compressed.gif) | aldiss_brian_w_amig_vilag_a_vilag_hu_rtf.zip | 2007-03-24 02:52 | 226K | |
![[ ]](/icons/compressed.gif) | Fred Hoyle-A Fekete Felho.zip | 2007-03-24 02:54 | 226K | |
![[ ]](/icons/unknown.gif) | BOOKFILE.JAR | 2007-03-24 02:54 | 226K | |
![[ ]](/icons/compressed.gif) | brunner_john_a_kozmosz_hienai_hu_doc.zip | 2007-03-24 02:56 | 226K | |
![[ ]](/icons/compressed.gif) | Rozsa Gyorgy-Buvos hatos.zip | 2007-03-24 03:00 | 226K | |
![[ ]](/icons/compressed.gif) | maclean_alestair_kemek_a_sasfeszekben_hu_rtf.zip | 2007-03-24 02:49 | 225K | |
![[ ]](/icons/compressed.gif) | Isaac Asimov - Félvér.zip | 2006-12-13 23:53 | 225K | |
![[ ]](/icons/compressed.gif) | levin_ira_a_braziliai_fiuk_hu_rtf.zip | 2007-03-24 02:55 | 225K | |
![[ ]](/icons/compressed.gif) | winnington_alan_a_milliomos_sziv_ugye_hu_doc_nncl2304-65ev1.zip | 2007-03-24 02:49 | 225K | |
![[ ]](/icons/layout.gif) | Megülhető állatok.pdf | 2007-05-03 06:47 | 225K | |
![[ ]](/icons/compressed.gif) | szonyi_gyorgy_endre_titkos_tudomanyok_hu_rtf.zip | 2007-03-24 03:00 | 225K | |
![[ ]](/icons/compressed.gif) | nemere_istvan_granitmezon_hu_rtf_nncl2166-63cv1.zip | 2007-03-24 02:58 | 225K | |
![[ ]](/icons/compressed.gif) | Rejto Jeno - Vanek ur Parizsban.doc.zip | 2007-03-24 02:59 | 225K | |
![[ ]](/icons/compressed.gif) | lll_a_keselyuk_gyaszzeneje.zip | 2007-03-20 00:18 | 225K | |
![[ ]](/icons/compressed.gif) | fraser_antonia_langyos_bunbanat_hu_rtf_nncl2614-6b1v1.zip | 2007-03-24 02:49 | 225K | |
![[ ]](/icons/compressed.gif) | Kolozsvari Grandpierre Emil-A lovatett sarkany.zip | 2007-03-24 02:56 | 225K | |
![[ ]](/icons/unknown.gif) | A halál havában.ZIP | 2007-03-24 03:01 | 225K | |
![[ ]](/icons/compressed.gif) | zsoldos_peter_a_holtak_nem_vetnek_arnyekot_hu_txt.zip | 2007-03-24 03:01 | 225K | |
![[ ]](/icons/compressed.gif) | zsuravljova_valentyina_hohid_a_szakadek_folott_hu_doc_nncl2359-66av1.zip | 2007-03-24 03:00 | 225K | |
![[ ]](/icons/compressed.gif) | Ursula K LeGuin - A sötétség balkeze.zip | 2007-03-26 15:44 | 225K | |
![[ ]](/icons/compressed.gif) | christie_agatha_drama_felvallrol_hu_doc_nncl2400-67bv1.zip | 2007-03-24 02:49 | 225K | |
![[ ]](/icons/compressed.gif) | rice_anne_vittorio_a_vampir_hu_rtf.zip | 2007-03-24 02:49 | 225K | |
![[ ]](/icons/compressed.gif) | tracy_honor_vannak_meg_csodak_hu_rtf.zip | 2007-03-24 02:55 | 225K | |
![[ ]](/icons/compressed.gif) | James Hilton-A kek hold volgye.zip | 2007-03-24 02:55 | 225K | |
![[ ]](/icons/compressed.gif) | garai_gabor_orpheusz_atvaltozasai_hu_rtf.zip | 2007-03-24 02:54 | 225K | |
![[ ]](/icons/compressed.gif) | moldova_gyorgy_a_harmadik_majom_html.zip | 2007-03-24 02:58 | 225K | |
![[ ]](/icons/compressed.gif) | macdonald_ross_a_barbar_part_hu_rtf.zip | 2007-03-24 03:00 | 225K | |
![[ ]](/icons/compressed.gif) | Ray Bradbury - Holdkórosok temetője.zip | 2007-03-22 16:59 | 225K | |
![[ ]](/icons/unknown.gif) | Riding the bullet.doc | 2007-03-24 03:00 | 225K | |
![[ ]](/icons/compressed.gif) | Randevú Rámával.zip | 2007-03-24 02:49 | 224K | |
![[ ]](/icons/compressed.gif) | marsh_evelyn_a_maltai_orvos_hu_doc.zip | 2007-03-24 02:53 | 224K | |
![[ ]](/icons/compressed.gif) | szepes_maria_a_valtozatlansag_hullamhossza_hu_rtf.zip | 2007-03-24 03:00 | 224K | |
![[ ]](/icons/compressed.gif) | clarke_arthur_c_randevu_a_ramaval.zip | 2007-03-24 02:49 | 224K | |
![[ ]](/icons/compressed.gif) | Arthur C. Clarke - Randevú a Rámával.zip | 2007-03-23 13:36 | 224K | |
![[ ]](/icons/compressed.gif) | wyndham_john_a_triffidek_napja_hu_html.zip | 2007-03-24 02:56 | 224K | |
![[ ]](/icons/compressed.gif) | fuks_ladislav_utazas_az_igeret_foldjere_hu_rtf.zip | 2007-03-24 02:57 | 224K | |
![[ ]](/icons/compressed.gif) | Eleven Cthulhu-Le Renard.zip | 2007-03-24 02:57 | 224K | |
![[ ]](/icons/compressed.gif) | John Wyndham-A Triffildek napja.zip | 2007-03-24 02:56 | 224K | |
![[ ]](/icons/compressed.gif) | keegan_josh_neonbiblia_hu_rtf.zip | 2007-03-24 02:56 | 224K | |
![[ ]](/icons/compressed.gif) | balzac_honore_de_sivatagi_szenvedely_rtf.zip | 2007-03-24 02:55 | 224K | |
![[ ]](/icons/compressed.gif) | clarke_az_orszem.zip | 2007-08-04 14:13 | 224K | |
![[ ]](/icons/compressed.gif) | clarke_arthur_c_az_orszem.zip | 2007-03-24 02:49 | 224K | |
![[ ]](/icons/compressed.gif) | ransome_arthur_fecskek_es_fruskak_hu_doc_nncl3096-706v1.zip | 2007-03-24 02:49 | 224K | |
![[ ]](/icons/compressed.gif) | watkins_ambrose_osszeeskudt_ellensegek_hu_rtf.zip | 2007-03-24 02:57 | 224K | |
![[ ]](/icons/compressed.gif) | fontane_theodor_jenny_treibel_hu_doc_nncl2632-6b9v1.zip | 2007-03-24 03:00 | 224K | |
![[ ]](/icons/unknown.gif) | osszes66.ace | 2007-03-24 02:56 | 224K | |
![[ ]](/icons/compressed.gif) | Alan O'Connor - Kék éjszakák árnyai.zip | 2007-04-06 11:05 | 224K | |
![[ ]](/icons/compressed.gif) | cook_robin_agymosas_hu_rtf.zip | 2007-03-24 03:00 | 223K | |
![[ ]](/icons/compressed.gif) | rogers_kelly_idocsuszas_hu_doc_nncl2037-625v3.zip | 2007-03-24 02:56 | 223K | |
![[ ]](/icons/compressed.gif) | cherryh_c_j_ivrel_kapuja_hu_rtf.zip | 2007-03-24 02:52 | 223K | |
![[ ]](/icons/compressed.gif) | Cherryh, C J - Ivrel kapuja hu rtf.zip | 2006-05-31 11:48 | 223K | |
![[ ]](/icons/compressed.gif) | david_peter_pokember.zip | 2007-03-24 02:52 | 223K | |
![[ ]](/icons/compressed.gif) | milne_a_a_micsoda_negy_nap_hu_doc.zip | 2007-03-24 02:49 | 223K | |
![[ ]](/icons/compressed.gif) | hicks_larry_tankvadaszok_hu_rtf.zip | 2007-03-24 02:57 | 223K | |
![[ ]](/icons/compressed.gif) | lem_stanislaw_visszateres_hu_rtf.zip | 2007-03-24 03:00 | 223K | |
![[ ]](/icons/compressed.gif) | Stanislaw Lem - Visszateres_hu_rtf.zip | 2006-05-28 02:08 | 223K | |
![[ ]](/icons/compressed.gif) | london_jack_a_sarga_satan_rtf_hu_nncl440-34bv2.zip | 2007-03-24 02:55 | 223K | |
![[ ]](/icons/compressed.gif) | botond-bolics_gyorgy_az_orbitron_terv_hu_rtf.zip | 2007-03-24 02:52 | 223K | |
![[ ]](/icons/compressed.gif) | Botond Bolics György - Az orbitron terv hu rtf.zip | 2007-02-21 16:25 | 223K | |
![[ ]](/icons/compressed.gif) | gyocsi_laszlo_lelket_orzik_a_sasok_hu_doc.zip | 2007-03-24 02:55 | 223K | |
![[ ]](/icons/compressed.gif) | nemere_istvan_a_veszelyes_rakomany_hu_rtf_nncl2164-63cv1.zip | 2007-03-24 02:58 | 223K | |
![[ ]](/icons/compressed.gif) | Philip K Dick - Kizökkent idő.zip | 2006-05-28 02:48 | 223K | |
![[ ]](/icons/compressed.gif) | teas_t_o_uldozesi_mania_hu_rtf.zip | 2007-03-24 03:00 | 223K | |
![[ ]](/icons/compressed.gif) | teas_t_o_old_ahol_ered_hu_rtf.zip | 2007-03-24 03:00 | 223K | |
![[ ]](/icons/compressed.gif) | sethfield_christopher_a_profeta_hu_doc.zip | 2007-03-24 03:00 | 223K | |
![[ ]](/icons/unknown.gif) | orpheusz_atvaltozasai.ace | 2007-03-24 02:52 | 223K | |
![[ ]](/icons/compressed.gif) | green_w_hamilton_mars_1910_hu_rtf.zip | 2007-03-24 03:01 | 223K | |
![[ ]](/icons/compressed.gif) | W. Hamilton Green - Mars 1910.zip | 2007-08-04 14:14 | 223K | |
![[ ]](/icons/unknown.gif) | A_VILÁ~1.DOC | 2002-12-04 11:42 | 223K | |
![[ ]](/icons/compressed.gif) | mcbain_ed_feher_por_hu_rtf.zip | 2007-03-24 02:53 | 222K | |
![[ ]](/icons/compressed.gif) | hilton_james_a_kek_hold_volgye.zip | 2007-03-24 02:55 | 222K | |
![[TXT]](/icons/text.gif) | Gibson, William - Számáló Nullára.txt.arj | 2006-05-31 09:09 | 222K | |
![[ ]](/icons/compressed.gif) | moldova_gyorgy_regi_nota_html.zip | 2007-03-24 02:58 | 222K | |
![[ ]](/icons/compressed.gif) | Leslie L. Lawrence - Dzsingisz kán.zip | 2007-03-24 02:57 | 222K | |
![[ ]](/icons/unknown.gif) | osszes03.ace | 2007-03-24 02:56 | 222K | |
![[ ]](/icons/compressed.gif) | silverberg_robert_uvegtorony_hu_doc_nncl943-42ev2.zip | 2007-03-24 02:59 | 222K | |
![[ ]](/icons/unknown.gif) | Kurt vonnegut- A Titan szirenjei | 2007-03-24 02:57 | 222K | |
![[ ]](/icons/compressed.gif) | cherryh_c_j_azeroth_pokla_hu_rtf.zip | 2007-03-24 02:52 | 222K | |
![[ ]](/icons/compressed.gif) | Cherryh, C J - Azeroth pokla hu rtf.zip | 2006-05-31 11:48 | 222K | |
![[ ]](/icons/compressed.gif) | koszegi_imre_a_fellegvari_venusz_hu_rtf_nncl744-3f2v1.zip | 2007-03-24 02:56 | 222K | |
![[ ]](/icons/compressed.gif) | hays_lawrence_columbo2_hu_rtf.zip | 2007-03-24 02:57 | 222K | |
![[ ]](/icons/unknown.gif) | Esti Kornél kalandjai.DOC | 2007-03-24 02:55 | 222K | |
![[ ]](/icons/compressed.gif) | Brian W. Aldiss - Amig a világ világ.zip | 2007-03-19 18:02 | 222K | |
![[ ]](/icons/compressed.gif) | nemere_istvan_lenni_vagy_elni_hu_rtf.zip | 2007-03-24 02:58 | 222K | |
![[ ]](/icons/compressed.gif) | balzac_honore_de_a_videki_orvos_rtf.zip | 2007-03-24 02:55 | 222K | |
![[ ]](/icons/compressed.gif) | james_p_d_nem_nonek_valo_hu_rtf_nncl1918-614v1.zip | 2007-03-24 02:58 | 222K | |
![[ ]](/icons/compressed.gif) | Arthur C Clarke - Birodalmi Föld.zip | 2007-03-23 13:30 | 222K | |
![[ ]](/icons/compressed.gif) | asimov_isaac_a_halhatatlansag_halala.zip | 2007-03-24 02:55 | 222K | |
![[ ]](/icons/compressed.gif) | szabo_magda_mezescsok_cerberusnak_html.zip | 2007-03-24 03:00 | 222K | |
![[ ]](/icons/compressed.gif) | soucek_ludvik_tamad_a_koporso_hu_rtf_nncl2707-6cav1.zip | 2007-03-24 02:57 | 221K | |
![[ ]](/icons/compressed.gif) | gibson_william_izzo_krom_hu_rtf.zip | 2007-03-24 03:01 | 221K | |
![[ ]](/icons/compressed.gif) | Willian Gibsom es masok-Izzo KROM.zip | 2007-03-24 03:01 | 221K | |
![[ ]](/icons/compressed.gif) | Gibson, William - Izzo krom hu rtf.zip | 2007-02-21 16:21 | 221K | |
![[ ]](/icons/compressed.gif) | a_keselyuk_gyaszzeneje.zip | 2007-03-24 02:57 | 221K | |
![[ ]](/icons/compressed.gif) | marai_sandor_naplo_1976_83_hu_rtf_nncl2974-6fcv1.zip | 2007-03-24 02:57 | 221K | |
![[ ]](/icons/compressed.gif) | verne_jules_sztrogof_mihaly_rtf.zip | 2007-03-24 02:56 | 221K | |
![[ ]](/icons/compressed.gif) | Desmond Bagley-Az ellenseg.zip | 2007-03-24 02:52 | 221K | |
![[ ]](/icons/compressed.gif) | John Wyndham - Ujjaszuletes.zip | 2006-05-31 06:26 | 221K | |
![[ ]](/icons/compressed.gif) | meszaros_marta_kisvilma_hu_doc_nncl3078-706v1.zip | 2007-03-24 02:57 | 221K | |
![[ ]](/icons/compressed.gif) | macchiavelli_loriano_cavedoni_markine_ekszerei_hu_rtf.zip | 2007-03-24 02:57 | 221K | |
![[ ]](/icons/compressed.gif) | Raoul Renier - Pokol.zip | 2007-04-06 11:06 | 221K | |
![[ ]](/icons/compressed.gif) | watson_ian_urgardista.jpg.zip | 2007-03-24 02:55 | 221K | |
![[ ]](/icons/unknown.gif) | 7.doc | 2007-11-14 08:05 | 221K | |
![[ ]](/icons/compressed.gif) | mattyasovszky_jeno_hod_es_a_megsemmisult_nyom_hu_doc_nncl2010-621v1.zip | 2007-03-24 02:57 | 221K | |
![[ ]](/icons/compressed.gif) | Francis Carsac-Sehollakok.zip | 2007-03-24 02:54 | 221K | |
![[ ]](/icons/compressed.gif) | Francis Carsac - Sehollakók.zip | 2006-08-24 23:00 | 221K | |
![[ ]](/icons/compressed.gif) | kerouac_jack_doktor_sax_hu_rtf.zip | 2007-03-24 02:55 | 221K | |
![[ ]](/icons/compressed.gif) | marsh_evelyn_mindhalalig_hu_doc.zip | 2007-03-24 02:53 | 221K | |
![[ ]](/icons/compressed.gif) | wyndham_john_ujjaszuletes.zip | 2007-03-24 02:56 | 221K | |
![[ ]](/icons/compressed.gif) | toke_peter_afrikai_nyomozas_hu_doc.zip | 2007-03-24 03:00 | 221K | |
![[ ]](/icons/compressed.gif) | bester_alfred_az_arcnelkuli_ember_hu_rtf.zip | 2007-03-24 02:49 | 221K | |
![[ ]](/icons/compressed.gif) | fraser_antonia_a_vad_sziget_hu_rtf_nncl522-36dv1.zip | 2007-03-24 02:49 | 221K | |
![[ ]](/icons/compressed.gif) | Babits Mihaly osszegyujtott versei.zip | 2007-03-24 02:55 | 221K | |
![[ ]](/icons/layout.gif) | Gladiátor viadalok.pdf | 2007-04-15 16:48 | 220K | |
![[ ]](/icons/layout.gif) | abbitfutam.pdf | 2007-04-15 16:43 | 220K | |
![[ ]](/icons/compressed.gif) | keyes_daniel_viragot_algernonnak_hu_doc_nncl3021-708v1.zip | 2007-03-24 02:52 | 220K | |
![[ ]](/icons/compressed.gif) | Alien 4.zip | 2007-03-24 02:49 | 220K | |
![[ ]](/icons/compressed.gif) | 04. Crispin & O'Malley - Feltámad a halál.zip | 2007-03-23 19:31 | 220K | |
![[ ]](/icons/compressed.gif) | wells_h_g_a_puspok_lelke_rtf.zip | 2007-03-24 02:55 | 220K | |
![[ ]](/icons/compressed.gif) | durrell_gerald_istenek_kertje_hu_rtf.zip | 2007-03-24 02:54 | 220K | |
![[ ]](/icons/compressed.gif) | Jules Verne-Sztrogof Mihaly.zip | 2007-03-24 02:56 | 220K | |
![[ ]](/icons/compressed.gif) | fink_viktor_idegenlegio_hu_rtf_nncl1286-4d7v1.zip | 2007-03-24 03:01 | 220K | |
![[ ]](/icons/compressed.gif) | berkesi_andras_utlevel_a_pokolba_hu_txt_nncl2348-667v1.zip | 2007-03-24 02:50 | 220K | |
![[ ]](/icons/compressed.gif) | Poul Anderson - Az idő folyosói hu.rtf.zip | 2006-05-10 06:32 | 220K | |
![[ ]](/icons/compressed.gif) | Ray Bradbury-A tetovalt ember.zip | 2007-03-24 02:59 | 220K | |
![[ ]](/icons/compressed.gif) | fuks_ladislav_utazas_az_igeret_foldjere_hu_html.zip | 2007-03-24 02:57 | 220K | |
![[ ]](/icons/compressed.gif) | lorincz_l_laszlo_uvolto_bika_hu_rtf.zip | 2007-03-24 02:57 | 220K | |
![[ ]](/icons/compressed.gif) | jamamoto_cunetomo_hagakure_a_szamurajok_kodexe_hu_rtf.zip | 2007-03-24 02:55 | 220K | |
![[ ]](/icons/compressed.gif) | ronaszegi_miklos_kartal_visszater_hu_rtf.zip | 2007-03-24 03:00 | 219K | |
![[ ]](/icons/compressed.gif) | clarke_arthur_c_birodalmi_fold_hu_rtf.zip | 2007-03-24 02:49 | 219K | |
![[ ]](/icons/compressed.gif) | joyce_james_ifjukori_onarckep_hu_txt.zip | 2007-03-24 02:55 | 219K | |
![[ ]](/icons/compressed.gif) | Harry Harrison-A technikolor idogep.zip | 2007-03-24 02:55 | 219K | |
![[ ]](/icons/compressed.gif) | A Magyar helyesírás szabályai.zip | 2007-03-24 02:49 | 219K | |
![[ ]](/icons/compressed.gif) | christie_agatha_egy_marek_rozs_hu_rtf.zip | 2007-03-24 02:49 | 219K | |
![[ ]](/icons/compressed.gif) | herman_gail_jurassic_park_hu_rtf.zip | 2007-03-24 02:54 | 219K | |
![[ ]](/icons/compressed.gif) | renier_raoul_korona_es_kehely_hu_rtf.zip | 2007-03-24 02:54 | 219K | |
![[ ]](/icons/compressed.gif) | ransome_arthur_nem_akartunk_tengerre_szallni_hu_doc_nncl3099-706v1.zip | 2007-03-24 02:49 | 219K | |
![[ ]](/icons/compressed.gif) | X-szárnyúak - 1. A Zsiványkommandó.zip | 2007-03-26 19:02 | 218K | |
![[ ]](/icons/compressed.gif) | merle_robert_mestersegem_a_halal_hu_html.zip | 2007-03-24 02:59 | 218K | |
![[ ]](/icons/compressed.gif) | stackpole_michael_a_zsivanykommando.zip | 2007-03-24 02:54 | 218K | |
![[ ]](/icons/compressed.gif) | Arthur C Clarke - A város és a csillagok.zip | 2007-03-23 13:30 | 218K | |
![[ ]](/icons/compressed.gif) | grey_anthony_a_kobraisten_bosszuja_hu_rtf.zip | 2007-03-24 02:49 | 218K | |
![[ ]](/icons/compressed.gif) | foster_alan_dean_a_dolog_hu_rtf.zip | 2007-03-24 02:49 | 218K | |
![[ ]](/icons/compressed.gif) | Foster, Alan Dean - A dolog_hu_rtf.zip | 2006-05-17 05:14 | 218K | |
![[ ]](/icons/compressed.gif) | Frankenstein.zip | 2007-03-24 02:57 | 218K | |
![[ ]](/icons/compressed.gif) | Isaac Asimov - Robbie.zip | 2006-05-10 22:56 | 218K | |
![[ ]](/icons/compressed.gif) | shelley_mary_frankenstein_html.zip | 2007-03-24 02:57 | 218K | |
![[ ]](/icons/compressed.gif) | maclean_alistair_nyomtalanul_hu_rtf.zip | 2007-03-24 02:49 | 218K | |
![[ ]](/icons/unknown.gif) | foldburok.ace | 2007-03-24 02:52 | 218K | |
![[ ]](/icons/compressed.gif) | jokai_anna_a_feladat_html.zip | 2007-03-24 02:56 | 218K | |
![[ ]](/icons/compressed.gif) | Kaiko Takesi-Oszakai ejszakak.zip | 2007-03-24 02:56 | 218K | |
![[ ]](/icons/compressed.gif) | follett_james_a_jeg_hu_doc.zip | 2007-02-21 16:26 | 218K | |
![[ ]](/icons/compressed.gif) | Az Evangerium Tamas szerint.zip | 2007-03-24 02:53 | 218K | |
![[ ]](/icons/compressed.gif) | stackpole_michael_a_zsivanykommando_hu_rtf.zip | 2006-05-28 04:04 | 218K | |
![[ ]](/icons/compressed.gif) | purs_laimonis_langolo_var_hu_rtf_nncl2112-636v1.zip | 2007-03-24 02:57 | 218K | |
![[ ]](/icons/compressed.gif) | feher_klara_foldrengesek_szigete_doc.zip | 2007-03-24 02:54 | 218K | |
![[ ]](/icons/compressed.gif) | hammett_dashiell_a_cingar_feltalalo_hu_rtf.zip | 2007-03-24 02:52 | 218K | |
![[ ]](/icons/compressed.gif) | Arthur C Clarke - Az éden szökőkútjai.zip | 2007-03-23 13:30 | 218K | |
![[ ]](/icons/layout.gif) | Szellem.pdf | 2007-04-15 16:46 | 217K | |
![[ ]](/icons/compressed.gif) | benko_mihaly_uj_torveny_spartaban_hu_txt.zip | 2007-03-24 02:50 | 217K | |
![[ ]](/icons/compressed.gif) | Alistair Maclean-Kulcsszo_retteges.zip | 2007-03-24 02:49 | 217K | |
![[ ]](/icons/compressed.gif) | pohl_frederik_az_atjaro_txt.zip | 2007-03-24 02:54 | 217K | |
![[ ]](/icons/compressed.gif) | gloger_gotthold_johann_kunckel_kalandjai_hu_rtf_nncl1603-55dv1.zip | 2007-03-24 02:55 | 217K | |
![[ ]](/icons/compressed.gif) | James Thurbert-A feher szarvas.zip | 2007-03-24 02:55 | 217K | |
![[ ]](/icons/compressed.gif) | balzac_honore_de_goirot_apo_html.zip | 2007-03-24 02:55 | 217K | |
![[ ]](/icons/compressed.gif) | Stone, Jeffrey - Harc az ej koveert hu rtf.zip | 2007-03-26 19:08 | 217K | |
![[ ]](/icons/compressed.gif) | nemere_istvan_a_neutron_akcio_hu_rtf.zip | 2007-03-24 02:58 | 217K | |
![[ ]](/icons/compressed.gif) | hollosi_tibor_hosszu_kesek_ejszakaja_hu_doc.zip | 2007-03-24 02:55 | 217K | |
![[ ]](/icons/compressed.gif) | Orson Scott Card - Holtak szószólója.zip | 2007-03-26 17:51 | 217K | |
![[ ]](/icons/compressed.gif) | christie_agatha_harom_vak_eger_hu_rtf_nncl2519-696v1.zip | 2007-03-24 02:49 | 217K | |
![[ ]](/icons/compressed.gif) | maclean_alistair_a_kulcsszo_retteges_hu_rtf.zip | 2007-03-24 02:49 | 217K | |
![[ ]](/icons/compressed.gif) | A szamlalo nullára.zip | 2007-03-24 03:01 | 217K | |
![[ ]](/icons/compressed.gif) | Robert A Heinlein - A Galaxis polgára.zip | 2007-03-23 13:52 | 217K | |
![[ ]](/icons/compressed.gif) | gibson_william_a_szamlalo_nullara_hu_txt.zip.zip | 2007-03-24 03:01 | 217K | |
![[ ]](/icons/compressed.gif) | A gyűrük ura III.zip | 2007-03-26 19:30 | 217K | |
![[ ]](/icons/compressed.gif) | gaspar_andras_kialts_farkast_hu_rtf_nncl1925-615v1.zip | 2007-03-24 02:54 | 217K | |
![[ ]](/icons/compressed.gif) | szent-gyorgyi_albert_az_elo_allapot_hu_rtf_nnvl2213-648v1.zip | 2007-03-24 03:00 | 217K | |
![[ ]](/icons/compressed.gif) | stone_jeffrey_harc_az_ej_koveert_hu_rtf.zip | 2007-03-24 02:54 | 217K | |
![[ ]](/icons/compressed.gif) | Stone, Jeffrey - Harc_az_ej_koveert_hu_rtf.zip | 2006-05-28 04:17 | 217K | |
![[ ]](/icons/compressed.gif) | Jozsef Attila osszes koltemenye.zip | 2007-03-24 02:55 | 217K | |
![[ ]](/icons/compressed.gif) | moldova_gyorgy_negyven_predikator_html.zip | 2007-03-24 02:58 | 217K | |
![[ ]](/icons/compressed.gif) | hoyle_fred_a_fekete_felho_doc.zip | 2007-03-24 02:54 | 217K | |
![[ ]](/icons/compressed.gif) | Hoyle, Fred - A fekete felhő.zip | 2006-08-24 22:09 | 217K | |
![[ ]](/icons/unknown.gif) | 05 - A hosszúéletűek (Mágia).doc | 2007-03-24 02:54 | 217K | |
![[ ]](/icons/unknown.gif) | BOOKFILE.JAR2 | 2007-03-24 02:54 | 216K | |
![[ ]](/icons/compressed.gif) | hegedus_hubert_urgyarmat_hu_rtf.zip | 2006-05-18 01:16 | 216K | |
![[ ]](/icons/compressed.gif) | peters_ellis_a_szent_csontjai_hu_html.zip | 2007-03-24 02:53 | 216K | |
![[ ]](/icons/compressed.gif) | heinlein_robert_a_galaxis_polgara_hu_html.zip | 2007-03-24 02:59 | 216K | |
![[ ]](/icons/compressed.gif) | coatmeur_jean_francois_bunteny_variaciok_hajokurtre_hu_rtf_nncl2704-6cav1.zip | 2007-03-24 02:56 | 216K | |
![[ ]](/icons/compressed.gif) | cooper_james_fenimore_de_nyomkereso_rtf.zip | 2007-03-24 02:52 | 216K | |
![[ ]](/icons/unknown.gif) | hzona.ace | 2007-03-24 02:52 | 216K | |
![[ ]](/icons/compressed.gif) | kertesz_imre_a_szamuzott_nyelv_html.zip | 2007-03-24 02:56 | 215K | |
![[ ]](/icons/compressed.gif) | clarke_mesek_a_foldrol.zip | 2007-08-04 15:04 | 215K | |
![[ ]](/icons/compressed.gif) | clarke_arthur_c_mesek_a_foldrol.zip | 2007-03-24 02:49 | 215K | |
![[ ]](/icons/compressed.gif) | Arthur C Clarke - Mesek_a_foldrol.zip | 2005-06-22 15:33 | 215K | |
![[ ]](/icons/compressed.gif) | fekete_istvan_karacsonyi_latogatok_hu_rtf_nncl2853-6ebv1.zip | 2007-03-24 02:57 | 215K | |
![[ ]](/icons/compressed.gif) | thurber_james_a_feher_szarvas_hu_rtf.zip | 2007-03-24 02:55 | 215K | |
![[ ]](/icons/compressed.gif) | JAMES THURBER - a_feher_szarvas.zip | 2006-05-10 06:25 | 215K | |
![[ ]](/icons/compressed.gif) | schmidt_dan_tuzgyuru_hu_rtf.zip | 2007-03-24 02:52 | 215K | |
![[ ]](/icons/compressed.gif) | molstand_stephen_godzilla_hu_rtf.zip | 2007-03-24 03:00 | 215K | |
![[ ]](/icons/unknown.gif) | Moricz Zsigmond-Legy jo mindhalalig | 2007-03-24 02:58 | 215K | |
![[ ]](/icons/compressed.gif) | gardonyi_geza_szivlobbanas_rtf.zip | 2007-03-24 02:54 | 215K | |
![[ ]](/icons/compressed.gif) | osborne_richard_a_pusztito_hu_doc_nncl2671-6c2v1.zip | 2007-03-24 02:59 | 215K | |
![[ ]](/icons/compressed.gif) | Q. G. Lyn - A. F. Bian - Üzen a nyolcadik bolygó.zip | 2007-02-21 16:27 | 215K | |
![[ ]](/icons/compressed.gif) | monette_paul_ovadek_hu_rtf_nncl2456-68ev1.zip | 2007-03-24 02:58 | 214K | |
![[ ]](/icons/compressed.gif) | Anne Frank-Anne Frank naploja.zip | 2007-03-24 02:49 | 214K | |
![[ ]](/icons/compressed.gif) | Poul Anderson - A törött kard.zip | 2007-03-21 19:11 | 214K | |
![[ ]](/icons/compressed.gif) | fallet_renee_egy_felnotas_parizsban_hu_doc_nncl1670-595v1.zip | 2007-03-24 02:59 | 214K | |
![[ ]](/icons/compressed.gif) | dick_philip_k_ember_a_fellegvarban.zip | 2007-03-24 02:58 | 214K | |
![[ ]](/icons/compressed.gif) | Philip K Dick - Az ember a Fellegvárban .zip | 2007-02-21 16:01 | 214K | |
![[ ]](/icons/compressed.gif) | briand_paul_fanfar_a_legyozottekert_hu_doc_nncl2698-6c8v1.zip | 2007-03-24 02:58 | 214K | |
![[ ]](/icons/compressed.gif) | london_jack_aranyasok_alaszkaban_hu_doc_nncl3023-708v1.zip | 2007-03-24 02:55 | 214K | |
![[ ]](/icons/compressed.gif) | csernai_zoltan_atleontisz.zip | 2007-03-24 02:52 | 214K | |
![[ ]](/icons/compressed.gif) | Csernai Zoltán - Atleontisz.zip | 2007-02-21 16:37 | 214K | |
![[ ]](/icons/unknown.gif) | osszes13.ace | 2007-03-24 02:56 | 214K | |
![[ ]](/icons/compressed.gif) | A gyűrük ura II.zip | 2007-03-26 19:30 | 214K | |
![[ ]](/icons/compressed.gif) | hays_lawrence_columbo1_hu_rtf.zip | 2007-03-24 02:57 | 214K | |
![[ ]](/icons/compressed.gif) | Isaac Asimov - Én a robot.zip | 2007-03-22 05:29 | 213K | |
![[ ]](/icons/compressed.gif) | krudy_gyula_boldogult_urfikoromban_hu_doc.zip | 2007-03-24 02:56 | 213K | |
![[ ]](/icons/compressed.gif) | hermann_zsuzsa_cesare_borgia_hu_rtf.zip | 2007-03-24 02:55 | 213K | |
![[ ]](/icons/compressed.gif) | aldridge_james_tengeri_sas_hu_rtf.zip | 2007-03-24 02:55 | 213K | |
![[ ]](/icons/compressed.gif) | carsac_francis_sehollakok_doc.zip | 2007-03-24 02:54 | 213K | |
![[ ]](/icons/compressed.gif) | cockney_frank_rokacsapda_hu_rtf.zip | 2007-03-24 02:54 | 213K | |
![[ ]](/icons/compressed.gif) | marsh_evelyn_lazalom_hu_doc.zip | 2007-03-24 02:53 | 213K | |
![[ ]](/icons/compressed.gif) | durrell_gerald_a _halak_jelleme_hu_rtf.zip | 2007-03-24 02:54 | 213K | |
![[ ]](/icons/compressed.gif) | mcbain_ed_ongyilkosok_hu_doc.zip | 2007-03-24 02:53 | 213K | |
![[ ]](/icons/compressed.gif) | Isaac Asimov-En,a robot.zip | 2007-03-24 02:55 | 213K | |
![[ ]](/icons/compressed.gif) | kurti_andras_csokol_renate_hu_doc.zip | 2007-03-24 02:57 | 213K | |
![[ ]](/icons/compressed.gif) | Alan Dean Foster-Elfelejtett urhajo.zip | 2007-03-24 02:49 | 213K | |
![[ ]](/icons/compressed.gif) | wilson_mark_f_terminator_a_golem_hu_rtf.zip | 2007-03-24 02:57 | 213K | |
![[ ]](/icons/compressed.gif) | ambler_eric_dimitriosz_koporsoja_hu_rtf_nncl1949-619v1.zip | 2007-03-24 02:53 | 213K | |
![[ ]](/icons/compressed.gif) | q_g_lyn_a_f_bian_uzen_a_nyolcadik_bolygo_hu_doc.zip | 2007-03-24 02:57 | 213K | |
![[ ]](/icons/compressed.gif) | Arthur Koestler-A tizenharmadik torsz[A kazar birodalom].zip | 2007-03-24 02:49 | 212K | |
![[ ]](/icons/compressed.gif) | bradbury_ray_holdkorosok_temetoje.zip | 2007-03-24 02:59 | 212K | |
![[ ]](/icons/compressed.gif) | Arthur Herzog-Hőseg.zip | 2007-03-24 02:49 | 212K | |
![[ ]](/icons/compressed.gif) | burroughs_edgar_rice_tarzan_a_dzsungel_ura_hu_rtf.zip | 2007-03-24 02:53 | 212K | |
![[ ]](/icons/compressed.gif) | herbert_frank_dune_messiasa_hu_rtf.zip | 2007-03-24 02:54 | 212K | |
![[ ]](/icons/compressed.gif) | Frank Herbert - A Düne messiása.zip | 2007-02-21 16:32 | 212K | |
![[ ]](/icons/compressed.gif) | shaw_g_b_cashel_byron_mestersege_hu_txt.zip | 2007-03-24 02:54 | 212K | |
![[ ]](/icons/compressed.gif) | Q. G. Lyn - A. F. Bian - Az ellentmondások bolygója.zip | 2007-03-23 19:10 | 212K | |
![[ ]](/icons/compressed.gif) | q_g_lyn_a_f_bian_az_ellentmondasok_bolygoja_hu_rtf.zip | 2007-03-24 02:57 | 212K | |
![[ ]](/icons/compressed.gif) | burroughs_edgar_rice_a_mars_istenei_hu_rtf.zip | 2007-03-24 02:53 | 212K | |
![[ ]](/icons/compressed.gif) | zweig_stefan_fouche_hu_doc.zip | 2007-03-24 03:00 | 212K | |
![[ ]](/icons/compressed.gif) | mcbain_ed_lidercnyomas_hu_rtf.zip | 2007-03-24 02:53 | 212K | |
![[ ]](/icons/compressed.gif) | ould_chris_zarovonalak_hu_rtf_nncl2398-674v1.zip | 2007-03-24 02:52 | 212K | |
![[ ]](/icons/compressed.gif) | hammett_dashiell_a_maltai_solyom_hu_rtf.zip | 2007-03-24 02:52 | 212K | |
![[ ]](/icons/compressed.gif) | harrison_harry_a_technicolor_idogep_hu_rtf.zip | 2007-03-24 02:55 | 212K | |
![[ ]](/icons/compressed.gif) | Harry Harryson - a technicolor_idogep_hu_rtf.zip | 2007-02-21 16:31 | 212K | |
![[ ]](/icons/compressed.gif) | Harry Harryson - a technicolor_idogep.rtf.zip | 2007-02-21 16:33 | 212K | |
![[ ]](/icons/compressed.gif) | Harry Harryson - A technicolor_idogép_hu_rtf.zip | 2006-05-30 18:04 | 212K | |
![[ ]](/icons/unknown.gif) | BOOKFILE.JAR3 | 2007-03-24 02:54 | 212K | |
![[ ]](/icons/unknown.gif) | omarossz.ace | 2007-03-24 02:52 | 212K | |
![[ ]](/icons/layout.gif) | Az érem másik oldala.pdf | 2007-04-15 15:45 | 212K | |
![[ ]](/icons/compressed.gif) | Krishanamuri,Jiddu-A mester labainal.zip | 2007-03-24 02:56 | 212K | |
![[ ]](/icons/compressed.gif) | may_karl_a_medveolo_fia_rtf.zip | 2007-03-24 02:56 | 212K | |
![[ ]](/icons/compressed.gif) | marsh_evelyn_orjito_szenvedely_hu_doc.zip | 2007-03-24 02:53 | 211K | |
![[ ]](/icons/compressed.gif) | hunter_sally_fertozes_hu_rtf_nncl2470-68ev1.zip | 2007-03-24 03:00 | 211K | |
![[ ]](/icons/compressed.gif) | Rob MecGregor-Indiana Jones 3.zip | 2007-03-24 02:55 | 211K | |
![[ ]](/icons/compressed.gif) | Terminator_2.zip | 2007-03-24 03:00 | 211K | |
![[ ]](/icons/compressed.gif) | Ray O'Sullivan - Sötét térítő.zip | 2007-04-06 11:06 | 211K | |
![[ ]](/icons/compressed.gif) | Boronkay ivan-Romai regek es mondak.zip | 2007-03-24 02:52 | 211K | |
![[ ]](/icons/compressed.gif) | Isaac Asimov- Alapitvany.zip | 2007-03-24 02:55 | 211K | |
![[ ]](/icons/compressed.gif) | frank_anne_anne_frank_naploja_hu_doc_nncl3018-708v1.zip | 2007-03-24 02:49 | 211K | |
![[ ]](/icons/compressed.gif) | frakes_randall_terminator_2_hu_rtf.zip | 2007-03-24 03:00 | 211K | |
![[ ]](/icons/compressed.gif) | Frakes Randall - Terminator_2.zip | 2006-05-17 05:58 | 211K | |
![[ ]](/icons/compressed.gif) | tetovalt.zip | 2007-08-04 15:11 | 211K | |
![[ ]](/icons/compressed.gif) | bradbury_ray_a_tetovalt_ember.zip | 2007-03-24 02:59 | 211K | |
![[ ]](/icons/compressed.gif) | Ray Bradbury - A tetovált ember elbeszélések.zip | 2006-08-24 23:32 | 211K | |
![[ ]](/icons/compressed.gif) | macgregor_rob_indiana_jones_es_az_utolso_kereszteslovag_hu_rtf.zip | 2007-03-24 02:55 | 211K | |
![[ ]](/icons/compressed.gif) | macgregor_rob_indiana_jones_es_az_utolso_keresztes_lovag.zip | 2007-03-24 02:55 | 211K | |
![[ ]](/icons/compressed.gif) | rogger_louis_lucien_a_grenoblei_gyors_hu_doc.zip | 2007-03-24 02:57 | 211K | |
![[ ]](/icons/compressed.gif) | asimov_isaac_alapitvany_es_birodalom.zip | 2007-03-24 02:55 | 211K | |
![[ ]](/icons/compressed.gif) | Isaac Asimov - Alapítvány sorozat - Alapitvany e birodalom hu rtf.zip | 2006-05-10 17:38 | 211K | |
![[ ]](/icons/compressed.gif) | dalai_lama_osi bolcsesseg_modern_vilag_hu_doc.zip | 2007-03-24 02:52 | 211K | |
![[ ]](/icons/compressed.gif) | kotzowinkle_william_et_foldonkivuli_hu_doc.zip | 2007-03-24 03:01 | 211K | |
![[ ]](/icons/compressed.gif) | szentmihalyi_szabo_peter_avarok_hu_rtf.zip | 2007-03-24 03:00 | 211K | |
![[ ]](/icons/compressed.gif) | golding_william_ripacs_martin_hu_rtf.zip | 2007-03-24 03:01 | 211K | |
![[ ]](/icons/compressed.gif) | mcmurtry_larry_az_utolso_mozieloadas_hu_rtf.zip | 2007-03-24 02:57 | 211K | |
![[ ]](/icons/compressed.gif) | shan_darren_az_ejszaka_szovetsegesei_hu_rtf.zip | 2007-03-24 02:52 | 210K | |
![[ ]](/icons/compressed.gif) | Szexuális etika jegyzet.zip | 2007-03-24 03:00 | 210K | |
![[ ]](/icons/compressed.gif) | apollinaire_guillaume_versei_html.zip | 2007-03-24 02:55 | 210K | |
![[ ]](/icons/unknown.gif) | niven,_larry_-_a_szornyeteg.rtf | 2007-11-14 04:34 | 210K | |
![[ ]](/icons/compressed.gif) | stewart_fred_m_a_matuzsalem-enzim_hu_rtf_nncl2005-61fv1.zip | 2007-03-24 02:54 | 210K | |
![[ ]](/icons/unknown.gif) | 6.doc | 2007-11-14 07:58 | 210K | |
![[ ]](/icons/compressed.gif) | moricz_zsigmond_legy_jo_mindhalalig.zip | 2007-03-24 02:58 | 210K | |
![[ ]](/icons/compressed.gif) | herzog_arthur_hoseg_hu_rtf.zip | 2007-03-24 02:49 | 210K | |
![[ ]](/icons/compressed.gif) | Bükki Tamás Perverziók .zip | 2007-03-22 17:51 | 210K | |
![[ ]](/icons/compressed.gif) | hambly_barbara_a_szep_es_a_szornyeteg_hu_rtf.zip | 2007-03-24 02:49 | 209K | |
![[ ]](/icons/compressed.gif) | szabo_magda_alvok_futasa_html.zip | 2007-03-24 03:00 | 209K | |
![[ ]](/icons/compressed.gif) | manyi_laszlo_cirkusz_a_holdon_hu_doc_nncl3024-708v1.zip | 2007-03-24 02:57 | 209K | |
![[ ]](/icons/compressed.gif) | gerber_michael_e_a_vallalkozas_mitosza_hu_html.zip | 2006-05-17 06:15 | 209K | |
![[ ]](/icons/compressed.gif) | John D Macdonald-Bibor szabadeses.zip | 2007-03-24 02:56 | 209K | |
![[ ]](/icons/compressed.gif) | green_julien_leviathan_hu_rtf.zip | 2007-03-24 02:56 | 209K | |
![[ ]](/icons/compressed.gif) | feher_klara_narkozis_negy_nap_a_paradicsomban_sargalaz_hu_rtf_nncl1422-50ev1.zip | 2007-03-24 02:54 | 209K | |
![[ ]](/icons/compressed.gif) | Arthur C Clarke - 2010 Második űrodisszea.zip | 2007-03-23 13:35 | 209K | |
![[ ]](/icons/compressed.gif) | nemere_istvan_holtak_harca_hu_rtf.zip | 2007-03-24 02:58 | 209K | |
![[ ]](/icons/compressed.gif) | salvatore_r_a_otthon_hu_txt.zip | 2006-05-28 03:41 | 209K | |
![[ ]](/icons/compressed.gif) | kaleidoszkop.zip | 2007-08-04 14:49 | 209K | |
![[ ]](/icons/compressed.gif) | bradbury_ray_kaleidoszkop.zip | 2007-03-24 02:59 | 209K | |
![[ ]](/icons/compressed.gif) | hamvas_bela_silentium_titkos_jegyzokonyv_unicornis_hu_rtf.zip | 2007-03-24 02:55 | 209K | |
![[ ]](/icons/compressed.gif) | John Wyndham - A triffidek napja.zip | 2007-03-26 19:55 | 209K | |
![[ ]](/icons/compressed.gif) | verne_jules_800_merfold_rtf.zip | 2007-03-24 02:56 | 209K | |
![[ ]](/icons/compressed.gif) | fleming_ian_csak_ketszer_elsz_hu_rtf.zip | 2007-03-24 02:55 | 209K | |
![[ ]](/icons/compressed.gif) | anthony_piers_szerencskerekpar.zip | 2007-03-24 02:58 | 209K | |
![[ ]](/icons/compressed.gif) | jokai_anna_perc-emberkek_daridoja_html.zip | 2007-03-24 02:56 | 209K | |
![[ ]](/icons/unknown.gif) | 03 - Roul Renier - Hideg karok ölelése.doc | 2007-03-24 02:54 | 209K | |
![[ ]](/icons/compressed.gif) | twain_mark_tom_sawyer_kalandjai_hu_rtf_nncl1970-61av.zip | 2007-03-24 02:57 | 208K | |
![[ ]](/icons/compressed.gif) | szabo_magda_az_ajto_html.zip | 2007-03-24 03:00 | 208K | |
![[ ]](/icons/unknown.gif) | orszem.ace | 2007-03-24 02:52 | 208K | |
![[ ]](/icons/compressed.gif) | amicis_edmondo_de_sziv_hu_rtf.zip | 2007-03-24 02:53 | 208K | |
![[ ]](/icons/compressed.gif) | J E Lovelock-GAIA.zip | 2007-03-24 02:55 | 208K | |
![[ ]](/icons/compressed.gif) | innes_hammond_a_maddon_szikla_hu_rtf_nncl1999-6c0v1.zip | 2007-03-24 02:55 | 208K | |
![[ ]](/icons/compressed.gif) | crichton_michael_kodsarkanyok_hu_rtf.zip | 2007-03-24 02:57 | 208K | |
![[ ]](/icons/compressed.gif) | nietzsche_emberi_tulsagosan_is_emberi.zip | 2007-03-24 02:54 | 208K | |
![[ ]](/icons/compressed.gif) | Terry Prachett - Mort.zip | 2007-03-26 18:20 | 208K | |
![[IMG]](/icons/image2.gif) | Jeffrey Stone_Gy'm ntv ros borˇt˘.JPG | 2005-02-17 21:54 | 208K | |
![[ ]](/icons/compressed.gif) | hegedus_geza_a_miletoszi_hajos_hu_txt.zip | 2007-03-24 02:55 | 208K | |
![[ ]](/icons/unknown.gif) | osszes32.ace | 2007-03-24 02:56 | 208K | |
![[ ]](/icons/compressed.gif) | durrell_gerald_vadallatok_bolondja_hu_rtf.zip | 2007-03-24 02:54 | 208K | |
![[ ]](/icons/compressed.gif) | czako_gabor_eufemia_hu_rtf.zip | 2007-03-24 02:52 | 208K | |
![[ ]](/icons/compressed.gif) | lynch_jennifer_ki_olte_meg_laura_palmert_doc.zip | 2007-03-24 02:56 | 207K | |
![[ ]](/icons/compressed.gif) | galaktika002.zip | 2007-08-04 14:09 | 207K | |
![[ ]](/icons/layout.gif) | Vaermina - Az álmok és rémálmok Istene.pdf | 2007-05-03 07:23 | 207K | |
![[ ]](/icons/compressed.gif) | clarke_arthur_c_a_varos_es_a_csillagok_hu_html.zip | 2007-03-24 02:49 | 207K | |
![[ ]](/icons/compressed.gif) | clarke_arthur_c_a_varos_es_a_csillagok.zip | 2007-03-24 02:49 | 207K | |
![[ ]](/icons/compressed.gif) | Város és a csillagok.zip | 2007-03-24 02:49 | 207K | |
![[ ]](/icons/compressed.gif) | csukas_istvan_kemenykalap_es_krumpliorr_hu_doc_nncl3045-706v1.zip | 2007-03-24 02:57 | 207K | |
![[ ]](/icons/compressed.gif) | grey_anthony_a_capa_szajaban_hu_rtf_nncl2147-638v1.zip | 2007-03-24 02:49 | 207K | |
![[ ]](/icons/compressed.gif) | 2061 Harmadik Urodisszeia.zip | 2007-03-24 02:49 | 207K | |
![[ ]](/icons/compressed.gif) | teas_t_o_becsi_keringo_hu_rtf_nncl2017-622v1.zip | 2007-03-24 03:00 | 207K | |
![[ ]](/icons/compressed.gif) | major_otto_szent_kelemen_vallomasai_hu_rtf.zip | 2007-03-24 02:57 | 207K | |
![[ ]](/icons/compressed.gif) | levi_strauss_claude_faj_es_tortenelem_hu_html.zip | 2007-03-24 02:52 | 207K | |
![[ ]](/icons/compressed.gif) | wharton_william_ejfelre_kitisztul_hu_rtf_nncl2301-65ev1.zip | 2007-03-24 03:01 | 207K | |
![[ ]](/icons/compressed.gif) | wallace_edgar_a_borzalmak_tornya_hu_rtf.zip | 2007-03-24 02:53 | 207K | |
![[ ]](/icons/compressed.gif) | aszody_janos_a_pokol_zsoldosai_hu_rtf_nncl2601-6aev1.zip | 2007-03-24 02:49 | 207K | |
![[ ]](/icons/compressed.gif) | GyURUKURA fergeteges parodia.zip | 2007-03-24 02:54 | 206K | |
![[ ]](/icons/compressed.gif) | athans_philip_baldurs_gate_rtf.zip | 2007-03-24 02:58 | 206K | |
![[ ]](/icons/compressed.gif) | athans_philip_baldurs_gate_hu_rtf.zip | 2007-03-24 02:54 | 206K | |
![[ ]](/icons/compressed.gif) | Ian Watson-Inquisitor.zip | 2007-03-24 02:55 | 206K | |
![[ ]](/icons/compressed.gif) | lenteric_bernard_agyhaboru_hu_rtf.zip | 2007-03-24 02:50 | 206K | |
![[ ]](/icons/compressed.gif) | clarke_arthur_c_2061_harmadik_urodisszeia.zip | 2007-03-24 02:49 | 206K | |
![[ ]](/icons/compressed.gif) | watson_ian_inkvizitor_hu_rtf.zip | 2007-03-24 02:55 | 206K | |
![[ ]](/icons/compressed.gif) | szabo_magda_a_szemlelok_html.zip | 2007-03-24 03:00 | 206K | |
![[ ]](/icons/compressed.gif) | woodley_richard_con_air_a_fegyencjarat_hu_rtf_nncl2306-65ev1.zip | 2007-03-24 02:59 | 206K | |
![[ ]](/icons/compressed.gif) | durrell_gerald_vadaszat_felvevogeppel_hu_rtf.zip | 2007-03-24 02:54 | 206K | |
![[ ]](/icons/compressed.gif) | philip_george_jegodisszeia_hu_rtf_nncl2916-6f3v1.zip | 2007-03-24 02:54 | 206K | |
![[ ]](/icons/compressed.gif) | nemere_istvan_a_hegy_hu_doc.zip | 2007-03-24 02:58 | 206K | |
![[ ]](/icons/compressed.gif) | Claude Levi-Strauss legfontossab muvei.zip | 2007-03-24 02:52 | 206K | |
![[ ]](/icons/compressed.gif) | bradford_richard_oly_tavol_az_eg_hu_rtf_nncl794-400v2.zip | 2007-03-24 02:59 | 206K | |
![[ ]](/icons/unknown.gif) | ordogszem.ace | 2007-03-24 02:52 | 205K | |
![[ ]](/icons/compressed.gif) | traven_b_halalhajo_hu_rtf.zip | 2007-03-24 02:49 | 205K | |
![[ ]](/icons/compressed.gif) | green_w_hamilton_renegatok_hu_rtf.zip | 2006-05-17 06:42 | 205K | |
![[ ]](/icons/compressed.gif) | 01. I Baljós árnyak.zip | 2007-03-26 19:01 | 205K | |
![[ ]](/icons/unknown.gif) | orbitron-terv.ace | 2007-03-24 02:52 | 205K | |
![[ ]](/icons/compressed.gif) | berkesi_andras_fb_86_hu_rtf_nncl2342-667v2.zip | 2007-03-24 02:50 | 205K | |
![[ ]](/icons/compressed.gif) | smith_wilbur_ehes_akar_a_tenger_hu_txt.zip | 2007-03-24 03:01 | 205K | |
![[ ]](/icons/compressed.gif) | moldova_gyorgy_ferencvarosi_koktel_html.zip | 2007-03-24 02:58 | 205K | |
![[ ]](/icons/compressed.gif) | durrenmatt_friedrich_az_igeret_a_baleset_a_biro_es_hoher_hu_rtf_nncl1961-614v2.zip | 2007-03-24 02:54 | 205K | |
![[ ]](/icons/compressed.gif) | osborne_richard_elemi_oszton_hu_rtf.zip | 2007-03-24 02:59 | 205K | |
![[ ]](/icons/compressed.gif) | durrenmatt_friedrich_a_csendestars_pdf.zip | 2007-03-24 02:54 | 205K | |
![[ ]](/icons/compressed.gif) | jokai_mor_nincsen_ordog_html.zip | 2007-03-24 02:56 | 204K | |
![[ ]](/icons/compressed.gif) | enrobot.zip | 2007-08-04 15:01 | 204K | |
![[ ]](/icons/compressed.gif) | asimov_isaac_en_a_robot.zip | 2007-03-24 02:55 | 204K | |
![[ ]](/icons/compressed.gif) | Isaac Asimov - Én és a robot.zip | 2002-03-15 14:16 | 204K | |
![[ ]](/icons/compressed.gif) | ALDOUS HUXLEY-Visszateres a szep uj vilaghoz.zip | 2007-03-24 02:49 | 204K | |
![[ ]](/icons/compressed.gif) | balzac_honore_de_hivatalnokok_rtf.zip | 2007-03-24 02:55 | 204K | |
![[ ]](/icons/compressed.gif) | Hal Clement - Az elveszett rakéta.zip | 2007-03-23 16:00 | 204K | |
![[ ]](/icons/compressed.gif) | nemere_istvan_a_sotetseg_hataran_hu_rtf.zip | 2007-03-24 02:58 | 204K | |
![[ ]](/icons/compressed.gif) | zahn_timothy_a_hoditok_oroksege_hu_doc.zip | 2006-05-31 07:56 | 204K | |
![[ ]](/icons/compressed.gif) | Zahn-Hoditok.zip | 2007-03-24 02:54 | 204K | |
![[ ]](/icons/compressed.gif) | Timothy Zahn - A hoditok_oroksege_hu_doc.zip | 2006-05-29 07:57 | 204K | |
![[ ]](/icons/compressed.gif) | nemeskurty_istvan_elfelejtett_evtized_hu_rtf.zip | 2007-03-24 02:58 | 204K | |
![[ ]](/icons/unknown.gif) | Tolkien A woottoni kovácsmester.doc | 2007-03-24 02:54 | 204K | |
![[ ]](/icons/compressed.gif) | foldes_laszlo_vadaszkalandok_vad_tajakon_hu_rtf.zip | 2007-03-24 02:54 | 204K | |
![[ ]](/icons/compressed.gif) | BD 3. Csillagrombolók.zip | 2007-03-26 19:01 | 204K | |
![[ ]](/icons/compressed.gif) | nietzsche_vidam_tudomany.zip | 2007-03-24 02:54 | 204K | |
![[ ]](/icons/compressed.gif) | Silva,Raimond-Caliostro rejtelmes elete.zip | 2007-03-24 03:00 | 204K | |
![[ ]](/icons/compressed.gif) | apollinaire_guillaume_szeszek_html.zip | 2007-03-24 02:55 | 204K | |
![[ ]](/icons/compressed.gif) | jokai_anna_a_labda_html.zip | 2007-03-24 02:56 | 204K | |
![[ ]](/icons/compressed.gif) | dick_philip_k_kamera_altal_homalyosan_hu_rtf.zip | 2007-03-24 02:58 | 204K | |
![[ ]](/icons/compressed.gif) | le_guin_ursula_k_tehanu_hu_rtf_nncl2283-65cv1.zip | 2007-03-24 03:00 | 204K | |
![[ ]](/icons/compressed.gif) | alain-fournier_henri_a_titokzatos_birtok_html.zip | 2007-03-24 02:49 | 204K | |
![[ ]](/icons/compressed.gif) | Alain-Fournier, Henri_A titokzatos birtok - html.zip | 2006-01-07 09:24 | 204K | |
![[ ]](/icons/compressed.gif) | bischoff_david_massza_hu_rtf_nncl2599-6adv1.zip | 2007-03-24 02:53 | 204K | |
![[ ]](/icons/compressed.gif) | J J Hurtak-Enok kulcsok.zip | 2007-03-24 02:55 | 203K | |
![[ ]](/icons/unknown.gif) | ido_folyosoi.ace | 2007-03-24 02:52 | 203K | |
![[ ]](/icons/compressed.gif) | lambert_eric_dicsosegre_itelve_hu_rtf.zip | 2007-03-24 02:53 | 203K | |
![[ ]](/icons/compressed.gif) | Joanne K Rowling-Herrry Potter es a bolcsek kove.zip | 2007-03-24 02:55 | 203K | |
![[ ]](/icons/compressed.gif) | baden_roach_hires_bunugyek_a_boncasztalon_hu_rtf_nncl3246-72av1.zip | 2007-03-24 02:53 | 203K | |
![[ ]](/icons/compressed.gif) | rosny_j_h_a_kardfogu_tigris_hu_doc.zip | 2007-03-24 02:55 | 203K | |
![[ ]](/icons/compressed.gif) | macalan_peter_valkur_direktiva_hu_rtf.zip | 2007-03-24 02:58 | 203K | |
![[ ]](/icons/compressed.gif) | Ian Watson - Inkvizítor.zip | 2007-03-26 19:46 | 203K | |
![[ ]](/icons/compressed.gif) | jokai_mor_balvanyosvar_html.zip | 2007-03-24 02:56 | 203K | |
![[ ]](/icons/compressed.gif) | padisak_mihaly_kanoc_az_emberszelidito_hu_doc_nncl3092-706v1.zip | 2007-03-24 02:58 | 203K | |
![[ ]](/icons/compressed.gif) | maclean_alistair_halalvonat_hu_rtf.zip | 2007-03-24 02:49 | 203K | |
![[ ]](/icons/compressed.gif) | Hasz Robert-A Szalmakutyak.zip | 2007-03-24 02:55 | 203K | |
![[ ]](/icons/unknown.gif) | Vavyan Fable-Kriplikommandó.ZIP | 2007-03-24 03:01 | 203K | |
![[ ]](/icons/compressed.gif) | Rorrerdami Erasmus-Beszelgetesek.zip | 2007-03-24 03:00 | 202K | |
![[ ]](/icons/compressed.gif) | toke_peter_a_kocka_hatalma_hu_doc_nncl3113-706v1.zip | 2007-03-24 03:00 | 202K | |
![[ ]](/icons/compressed.gif) | fable_vavyan_kriplikommando.zip | 2007-03-24 03:01 | 202K | |
![[ ]](/icons/compressed.gif) | hamvas_bela_baberligetkonyv_hu_html.zip | 2007-03-24 02:55 | 202K | |
![[ ]](/icons/compressed.gif) | jordan_lee_a_macska_szeme_hu_rtf.zip | 2007-03-24 02:57 | 202K | |
![[ ]](/icons/compressed.gif) | ballard_j_g_vizbe_fult_vilag_hu_rtf_nncl2600-6adv1.zip | 2007-03-24 02:55 | 202K | |
![[ ]](/icons/compressed.gif) | mikszath_kalman_szent_peter_esernyoje.zip | 2007-03-24 02:58 | 202K | |
![[ ]](/icons/compressed.gif) | beagle_peter_s_az_utolso_egyszarvu_hu_doc.zip | 2007-03-24 02:58 | 202K | |
![[ ]](/icons/compressed.gif) | follett_ken_a_modigliani_botrany_hu_rtf_nncl2664-6c2v1.zip | 2007-03-24 02:56 | 202K | |
![[ ]](/icons/compressed.gif) | Hunyady Jozsef-Het tenger vandora.zip | 2007-03-24 02:55 | 202K | |
![[ ]](/icons/unknown.gif) | osszes60.ace | 2007-03-24 02:56 | 202K | |
![[ ]](/icons/compressed.gif) | Kaland a vegeken-antologia.zip | 2007-03-24 02:56 | 202K | |
![[ ]](/icons/compressed.gif) | macutani_mijoko_levelek_tokiobol_hu_doc.zip | 2007-03-24 02:57 | 202K | |
![[ ]](/icons/compressed.gif) | Rejto Jeno - Az eloretolt helyorseg.doc.zip | 2007-03-24 02:59 | 202K | |
![[ ]](/icons/compressed.gif) | reymont_wladyslaw_st_a_vampir_hu_rtf_ nncl2192-642v1.zip | 2007-03-24 03:01 | 202K | |
![[ ]](/icons/compressed.gif) | laszlo_lajos_kanyarkulcs_hu_rtf.zip | 2007-03-24 02:57 | 202K | |
![[ ]](/icons/compressed.gif) | moorcock_michael_az_igazgyongy_erodje_hu_rtf.zip | 2007-03-24 02:57 | 202K | |
![[ ]](/icons/compressed.gif) | abbott_edwin_a_sikfold_hu_rtf.zip | 2007-03-24 02:53 | 202K | |
![[ ]](/icons/unknown.gif) | foldrol.ace | 2007-03-24 02:52 | 202K | |
![[ ]](/icons/compressed.gif) | wilder_thornton_caesar_hu_rtf_nncl2705-6cav1.zip | 2007-03-24 03:00 | 202K | |
![[ ]](/icons/compressed.gif) | hegedus_geza_az_irnok_es_a_farao_hu_txt.zip | 2007-03-24 02:55 | 202K | |
![[ ]](/icons/compressed.gif) | naha_ed_robotzsaru_1_hu_rtf.zip | 2007-03-24 02:58 | 202K | |
![[ ]](/icons/compressed.gif) | lll_a_suttogo_arnyak_oble.zip | 2007-03-20 00:16 | 202K | |
![[ ]](/icons/unknown.gif) | II_09.doc | 2007-11-13 21:39 | 202K | |
![[ ]](/icons/compressed.gif) | kosztolanyi_dezso_osszes_novellaja_rtf.zip | 2007-03-24 02:55 | 201K | |
![[ ]](/icons/compressed.gif) | zelazny_roger_amber_hercegei_hu_doc_nncl2209-647v1.zip | 2007-03-24 03:00 | 201K | |
![[ ]](/icons/unknown.gif) | Hermaeus Mora - A jóslatok és jövendölések Istene | 2007-05-03 07:17 | 201K | |
![[ ]](/icons/unknown.gif) | osszes48.ace | 2007-03-24 02:56 | 201K | |
![[ ]](/icons/compressed.gif) | vachss_andrew_az_embertenyeszto_hu_rtf.zip | 2007-03-24 02:49 | 201K | |
![[ ]](/icons/compressed.gif) | Eca de Queiros,Jose Maria-A varos es a hegyvidek.zip | 2007-03-24 02:53 | 201K | |
![[ ]](/icons/compressed.gif) | analogia01.zip | 2007-08-04 14:39 | 201K | |
![[ ]](/icons/compressed.gif) | David Drake - A Tőr.zip | 2007-03-23 21:48 | 201K | |
![[ ]](/icons/compressed.gif) | isaac_asimov-gyilkossag_az_urvarosban.zip | 2007-03-24 02:55 | 201K | |
![[ ]](/icons/compressed.gif) | szabo_magda_szuletesnap_hu_doc_nncl3104-706v1.zip | 2007-03-24 03:00 | 201K | |
![[ ]](/icons/compressed.gif) | macgregor_rob_indiana_jones_es_az_ozonviz_legendaja_hu_rtf.zip | 2007-03-24 02:55 | 201K | |
![[ ]](/icons/compressed.gif) | Robert Louis-Emberrablok.zip | 2007-03-24 02:59 | 201K | |
![[ ]](/icons/compressed.gif) | stevenson_r_l_emberrablok_rtf.zip | 2007-03-24 02:58 | 201K | |
![[ ]](/icons/compressed.gif) | Athans , Philip.zip | 2007-10-21 14:56 | 201K | |
![[ ]](/icons/compressed.gif) | Vámpír könyvek - 01. Rémségek Cirkusza.zip | 2007-03-20 13:25 | 201K | |
![[ ]](/icons/compressed.gif) | John Brunner-A Kozmosz hienai.zip | 2007-03-24 02:56 | 200K | |
![[ ]](/icons/compressed.gif) | wells_h_g_bealby_rtf.zip | 2007-03-24 02:55 | 200K | |
![[ ]](/icons/unknown.gif) | Az Úr Hangja.ace | 2007-03-24 03:00 | 200K | |
![[ ]](/icons/compressed.gif) | shan_darren_remsegek_cirkusza_hu_rtf.zip | 2007-03-24 02:52 | 200K | |
![[ ]](/icons/compressed.gif) | Ian Watson-Az urgardista.zip | 2007-03-24 02:55 | 200K | |
![[ ]](/icons/compressed.gif) | crichton_michael_a_nagy_vonatrablas_hu_txt.zip | 2007-03-24 02:57 | 200K | |
![[ ]](/icons/unknown.gif) | Viszokay Tamás Viszokay Tamás novellái.doc | 2005-07-09 17:27 | 200K | |
![[ ]](/icons/compressed.gif) | Zsoldos Péter - A holtak nem vetnek árnyékot.zip | 2007-03-24 03:01 | 200K | |
![[ ]](/icons/compressed.gif) | Roland Morgan - Mágikus vihar.zip | 2007-04-06 11:06 | 200K | |
![[ ]](/icons/compressed.gif) | kaland.zip | 2007-08-04 14:04 | 200K | |
![[ ]](/icons/compressed.gif) | BD 2. Birodalmi flotta.zip | 2007-03-26 19:01 | 200K | |
![[ ]](/icons/compressed.gif) | silva_raymond_cagliostro_rejtelmes_elete_hu_rtf.zip | 2007-03-24 02:59 | 200K | |
![[ ]](/icons/compressed.gif) | haldeman_joe_orok_haboru_hu_txt.zip | 2007-03-24 02:56 | 200K | |
![[ ]](/icons/compressed.gif) | conrad_joseph_almayer_legvara_hu_rtf.zip | 2007-03-24 02:56 | 200K | |
![[ ]](/icons/compressed.gif) | Regény - Császári vér.zip | 2007-03-26 19:02 | 200K | |
![[ ]](/icons/compressed.gif) | Védikus asztrológia_elemei.zip | 2007-03-24 03:01 | 200K | |
![[ ]](/icons/compressed.gif) | padisak_mihaly_a_csucs_mindig_folottunk_van_hu_doc_nncl3025-708v1.zip | 2007-03-24 02:58 | 200K | |
![[ ]](/icons/compressed.gif) | Jokai Mor-Balvanyosvar.zip | 2007-03-24 02:56 | 200K | |
![[ ]](/icons/compressed.gif) | leonard_elmore_simlis_fiuk_hu_txt.zip | 2007-03-24 02:53 | 199K | |
![[ ]](/icons/layout.gif) | krpg_borito.pdf | 2007-03-24 02:54 | 199K | |
![[ ]](/icons/compressed.gif) | benchley_peter_az_obol_hu_rtf.zip | 2007-03-24 02:58 | 199K | |
![[ ]](/icons/compressed.gif) | wodehouse_p_g_karikacsapas_hu_doc_nncl3129-706v1.zip | 2007-03-24 02:58 | 199K | |
![[ ]](/icons/compressed.gif) | burroughs_edgar_rice_tarzan_es_az_elveszett_birodalom_hu_rtf.zip | 2007-03-24 02:53 | 199K | |
![[ ]](/icons/compressed.gif) | marsh_evelyn_a_titokzatos_kovek_hu_doc.zip | 2007-03-24 02:53 | 199K | |
![[ ]](/icons/compressed.gif) | deighton_len_temetes_berlinben_hu_rtf.zip | 2007-03-24 02:57 | 199K | |
![[ ]](/icons/compressed.gif) | noon_jeff_vurt_hu_rtf_nncl2174-63ev1.zip | 2007-03-24 02:56 | 199K | |
![[ ]](/icons/unknown.gif) | 02 - Jan Van den Boomen - Megtartó varázs.doc | 2007-03-24 02:54 | 199K | |
![[ ]](/icons/compressed.gif) | brunner_john_a_kozmosz_hienai_hu_rtf.zip | 2007-03-24 02:56 | 199K | |
![[ ]](/icons/compressed.gif) | John Brunner - A kozmosz hienai hu rtf.zip | 2006-05-10 06:54 | 199K | |
![[ ]](/icons/compressed.gif) | renier_raoul_a_kivulallo_hu_rtf_nncl2587-6aav1.zip | 2007-03-24 02:59 | 199K | |
![[ ]](/icons/compressed.gif) | Isaac Asimov irasai.zip | 2007-03-24 02:55 | 199K | |
![[ ]](/icons/compressed.gif) | 2001 Urodisszeia.zip | 2007-03-24 02:49 | 199K | |
![[ ]](/icons/compressed.gif) | Merle - Mesterségem a halál.zip | 2005-06-09 14:04 | 198K | |
![[ ]](/icons/compressed.gif) | london_jack_adam_elott_hu_doc.zip | 2007-03-24 02:55 | 198K | |
![[ ]](/icons/compressed.gif) | shan_darren_a_hajnal_gyilkosai_hu_rtf.zip | 2007-03-24 02:52 | 198K | |
![[ ]](/icons/compressed.gif) | a_suttogo_arnyak_oble.zip | 2007-03-24 02:57 | 198K | |
![[ ]](/icons/compressed.gif) | feher_tibor_nyugtalan_ver_hu_rtf.zip | 2007-03-24 02:54 | 198K | |
![[ ]](/icons/unknown.gif) | osszes06.ace | 2007-03-24 02:56 | 198K | |
![[ ]](/icons/compressed.gif) | peiper_joachim_viperafeszek_hu_rtf_nncl2286-65cv1.zip | 2007-03-24 02:56 | 198K | |
![[ ]](/icons/compressed.gif) | nemere_istvan_az_atlantisz_alapitvany_hu_doc_nncl2038-625v2.zip | 2007-03-24 02:58 | 198K | |
![[ ]](/icons/compressed.gif) | nemere_istvan_vadak_kozott_hu_rtf.zip | 2007-03-24 02:58 | 198K | |
![[ ]](/icons/compressed.gif) | Arthur C. Clarke - A Germekkor vége.zip | 2007-03-23 13:30 | 198K | |
![[ ]](/icons/layout.gif) | Csuklyas.pdf | 2007-04-15 15:51 | 198K | |
![[ ]](/icons/compressed.gif) | szentmihalyi_szabo_peter_a_lato_es_a_vak_hu_txt.zip | 2007-03-24 03:00 | 198K | |
![[ ]](/icons/compressed.gif) | Fritz Leiber - Kardok a halál ellen.zip | 2007-03-26 16:28 | 198K | |
![[ ]](/icons/compressed.gif) | jokai_mor_a_ket_trenk_html.zip | 2007-03-24 02:56 | 198K | |
![[ ]](/icons/compressed.gif) | buxton_william_az_elso_jel_baldur_vere_hu_doc_nncl2545-69fv2.zip | 2007-03-24 03:01 | 198K | |
![[ ]](/icons/compressed.gif) | szabo_magda_okut_html.zip | 2007-03-24 03:00 | 198K | |
![[ ]](/icons/compressed.gif) | peiper_joachim_rommel_kutyai_hu_rtf_nncl2224-64av1.zip | 2007-03-24 02:56 | 198K | |
![[ ]](/icons/compressed.gif) | M2B-Sotet zsaruk 2.zip | 2007-03-24 02:57 | 198K | |
![[ ]](/icons/compressed.gif) | jokai_mor_egy_jatekos_aki_nyer_html.zip | 2007-03-24 02:56 | 198K | |
![[ ]](/icons/compressed.gif) | friesner_esther_m_sotet_zsaruk_2_hu_rtf_.zip | 2007-03-24 02:57 | 197K | |
![[ ]](/icons/compressed.gif) | Foster, Alan Dean - A bolygo_neve_halal_hu_txt.zip | 2007-02-21 16:10 | 197K | |
![[ ]](/icons/compressed.gif) | cronin_a_j_gracie_hu_doc_nncl2493-691v1.zip | 2007-03-24 02:49 | 197K | |
![[ ]](/icons/compressed.gif) | csukas_istvan_vakacio_a_halott_utcaban_hu_doc_nncl3046-706v1.zip | 2007-03-24 02:57 | 197K | |
![[ ]](/icons/compressed.gif) | feher_klara_szexmozi_hu_doc_nncl3056-706v1.zip | 2007-03-24 02:54 | 197K | |
![[ ]](/icons/unknown.gif) | g113.ace | 2007-03-24 02:52 | 197K | |
![[ ]](/icons/compressed.gif) | townsend_sue_a_13_es_3_4_eves_adrian_mole_titkos_naploja_hu_doc_nncl3034-708v1.zip | 2007-03-24 02:49 | 197K | |
![[ ]](/icons/compressed.gif) | Revai Jozsef-Raevius ezredes utazasa.zip | 2007-03-24 02:59 | 197K | |
![[ ]](/icons/layout.gif) | magus.pdf | 2007-04-15 15:18 | 197K | |
![[ ]](/icons/unknown.gif) | Clavicus Vile - A fondotlatok, üsszeesküvések Ist | 2007-05-03 07:17 | 197K | |
![[ ]](/icons/compressed.gif) | nemere_istvan_terra_hu_rtf.zip | 2007-03-24 02:58 | 197K | |
![[TXT]](/icons/text.gif) | arnyekhaboru.htm | 2007-04-15 16:32 | 197K | |
![[ ]](/icons/compressed.gif) | Rejto Jeno - Piszkos Fred, a kapitany.doc.zip | 2007-03-24 02:59 | 197K | |
![[ ]](/icons/compressed.gif) | gary_romain_lady_l_hu_rtf_nncl1916-614v2.zip | 2007-03-24 03:00 | 197K | |
![[ ]](/icons/compressed.gif) | frank_leonhard_haramiak_bandaja_hu_rtf.zip | 2007-03-24 02:57 | 196K | |
![[ ]](/icons/compressed.gif) | A gyermekkor vége.zip | 2007-03-24 02:49 | 196K | |
![[ ]](/icons/compressed.gif) | wincott_len_ofelsege_tengeresze_hu_rtf.zip | 2007-03-24 02:57 | 196K | |
![[ ]](/icons/compressed.gif) | moldova_gyorgy_arnyek_az_egen_html.zip | 2007-03-24 02:58 | 196K | |
![[ ]](/icons/compressed.gif) | olineast_john_y_szintetikus_remalom_hu_rtf_nncl2972-6fcv1.zip | 2007-03-24 02:56 | 196K | |
![[ ]](/icons/compressed.gif) | manyi_laszlo_hova_tunt_dorman_professzor_agya_hu_rtf.zip | 2007-03-24 02:57 | 196K | |
![[ ]](/icons/compressed.gif) | ALAN Dean Foster-Kristálykönnyek.zip | 2007-03-24 02:49 | 196K | |
![[ ]](/icons/unknown.gif) | foldgomb.ace | 2007-03-24 02:52 | 196K | |
![[ ]](/icons/layout.gif) | Mephala - A Hálószövő vagy Pókisten.pdf | 2007-05-03 07:19 | 196K | |
![[ ]](/icons/compressed.gif) | durrell_gerald_a_reszeg_erdo_hu_rtf.zip | 2007-03-24 02:54 | 196K | |
![[ ]](/icons/compressed.gif) | mikszath_kalman_beszterce_ostroma_doc.zip | 2007-03-24 02:57 | 196K | |
![[ ]](/icons/unknown.gif) | osszes29.ace | 2007-03-24 02:56 | 196K | |
![[ ]](/icons/compressed.gif) | anderson_poul_idojaror_hu_rtf.zip | 2007-03-24 02:58 | 196K | |
![[ ]](/icons/compressed.gif) | j_herbert-patkanyok.zip | 2006-05-31 06:26 | 196K | |
![[ ]](/icons/layout.gif) | Lakberendezés II. - Trágyak átméretezése és törlése.pdf | 2007-05-03 06:57 | 196K | |
![[ ]](/icons/compressed.gif) | chandler_raymond_a_gyongy_bajjal_jar_hu_rtf.zip | 2007-03-24 02:59 | 196K | |
![[ ]](/icons/compressed.gif) | vonnegut_kurt_kekszakall_hu_doc_nncl2821-6e4v1.zip | 2007-03-24 02:57 | 195K | |
![[ ]](/icons/compressed.gif) | sztaszj_anatolij_zold_utveszto_hu_doc_nncl3108-706v1.zip | 2007-03-24 02:49 | 195K | |
![[ ]](/icons/compressed.gif) | Harry Harrison-Rozsdamentes Acelpatkany szuletett.zip | 2007-03-24 02:55 | 195K | |
![[ ]](/icons/compressed.gif) | robin_daniel_az_ebredes_kronikaja_hu_doc_nncl2608-6b0v1.zip | 2007-03-24 02:52 | 195K | |
![[ ]](/icons/compressed.gif) | Rejto Jeno - A tizennegy karatos auto.doc.zip | 2007-03-24 02:59 | 195K | |
![[ ]](/icons/compressed.gif) | Asimov nyomán - McQuay - Gyanú.zip | 2006-12-13 23:25 | 195K | |
![[ ]](/icons/compressed.gif) | abraham_cyril_a_feher_hajok_hu_rtf.zip | 2007-03-24 02:52 | 195K | |
![[ ]](/icons/compressed.gif) | jokai_mor_szomoru_napok_html.zip | 2007-03-24 02:56 | 195K | |
![[ ]](/icons/compressed.gif) | hagberg_david_terminator_3_a_gepek_lazadasa_hu_rtf.zip | 2007-03-24 03:00 | 195K | |
![[ ]](/icons/compressed.gif) | Terminator_3_a_gepek_lazadasa_hu_rtf.zip | 2007-03-24 03:00 | 195K | |
![[ ]](/icons/compressed.gif) | harris_joel_chandler_remusz_bacsi_mesel_hu_rtf.zip | 2007-03-24 02:56 | 195K | |
![[ ]](/icons/layout.gif) | Molag Bal - A Cselszövés Istene.pdf | 2007-05-03 07:20 | 195K | |
![[ ]](/icons/compressed.gif) | Rajmond Chandler-A gyongy bajjal jar.zip | 2007-03-24 02:58 | 195K | |
![[ ]](/icons/compressed.gif) | burroughs_edgar_rice_tarzan_es_az_orok_elet_hu_rtf.zip | 2007-03-24 02:53 | 195K | |
![[ ]](/icons/compressed.gif) | cooper_james_fenimore_de_a_voros_kaloz_rtf.zip | 2007-03-24 02:52 | 195K | |
![[ ]](/icons/compressed.gif) | gardonyi_geza_az_en_falum_rtf.zip | 2007-03-24 02:54 | 195K | |
![[ ]](/icons/compressed.gif) | Terry Prachett - Egyenjogú rítusok.zip | 2007-03-26 18:20 | 195K | |
![[ ]](/icons/compressed.gif) | Josh Keegan - Neonbiblia.rtf.zip | 2006-05-30 18:06 | 195K | |
![[ ]](/icons/unknown.gif) | ogg.ace | 2007-03-24 02:52 | 194K | |
![[ ]](/icons/compressed.gif) | Noel Langley-Edgar Cayce a reinkarnaciorol.zip | 2007-03-24 02:58 | 194K | |
![[ ]](/icons/compressed.gif) | groom_winston_forrest_gump.zip | 2007-03-24 03:01 | 194K | |
![[ ]](/icons/unknown.gif) | Chavalier - Vérvonal.rtf | 2006-06-28 07:36 | 194K | |
![[ ]](/icons/compressed.gif) | berkesi_andras_huszevesek_hu_txt.zip | 2007-03-24 02:50 | 194K | |
![[ ]](/icons/unknown.gif) | Szent Kelemen vallomasai-Major Otto | 2007-03-24 03:00 | 194K | |
![[ ]](/icons/unknown.gif) | Q G LYN-A F BIAN--Uzen a nyolcadik bolygo | 2007-03-24 02:58 | 194K | |
![[ ]](/icons/compressed.gif) | oates_joyce_carol_napfordulo_hu_rtf.zip | 2007-03-24 03:00 | 194K | |
![[ ]](/icons/compressed.gif) | az_invazio_elmarad.zip | 2007-03-24 02:57 | 194K | |
![[ ]](/icons/compressed.gif) | keyes_daniel_viragot_algernonnak_hu_rtf.zip | 2007-03-24 02:52 | 194K | |
![[ ]](/icons/compressed.gif) | Daniel Keyes - Virágot Algernonnak.zip | 2006-08-24 21:41 | 194K | |
![[ ]](/icons/compressed.gif) | clarke_arthur_c_a_gyemekkor_vege.zip | 2007-03-24 02:49 | 194K | |
![[ ]](/icons/layout.gif) | Fagyvár.pdf | 2007-04-15 15:41 | 194K | |
![[ ]](/icons/compressed.gif) | illyes_gyula_csak_az_igazat_html.zip | 2007-03-24 02:55 | 194K | |
![[ ]](/icons/compressed.gif) | asimov_isaac_szuperneutron_hu_rtf_nncl2610-6b0v1.zip | 2007-03-24 02:55 | 193K | |
![[ ]](/icons/compressed.gif) | merle_robert_ket_nap_az_elet_hu_rtf.zip | 2007-03-24 02:59 | 193K | |
![[ ]](/icons/compressed.gif) | nemere_istvan_a_kupolavaros_titka_hu_rtf.zip | 2007-03-24 02:58 | 193K | |
![[ ]](/icons/compressed.gif) | babics_imre_a_kek_utem_lovagrend_hu_pdf_nncl2459-68ev1.zip | 2007-03-24 02:49 | 193K | |
![[ ]](/icons/unknown.gif) | osszes23.ace | 2007-03-24 02:56 | 193K | |
![[ ]](/icons/unknown.gif) | JULES VERNE-kétévi vakacio.ace | 2007-03-24 02:56 | 193K | |
![[ ]](/icons/compressed.gif) | nemere_istvan_az_utolso_bolygo_hu_rtf.zip | 2007-03-24 02:58 | 193K | |
![[ ]](/icons/compressed.gif) | twain_mark_koldus_es_kiralyfi_rtf.zip | 2007-03-24 02:57 | 193K | |
![[ ]](/icons/compressed.gif) | mccay_bill_stargate_bosszu_hu_rtf.zip | 2007-03-23 19:54 | 193K | |
![[ ]](/icons/compressed.gif) | baldwin_louis_kulonos_diadalok_hu_rtf.zip | 2007-03-24 02:57 | 193K | |
![[ ]](/icons/compressed.gif) | Ed Mazzaro-Chicagoi tortenet.zip | 2007-03-24 02:53 | 193K | |
![[ ]](/icons/compressed.gif) | hoyle_fred_a_fekete_felho_html.zip | 2007-03-24 02:54 | 193K | |
![[ ]](/icons/compressed.gif) | Tamasi Aron-Abel Amerikaban.zip | 2007-03-24 02:55 | 193K | |
![[ ]](/icons/compressed.gif) | lutz_john_egyedulallo_no_megosztana_hu_rtf.zip | 2007-03-24 02:56 | 193K | |
![[ ]](/icons/compressed.gif) | durrell_gerald_a_hahagaj_hu_doc.zip | 2007-03-24 02:54 | 192K | |
![[ ]](/icons/compressed.gif) | fegyverek_halala.zip | 2007-02-21 16:21 | 192K | |
![[ ]](/icons/compressed.gif) | Erdei Grrunvald Mihaly-A fegyverek halala.zip | 2007-03-24 02:53 | 192K | |
![[ ]](/icons/compressed.gif) | delau_reinhard_mecsetek_es_mandulafak_hu_doc_nncl2891-6f3v1.zip | 2007-03-24 02:59 | 192K | |
![[ ]](/icons/unknown.gif) | osszes10.ace | 2007-03-24 02:56 | 192K | |
![[ ]](/icons/compressed.gif) | huxley_aldous_szep_uj_vilag_hu_rtf.zip | 2007-03-24 02:49 | 192K | |
![[ ]](/icons/compressed.gif) | Huxley Aldous Szep uj vilag hu rtf.zip | 2007-02-21 16:05 | 192K | |
![[ ]](/icons/compressed.gif) | blake_michael_farkasokkal_tancolo.zip | 2007-03-24 02:57 | 192K | |
![[ ]](/icons/unknown.gif) | hatodik.doc | 2007-11-14 01:19 | 192K | |
![[ ]](/icons/compressed.gif) | teas_t_o_gyilkossag_vizum_nelkul_hu_rtf.zip | 2007-03-24 03:00 | 192K | |
![[ ]](/icons/compressed.gif) | J F Cooper-A Voros kaloz.zip | 2007-03-24 02:52 | 192K | |
![[ ]](/icons/compressed.gif) | Dashiell Hammett-A Maltai solyom.zip | 2007-03-24 02:52 | 192K | |
![[ ]](/icons/compressed.gif) | arsan_emmanuelle_emmanuelle_hu_rtf.zip | 2007-03-24 02:53 | 192K | |
![[ ]](/icons/compressed.gif) | dorry_thomas_kigyotojas_hu_rtf_nncl2170-63dv1.zip | 2007-03-24 03:00 | 192K | |
![[ ]](/icons/compressed.gif) | adams_douglas_dirk_gently_holisztikus_nyomozoirodaja.zip | 2007-03-24 02:53 | 192K | |
![[ ]](/icons/layout.gif) | Csillagjegyek - Horoszkópjaink és hatásaik.pdf | 2007-05-03 06:40 | 192K | |
![[ ]](/icons/compressed.gif) | abraham_cyril_szeszelyes_szeljaras_hu_rtf.zip | 2007-03-24 02:52 | 192K | |
![[ ]](/icons/compressed.gif) | Arthur C Clarke - A gyermekkor vége.zip | 2007-03-23 13:29 | 192K | |
![[ ]](/icons/compressed.gif) | hoff_benjamin_malacka_es_a_tao_hu_rtf.zip | 2007-03-24 02:50 | 192K | |
![[ ]](/icons/compressed.gif) | peiper_joachim_a_futar_halott_hu_rtf_nncl2193-642v1.zip | 2007-03-24 02:56 | 192K | |
![[ ]](/icons/compressed.gif) | hall_andrew_titkok_vilaga_hu_rtf.zip | 2007-03-24 02:49 | 191K | |
![[ ]](/icons/compressed.gif) | Hamvas Bela-Scientia sakra.zip | 2007-03-24 02:53 | 191K | |
![[ ]](/icons/compressed.gif) | higgins_jack_dillinger_hu_rtf.zip | 2007-03-24 02:55 | 191K | |
![[ ]](/icons/compressed.gif) | felver.zip | 2007-08-04 14:45 | 191K | |
![[ ]](/icons/compressed.gif) | asimov_isaac_felver.zip | 2007-03-24 02:55 | 191K | |
![[ ]](/icons/compressed.gif) | Marsbéli krónikák.zip | 2007-03-24 02:59 | 191K | |
![[ ]](/icons/compressed.gif) | foldi_pal_az_armada_pusztulasa_hu_rtf.zip | 2007-03-24 02:54 | 191K | |
![[ ]](/icons/compressed.gif) | veszelkane_gemes_eszter_tortenetek_ruzsa_sandorrol_hu_rtf.zip | 2007-03-24 03:01 | 191K | |
![[ ]](/icons/compressed.gif) | kautzky_norbert_elefanthaz_hu_doc_nncl558-3a0v1.zip | 2007-03-24 02:56 | 191K | |
![[ ]](/icons/compressed.gif) | verne_jules_sztrogof_mihaly_txt.zip | 2007-03-24 02:56 | 191K | |
![[ ]](/icons/compressed.gif) | jurjev_z_alfa_es_omega_hu_doc_nncl2378-671v1.zip | 2007-03-24 03:01 | 191K | |
![[ ]](/icons/compressed.gif) | herzog_arthur_delej_hu_rtf.zip | 2007-03-24 02:49 | 191K | |
![[ ]](/icons/unknown.gif) | ozd.ace | 2007-03-24 02:52 | 191K | |
![[TXT]](/icons/text.gif) | 04 - Jan Van den Boomen - Lágy szélben lazacszin hold alatt.txt | 2007-03-24 02:54 | 191K | |
![[ ]](/icons/compressed.gif) | Revai Jozsef-Marvany menyasszony.zip | 2007-03-24 02:59 | 191K | |
![[ ]](/icons/compressed.gif) | Stone, Jeffrey - Harc_az_ej_koveert.zip | 2006-05-18 00:35 | 191K | |
![[ ]](/icons/compressed.gif) | Gomori Imre-Szupergazdagok.zip | 2007-03-24 02:55 | 191K | |
![[ ]](/icons/compressed.gif) | hegedus_geza_vergilius_ifjusaga_hu_txt.zip | 2007-03-24 02:55 | 191K | |
![[ ]](/icons/compressed.gif) | pohl-kornbluth_dr_gladiator_hu_html.zip | 2007-03-24 02:54 | 191K | |
![[ ]](/icons/compressed.gif) | Brian W. Aldiss - Földburok.zip | 2007-03-19 18:04 | 191K | |
![[ ]](/icons/compressed.gif) | wassermann_jakob_kolumbusz_kristof_az_ocean_don_quijoteja_hu_rtf.zip | 2007-03-24 02:55 | 191K | |
![[ ]](/icons/compressed.gif) | Arthur C Clarke - 3001 Végső űrodisszea.zip | 2007-03-23 13:36 | 190K | |
![[ ]](/icons/compressed.gif) | dumas_alexandre_a_fekete_tulipan_rtf.zip | 2007-03-24 02:49 | 190K | |
![[ ]](/icons/compressed.gif) | nyiszli_miklos_orvos_voltam_auschwitzban_hu_rtf.zip | 2007-03-24 02:58 | 190K | |
![[ ]](/icons/compressed.gif) | popper_peter_felnottnek_lenni_hu_rtf_nncl2804-6e0v1.zip | 2007-03-24 02:58 | 190K | |
![[ ]](/icons/compressed.gif) | rokacsapda.zip | 2007-03-24 02:57 | 190K | |
![[ ]](/icons/compressed.gif) | kipling_rudyard_harom kope_hun_rtf.zip | 2007-03-24 02:56 | 190K | |
![[ ]](/icons/compressed.gif) | balzac_honore_de_a_rejtely_rtf.zip | 2007-03-24 02:55 | 190K | |
![[ ]](/icons/unknown.gif) | osszes64.ace | 2007-03-24 02:56 | 190K | |
![[ ]](/icons/unknown.gif) | 01 - Wayne Chapman - Holtszezon.doc | 2007-03-24 02:54 | 190K | |
![[ ]](/icons/compressed.gif) | Rejto Jeno - A pokol zsoldosai.doc.zip | 2007-03-24 02:59 | 189K | |
![[ ]](/icons/compressed.gif) | kosztolanyi_dezso_nero_a_veres_kolto_rtf.zip | 2007-03-24 02:55 | 189K | |
![[ ]](/icons/compressed.gif) | cooper_james_fenimore_de_vadolo_rtf.zip | 2007-03-24 02:52 | 189K | |
![[ ]](/icons/compressed.gif) | Frank Herbert-Dune messiasa.zip | 2007-03-24 02:54 | 189K | |
![[ ]](/icons/compressed.gif) | g36.zip | 2007-08-04 14:38 | 189K | |
![[ ]](/icons/compressed.gif) | Vamos Miklos-Anya csak egy van.zip | 2007-03-24 03:00 | 189K | |
![[ ]](/icons/compressed.gif) | URSULA K LE GUIN---A legtavolibb part.zip | 2007-03-24 03:00 | 189K | |
![[ ]](/icons/unknown.gif) | 14 - Aquir varázstárgyak.doc | 2007-03-24 02:54 | 189K | |
![[ ]](/icons/compressed.gif) | mattyasovszky_jeno_hod_jelentkezik_hu_doc.zip | 2007-03-24 02:57 | 188K | |
![[ ]](/icons/compressed.gif) | gulacsy_iren_hamueso_hu_rtf.zip | 2007-03-24 02:55 | 188K | |
![[ ]](/icons/compressed.gif) | Robert Heinlein - Őrjárat a világűrben.zip | 2007-03-23 13:52 | 188K | |
![[TXT]](/icons/text.gif) | 02 - Alan O'Connor - A halál hét arca.txt | 2007-03-24 02:54 | 188K | |
![[ ]](/icons/compressed.gif) | lorre_charles_a_szahara_rabszolgai_hu_rtf.zip | 2007-03-24 02:52 | 188K | |
![[ ]](/icons/compressed.gif) | Arthur C Clarke - Holdrengés.zip | 2007-03-23 13:35 | 188K | |
![[ ]](/icons/compressed.gif) | smith_dean_wesley_a_mag_hu_rtf.zip | 2007-03-24 02:52 | 188K | |
![[ ]](/icons/compressed.gif) | Isaac Asimov-Szuperneutron.zip | 2007-03-24 02:55 | 188K | |
![[ ]](/icons/compressed.gif) | higgins_jack_windsor_akcio_hu_rtf_nncl2051-62av2.zip | 2007-03-24 02:55 | 188K | |
![[ ]](/icons/compressed.gif) | lll_uvolto_bika.zip | 2007-03-20 00:18 | 188K | |
![[ ]](/icons/compressed.gif) | Rejto Jeno - A harom testor Afrikaban.doc.zip | 2007-03-24 02:59 | 187K | |
![[ ]](/icons/compressed.gif) | C W LEADBEATER-Vilagunk rejtett oldala.zip | 2007-03-24 02:52 | 187K | |
![[ ]](/icons/compressed.gif) | sturgeon_theodore_tobb_mint_emberi_hu_html.zip | 2007-03-24 03:00 | 187K | |
![[ ]](/icons/compressed.gif) | stone_jeffrey_az_ej_kardja_hu_rtf.zip | 2007-03-24 02:58 | 187K | |
![[ ]](/icons/compressed.gif) | kertesz_imre_kaddis_pdf.zip | 2007-03-24 02:56 | 187K | |
![[ ]](/icons/compressed.gif) | mikszath_kalman_akli_miklos_doc.zip | 2007-03-24 02:57 | 187K | |
![[ ]](/icons/unknown.gif) | 04 - Adrian T Smithers - Csontok és kövek.doc | 2007-03-24 02:54 | 187K | |
![[ ]](/icons/compressed.gif) | chadwick_elizabeth_az_elso_lovag_hu_rtf_nncl2873-6f3v1.zip | 2007-03-24 02:53 | 187K | |
![[ ]](/icons/compressed.gif) | Bohumil Hrabal--Sorgyari Capriccoio.zip | 2007-03-24 02:52 | 187K | |
![[ ]](/icons/unknown.gif) | osszes45.ace | 2007-03-24 02:56 | 187K | |
![[ ]](/icons/compressed.gif) | wen_ce_lao_ce_utolso_tanitasai_hu_rtf_nncl2754-6d7v1.zip | 2007-03-24 03:01 | 186K | |
![[ ]](/icons/compressed.gif) | peiper_joachim_a_fuhrer_oroszlanja_hu_rtf_nncl2205-646v1.zip | 2007-03-24 02:56 | 186K | |
![[ ]](/icons/compressed.gif) | jokai_mor_a_janicsarok_vegnapjai_html.zip | 2007-03-24 02:56 | 186K | |
![[ ]](/icons/compressed.gif) | shaw_g_b_ember_es_felsobbrendu_ember_hu_rtf_nncl2129-637v1.zip | 2007-03-24 02:54 | 186K | |
![[ ]](/icons/compressed.gif) | Apati Miklos-A fekete gen.zip | 2007-03-24 02:49 | 186K | |
![[ ]](/icons/compressed.gif) | simenon_georges_a_bicetre_harangjai_hu_rtf.zip | 2007-03-24 02:54 | 186K | |
![[ ]](/icons/compressed.gif) | sztrugackij_a_b_novellak_metagalaktika6_hu_rtf.zip | 2007-03-24 02:49 | 186K | |
![[ ]](/icons/compressed.gif) | Alan Dean Foster - A bolygó neve halál.zip | 2007-03-24 02:49 | 186K | |
![[ ]](/icons/compressed.gif) | fisher_ed_profundis_hu_rtf.zip | 2007-03-24 02:54 | 186K | |
![[ ]](/icons/unknown.gif) | Raoul Renier - A vér szava.rtf | 2006-07-19 18:09 | 186K | |
![[ ]](/icons/compressed.gif) | Wilson Mark F. - Terminator 3. A gólem.zip | 2007-03-26 19:26 | 186K | |
![[ ]](/icons/compressed.gif) | g46.zip | 2007-08-04 14:36 | 186K | |
![[ ]](/icons/compressed.gif) | shelley_mary_frankenstein_rtf.zip | 2007-03-24 02:57 | 186K | |
![[ ]](/icons/compressed.gif) | ED FISHER-Profundis.zip | 2007-03-24 02:53 | 186K | |
![[ ]](/icons/compressed.gif) | moravia_alberto_levelek_a_szaharabol_hu_doc_nncl1767-5d7v2.zip | 2007-03-24 02:49 | 186K | |
![[ ]](/icons/compressed.gif) | wells_h_g_emberek_a_holdban_rtf.zip | 2007-03-24 02:55 | 186K | |
![[ ]](/icons/layout.gif) | Hircine - A Vadászat Istene.pdf | 2007-05-03 07:18 | 186K | |
![[ ]](/icons/compressed.gif) | wells_h_g_vilagok_harca_rtf.zip | 2007-03-24 02:55 | 186K | |
![[ ]](/icons/unknown.gif) | osszes17.ace | 2007-03-24 02:56 | 186K | |
![[ ]](/icons/unknown.gif) | 07 - Jan Van Den Boomen - Számoknak ideje.doc | 2007-03-24 02:54 | 186K | |
![[ ]](/icons/compressed.gif) | jerofejev_venedikt_moszkva_petuski_hu_doc_nncl2990-703v1.zip | 2007-03-24 03:01 | 185K | |
![[ ]](/icons/compressed.gif) | mann_thomas_kisregenyek_rtf.zip | 2007-03-24 03:00 | 185K | |
![[ ]](/icons/compressed.gif) | Netherreal (Cthulu).MID.zip | 2007-03-26 16:56 | 185K | |
![[ ]](/icons/compressed.gif) | petrovacz_istvan_13_fo_hu_rtf.zip | 2007-03-24 02:58 | 185K | |
![[ ]](/icons/compressed.gif) | macdonald_ross_ember_a_foldben_hu_rtf_nncl2285-65cv1.zip | 2007-03-24 03:00 | 185K | |
![[ ]](/icons/compressed.gif) | wilcox_collin_az_ujsagiro_halala_hu_rtf_nncl2302-65ev1.zip | 2007-03-24 02:52 | 185K | |
![[ ]](/icons/compressed.gif) | macgregor_rob_indiana_jones_es_az_oriasok_tanca_hu_html.zip | 2007-03-24 02:55 | 185K | |
![[ ]](/icons/compressed.gif) | hammett_dashiell_veres_aratas_hu_rtf.zip | 2007-03-24 02:52 | 185K | |
![[ ]](/icons/compressed.gif) | esterhazy_peter_kis_magyar_pornografia_html.zip | 2007-03-24 02:53 | 185K | |
![[ ]](/icons/compressed.gif) | queneau_raymond_az_elet_vasarnapja_hu_rtf.zip | 2007-03-24 02:59 | 185K | |
![[ ]](/icons/compressed.gif) | james_redfield_-_a_mennyei_profecia_txt.zip | 2006-05-18 04:29 | 185K | |
![[ ]](/icons/compressed.gif) | gawain_shakti_elj_a_fenyben_hu_rtf.zip | 2007-03-24 03:00 | 185K | |
![[ ]](/icons/compressed.gif) | defoe_daniel_bob_kapitany_rtf.zip | 2007-03-24 02:52 | 185K | |
![[ ]](/icons/compressed.gif) | berkesi_andras_szerelem_harom_tetelben_hu_txt_nncl2346-667v1.zip | 2007-03-24 02:50 | 185K | |
![[ ]](/icons/compressed.gif) | hegedus_geza_a_megalazott_babilon_hu_txt.zip | 2007-03-24 02:55 | 185K | |
![[ ]](/icons/compressed.gif) | nemere_istvan_rejtelmes_oceanok_hu_rtf.zip | 2007-03-24 02:58 | 185K | |
![[ ]](/icons/compressed.gif) | Szatmari Sandor-GEPVILAG.zip | 2007-03-24 03:00 | 185K | |
![[ ]](/icons/compressed.gif) | tolsztoj_mesek_rtf.zip | 2007-03-24 02:57 | 185K | |
![[ ]](/icons/compressed.gif) | peiper_joachim_farkashajsza_hu_rtf.zip | 2007-03-24 02:56 | 185K | |
![[ ]](/icons/unknown.gif) | Melléklet.doc | 2007-04-15 16:19 | 185K | |
![[ ]](/icons/compressed.gif) | douglas_garry_hegylako_hu_doc.zip | 2007-03-24 02:54 | 184K | |
![[ ]](/icons/compressed.gif) | BATMAN a deneverember.zip | 2007-03-24 02:50 | 184K | |
![[ ]](/icons/compressed.gif) | ignacz_rozsa_koborlo_kisfiu_kalandjai_hu_doc_nncl3064-706v1.zip | 2007-03-24 02:55 | 184K | |
![[ ]](/icons/compressed.gif) | salgari_emilio_a_bermudai_kalozok_hu_rtf.zip | 2007-03-24 02:53 | 184K | |
![[ ]](/icons/compressed.gif) | may_karl_a_sivatag_szelleme_rtf.zip | 2007-03-24 02:56 | 184K | |
![[ ]](/icons/compressed.gif) | lucas_george_starwars.zip | 2006-05-28 02:10 | 184K | |
![[ ]](/icons/compressed.gif) | le_guin_ursula_k_a_legtavolibb_part_hu_rtf.zip | 2007-03-24 03:00 | 184K | |
![[ ]](/icons/compressed.gif) | gardner_craig_shaw_batman_a_deneverember.zip | 2007-03-24 02:52 | 184K | |
![[ ]](/icons/compressed.gif) | sheenard_anthony_parazs_varazs_hu.rtf_nncl1363-4f9v2.zip | 2007-03-24 02:49 | 184K | |
![[ ]](/icons/compressed.gif) | Harry Harryson - A Technikolor_idogep.rtf.zip | 2007-02-21 16:30 | 184K | |
![[ ]](/icons/compressed.gif) | alex_joe_a_labirintus_urnoje_hu_rtf.zip | 2007-03-24 02:56 | 184K | |
![[ ]](/icons/compressed.gif) | verne_jules_80_nap_alatt_a_fold_korul_rtf.zip | 2007-03-24 02:56 | 184K | |
![[ ]](/icons/compressed.gif) | DRAMMAPADA-A tan osvenye.zip | 2007-03-24 02:53 | 183K | |
![[ ]](/icons/compressed.gif) | Neveles a kozepkori Islam vilagban.zip | 2007-03-24 02:58 | 183K | |
![[ ]](/icons/compressed.gif) | amicis_edmondo_de_sziv_hu_html.zip | 2007-03-24 02:53 | 183K | |
![[ ]](/icons/compressed.gif) | moricz_zsigmond_betyar_rtf.zip | 2007-03-24 02:58 | 183K | |
![[ ]](/icons/compressed.gif) | harrington_stewart_masodik_talalkozas_a_halallal_hu_rtf.zip | 2007-03-24 03:00 | 183K | |
![[ ]](/icons/unknown.gif) | Utas és holdvilág.ace | 2007-03-24 03:00 | 183K | |
![[ ]](/icons/unknown.gif) | 13 - Aquir hatalomszavak.doc | 2007-03-24 02:54 | 183K | |
![[ ]](/icons/unknown.gif) | mukincsrablok.ace | 2007-03-24 02:52 | 183K | |
![[ ]](/icons/compressed.gif) | Rejto Jeno - A lathatatlan legio.doc.zip | 2007-03-24 02:59 | 183K | |
![[ ]](/icons/compressed.gif) | illyes_gyula_szellem_es_eroszak_html.zip | 2007-03-24 02:55 | 183K | |
![[ ]](/icons/compressed.gif) | dolman_drew_willow_hu_rtf.zip | 2007-03-24 02:54 | 183K | |
![[ ]](/icons/compressed.gif) | szentivanyi_jeno_a_kobaltas_ember_hu_rtf.zip | 2007-03-24 03:00 | 182K | |
![[ ]](/icons/unknown.gif) | Robert Merle-Ket nap az elet | 2007-03-24 02:59 | 182K | |
![[ ]](/icons/compressed.gif) | Csehov-Sziberia.zip | 2007-03-24 02:52 | 182K | |
![[ ]](/icons/compressed.gif) | karinthy_frigyes_utazas_a_koponyam_korul_rtf.zip | 2007-03-24 02:56 | 182K | |
![[ ]](/icons/compressed.gif) | wodehouse_p_g_kirabol_a_komornyikom_hu_doc_nncl3130-706v1.zip | 2007-03-24 02:58 | 182K | |
![[TXT]](/icons/text.gif) | k08.html | 2007-11-13 21:16 | 182K | |
![[ ]](/icons/compressed.gif) | anderson_kevin_j_zeropont_hu_rtf.zip | 2007-03-24 02:56 | 182K | |
![[ ]](/icons/compressed.gif) | rovin_jeff_cliffhanger_a_fuggo_jatszma_hu_doc.zip | 2007-03-24 02:56 | 182K | |
![[ ]](/icons/compressed.gif) | Ray Badbury-R,mint raketa.zip | 2007-03-24 02:59 | 182K | |
![[ ]](/icons/compressed.gif) | maclean_alistair_baba_a_lancon_hu_doc.zip | 2007-03-24 02:49 | 182K | |
![[ ]](/icons/compressed.gif) | mesta_gabriel_a_teremtok_arnyai_hu_doc_nncl2119-637v1.zip | 2007-03-24 02:54 | 182K | |
![[ ]](/icons/compressed.gif) | alaksza_tamas_egy_utas_eltunt_hu_doc_nncl3032-706v1.zip | 2007-03-24 02:49 | 182K | |
![[ ]](/icons/compressed.gif) | vaszary_gabor_harman_egymas_ellen_hu_txt_nncl2437-683v1.zip | 2007-03-24 03:01 | 182K | |
![[ ]](/icons/compressed.gif) | kasztovszky_bela_ketszemelyes_vilag_hu_rtf.zip | 2007-03-24 02:56 | 182K | |
![[ ]](/icons/layout.gif) | Peryite - A Munkafelügyelő.pdf | 2007-05-03 07:21 | 182K | |
![[ ]](/icons/compressed.gif) | may_karl_az_ezust-to_kincse_rtf.zip | 2007-03-24 02:56 | 181K | |
![[ ]](/icons/compressed.gif) | Harry Harryson - A technikolor_idogep.zip | 2004-06-21 11:48 | 181K | |
![[ ]](/icons/compressed.gif) | nemere_istvan_a_kozmosz_korbacsa_hu_rtf_nncl656-3d3v3.zip | 2007-03-24 02:58 | 181K | |
![[TXT]](/icons/text.gif) | A vadon szava.txt | 2007-03-24 02:55 | 181K | |
![[ ]](/icons/compressed.gif) | babay_jozsef_a_szeretet_konyve_hu_doc.zip | 2007-03-24 02:49 | 181K | |
![[ ]](/icons/layout.gif) | Azura - Az Alkony és a Hajnal Istennője.pdf | 2007-05-03 07:16 | 181K | |
![[ ]](/icons/compressed.gif) | szentmihalyi_szabo_peter_gellert_hu_html.zip | 2007-03-24 03:00 | 181K | |
![[ ]](/icons/compressed.gif) | esterhazy_peter_az_elefantcsonttoronybol_html.zip | 2007-03-24 02:53 | 181K | |
![[ ]](/icons/compressed.gif) | rieder_kurt_kemek_es_hirszerzok_a_III_birodalomban_hu_rtf.zip | 2007-03-24 02:57 | 181K | |
![[ ]](/icons/unknown.gif) | Egy halotti lepel vallomásai.doc | 2007-03-24 02:52 | 181K | |
![[ ]](/icons/unknown.gif) | 02 - Wayne Chapman - Leviatán.doc | 2007-03-24 02:54 | 181K | |
![[ ]](/icons/compressed.gif) | Donaszy Kalman-A Borkman--villa titka.zip | 2007-03-24 02:53 | 181K | |
![[ ]](/icons/compressed.gif) | rieder_kurt_a_legyozhetetlen_farkasfalka_hu_rtf.zip | 2007-03-24 02:57 | 181K | |
![[ ]](/icons/compressed.gif) | lll_a_megfojtott_viking_mocsara.zip | 2007-03-20 00:16 | 181K | |
![[ ]](/icons/compressed.gif) | Hery Jones Jr-Vizio.zip | 2007-03-24 02:55 | 181K | |
![[ ]](/icons/unknown.gif) | osszes14.ace | 2007-03-24 02:56 | 181K | |
![[ ]](/icons/compressed.gif) | moorcock_michael_az_igazgyongy_erodje_hu_html.zip | 2007-03-24 02:57 | 180K | |
![[ ]](/icons/layout.gif) | Sanguine - A dorbézolás és mulatozás Istene.pdf | 2007-05-03 07:22 | 180K | |
![[ ]](/icons/compressed.gif) | palahniuk_chuck_harcosok_klubja_hu_rtf_nncl3150-70bv1.zip | 2007-03-24 02:52 | 180K | |
![[ ]](/icons/compressed.gif) | durrell_gerald_allatkert_a_kastely_korul_hu_doc.zip | 2007-03-24 02:54 | 180K | |
![[ ]](/icons/unknown.gif) | sorstalan.ace | 2007-03-24 02:52 | 180K | |
![[ ]](/icons/compressed.gif) | orwell_george_donald_mcgill_muveszete_hu_rtf.zip | 2007-03-24 02:54 | 180K | |
![[ ]](/icons/compressed.gif) | redfield_james_a_tizedik_felismeres_hu_rtf.zip | 2006-05-28 03:02 | 180K | |
![[ ]](/icons/compressed.gif) | clarke_arthur_c_2001_urodusszeia_doc_nncl3013-708v1.zip | 2007-03-24 02:49 | 180K | |
![[ ]](/icons/compressed.gif) | nagy_katalin_intokonyvem_tortenete_hu_doc_nncl3081-706v1.zip | 2007-03-24 02:58 | 180K | |
![[ ]](/icons/compressed.gif) | reage_pauline_o_tortenete_hu_rtf.zip | 2007-03-24 02:58 | 180K | |
![[ ]](/icons/unknown.gif) | azriel_es_chelifer.doc | 2007-04-15 15:33 | 180K | |
![[ ]](/icons/compressed.gif) | Burroughs, Edgar - A mars istenei.zip | 2006-05-10 22:41 | 179K | |
![[ ]](/icons/compressed.gif) | Robert Sheckley -Zarandokut a foldre.zip | 2007-03-24 02:59 | 179K | |
![[ ]](/icons/compressed.gif) | teas_t_o_old_meg_puszta_kezzel_hu_rtf.zip | 2007-03-24 03:00 | 179K | |
![[ ]](/icons/compressed.gif) | Isaac Asimov - Alapítvány sorozat - Alapítvány.zip | 2003-01-30 11:50 | 179K | |
![[ ]](/icons/compressed.gif) | gulik_robert_van_a_kinai_haranggyilkossag_esete_hu_rtf_nncl2903-6f3v1.zip | 2007-03-24 03:00 | 179K | |
![[ ]](/icons/compressed.gif) | szneutr.zip | 2007-08-04 14:36 | 179K | |
![[ ]](/icons/compressed.gif) | asimov_isaac_szuperneutron.zip | 2007-03-24 02:55 | 179K | |
![[ ]](/icons/compressed.gif) | donald_f_glut_a_birodalom_visszavag.zip | 2006-05-08 07:22 | 179K | |
![[ ]](/icons/compressed.gif) | nemere_istvan_a_hegy_hu_html.zip | 2007-03-24 02:58 | 179K | |
![[ ]](/icons/compressed.gif) | Emberek a Holdban.rtf.zip | 2007-03-24 02:55 | 179K | |
![[ ]](/icons/compressed.gif) | follett_ken_papirpenz_hu_txt.zip | 2007-03-24 02:56 | 179K | |
![[ ]](/icons/unknown.gif) | osszes11.ace | 2007-03-24 02:56 | 179K | |
![[ ]](/icons/compressed.gif) | morrell_david_rambo_3_hu_doc.zip | 2007-03-24 02:52 | 179K | |
![[ ]](/icons/compressed.gif) | krudy_gyula_bukfenc_hu_doc.zip | 2007-03-24 02:56 | 179K | |
![[ ]](/icons/compressed.gif) | esterhazy_peter_papai_vizeken_ne_kalozkodj_html.zip | 2007-03-24 02:53 | 179K | |
![[ ]](/icons/compressed.gif) | eckhart_mester_utmutato_beszedek_hu_html.zip | 2007-03-24 02:53 | 179K | |
![[ ]](/icons/compressed.gif) | a_birodalom_visszavag.zip | 2007-03-24 02:54 | 179K | |
![[ ]](/icons/compressed.gif) | smith_l_neil_lando_calrissian_es_sharu_varazskulcsa_hu_rtf.zip | 2007-03-24 02:54 | 179K | |
![[ ]](/icons/compressed.gif) | smith_l_neil_lando_calrissian_es_sharu_varazskulcsa_hu_rtf(1).zip | 2006-05-28 03:58 | 179K | |
![[ ]](/icons/compressed.gif) | lando_calrissian_es_sharu_varazskulcsa.zip | 2007-03-24 02:54 | 179K | |
![[ ]](/icons/compressed.gif) | Tibet-Magyar_Magyar-Tibet szotar.zip | 2007-03-24 03:00 | 178K | |
![[ ]](/icons/compressed.gif) | lll_az_elatkozott_hajo.zip | 2007-03-20 00:19 | 178K | |
![[ ]](/icons/compressed.gif) | baruske_heinz_gronland_a_fold_legnagyobb_szigete_hu_html_nncl1327-4e7v2.zip | 2007-03-24 02:55 | 178K | |
![[ ]](/icons/compressed.gif) | g42.zip | 2007-08-04 14:27 | 178K | |
![[ ]](/icons/compressed.gif) | kindzierszky_emil_a_kek_harang_hu_rtf_nncl2603-6aev1.zip | 2007-03-24 02:56 | 178K | |
![[ ]](/icons/compressed.gif) | glut_donald_f_a_birodalom_visszavag_hu_rtf.zip | 2006-05-17 06:26 | 178K | |
![[ ]](/icons/compressed.gif) | glut_donald_f_a_birodalom_visszavag.zip | 2007-03-24 02:53 | 178K | |
![[ ]](/icons/compressed.gif) | silver_amanda_a_kez_amely_a_bolcsot_ringatja_hu_doc.zip | 2007-03-24 02:49 | 178K | |
![[ ]](/icons/compressed.gif) | verne_jules_a_dunai_hajos_rtf.zip | 2007-03-24 02:56 | 178K | |
![[ ]](/icons/compressed.gif) | lawrence_leslie_l_a_megfojtott_viking_mocsara_hu_rtf.zip | 2007-03-24 02:57 | 178K | |
![[ ]](/icons/compressed.gif) | vonnegut_kurt_aldja_meg_az_isten_mr_rosewater_hun_html.zip | 2007-03-24 02:57 | 178K | |
![[ ]](/icons/compressed.gif) | greene_graham_monsignor_quijote_hu_rtf.zip | 2007-03-24 02:55 | 178K | |
![[ ]](/icons/compressed.gif) | malone_john_ezredvegi_jovendolesek_rtf.hu.zip | 2007-03-24 02:56 | 178K | |
![[ ]](/icons/compressed.gif) | Robert Sheckley - Kozmikus főnyeremény.zip | 2007-03-26 18:48 | 178K | |
![[ ]](/icons/compressed.gif) | Rejto Jeno - Csontbrigad.txt.zip | 2007-03-24 02:59 | 178K | |
![[ ]](/icons/unknown.gif) | 3.doc | 2007-11-14 03:02 | 178K | |
![[ ]](/icons/compressed.gif) | hedervari_peter_az_ocean_foglyai_hu_rtf.zip | 2007-03-24 02:55 | 177K | |
![[ ]](/icons/compressed.gif) | austen_jane_a_klastrom_titka_html.zip | 2007-03-24 02:56 | 177K | |
![[ ]](/icons/compressed.gif) | Ursula K Le Guin - A legtávolibb part.zip | 2007-03-26 15:44 | 177K | |
![[ ]](/icons/compressed.gif) | Winston Grom-Forrest Gump.zip | 2007-03-24 03:01 | 177K | |
![[ ]](/icons/compressed.gif) | Edda-Oeszaki mitologia es hosi enek.zip | 2007-03-24 02:53 | 177K | |
![[ ]](/icons/compressed.gif) | 2. Predator 2 - Simon Hawke - Ragadozó 2.zip | 2007-03-23 19:32 | 177K | |
![[ ]](/icons/compressed.gif) | 1. Predator - Paul Monette - A ragadozó.zip | 2007-03-23 19:32 | 177K | |
![[ ]](/icons/compressed.gif) | C S Lewis-Csendes bolygo.zip | 2007-03-24 02:52 | 177K | |
![[ ]](/icons/unknown.gif) | Herbert George Wells - Kőkori történet.rtf | 2006-07-19 19:41 | 177K | |
![[ ]](/icons/layout.gif) | Boethia - Az Összeesküvés Hercege.pdf | 2007-05-03 07:16 | 177K | |
![[ ]](/icons/compressed.gif) | gawain_shakti_ebredes_hu_doc.zip | 2007-03-24 03:00 | 177K | |
![[ ]](/icons/compressed.gif) | hauff_wilhelm_a_spessarti_fogado_hu_rtf.zip | 2007-03-24 03:01 | 177K | |
![[ ]](/icons/compressed.gif) | collins_max_allan_celkeresztben_hu_rtf.zip | 2007-03-24 02:57 | 177K | |
![[ ]](/icons/compressed.gif) | Karinthy Frigyes-Viccelnek velem.zip | 2007-03-24 02:56 | 177K | |
![[ ]](/icons/compressed.gif) | hays_lee_volt_egyszer_egy_amerika_hu_rtf.zip | 2007-03-24 02:57 | 177K | |
![[ ]](/icons/compressed.gif) | steinbeck_john_egy_marek_arany_rtf.zip | 2007-03-24 02:56 | 177K | |
![[ ]](/icons/compressed.gif) | Rejto Jeno - A szoke ciklon.doc.zip | 2007-03-24 02:59 | 177K | |
![[ ]](/icons/layout.gif) | Meridian - Az Átjáró élet és halál között.pdf | 2007-05-03 07:19 | 177K | |
![[ ]](/icons/layout.gif) | A Pajkos Póni átka.pdf | 2007-04-15 16:44 | 176K | |
![[ ]](/icons/compressed.gif) | rodari_gianni_hagymacska_tortenete_hu_doc.zip | 2007-03-24 02:55 | 176K | |
![[ ]](/icons/unknown.gif) | holdban.ace | 2007-03-24 02:52 | 176K | |
![[ ]](/icons/compressed.gif) | Edda Óészaki mitológiai és hősi énekek.zip | 2007-03-24 02:58 | 176K | |
![[ ]](/icons/compressed.gif) | moldova_gyorgy_ki_olte_meg_a_holt_tengert_hu_rtf.zip | 2007-03-24 02:58 | 176K | |
![[ ]](/icons/layout.gif) | A titokzatos átjáró - (A Door in Niben Bay).pdf | 2007-05-03 07:31 | 176K | |
![[ ]](/icons/compressed.gif) | Varga A Csaba-65eves Herbert W Franke.zip | 2007-03-24 03:00 | 176K | |
![[ ]](/icons/compressed.gif) | mikes_george_tsi-tsa_es_tsai_hu_rtf_nncl2914-6f3v1.zip | 2007-03-24 02:54 | 176K | |
![[ ]](/icons/compressed.gif) | Nemere István - Holtak harca.zip | 2007-03-26 17:43 | 176K | |
![[ ]](/icons/compressed.gif) | az_elatkozott_hajo.zip | 2007-03-24 02:57 | 176K | |
![[ ]](/icons/compressed.gif) | g41.zip | 2007-08-04 13:55 | 176K | |
![[ ]](/icons/compressed.gif) | monette_paul_a_ragadozo_hu_rtf.zip | 2007-03-24 02:58 | 176K | |
![[ ]](/icons/compressed.gif) | burgess_anthony_egy_tenyer_ha_csattan_hu_doc.zip | 2007-03-24 02:49 | 176K | |
![[ ]](/icons/compressed.gif) | Vámpír könyvek - 11. Az árnyak ura.zip | 2007-03-20 13:26 | 176K | |
![[ ]](/icons/compressed.gif) | hamvas_bela_patmosz_2_hu_html.zip | 2007-03-24 02:55 | 176K | |
![[ ]](/icons/compressed.gif) | soucek_ludvik_a_fekete_bolygo_testverei_hu_rtf.zip | 2007-03-24 02:57 | 175K | |
![[ ]](/icons/compressed.gif) | smith_wilbur_gyemantvadaszok_hu_txt_nncl2563-6a6v1.zip | 2007-03-24 03:01 | 175K | |
![[ ]](/icons/compressed.gif) | ronaszegi_miklos_kartal_kalandos_eskuvoje_hu_txt.zip | 2007-03-24 03:00 | 175K | |
![[ ]](/icons/compressed.gif) | moldova_gyorgy_ha_jonne_az_angyal_html.zip | 2007-03-24 02:58 | 175K | |
![[ ]](/icons/compressed.gif) | rogger_louis_lucien_harom_csepp_ver_hu_doc.zip | 2007-03-24 02:57 | 175K | |
![[ ]](/icons/compressed.gif) | szabo_magda_az_oz_html.zip | 2007-03-24 03:00 | 175K | |
![[ ]](/icons/compressed.gif) | laszlo_endre_sziriusz_kapitany_es_corinta_hu_rtf.zip | 2007-03-24 02:57 | 175K | |
![[ ]](/icons/compressed.gif) | Laszlo Endre-Sziriusz kapitany es a Corinta.zip | 2007-03-24 02:57 | 175K | |
![[ ]](/icons/compressed.gif) | Erich Kastner-Emil es a detektivek.zip | 2007-03-24 02:53 | 175K | |
![[ ]](/icons/layout.gif) | Sheogorath - Az őrült Isten.pdf | 2007-05-03 07:22 | 175K | |
![[ ]](/icons/compressed.gif) | hawke_simon_ragadozo2.zip | 2007-03-24 03:00 | 175K | |
![[ ]](/icons/compressed.gif) | durrenmatt_friedrich_igazsag-ugy_hu_rtf_nncl2506-694v1.zip | 2007-03-24 02:54 | 175K | |
![[ ]](/icons/layout.gif) | Namira - A Daedra Szellem.pdf | 2007-05-03 07:20 | 175K | |
![[ ]](/icons/compressed.gif) | balzac_honore_de_eugenie_grandet_rtf.zip | 2007-03-24 02:55 | 175K | |
![[ ]](/icons/compressed.gif) | burgess_anthony_gepnarancs_hu_rtf.zip | 2007-03-24 02:49 | 175K | |
![[ ]](/icons/compressed.gif) | verne_jules_az_antillak_vilaga_hu_rtf.zip | 2007-03-24 02:56 | 175K | |
![[ ]](/icons/compressed.gif) | coelho_paulo_veronika_meg_akar_halni_hu_doc_nncl2529-69cv2.zip | 2007-03-24 02:58 | 175K | |
![[ ]](/icons/compressed.gif) | Berta Bulcsu -A kenguru.zip | 2007-03-24 02:50 | 175K | |
![[ ]](/icons/compressed.gif) | Arthur C Clarke - A Mars titka.zip | 2007-03-23 13:29 | 175K | |
![[ ]](/icons/compressed.gif) | green_simon_robin_hood_a_tolvajok_fejedelme_hu_rtf.zip | 2007-03-24 03:00 | 175K | |
![[ ]](/icons/layout.gif) | Arnyek.pdf | 2007-04-15 15:38 | 175K | |
![[ ]](/icons/compressed.gif) | raketa.zip | 2007-08-04 15:29 | 175K | |
![[ ]](/icons/compressed.gif) | bradbury_ray_r_mint_raketa.zip | 2007-03-24 02:59 | 175K | |
![[ ]](/icons/compressed.gif) | Ray Bradbury - Raketa elbeszélések.zip | 2006-08-24 23:29 | 175K | |
![[ ]](/icons/compressed.gif) | Bükki Tamás Kirakósjáték .zip | 2007-03-22 17:51 | 174K | |
![[ ]](/icons/unknown.gif) | idojaror.ace | 2007-03-24 02:52 | 174K | |
![[ ]](/icons/compressed.gif) | A kincses sziget-R L Stevenson.zip | 2007-03-24 02:58 | 174K | |
![[ ]](/icons/compressed.gif) | jokai_mor_felfordult_vilag_html.zip | 2007-03-24 02:56 | 174K | |
![[ ]](/icons/compressed.gif) | stevenson_r_l_kincses_sziget_doc.zip | 2007-03-24 02:58 | 174K | |
![[ ]](/icons/compressed.gif) | mandy_ivan_robin_hood_hu_rtf.zip | 2007-03-24 02:57 | 174K | |
![[ ]](/icons/compressed.gif) | rogers_kelly_zonakatonak_hu_rtf.zip | 2007-03-24 02:56 | 174K | |
![[ ]](/icons/compressed.gif) | marai_sandor_musoron_kivul_hu_rtf_nncl2639-6bav1.zip | 2007-03-24 02:57 | 174K | |
![[ ]](/icons/compressed.gif) | white_james_korhaz_a_galaktika_szelen_hu_rtf_nncl2440-683v1.zip | 2007-03-24 02:55 | 174K | |
![[ ]](/icons/compressed.gif) | berkesi_andras_bunker_hu_rtf_nncl2341-667v2.zip | 2007-03-24 02:50 | 174K | |
![[ ]](/icons/layout.gif) | Ellenfelek + ranglétra - Ranglista és jutalmak.pdf | 2007-05-03 07:11 | 174K | |
![[ ]](/icons/compressed.gif) | swift_jonathan_hordomese_hu_rtf_nncl2558-6a5v1.zip | 2007-03-24 02:56 | 174K | |
![[ ]](/icons/compressed.gif) | grady_james_a_keselyu_hat_napja_hu_rtf.zip | 2007-03-24 02:55 | 174K | |
![[ ]](/icons/compressed.gif) | James Grandy-A keselyu hat napja.zip | 2007-03-24 02:55 | 174K | |
![[ ]](/icons/compressed.gif) | Thomas Mann--harom regeny.zip | 2007-03-24 03:00 | 174K | |
![[ ]](/icons/compressed.gif) | drew_wayland_willow.zip | 2007-03-24 03:01 | 173K | |
![[ ]](/icons/compressed.gif) | Rejto Jeno - Az ellopott futar.doc.zip | 2007-03-24 02:59 | 173K | |
![[ ]](/icons/compressed.gif) | durrell_gerald_vadak_a_vadonban_hu_rtf.zip | 2007-03-24 02:54 | 173K | |
![[ ]](/icons/compressed.gif) | zsoldos_peter_a_feladat_hu_doc_nncl3136-708v1.zip | 2007-03-24 03:01 | 173K | |
![[ ]](/icons/compressed.gif) | bradley_marion_zimmer_darkover_hu_rtf.zip | 2007-03-24 02:57 | 173K | |
![[ ]](/icons/compressed.gif) | moravia_alberto_a_megvetes_hu_sxw.zip | 2007-03-24 02:49 | 173K | |
![[ ]](/icons/compressed.gif) | Conan a zsoldos barbár.zip | 2007-03-26 18:25 | 173K | |
![[ ]](/icons/compressed.gif) | maerov_lauri_tokeletes_masolat_hu_rtf_nncl2923-6f3v1.zip | 2007-03-24 02:57 | 173K | |
![[ ]](/icons/compressed.gif) | kertesz_imre_a_gondolatnyi_csend_html.zip | 2007-03-24 02:56 | 173K | |
![[ ]](/icons/compressed.gif) | balzac_honore_de_a_harminceves_asszony_rtf.zip | 2007-03-24 02:55 | 173K | |
![[ ]](/icons/unknown.gif) | 01 - Aalish D'Mohlen - Ragadozók.doc | 2007-03-24 02:54 | 173K | |
![[ ]](/icons/compressed.gif) | leonard_elmore_pronto_hu_txt.zip | 2007-03-24 02:53 | 172K | |
![[ ]](/icons/compressed.gif) | jokai_mor_a_damokosok_html.zip | 2007-03-24 02:56 | 172K | |
![[ ]](/icons/compressed.gif) | antal_balazs_oreg_hu_rtf.zip | 2007-03-24 02:49 | 172K | |
![[ ]](/icons/compressed.gif) | Fred Hoyle-Osszian kuldetese.zip | 2007-03-24 02:54 | 172K | |
![[ ]](/icons/compressed.gif) | Pancsatantra-Hindu tanmesek.zip | 2007-03-24 02:58 | 172K | |
![[ ]](/icons/compressed.gif) | Arthur C Clarke - 2061 Harmadik űrodisszea.zip | 2007-03-23 13:36 | 172K | |
![[ ]](/icons/compressed.gif) | wilson_mark_f_terminator_a_leszamolas_hu_rtf.zip | 2006-05-29 13:54 | 172K | |
![[ ]](/icons/compressed.gif) | verne_jules_varkastely_a_karpatokban_rtf.zip | 2007-03-24 02:56 | 172K | |
![[ ]](/icons/unknown.gif) | g063.ace | 2007-03-24 02:52 | 172K | |
![[ ]](/icons/compressed.gif) | Rejto Jeno - A Nema Revolverek Varosa.doc.zip | 2007-03-24 02:59 | 172K | |
![[ ]](/icons/compressed.gif) | zarandok.zip | 2007-08-04 13:41 | 172K | |
![[ ]](/icons/compressed.gif) | sheckley_robert_zarandokut_a_foldre.zip | 2007-03-24 02:59 | 172K | |
![[ ]](/icons/compressed.gif) | Robert Sheckley - Zarándokút a Földre Elbeszéléskötet.zip | 2006-08-25 01:44 | 172K | |
![[ ]](/icons/compressed.gif) | Város.zip | 2007-03-24 02:52 | 172K | |
![[ ]](/icons/compressed.gif) | braun_es_braun_a_nagy_varazslo_tevedese_hu_doc.zip | 2007-03-24 02:56 | 172K | |
![[ ]](/icons/compressed.gif) | corman_avery_kramer_kontra_kramer_hu_rtf.zip | 2007-03-24 02:49 | 172K | |
![[ ]](/icons/compressed.gif) | dygat_stanislaw_disneyland_hu_rtf_nncl1913-614v1.zip | 2007-03-24 03:00 | 172K | |
![[ ]](/icons/compressed.gif) | hemingway_ernest_afrikai_vadasznaplo_hu_rtf.zip | 2007-03-24 02:53 | 172K | |
![[ ]](/icons/compressed.gif) | X-aktak-Felemelkedes.zip | 2007-03-24 03:01 | 172K | |
![[TXT]](/icons/text.gif) | 5SZAK05.HTM | 2007-03-24 02:59 | 172K | |
![[ ]](/icons/unknown.gif) | 8.doc | 2007-11-14 02:11 | 172K | |
![[ ]](/icons/compressed.gif) | Mark Twain-A lovatett varos.zip | 2007-03-24 02:57 | 171K | |
![[ ]](/icons/compressed.gif) | Rejto Jeno - Az elatkozott part.doc.zip | 2007-03-24 02:59 | 171K | |
![[ ]](/icons/compressed.gif) | harrison_harry_bill_a_galaktika_hose_hu_rtf.zip | 2007-03-24 02:55 | 171K | |
![[ ]](/icons/compressed.gif) | Harry Harryson - Bill a galaktika hose hu rtf.zip | 2006-05-29 13:57 | 171K | |
![[ ]](/icons/compressed.gif) | mcbain_ed_zsaruk_hu_rtf_nncl2274-654v1.zip | 2007-03-24 02:53 | 171K | |
![[ ]](/icons/compressed.gif) | Isaac Asimov - A halál fuvallata.zip | 2006-12-14 01:09 | 171K | |
![[ ]](/icons/compressed.gif) | asimov_isaac_a_halal_fuvallata_hu_rtf.zip | 2007-03-24 02:55 | 171K | |
![[ ]](/icons/compressed.gif) | thomas_quentin_x_aktak_felemelkedes.zip | 2007-03-24 03:01 | 171K | |
![[ ]](/icons/compressed.gif) | clarke_arthur_c_2001_urodesszeia_rtf.zip | 2007-03-24 02:49 | 171K | |
![[ ]](/icons/compressed.gif) | van_vogt_a_e_linn_varazsloja_hu_rtf.zip | 2007-03-24 02:49 | 171K | |
![[ ]](/icons/compressed.gif) | carey_diane_equinox_hu_txt.zip | 2007-03-24 02:52 | 171K | |
![[ ]](/icons/compressed.gif) | rieder_kurt_magia_es_okultizmus_a_III._birodalomban_hu_rtf.zip | 2007-03-24 02:57 | 171K | |
![[ ]](/icons/compressed.gif) | nemere_istvan_kilephetsz_testedbol_hu_rtf.zip | 2007-03-24 02:58 | 171K | |
![[ ]](/icons/compressed.gif) | sethfield_christopher_vadaszok_vadasza_hu_rtf_nncl2287-65cv1.zip | 2007-03-24 03:00 | 171K | |
![[ ]](/icons/compressed.gif) | gardonyi_geza_fuveskonyv_ful_hu_doc_nncl2859-6efv1.zip | 2007-03-24 02:54 | 171K | |
![[ ]](/icons/compressed.gif) | queneau_raymond_az_elet_vasarnapja_hu_html.zip | 2007-03-24 02:59 | 171K | |
![[ ]](/icons/compressed.gif) | moldova_gyorgy_akar_velem_beszelgetni_html.zip | 2007-03-24 02:58 | 171K | |
![[ ]](/icons/compressed.gif) | Michael Moorcock - Harcikutya.zip | 2007-03-26 17:37 | 171K | |
![[ ]](/icons/compressed.gif) | menghini_luigi_a_felhobirodalom_hu_rtf_nncl2524-696v1.zip | 2007-03-24 02:57 | 171K | |
![[ ]](/icons/compressed.gif) | Hagberg, David - Terminator 3 - A gepek lazadasa hu rtf.zip | 2006-05-17 06:56 | 171K | |
![[ ]](/icons/compressed.gif) | Hamis - 3. Han Solo és a fejvadászok.zip | 2007-03-26 19:01 | 170K | |
![[ ]](/icons/compressed.gif) | Sw - Han solo és a fejvadászok.zip | 2007-03-26 19:02 | 170K | |
![[ ]](/icons/compressed.gif) | orsi_ferenc_a_bujdoso_zatony_foglyai_hu_html.zip | 2007-03-24 02:58 | 170K | |
![[ ]](/icons/compressed.gif) | James Joyce-Dublini emberek.zip | 2007-03-24 02:55 | 170K | |
![[ ]](/icons/compressed.gif) | franke.zip | 2007-08-04 14:25 | 170K | |
![[ ]](/icons/compressed.gif) | Herbert W. Franke - Elbeszélések.zip | 2005-06-22 15:34 | 170K | |
![[ ]](/icons/compressed.gif) | Herbert W. Franke írásai.zip | 2006-08-25 00:44 | 170K | |
![[ ]](/icons/compressed.gif) | han solo es a fejvadaszok.zip | 2007-03-24 02:54 | 170K | |
![[ ]](/icons/compressed.gif) | avery_dale_han_solo_es_a_fejvadaszok_hu_rtf.zip | 2007-03-24 02:54 | 170K | |
![[ ]](/icons/compressed.gif) | avery_dale_han_solo_es_a_fejvadaszok_hu_rtf(1).zip | 2006-05-10 06:46 | 170K | |
![[ ]](/icons/compressed.gif) | door_agnes_kinek_kell_egy_ilyen_balazs_hu_doc_nncl3014-708v1.zip | 2007-03-24 02:53 | 170K | |
![[ ]](/icons/compressed.gif) | szentivanyi_jeno_a_feher_csapat_hu_rtf.zip | 2007-03-24 03:00 | 170K | |
![[ ]](/icons/compressed.gif) | Jules Verne-Varkastely a Karpatokban.zip | 2007-03-24 02:56 | 170K | |
![[ ]](/icons/compressed.gif) | Adam Kennedy-A domino bosszuja.zip | 2007-03-24 02:49 | 170K | |
![[ ]](/icons/unknown.gif) | osszes50.ace | 2007-03-24 02:56 | 170K | |
![[ ]](/icons/compressed.gif) | schreiter_helfried_dobja_be_a_torulkozot_allamugyesz_ur_hu_rtf_nncl2268-651v1.zip | 2007-03-24 02:55 | 170K | |
![[ ]](/icons/compressed.gif) | Martin Clark Ashton - Shadoni krónika.zip | 2007-10-21 14:56 | 170K | |
![[ ]](/icons/compressed.gif) | A gyűrük ura V.zip | 2007-03-26 19:30 | 170K | |
![[ ]](/icons/compressed.gif) | doyle_arthur_conan_az_elveszett_vilag_hu_rtf.zip | 2007-03-24 02:49 | 170K | |
![[ ]](/icons/compressed.gif) | mcbain_ed_negy_holttest_a_konyvesboltban_hu_doc.zip | 2007-03-24 02:53 | 169K | |
![[ ]](/icons/compressed.gif) | vidor_miklos_onkentes_hajotorottek_hu_rtf.zip | 2007-03-24 03:01 | 169K | |
![[ ]](/icons/compressed.gif) | Alien 1.zip | 2007-03-24 02:49 | 169K | |
![[ ]](/icons/compressed.gif) | Kun Akos-Az ezoteria kivitelezese.zip | 2007-03-24 02:57 | 169K | |
![[ ]](/icons/compressed.gif) | girdo_e_a_lasszoveto_hu_rtf.zip | 2007-03-24 02:53 | 169K | |
![[ ]](/icons/compressed.gif) | g62.zip | 2007-08-04 14:36 | 169K | |
![[ ]](/icons/compressed.gif) | kertesz_imre_galyanaplo_html.zip | 2007-03-24 02:56 | 169K | |
![[ ]](/icons/compressed.gif) | padisak_mihaly_csipisz_megis_gyoz_hu_doc_nncl3088-706v1.zip | 2007-03-24 02:58 | 169K | |
![[ ]](/icons/compressed.gif) | abraham_cyril_megfordul_a_szel_hu_rtf.zip | 2007-03-24 02:52 | 169K | |
![[ ]](/icons/compressed.gif) | nietzsche_az ertekek_atertekelese_hu_rtf.zip | 2007-03-24 02:54 | 169K | |
![[ ]](/icons/compressed.gif) | eliade_mircea_a_szent_es_a_profan.zip | 2007-03-24 02:58 | 169K | |
![[ ]](/icons/compressed.gif) | Jorge Luis Borges-Korkoros romok.zip | 2007-03-24 02:56 | 169K | |
![[ ]](/icons/compressed.gif) | Erich Segal-Szerelmi tortenet.zip | 2007-03-24 02:53 | 169K | |
![[ ]](/icons/compressed.gif) | brunner_john_teljes_napfogyatkozas_hu_rtf.zip | 2007-03-24 02:56 | 168K | |
![[ ]](/icons/compressed.gif) | korkoros_romok.zip | 2006-05-18 05:24 | 168K | |
![[ ]](/icons/compressed.gif) | borges_jorge_luis_korkoros_romok_hu_rtf.zip | 2007-03-24 02:56 | 168K | |
![[ ]](/icons/compressed.gif) | moricz_zsigmond_forro_mezok_rtf.zip | 2007-03-24 02:58 | 168K | |
![[ ]](/icons/compressed.gif) | vaszary_gabor_monpti_hu_txt_nncl2439-683v1.zip | 2007-03-24 03:01 | 168K | |
![[ ]](/icons/layout.gif) | Malacath - Az Orkok Ősatyja, az Átkok Istene.pdf | 2007-05-03 07:18 | 168K | |
![[ ]](/icons/compressed.gif) | kennedy_adam_a_domino_bosszuja_hu_rtf.zip | 2007-03-24 02:49 | 168K | |
![[ ]](/icons/compressed.gif) | hajnoczy_peter_a_halal_kilovagolt_perzsiabol_hu_doc_nncl3230-722v1.zip | 2007-03-24 02:55 | 168K | |
![[ ]](/icons/compressed.gif) | Terry Pratehett-soforok.zip | 2007-03-24 03:00 | 168K | |
![[ ]](/icons/compressed.gif) | Armaggeddon.zip | 2007-10-21 14:56 | 168K | |
![[ ]](/icons/compressed.gif) | gardonyi_geza_ki-ki_a_parjaval_rtf.zip | 2007-03-24 02:54 | 168K | |
![[ ]](/icons/compressed.gif) | veres_peter_bolcs_es_balgatag_oseink_hu_doc_nncl2293-65ev1.zip | 2007-03-24 03:01 | 168K | |
![[ ]](/icons/compressed.gif) | card_orson_scott_a_holtak_szoszoloja.zip | 2007-03-24 02:58 | 168K | |
![[ ]](/icons/compressed.gif) | A es B Sztrugackij-Valaszd az eletet.zip | 2007-03-24 02:49 | 168K | |
![[ ]](/icons/compressed.gif) | stock_peter_a_marhakiraly_hu_rtf.zip | 2007-03-24 02:58 | 168K | |
![[ ]](/icons/compressed.gif) | bolin_m_c_armageddon_hu_rtf.zip | 2007-03-24 02:57 | 168K | |
![[ ]](/icons/unknown.gif) | g002.ace | 2007-03-24 02:52 | 168K | |
![[ ]](/icons/compressed.gif) | Haldeman, joe_orok_haboru_hu_txt.zip | 2006-05-17 07:20 | 167K | |
![[ ]](/icons/compressed.gif) | semprun_jorge_a_nagy_utazas_hu_rtf_nncl1829-606v1.zip | 2007-03-24 02:56 | 167K | |
![[ ]](/icons/unknown.gif) | Boris Vian-Tajtekos napok.ZIP | 2007-03-24 02:52 | 167K | |
![[ ]](/icons/compressed.gif) | foster_alan_dean_kristalykonnyek_hu_rtf.zip | 2007-03-24 02:49 | 167K | |
![[ ]](/icons/compressed.gif) | gannet_lewis_szuksegallapot_hu_rtf_nncl2900-6f3v1.zip | 2007-03-24 02:57 | 167K | |
![[ ]](/icons/compressed.gif) | marek_jiri_az_egyenlitotol_delre_hu_doc_nncl2259-651v1.zip | 2007-03-24 02:56 | 167K | |
![[ ]](/icons/compressed.gif) | Daley,Brian-Tron.zip | 2007-03-24 02:52 | 167K | |
![[ ]](/icons/compressed.gif) | hinton_s_e_kivulallok_hu_rtf_nncl3237-72av1.zip | 2007-03-24 03:00 | 167K | |
![[ ]](/icons/compressed.gif) | cable_mary_fekete_odusszeia_hu_rtf.zip | 2007-03-24 02:57 | 167K | |
![[ ]](/icons/compressed.gif) | robinson_frank_m_az_ero.zip | 2007-03-24 02:54 | 167K | |
![[ ]](/icons/compressed.gif) | foster_alan_dean_az_ut_vegen_a_halal_hu_rtf.zip | 2007-03-24 02:49 | 167K | |
![[ ]](/icons/compressed.gif) | Foster, Alan Dean - Az ut_vegen_a_halal.zip | 2006-05-17 05:22 | 167K | |
![[ ]](/icons/compressed.gif) | jurgen_anna_az_irokezek_fia_hu_html.zip | 2007-03-24 02:49 | 167K | |
![[ ]](/icons/compressed.gif) | mcbain_ed_holtomiglan_holtodiglan_hu_rtf.zip | 2007-03-24 02:53 | 167K | |
![[ ]](/icons/compressed.gif) | botond-bolics_gyorgy_redivivus_tuzet_ker_hu_rtf.zip | 2007-03-24 02:52 | 167K | |
![[ ]](/icons/compressed.gif) | Botond Bolics György - Redivivus tuzet ker hu rtf.zip | 2007-02-21 16:48 | 167K | |
![[ ]](/icons/compressed.gif) | Poul Anderson - Időjárőr.zip | 2007-03-21 19:11 | 167K | |
![[ ]](/icons/compressed.gif) | A római konyha.zip | 2007-03-24 02:59 | 167K | |
![[ ]](/icons/compressed.gif) | Wayne Chapman - Megkövült Napvilág.zip | 2007-03-23 05:21 | 167K | |
![[ ]](/icons/compressed.gif) | A gyűrük ura IV.zip | 2007-03-26 19:30 | 167K | |
![[ ]](/icons/compressed.gif) | baraniecki_marek_kasszandra_feje_hu_rtf_nncl2949-6f3v1.zip | 2007-03-24 02:57 | 167K | |
![[ ]](/icons/compressed.gif) | harbou_thea_von_metropolisz_hu_rtf.zip | 2007-03-24 03:00 | 167K | |
![[ ]](/icons/compressed.gif) | Harbou Thea Von_metropolisz_hu_rtf.zip | 2006-05-18 00:24 | 167K | |
![[ ]](/icons/layout.gif) | Nocturnal - Az Éjúrnő.pdf | 2007-05-03 07:21 | 167K | |
![[ ]](/icons/compressed.gif) | John Brunner A Yan jatekmesterei.zip | 2007-03-24 02:56 | 167K | |
![[ ]](/icons/compressed.gif) | munkacsi_miklos_a_mangofa_negyedik_gyumolcse_hu_doc_nncl1946_618v1.zip | 2007-03-24 02:58 | 166K | |
![[ ]](/icons/compressed.gif) | Terry Prachett - Sofőrök.zip | 2007-03-26 18:20 | 166K | |
![[ ]](/icons/compressed.gif) | lynch_jennifer_ki_olte_meg_laura_palmert_rtf.zip | 2007-03-24 02:56 | 166K | |
![[ ]](/icons/compressed.gif) | Gion Nandor-Aranyat talalt.zip | 2007-03-24 02:55 | 166K | |
![[ ]](/icons/compressed.gif) | sztrugackij_a_b_fogado_a_halott_alpinistahoz_hu_rtf.zip | 2007-03-24 02:49 | 166K | |
![[ ]](/icons/compressed.gif) | Sztrugackij, Arkagyij és Borisz - Fogado_a_halott_alpinistahoz.zip | 2007-02-21 16:27 | 166K | |
![[ ]](/icons/compressed.gif) | simak_clifford_d_a_varos_hu_rtf_nncl2214-648v3.zip | 2007-03-24 02:52 | 166K | |
![[ ]](/icons/compressed.gif) | fekete_istvan_kepzelet_es_valosag_hu_rtf.zip | 2007-03-24 02:57 | 166K | |
![[ ]](/icons/compressed.gif) | Shelley,Mary - Frankenstein.zip | 2007-02-21 16:39 | 166K | |
![[ ]](/icons/compressed.gif) | Dashiell Hammett-Veres aratas.zip | 2007-03-24 02:52 | 166K | |
![[ ]](/icons/compressed.gif) | Szferak a Fold es a Nap kozott.zip | 2007-03-24 03:00 | 166K | |
![[ ]](/icons/compressed.gif) | moldova_gyorgy_az_elatkozott_hivatal_html.zip | 2007-03-24 02:58 | 166K | |
![[ ]](/icons/compressed.gif) | sztrugackij_a_b_valaszd_az_eletet_hu_rtf.zip | 2007-03-24 02:49 | 166K | |
![[ ]](/icons/compressed.gif) | Sztrugackij, Arkagyij és Borisz - Valaszd_az_eletet.zip | 2007-02-21 16:22 | 166K | |
![[ ]](/icons/compressed.gif) | a_kodde_valt_kolostor.zip | 2007-03-24 02:57 | 166K | |
![[ ]](/icons/compressed.gif) | leacock_stephen_a_kek_edward_hu_rtf.zip | 2007-03-24 03:00 | 166K | |
![[ ]](/icons/compressed.gif) | tailor_martha_embolia_hu_doc_nncl2372-66dv1.zip | 2007-03-24 02:57 | 166K | |
![[ ]](/icons/compressed.gif) | stevenson_r_l_kincses_sziget_html.zip | 2007-03-24 02:58 | 166K | |
![[TXT]](/icons/text.gif) | Nemere_Istvan_Szomszedom_a_halal.html | 2007-03-24 02:58 | 166K | |
![[ ]](/icons/unknown.gif) | homokszemek_karakterek.xls | 2007-04-15 16:50 | 166K | |
![[ ]](/icons/compressed.gif) | mcbain_ed_baba_hu_doc_nncl1995-61dv.zip | 2007-03-24 02:53 | 165K | |
![[IMG]](/icons/image2.gif) | elolap.JPG | 2007-11-14 08:32 | 165K | |
![[ ]](/icons/compressed.gif) | RAMBO vietnamban-David Morrell.zip | 2007-03-24 02:58 | 165K | |
![[ ]](/icons/unknown.gif) | Kurt Vonnegut JR-Aldja meg az isten,Mr ROSEWATER | 2007-03-24 02:57 | 165K | |
![[ ]](/icons/compressed.gif) | Gromova-Fenykorben.zip | 2007-03-24 02:55 | 165K | |
![[ ]](/icons/compressed.gif) | wilson_mark_f_terminator_demon_a_jovobol_hu_html.zip | 2007-03-24 02:57 | 165K | |
![[ ]](/icons/unknown.gif) | Napló.mek | 2007-03-24 02:52 | 165K | |
![[ ]](/icons/compressed.gif) | sargasso_a_vilagurben.zip | 2007-08-04 14:45 | 165K | |
![[ ]](/icons/compressed.gif) | norton_andre_sargasso_a_vilagurben.zip | 2007-03-24 02:49 | 165K | |
![[ ]](/icons/compressed.gif) | Norton, Andre - Sargasso a vilagurben.zip | 2005-09-13 17:34 | 165K | |
![[ ]](/icons/compressed.gif) | Andre Norton-Sargasso a vilagurben.zip | 2007-03-24 02:49 | 165K | |
![[ ]](/icons/compressed.gif) | Joe Alex-A labirintus urnoje.zip | 2007-03-24 02:56 | 165K | |
![[ ]](/icons/compressed.gif) | moldova_gyorgy_a_nema_sugo_html.zip | 2007-03-24 02:58 | 165K | |
![[ ]](/icons/compressed.gif) | morrell_david_rambo_vietnamban_hu.zip | 2007-03-24 02:52 | 165K | |
![[ ]](/icons/compressed.gif) | pohl_kornbluth_dr_gladiator_hu_html.zip | 2006-05-30 21:48 | 165K | |
![[ ]](/icons/compressed.gif) | alex_joe_a_halal_beszel_helyettem_hu_rtf.zip | 2007-03-24 02:56 | 165K | |
![[ ]](/icons/compressed.gif) | joyce_james_dublini_emberek.zip | 2007-03-24 02:55 | 165K | |
![[ ]](/icons/compressed.gif) | z_vincze_gyorgy_az_android_per_hu_rtf.zip | 2007-03-24 03:01 | 165K | |
![[ ]](/icons/compressed.gif) | szabo_magda_fresko_html.zip | 2007-03-24 03:00 | 165K | |
![[ ]](/icons/compressed.gif) | dick_philip_k_elektronikus_barany.zip | 2007-03-24 02:58 | 165K | |
![[ ]](/icons/compressed.gif) | Philip K Dick - Elektronikus bárány.zip | 2007-02-21 16:13 | 165K | |
![[ ]](/icons/compressed.gif) | beck_ernest_a_titokzatos_arnyek_hu_doc_nncl857-412v1.zip | 2007-03-24 02:53 | 165K | |
![[ ]](/icons/compressed.gif) | tine_robert_tobb_mint_testor_hu_rtf.zip | 2007-03-24 03:00 | 165K | |
![[ ]](/icons/unknown.gif) | holt_tenger.ace | 2007-03-24 02:52 | 165K | |
![[ ]](/icons/compressed.gif) | steinbeck_john_volt_egyszer_egy_haboru_rtf.zip | 2007-03-24 02:56 | 164K | |
![[ ]](/icons/compressed.gif) | nemere_istvan_mukincsrablok_a_kisbolygon_hu_doc.zip | 2007-03-24 02:58 | 164K | |
![[ ]](/icons/compressed.gif) | capote_truman_mas_hangok_mas_szobak_hu_rtf_nncl1909-614v2.zip | 2007-03-24 03:00 | 164K | |
![[ ]](/icons/compressed.gif) | green_simon_r_hawk_&_fisher_hu_rtf.zip | 2007-03-24 03:00 | 164K | |
![[ ]](/icons/compressed.gif) | Arthur C Clarke - 2001 Űrodüsszeia.zip | 2007-03-23 13:35 | 164K | |
![[ ]](/icons/compressed.gif) | rendell_ruth_gyilkossag_a_kriptaban_hu_rtf_nncl1886-610v2.zip | 2007-03-24 03:00 | 164K | |
![[ ]](/icons/compressed.gif) | Rejto Jeno - Ezen egy ejszaka.txt.zip | 2007-03-24 02:59 | 164K | |
![[ ]](/icons/compressed.gif) | fuhmann_franz_szajensz_fikson_hu_rtf.zip | 2007-03-24 02:54 | 164K | |
![[ ]](/icons/compressed.gif) | conrad_joseph_a_sotetseg_melyen_hu_rtf.zip | 2007-03-24 02:56 | 164K | |
![[ ]](/icons/unknown.gif) | 03 - Jan van den Boomen - Hősi kard.doc | 2007-03-24 02:54 | 164K | |
![[ ]](/icons/compressed.gif) | gromova_ariadna_fenykorben.zip | 2007-03-24 02:49 | 163K | |
![[ ]](/icons/compressed.gif) | Gromova Ariadna - Fenykorben hu rtf.zip | 2007-02-21 16:31 | 163K | |
![[ ]](/icons/compressed.gif) | tinodi_sebestyen_osszes_koltemenye_html.zip | 2007-03-24 03:00 | 163K | |
![[ ]](/icons/compressed.gif) | blake_william_versei_pdf.zip | 2007-03-24 03:01 | 163K | |
![[ ]](/icons/compressed.gif) | dick_philip_k_ubik_hu_html.zip | 2007-03-24 02:58 | 163K | |
![[ ]](/icons/compressed.gif) | Alistair Maclean-Halal a Forma-1-en.zip | 2007-03-24 02:49 | 163K | |
![[ ]](/icons/compressed.gif) | Foster, Alan Dean - Kristalykonnyek_hu_rtf.zip | 2006-05-17 05:43 | 163K | |
![[ ]](/icons/unknown.gif) | 5SZAKACS.05 | 2007-03-24 02:59 | 163K | |
![[ ]](/icons/compressed.gif) | alex_joe_magam_vagyok_a_pokol_hu_rtf.zip | 2007-03-24 02:56 | 163K | |
![[ ]](/icons/compressed.gif) | maclean_alistair_halal_a_forma1en_hu_rtf.zip | 2007-03-24 02:49 | 163K | |
![[ ]](/icons/compressed.gif) | mcbain_ed_puska_hu_doc.zip | 2007-03-24 02:53 | 163K | |
![[ ]](/icons/compressed.gif) | sienkiewicz_henryk_a_romai_patricius_rtf.zip | 2007-03-24 02:55 | 163K | |
![[ ]](/icons/compressed.gif) | Javor Otto-A Csikvari kerengorol.zip | 2007-03-24 02:56 | 163K | |
![[ ]](/icons/compressed.gif) | lengyel_peter_ogg_masodik_bolygoja.zip | 2007-03-24 02:57 | 163K | |
![[ ]](/icons/compressed.gif) | Lengyel Péter - Ogg masodik bolygoja.zip | 2007-02-21 16:45 | 163K | |
![[ ]](/icons/compressed.gif) | Rejto Jeno - Menni vagy meghalni.doc.zip | 2007-03-24 02:59 | 163K | |
![[ ]](/icons/unknown.gif) | g062.ace | 2007-03-24 02:52 | 162K | |
![[ ]](/icons/compressed.gif) | Bohdan Retecki-MESSIER 13.zip | 2007-03-24 02:52 | 162K | |
![[ ]](/icons/compressed.gif) | waltari_mika_cselszovok_hu_rtf.zip | 2007-03-24 02:57 | 162K | |
![[ ]](/icons/compressed.gif) | lem_stanislaw_a_legyozhetetlen_hu_rtf.zip | 2007-03-24 03:00 | 162K | |
![[ ]](/icons/compressed.gif) | Stanislaw Lem - A legyozhetetlen.zip | 2006-05-31 07:49 | 162K | |
![[ ]](/icons/unknown.gif) | g046.ace | 2007-03-24 02:52 | 162K | |
![[ ]](/icons/compressed.gif) | Gaileo Galilei-Parbeszedek.zip | 2007-03-24 02:54 | 162K | |
![[ ]](/icons/unknown.gif) | davids_paul_es_hollace_darth_vader_kesztyuje.rtf | 2007-03-24 02:54 | 162K | |
![[ ]](/icons/compressed.gif) | John Malone-ezredvegi jovendolesek a XIX-XX szazad leghiresebb joslatai.zip | 2007-03-24 02:56 | 162K | |
![[ ]](/icons/compressed.gif) | padisak_mihaly_kedves_miska_bacsi_hu_doc_nncl3093-706v1.zip | 2007-03-24 02:58 | 162K | |
![[TXT]](/icons/text.gif) | Nemere_Istvan_Szomszedom_a_halal.txt | 2007-03-24 02:58 | 162K | |
![[ ]](/icons/compressed.gif) | teas_t_o_gyilkossag_negy_lepesben_hu_rtf.zip | 2007-03-24 03:00 | 162K | |
![[ ]](/icons/compressed.gif) | csukas_istvan_nagy_meseskonyve_html.zip | 2007-03-24 02:57 | 162K | |
![[ ]](/icons/compressed.gif) | -Pierre boulle-a majmok bolygoja.zip | 2007-03-24 02:58 | 161K | |
![[ ]](/icons/compressed.gif) | tailor_martha_zold_halal_hu_txt_nncl2443-688v1.zip | 2007-03-24 02:57 | 161K | |
![[ ]](/icons/compressed.gif) | engelmann_bernt_a_nagy_szovetsegi_erdemkereszt_hu_rtf.zip | 2007-03-24 02:50 | 161K | |
![[ ]](/icons/compressed.gif) | Erich Kastner-Arepulo osztaly.zip | 2007-03-24 02:53 | 161K | |
![[ ]](/icons/unknown.gif) | hyman_mac_en_meg_az_ormester_hu_rtf.zip2 | 2007-03-24 02:57 | 161K | |
![[ ]](/icons/compressed.gif) | kim_roman_elolvasas_utan_elegetendo_hu_html.zip | 2007-03-24 03:00 | 161K | |
![[ ]](/icons/compressed.gif) | jokai_mor_egesz_az_eszaki_polusig_html.zip | 2007-03-24 02:56 | 161K | |
![[ ]](/icons/compressed.gif) | marai_sandor_naplo_1984_89_hu_rtf_nncl2975-6fcv1.zip | 2007-03-24 02:57 | 161K | |
![[ ]](/icons/compressed.gif) | Junior - 3. A hutt visszavág.zip | 2007-03-26 19:02 | 161K | |
![[ ]](/icons/compressed.gif) | Rejto Jeno - Vanek ur Parizsban.txt.zip | 2007-03-24 02:59 | 161K | |
![[ ]](/icons/compressed.gif) | brockman_john_az_elmult_2000_ev_legfontosabb_talalmanyai_hu_rtf.zip | 2007-03-24 02:56 | 161K | |
![[ ]](/icons/compressed.gif) | tubb_e_c_elszakadas_alfa_holdbazis_hu_doc_nncl2290-65ev1.zip | 2007-03-24 02:53 | 161K | |
![[ ]](/icons/unknown.gif) | g036.ace | 2007-03-24 02:52 | 161K | |
![[ ]](/icons/compressed.gif) | Michael Moorcock - Az igazgyöngy erődje.zip | 2007-03-26 17:37 | 161K | |
![[ ]](/icons/compressed.gif) | christopher_john_egyetlen_fuszal_se_hu_rtf.zip | 2007-03-24 02:56 | 161K | |
![[ ]](/icons/compressed.gif) | Tamasi Aron-Abel a rengetegben.zip | 2007-03-24 02:55 | 161K | |
![[ ]](/icons/compressed.gif) | Isaac Asimov - A csillagok akár a por.zip | 2007-03-21 21:10 | 160K | |
![[ ]](/icons/compressed.gif) | Fekete Gen.zip | 2007-02-21 16:21 | 160K | |
![[ ]](/icons/compressed.gif) | koziliecki_jozef_a_beteljesult_mesek_szomorusaga_hu_html.zip | 2007-03-24 02:56 | 160K | |
![[ ]](/icons/compressed.gif) | nagy_lajos_kiskunhalom_hu_rtf_nncl2566-6a6v1.zip | 2007-03-24 02:58 | 160K | |
![[ ]](/icons/compressed.gif) | Horrorlexikon.zip | 2006-05-18 03:21 | 160K | |
![[ ]](/icons/compressed.gif) | Csupor Tibor-Csillag es osi szo.zip | 2007-03-24 02:52 | 160K | |
![[TXT]](/icons/text.gif) | SZARNY.HTM | 2007-03-24 02:59 | 160K | |
![[ ]](/icons/compressed.gif) | mattyasovszky_jeno_hod_titkos_feladata_hu_txt.zip | 2007-03-24 02:57 | 160K | |
![[ ]](/icons/compressed.gif) | Rejto Jeno - Piszkos Fred kozbelep.txt.zip | 2007-03-24 02:59 | 160K | |
![[ ]](/icons/compressed.gif) | kosztolanyi_dezso_kinai_kancso_rtf.zip | 2007-03-24 02:55 | 160K | |
![[ ]](/icons/unknown.gif) | Modul.doc | 2007-04-15 15:31 | 160K | |
![[ ]](/icons/compressed.gif) | sheckley_robert_szabad_preda_hu_html.zip | 2007-03-24 02:59 | 159K | |
![[ ]](/icons/compressed.gif) | Frederik Pohl - Terror.zip | 2007-03-26 18:11 | 159K | |
![[ ]](/icons/compressed.gif) | higgins_jack_az_oroszlan_duhe_hu_txt.zip | 2007-03-24 02:55 | 159K | |
![[ ]](/icons/compressed.gif) | salinger_j_d_franny_es_zooey_hu_html.zip | 2007-03-24 02:55 | 159K | |
![[ ]](/icons/compressed.gif) | claymore_tod_viperak_feszke_hu_rtf_nncl1911-614v2.zip | 2007-03-24 03:00 | 159K | |
![[ ]](/icons/compressed.gif) | verne_jules_egy_k_25ednai_viszontags_25e1gai_kinaban_rtf.zip | 2007-03-24 02:56 | 159K | |
![[ ]](/icons/compressed.gif) | J D Salinger-Franny es Zooey.zip | 2007-03-24 02:55 | 159K | |
![[ ]](/icons/compressed.gif) | Vámpír könyvek - 08. Az éjszaka szövetségesei.zip | 2007-03-20 13:26 | 159K | |
![[ ]](/icons/compressed.gif) | kosztolanyi_dezso_aprilis_bolondja_rtf.zip | 2007-03-24 02:55 | 159K | |
![[ ]](/icons/unknown.gif) | g042.ace | 2007-03-24 02:52 | 159K | |
![[ ]](/icons/compressed.gif) | Alan Dean Foster - A nyolcadik utas a halál.zip | 2007-03-24 02:49 | 159K | |
![[ ]](/icons/compressed.gif) | 01 Alan Dean Foster - Alien.zip | 2007-03-23 19:30 | 159K | |
![[ ]](/icons/compressed.gif) | Foster, Alan Dean - Alien.rtf.zip | 2007-02-21 16:42 | 159K | |
![[ ]](/icons/compressed.gif) | asimov_isaac_robotvarosa.zip | 2007-03-24 02:55 | 159K | |
![[ ]](/icons/compressed.gif) | paddock_norton_versenyfutas_a_prerin_hu_rtf.zip | 2007-03-24 02:58 | 159K | |
![[ ]](/icons/compressed.gif) | wittgen_tom_oszi kikerics_hu_rtf_nncl1924-614v2.zip | 2007-03-24 03:00 | 159K | |
![[ ]](/icons/compressed.gif) | durrenmatt_friedrich_zurvolgy_hu_doc.zip | 2007-03-24 02:54 | 159K | |
![[ ]](/icons/compressed.gif) | lem_stanislaw_dilemmak_hu_html.zip | 2007-03-24 03:00 | 158K | |
![[ ]](/icons/compressed.gif) | brackett_leigh_a_rot_csillag_hu_rtf.zip | 2007-03-24 02:57 | 158K | |
![[ ]](/icons/compressed.gif) | Leigh Bracket - A rőt csillag.zip | 2006-05-10 08:16 | 158K | |
![[ ]](/icons/compressed.gif) | carr_john_dickson_a_kastely_titka_html.zip | 2007-03-24 02:56 | 158K | |
![[ ]](/icons/compressed.gif) | Ray Bradbury - Marsbeli krónikák.zip | 2007-03-22 16:55 | 158K | |
![[ ]](/icons/compressed.gif) | 03.Alan Dean Foster - Végső megoldás a halál.zip | 2007-03-23 19:30 | 158K | |
![[ ]](/icons/compressed.gif) | hoyle_fred_a_fekete_felho_txt.zip | 2007-03-24 02:54 | 158K | |
![[ ]](/icons/unknown.gif) | osszes34.ace | 2007-03-24 02:56 | 158K | |
![[ ]](/icons/compressed.gif) | foster_alan_dean_alien_3_hu_rtf.zip | 2007-03-24 02:49 | 158K | |
![[ ]](/icons/compressed.gif) | Foster, Alan Dean - Alien_3_hu_rtf.zip | 2007-02-21 16:05 | 158K | |
![[ ]](/icons/compressed.gif) | Alien 3.zip | 2007-03-24 02:49 | 158K | |
![[ ]](/icons/unknown.gif) | osszes39.ace | 2007-03-24 02:56 | 158K | |
![[ ]](/icons/layout.gif) | Sebes.pdf | 2007-04-15 16:28 | 158K | |
![[ ]](/icons/compressed.gif) | gorkij_maxim_huszonhat_ferfi_egy_leany_rtf.zip | 2007-03-24 02:57 | 158K | |
![[ ]](/icons/unknown.gif) | Vadkacsa receptek A-tól Z-ig.doc | 2007-03-24 02:59 | 158K | |
![[ ]](/icons/compressed.gif) | roulet_dominique_az_alibi_halott_hu_rtf_nncl1273-4cfv2.zip | 2007-03-24 02:53 | 158K | |
![[ ]](/icons/compressed.gif) | Rejto Jeno - A Nevada szelleme.doc.zip | 2007-03-24 02:59 | 158K | |
![[ ]](/icons/compressed.gif) | gardner_erle_stanley_a_muveszi_csapda_esete_hu_rtf_nncl2895-6f3v1.zip | 2007-03-24 02:53 | 158K | |
![[ ]](/icons/compressed.gif) | Sarkozy Halasz Peter-Dzsungellaz.zip | 2007-03-24 03:00 | 158K | |
![[ ]](/icons/compressed.gif) | harrington_stewart_masodik_talakozas_a_halallal_hu_txt.zip | 2007-03-23 19:54 | 158K | |
![[ ]](/icons/compressed.gif) | barbet_pierre_baphomet_birodalma_hu_doc.zip | 2007-03-24 02:58 | 158K | |
![[ ]](/icons/compressed.gif) | Horvath Marietta-Kezedben a mecs.zip | 2007-03-24 02:55 | 158K | |
![[ ]](/icons/layout.gif) | Modul_JK_NJK.pdf | 2007-04-15 14:56 | 157K | |
![[ ]](/icons/compressed.gif) | howard_robert_e_barbarok_es_varazslok_hu_rtf.zip | 2007-03-24 02:59 | 157K | |
![[ ]](/icons/layout.gif) | Lakberendezés I. - Tárgymozgatás gyorstalpaló.pdf | 2007-05-03 06:56 | 157K | |
![[ ]](/icons/layout.gif) | alelet.pdf | 2007-04-15 15:51 | 157K | |
![[ ]](/icons/compressed.gif) | fekete_istvan_a_koppanyi_aga_testamentuma_hu_rtf_nncl803-5fev1.zip | 2007-03-24 02:57 | 157K | |
![[ ]](/icons/compressed.gif) | DUALTORVENY-A nevtelen szellem bolcseszete.zip | 2007-03-24 02:53 | 157K | |
![[ ]](/icons/unknown.gif) | BOOKFILE.JAR4 | 2007-03-24 02:54 | 157K | |
![[ ]](/icons/compressed.gif) | mcbain_ed_narkonepper_hu_doc.zip | 2007-03-24 02:53 | 157K | |
![[ ]](/icons/compressed.gif) | dick_philip_k_kizokkent_ido_hu_html.zip | 2007-03-24 02:58 | 157K | |
![[ ]](/icons/compressed.gif) | Zsoldos Peter-A Feladat.zip | 2007-03-24 03:01 | 157K | |
![[ ]](/icons/compressed.gif) | schopenhauer_arthur_eletbolcsesseg.zip | 2007-03-24 02:49 | 157K | |
![[ ]](/icons/layout.gif) | Stealth skillek - Tolvajok és csempészek képességei.pdf | 2007-05-03 06:39 | 157K | |
![[ ]](/icons/compressed.gif) | nemere_istvan_aranyhalo_hu_rtf.zip | 2007-03-24 02:58 | 157K | |
![[ ]](/icons/compressed.gif) | jokai_mor_a_fekete_ver_html.zip | 2007-03-24 02:56 | 157K | |
![[ ]](/icons/compressed.gif) | douglas_garry_hegylako_hu_html.zip | 2007-03-24 02:54 | 157K | |
![[ ]](/icons/compressed.gif) | dumas_alexandre_a_kamelias_holgy_rtf.zip | 2007-03-24 02:49 | 157K | |
![[ ]](/icons/compressed.gif) | stone_jeffrey_a_hajnal_lovagja_hu_rtf.zip | 2007-03-24 02:58 | 157K | |
![[ ]](/icons/compressed.gif) | foster_alan_dean_alien.zip | 2007-03-24 02:49 | 157K | |
![[ ]](/icons/compressed.gif) | szabo_magda_tunder_lala_html.zip | 2007-03-24 03:00 | 157K | |
![[ ]](/icons/compressed.gif) | Aisopus-Esopus fabulai.zip | 2007-03-24 02:58 | 156K | |
![[ ]](/icons/compressed.gif) | kurti_andras_a_csodalatos_mukator.zip | 2007-03-24 02:57 | 156K | |
![[ ]](/icons/compressed.gif) | Csodálatos mukator.zip | 2006-08-08 17:24 | 156K | |
![[ ]](/icons/compressed.gif) | bayard_j_zold_anakonda_hu_doc_nncl2089-635v1.zip | 2007-03-24 02:55 | 156K | |
![[ ]](/icons/compressed.gif) | bergmann_ingmar_jelenetek_egy_hazassagbol_hu_rtf.zip | 2007-03-24 02:55 | 156K | |
![[ ]](/icons/compressed.gif) | nemere_istvan_kozmikus_osszecsapas_hu_rtf.zip | 2007-03-24 02:58 | 156K | |
![[ ]](/icons/compressed.gif) | RAGADOZO 2-Simon Hawke.zip | 2007-03-24 02:58 | 156K | |
![[ ]](/icons/unknown.gif) | osszes72.ace | 2007-03-24 02:56 | 156K | |
![[ ]](/icons/compressed.gif) | Daniel Defoe-Robinson Cruzoe.zip | 2007-03-24 02:52 | 156K | |
![[ ]](/icons/compressed.gif) | rieder_kurt_hitler_titkos_fegyverei_hu_rtf.zip | 2007-03-24 02:57 | 156K | |
![[ ]](/icons/compressed.gif) | brown_fredric_marslakok_mars_haza_hu_txt.zip | 2007-03-24 02:54 | 156K | |
![[ ]](/icons/compressed.gif) | Hal[l]hatatlan politikai viccek.zip | 2007-03-24 02:55 | 156K | |
![[ ]](/icons/compressed.gif) | huxley_aldous_brave_new_world.zip | 2007-03-24 02:49 | 156K | |
![[ ]](/icons/compressed.gif) | Heltai Jeno-Kiskiralyok.zip | 2007-03-24 02:55 | 156K | |
![[ ]](/icons/compressed.gif) | farmer_philip_jose_fenevadak_hu_rtf.zip | 2007-03-24 02:58 | 156K | |
![[ ]](/icons/unknown.gif) | osszes62.ace | 2007-03-24 02:56 | 156K | |
![[ ]](/icons/unknown.gif) | fogado.ace | 2007-03-24 02:52 | 156K | |
![[ ]](/icons/unknown.gif) | Egy kínai viszontagságai kínában.ZIP | 2007-03-24 02:56 | 156K | |
![[ ]](/icons/compressed.gif) | augustinus_isten_varosarol.zip | 2007-03-24 02:49 | 155K | |
![[ ]](/icons/compressed.gif) | travers_p_l_a_csudalatos_mary_visszater_hu_doc_nncl3116-706v1.zip | 2007-03-24 02:58 | 155K | |
![[ ]](/icons/compressed.gif) | A gyűrük ura VI.zip | 2007-03-26 19:30 | 155K | |
![[ ]](/icons/compressed.gif) | RAGADOZO-Paul Monette.zip | 2007-03-24 02:58 | 155K | |
![[ ]](/icons/compressed.gif) | dick_philip_k_transz_hu_rtf.zip | 2007-03-24 02:58 | 155K | |
![[ ]](/icons/compressed.gif) | Philip K Dick - Transz_hu_rtf.zip | 2006-05-10 07:03 | 155K | |
![[ ]](/icons/compressed.gif) | nogradi_gabor_pete_pite_hu_doc_nncl3084-706v1.zip | 2007-03-24 02:58 | 155K | |
![[ ]](/icons/compressed.gif) | Tamasi Aron-Abel orszagaban.zip | 2007-03-24 02:55 | 155K | |
![[ ]](/icons/compressed.gif) | David Bischoff - Éjszakai világ.zip | 2007-03-21 19:27 | 155K | |
![[ ]](/icons/compressed.gif) | sobel_dava_hosszusagi_fok_hu_rtf_nncl2867-6efv1.zip | 2007-03-24 02:52 | 155K | |
![[ ]](/icons/compressed.gif) | rigby_ray_a_domb_hu_rtf.zip | 2007-03-24 02:59 | 155K | |
![[ ]](/icons/compressed.gif) | foster_alan_dean_eroproba_star_wars_hu_rtf.zip | 2007-03-24 02:49 | 155K | |
![[ ]](/icons/compressed.gif) | scott_walter_a_fekete_torpe_rtf.zip | 2007-03-24 03:01 | 155K | |
![[TXT]](/icons/text.gif) | 5SZAK04.HTM | 2007-03-24 02:59 | 155K | |
![[ ]](/icons/compressed.gif) | dekany_andras_tatrai_tuzek_hu_rtf_nncl346-30ev2.zip | 2007-03-24 02:52 | 155K | |
![[ ]](/icons/compressed.gif) | pope_saxton_t_vadaszat_ijjal_es_nyillal.zip | 2007-03-24 02:53 | 155K | |
![[ ]](/icons/unknown.gif) | QUARK fantasztikus fuzet 3 | 2007-03-24 02:58 | 155K | |
![[ ]](/icons/compressed.gif) | sartre_jean-paul_egy_vezer_gyermekkora_hu_rtf.zip | 2007-03-24 02:56 | 155K | |
![[ ]](/icons/compressed.gif) | nagy_katalin_a_vilag_legrosszabb_gyereke_hu_doc_nncl3080-706v1.zip | 2007-03-24 02:58 | 155K | |
![[ ]](/icons/layout.gif) | Anvil - Kalandok a kikötővárosban.pdf | 2007-05-03 07:06 | 155K | |
![[ ]](/icons/compressed.gif) | Szerb Antal -Budapesti kalauz.zip | 2007-03-24 03:00 | 154K | |
![[ ]](/icons/compressed.gif) | block_lawrence_betoro_a_szekrenyben_hu_rtf.zip | 2007-03-24 02:57 | 154K | |
![[ ]](/icons/compressed.gif) | may_karl_vitzliputzli_professzor_rtf.zip | 2007-03-24 02:56 | 154K | |
![[ ]](/icons/compressed.gif) | doyle_arthur_conan_a_satan_kutyaja_rtf.zip | 2007-03-24 02:49 | 154K | |
![[ ]](/icons/unknown.gif) | osszes73.ace | 2007-03-24 02:56 | 154K | |
![[ ]](/icons/unknown.gif) | 05 - Függelék.doc | 2007-03-24 02:54 | 154K | |
![[ ]](/icons/unknown.gif) | 02 - Jan van den Boomen - Kadal kedve szerint.doc | 2007-03-24 02:54 | 154K | |
![[ ]](/icons/compressed.gif) | mora_ferenc_kincskereso_kiskodmon_doc.zip | 2007-03-24 02:58 | 154K | |
![[ ]](/icons/compressed.gif) | wood_o_vadnyugat_ordoge_hu_rtf.zip | 2007-03-24 02:58 | 154K | |
![[ ]](/icons/compressed.gif) | Alan Dean Foster - Alien IV Idegenek a Földön.zip | 2007-03-24 02:49 | 154K | |
![[ ]](/icons/compressed.gif) | padisak_mihaly_eljen_a_szamuzetes_hu_doc_nncl3089-706v1.zip | 2007-03-24 02:58 | 154K | |
![[ ]](/icons/compressed.gif) | vaszary_gabor_ketten_parizs_ellen_hu_txt_nncl2438-683v1.zip | 2007-03-24 03:01 | 154K | |
![[ ]](/icons/compressed.gif) | Rejto Jeno - A feher folt.doc.zip | 2007-03-24 02:59 | 153K | |
![[ ]](/icons/unknown.gif) | poker.ace | 2007-03-24 02:52 | 153K | |
![[ ]](/icons/compressed.gif) | Aliens - Perry, Steve_Aliens 4 - Idegenek a Földön - txt.zip | 2006-01-07 08:52 | 153K | |
![[ ]](/icons/compressed.gif) | durrenmatt_friedrich_gorog_ferfi_gorog_not_keres_hu_doc.zip | 2007-03-24 02:54 | 153K | |
![[ ]](/icons/compressed.gif) | Vámpír könyvek - 09. A hajnal gyilkosai.zip | 2007-03-20 13:26 | 153K | |
![[ ]](/icons/compressed.gif) | Nyerges Andras-Magyar Fakir.zip | 2007-03-24 02:58 | 153K | |
![[ ]](/icons/compressed.gif) | kastner_erich_az_emberke_hu_doc_nncl3066-706v1.zip | 2007-03-24 02:53 | 153K | |
![[ ]](/icons/compressed.gif) | mcbain_ed_karacsonyi_ajandekok_hu_doc.zip | 2007-03-24 02:53 | 153K | |
![[ ]](/icons/unknown.gif) | pokol.ace | 2007-03-24 02:52 | 153K | |
![[ ]](/icons/compressed.gif) | Bradley, Marion Zimmer - Darkover hu rtf.zip | 2006-05-10 06:48 | 153K | |
![[ ]](/icons/unknown.gif) | Q G Lyn-A F Bian-Az ellentmondasok bolygoja | 2007-03-24 02:58 | 153K | |
![[ ]](/icons/compressed.gif) | Rejto Jeno - Pokol a hegyek kozott.doc.zip | 2007-03-24 02:59 | 153K | |
![[ ]](/icons/compressed.gif) | benedek_elek_vilagszep_nadszal_kiralykisasszony_hu_rtf.zip | 2007-03-24 02:57 | 153K | |
![[ ]](/icons/compressed.gif) | sheckley_robert_ugyanaz_duplan_hu_rtf.zip | 2007-03-24 02:59 | 153K | |
![[ ]](/icons/compressed.gif) | Robert Sheckley - Szabad préda.zip | 2007-03-26 18:49 | 152K | |
![[ ]](/icons/compressed.gif) | Gianni Rodari-Hagymacska tortenete.zip | 2007-03-24 02:57 | 152K | |
![[ ]](/icons/compressed.gif) | ibragimbekov_makszud_a_csodaszer_hu_html_nncl3238-72av1.zip | 2007-03-24 02:57 | 152K | |
![[ ]](/icons/compressed.gif) | shan_darren_a_sotetseg_vadaszai_hu_rtf.zip | 2007-03-24 02:52 | 152K | |
![[ ]](/icons/compressed.gif) | Jack Vance - A Klau rabszolgái hu_rtf.zip | 2006-05-28 04:38 | 152K | |
![[ ]](/icons/compressed.gif) | mcintyre_vonda_n_khan_haragja_hu_html.zip | 2006-05-28 02:18 | 152K | |
![[ ]](/icons/compressed.gif) | lll_a_halott_varos_arnyai.zip | 2007-03-20 00:16 | 152K | |
![[ ]](/icons/compressed.gif) | Nemere István - A kupolaváros titka.zip | 2007-03-26 17:42 | 152K | |
![[ ]](/icons/compressed.gif) | levin_ira_stepfordi_felesegek_hu_rtf_nncl2946-6f3v1.zip | 2007-03-24 02:55 | 152K | |
![[ ]](/icons/unknown.gif) | 11 - Wayne Chapman - A bárd és a démonok.doc | 2007-03-24 02:54 | 152K | |
![[TXT]](/icons/text.gif) | RPG_HU - - Mesélőknek - Elfajzás (dark fantasy MAGUS kalandmodul).htm | 2007-04-15 15:26 | 152K | |
![[ ]](/icons/compressed.gif) | szabo_magda_katalin_utca_html.zip | 2007-03-24 03:00 | 152K | |
![[ ]](/icons/compressed.gif) | barbet_pierre_a_psziborgok_almai.zip | 2007-03-24 02:58 | 152K | |
![[ ]](/icons/compressed.gif) | Rejto Jeno - A boszorkanymester.doc.zip | 2007-03-24 02:59 | 152K | |
![[ ]](/icons/compressed.gif) | Farley Mowat-Ne feljunk a farkastol.zip | 2007-03-24 02:54 | 152K | |
![[ ]](/icons/compressed.gif) | millet_catherine_catherine_m_szexualis_elete_hu_txt.zip | 2007-03-24 02:52 | 152K | |
![[ ]](/icons/unknown.gif) | pohl_terror.ace | 2007-03-24 02:52 | 152K | |
![[ ]](/icons/unknown.gif) | 5SZAKACS.04 | 2007-03-24 02:59 | 152K | |
![[ ]](/icons/unknown.gif) | g041.ace | 2007-03-24 02:52 | 152K | |
![[ ]](/icons/compressed.gif) | ham_bob_duh_hu_html.zip | 2007-03-24 02:51 | 151K | |
![[ ]](/icons/compressed.gif) | curwood_oliver_j_furge_villam_hu_rtf.zip | 2007-03-24 02:55 | 151K | |
![[ ]](/icons/compressed.gif) | sheckley_robert_kozmikus_fonyeremeny_hu_html.zip | 2007-03-24 02:59 | 151K | |
![[ ]](/icons/compressed.gif) | Robert Sheckley - Kozmikus_fonyeremeny_hu_html.zip | 2006-05-28 03:54 | 151K | |
![[ ]](/icons/compressed.gif) | Philip K Dick - A halal_utvesztoje_hu_rtf.zip | 2006-05-10 17:41 | 151K | |
![[ ]](/icons/unknown.gif) | Martin C Ashton-EXCALIBUR.ZIP | 2007-03-24 02:57 | 151K | |
![[ ]](/icons/compressed.gif) | Jules Verne-A langban allo szigettenger.zip | 2007-03-24 02:56 | 151K | |
![[ ]](/icons/compressed.gif) | verne_jules_a_langban_allo_szigettenger_rtf.zip | 2007-03-24 02:56 | 151K | |
![[ ]](/icons/compressed.gif) | grey_anthony_es_elszabadul_a_pokol_hu_rtf_nncl2107-636v1.zip | 2007-03-24 02:49 | 151K | |
![[ ]](/icons/layout.gif) | Duskfang-Dawnfang - Korunk egyik legjobb kardja.pdf | 2007-05-03 06:49 | 151K | |
![[ ]](/icons/unknown.gif) | 1.doc | 2007-11-14 03:02 | 151K | |
![[ ]](/icons/compressed.gif) | A E. Van Vogt - Linn_varazsloja_hu_rtf.zip | 2006-05-31 09:01 | 150K | |
![[ ]](/icons/compressed.gif) | durrenmatt_friedrich_a_bukas_hu_doc.zip | 2007-03-24 02:54 | 150K | |
![[ ]](/icons/compressed.gif) | Vámpír könyvek - 12. A Végzet fiai.zip | 2007-03-20 13:26 | 150K | |
![[ ]](/icons/compressed.gif) | Rejto Jeno - Vesztegzar a Grand Hotelban.doc.zip | 2007-03-24 02:59 | 150K | |
![[ ]](/icons/compressed.gif) | Vámpír könyvek - 05. A halál próbái.zip | 2007-03-20 13:25 | 150K | |
![[ ]](/icons/unknown.gif) | 2.doc | 2007-11-14 03:02 | 150K | |
![[ ]](/icons/compressed.gif) | majtenyi_erik_betonkelepce_hu_rtf.zip | 2007-03-24 02:57 | 150K | |
![[ ]](/icons/compressed.gif) | vance_jack_a_klau_rabszolgai_hu_rtf.zip | 2007-03-24 02:55 | 150K | |
![[ ]](/icons/compressed.gif) | ausztral_nyar.zip | 2007-03-24 02:57 | 150K | |
![[ ]](/icons/compressed.gif) | egel_czepuck_karambol_a_venusz_hegyen_hu_doc_nncl1531-52cv1.zip | 2007-03-24 02:56 | 150K | |
![[ ]](/icons/compressed.gif) | jokai_anna_mindhalalig_html.zip | 2007-03-24 02:56 | 150K | |
![[ ]](/icons/compressed.gif) | moody_susan_fekete_penny_hu_rtf_nncl2369-66dv1.zip | 2007-03-24 03:00 | 150K | |
![[ ]](/icons/compressed.gif) | marai_sandor_a_gyertyak_csonkig_egnek_hu_rtf.zip | 2007-03-24 02:57 | 150K | |
![[ ]](/icons/compressed.gif) | Arthur Herzog-Delej.zip | 2007-03-24 02:49 | 150K | |
![[ ]](/icons/compressed.gif) | fekete_istvan_21_nap_hu_rtf.zip | 2007-03-24 02:57 | 150K | |
![[ ]](/icons/compressed.gif) | cheyney_peter_ez_az_ember_veszelyes_hu_rtf.zip | 2007-03-24 02:58 | 149K | |
![[ ]](/icons/unknown.gif) | haigazvolna.ace | 2007-03-24 02:52 | 149K | |
![[ ]](/icons/compressed.gif) | asturias_miguel_angel_kincses_urfi_hu_html.zip | 2007-03-24 02:57 | 149K | |
![[ ]](/icons/compressed.gif) | Stenszky Cecilia-Mimi es Antony.zip | 2007-03-24 03:00 | 149K | |
![[ ]](/icons/compressed.gif) | mcalary_mike_cop_land_hu_html.zip | 2007-03-24 02:57 | 149K | |
![[ ]](/icons/compressed.gif) | cheyney_peter_csali_pali_hu_rtf_nncl2736-6d7v1.zip | 2007-03-24 02:58 | 149K | |
![[ ]](/icons/compressed.gif) | M A Austrias-Akincses urfi.zip | 2007-03-24 02:57 | 149K | |
![[ ]](/icons/compressed.gif) | kosztolanyi_dezso_furdes_rtf.zip | 2007-03-24 02:55 | 149K | |
![[ ]](/icons/compressed.gif) | E T A Hoffman-Az arany viragcserep.zip | 2007-03-24 02:53 | 149K | |
![[ ]](/icons/unknown.gif) | osszes09.ace | 2007-03-24 02:56 | 149K | |
![[ ]](/icons/compressed.gif) | lewis_c_s_a_csendes_bolygo.zip | 2007-03-24 02:52 | 149K | |
![[ ]](/icons/compressed.gif) | C.S. Lewis.zip | 2006-05-31 11:36 | 149K | |
![[ ]](/icons/compressed.gif) | 06. VI. Jedi visszatér.zip | 2007-03-26 19:01 | 149K | |
![[ ]](/icons/compressed.gif) | dick_philip_k_figyel_az_eg_hu_html.zip | 2007-03-24 02:58 | 149K | |
![[ ]](/icons/compressed.gif) | shan_darren_az_arnyak_ura_hu_rtf_nncl2389-673v1.zip | 2007-03-24 02:52 | 148K | |
![[ ]](/icons/compressed.gif) | kahn_james_a_jedi_visszater_hu_rtf.zip | 2006-05-18 04:44 | 148K | |
![[ ]](/icons/compressed.gif) | teas_t_o_gorillak_hu_html.zip | 2007-03-24 03:00 | 148K | |
![[ ]](/icons/compressed.gif) | hawking_stephen_Einstein_alma.zip | 2007-03-24 03:00 | 148K | |
![[ ]](/icons/compressed.gif) | shan_darren_a_vampirok_hegye_hu_rtf.zip | 2007-03-24 02:52 | 148K | |
![[ ]](/icons/compressed.gif) | thury_zsuzsa_szokes_karacsonykor_hu_doc_nncl3112-706v1.zip | 2007-03-24 03:00 | 148K | |
![[ ]](/icons/compressed.gif) | gallagher_richard_a_halalraitelt_szakasz_hu_rtf.zip | 2007-03-24 02:59 | 148K | |
![[ ]](/icons/compressed.gif) | coelho_paulo_tizenegy_perc_hu_txt.zip | 2007-03-24 02:58 | 148K | |
![[ ]](/icons/unknown.gif) | marsbeli.ace | 2007-03-24 02:52 | 148K | |
![[ ]](/icons/unknown.gif) | 5.doc | 2007-11-13 21:13 | 148K | |
![[ ]](/icons/unknown.gif) | a_tizorai_emberek.rtf | 2005-03-03 17:58 | 147K | |
![[ ]](/icons/compressed.gif) | S.Hawking - Einstein álma.zip | 2007-03-24 02:49 | 147K | |
![[ ]](/icons/compressed.gif) | Brian Daley - Tron.zip | 2007-03-22 17:03 | 147K | |
![[ ]](/icons/compressed.gif) | Ray Bradbury-Szep arany almait a nap.zip | 2007-03-24 02:59 | 147K | |
![[ ]](/icons/compressed.gif) | Vámpír könyvek - 07. A sötétség vadászai.zip | 2007-03-20 13:26 | 147K | |
![[ ]](/icons/compressed.gif) | jokai_mor_ahol_a_penz_nem_isten_html.zip | 2007-03-24 02:56 | 147K | |
![[ ]](/icons/unknown.gif) | kproba.rtf | 2007-04-15 15:53 | 147K | |
![[ ]](/icons/compressed.gif) | tron.zip | 2007-02-21 16:24 | 147K | |
![[ ]](/icons/compressed.gif) | A nyugati Iszlam rozsai[a rozsaviz,a rozsaolaj,s a hasznuk].zip | 2007-03-24 02:53 | 147K | |
![[ ]](/icons/compressed.gif) | dick_philip_k_almodnak_e_az_androidok_elektromos_baranyokrol_hu_txt.zip | 2007-03-24 02:58 | 147K | |
![[TXT]](/icons/text.gif) | 01 - Wayne Chapman - Prófécia.txt | 2007-03-24 02:54 | 147K | |
![[ ]](/icons/compressed.gif) | lem_stanislaw_az_emberiseg_egy_perce_hu_rtf_nncl2021-623v1.zip | 2007-03-24 03:00 | 147K | |
![[ ]](/icons/compressed.gif) | brunner_john_a_yan_jatekmesterei.zip | 2007-03-24 02:56 | 147K | |
![[ ]](/icons/compressed.gif) | John Brunner- A Yan jatekmesterei.zip | 2006-08-24 22:31 | 147K | |
![[ ]](/icons/compressed.gif) | a_varosgep.zip | 2007-02-21 16:24 | 147K | |
![[ ]](/icons/compressed.gif) | trimble_louis_a_varosgep.zip | 2007-03-24 02:57 | 147K | |
![[ ]](/icons/compressed.gif) | bergmann_ingmar_jelenetek_egy_hazassagbol_hu_htm.zip | 2007-03-24 02:55 | 147K | |
![[ ]](/icons/compressed.gif) | shan_darren_a_halal_probai_hu_rtf.zip | 2007-03-24 02:52 | 146K | |
![[ ]](/icons/compressed.gif) | Marlo Morgan-Vidd hiret az igazaknak.zip | 2007-03-24 02:57 | 146K | |
![[ ]](/icons/compressed.gif) | semprun_jorge_az_ajulas_hu_rtf.zip | 2007-03-24 02:56 | 146K | |
![[ ]](/icons/unknown.gif) | harom_nap_egy_esztendo.rtf | 2007-11-14 05:13 | 146K | |
![[ ]](/icons/compressed.gif) | webster_jean_nyakiglab_apo_hu_doc_nncl3124-706v1.zip | 2007-03-24 02:56 | 146K | |
![[ ]](/icons/compressed.gif) | forester_cecil_scott_gyilkossag_reszletfizetesre_hu_rtf.zip | 2007-03-24 02:52 | 146K | |
![[ ]](/icons/compressed.gif) | madach_imre_az_ember_tragediaja.zip | 2007-03-24 02:57 | 146K | |
![[ ]](/icons/compressed.gif) | harte_bret_egy_banya_tortenete_hu_rtf.zip | 2007-03-24 02:52 | 146K | |
![[ ]](/icons/compressed.gif) | Carasoni, J. A fehér mágus .zip | 2007-03-23 05:08 | 146K | |
![[ ]](/icons/compressed.gif) | szigeti_janos_kemek_egymas_kozott_hu_rtf.zip | 2007-03-24 03:00 | 145K | |
![[ ]](/icons/compressed.gif) | Jerome David Salinger-Zabhegyezo.zip | 2007-03-24 02:56 | 145K | |
![[ ]](/icons/compressed.gif) | fazekas_laszlo_otig_raerunk_hu_doc_nncl3051-706v1.zip | 2007-03-24 02:54 | 145K | |
![[ ]](/icons/compressed.gif) | smith_l_neil_lando_calrissian_es_oseon_tuzvihara_hu_rtf.zip | 2007-03-24 02:54 | 145K | |
![[ ]](/icons/compressed.gif) | smith_l_neil_lando_calrissian_es_oseon_tuzvihara_hu_rtf(1).zip | 2006-05-28 03:57 | 145K | |
![[ ]](/icons/compressed.gif) | lando_calrissian_es_oseon_tuzvihara.zip | 2007-03-24 02:54 | 145K | |
![[ ]](/icons/compressed.gif) | berkesi_andras_vallomas_hu_txt_nncl2349-667v1.zip | 2007-03-24 02:50 | 145K | |
![[ ]](/icons/compressed.gif) | bach_richard_siraly.zip | 2007-03-24 02:59 | 145K | |
![[ ]](/icons/compressed.gif) | Botond-Bolics Gyorgy-Redivius tuzet ker.zip | 2007-03-24 02:52 | 145K | |
![[ ]](/icons/compressed.gif) | barker_clive_az_oroklet_tolvaja_hu_rtf.zip | 2007-03-24 02:52 | 145K | |
![[ ]](/icons/compressed.gif) | Clive Barker - Az oroklet tolvaja hu rtf.zip | 2007-02-21 16:10 | 145K | |
![[ ]](/icons/compressed.gif) | queneau_raymond_zazie_a_metron_hu_html.zip | 2007-03-24 02:59 | 145K | |
![[ ]](/icons/compressed.gif) | crosa_ricardo_a_vegitelet_gyermeke_hu_rtf_nncl2657-6bfv1.zip | 2007-03-24 02:59 | 145K | |
![[ ]](/icons/compressed.gif) | 05. V. Birodalom Visszavág.zip | 2007-03-26 19:01 | 145K | |
![[ ]](/icons/unknown.gif) | osszes47.ace | 2007-03-24 02:56 | 145K | |
![[ ]](/icons/compressed.gif) | may_karl_sziklafeszek_1_hu_rtf.zip | 2007-03-24 02:56 | 145K | |
![[ ]](/icons/compressed.gif) | fox_sylvan_a_kennedy_gyilkossag_hu_rtf_nncl2030-624v1.zip | 2007-03-24 03:00 | 144K | |
![[ ]](/icons/compressed.gif) | besson_thompson_hazibuli_hu_rtf.zip | 2007-03-24 02:58 | 144K | |
![[ ]](/icons/compressed.gif) | Vámpír könyvek - 04. A Vámpírok Hegye.zip | 2007-03-20 13:25 | 144K | |
![[ ]](/icons/compressed.gif) | atkins_p_w_teremtes_hu_doc.zip | 2007-03-24 02:58 | 144K | |
![[ ]](/icons/unknown.gif) | hobbit08.doc | 2007-03-24 02:54 | 144K | |
![[ ]](/icons/compressed.gif) | kaszas_istvan_a_felderito_hu_rtf.zip | 2007-03-24 02:56 | 144K | |
![[ ]](/icons/compressed.gif) | boll_heinrich_adam_hol_voltal_hu_rtf.zip | 2007-03-24 02:55 | 144K | |
![[ ]](/icons/compressed.gif) | Az elmult 2000 ev legfontosabb talalmanyai.zip | 2007-03-24 02:49 | 144K | |
![[ ]](/icons/compressed.gif) | illyes_gyula_kharon_ladikjan_html.zip | 2007-03-24 02:55 | 144K | |
![[ ]](/icons/compressed.gif) | g13.zip | 2007-08-04 14:25 | 144K | |
![[ ]](/icons/compressed.gif) | moldova_gyorgy_a_beszelo_diszno_html.zip | 2007-03-24 02:58 | 144K | |
![[ ]](/icons/unknown.gif) | A parazita.doc | 2007-04-15 16:44 | 144K | |
![[ ]](/icons/unknown.gif) | 07 - A kőfiak (Játéktechnikai megjegyzések).doc | 2007-03-24 02:54 | 144K | |
![[ ]](/icons/compressed.gif) | tasnadi_kubacska_andras_oriasok_birodalma_hu_rtf.zip | 2007-03-24 03:00 | 143K | |
![[ ]](/icons/compressed.gif) | szalay_lenke_mogyoro_kinovi_a_kabatjat_hu_doc_nncl3105-706v1.zip | 2007-03-24 03:00 | 143K | |
![[ ]](/icons/unknown.gif) | g049.ace | 2007-03-24 02:52 | 143K | |
![[ ]](/icons/compressed.gif) | Steve_Perry_A_ferfi_aki_sosem_hibaz.zip | 2007-03-24 03:00 | 143K | |
![[ ]](/icons/compressed.gif) | A Férfi Aki Sosem Hibáz.zip | 2006-05-31 08:57 | 143K | |
![[ ]](/icons/compressed.gif) | sikolyok.zip | 2007-08-04 15:11 | 143K | |
![[ ]](/icons/compressed.gif) | Ejszakai sikolyok-Horror antologia.zip | 2007-03-24 02:53 | 143K | |
![[TXT]](/icons/text.gif) | k02.html | 2007-11-14 08:47 | 143K | |
![[TXT]](/icons/text.gif) | Gyilkos_az_arnyekban.txt | 2007-03-24 02:54 | 143K | |
![[ ]](/icons/compressed.gif) | woodley_richard_tuzhanyo_hu_rtf.zip | 2007-03-24 02:59 | 143K | |
![[ ]](/icons/compressed.gif) | John Brunner - Teljes napfogyatkozas hu rtf.zip | 2006-05-10 06:52 | 143K | |
![[ ]](/icons/compressed.gif) | Frank M. Robinson - Az erö .zip | 2007-03-26 18:27 | 142K | |
![[ ]](/icons/compressed.gif) | beard_kenney_gyurukura_hu_rtf.zip | 2007-03-24 02:55 | 142K | |
![[ ]](/icons/compressed.gif) | forsyth_frederick_a_pasztor_hu_html.zip | 2007-03-24 02:54 | 142K | |
![[ ]](/icons/compressed.gif) | Clifford D Simak - Az emberfarkas-elv.zip | 2007-03-26 18:54 | 142K | |
![[ ]](/icons/compressed.gif) | Carasoni, J. Mrs. Chester margarétái.zip | 2007-03-23 05:08 | 142K | |
![[ ]](/icons/compressed.gif) | doyle_arthur_conan_a_berill_fejek_hu_html.zip | 2007-03-24 02:49 | 142K | |
![[ ]](/icons/compressed.gif) | Achilles Dent-A drogokat belovik ugye.zip | 2007-03-24 02:49 | 142K | |
![[ ]](/icons/compressed.gif) | hyman_mac_en_meg_az_ormester_hu_rtf.zip | 2007-03-24 02:53 | 142K | |
![[ ]](/icons/compressed.gif) | bloch_robert_pszicho_hu_rtf.zip | 2007-03-24 02:59 | 142K | |
![[ ]](/icons/compressed.gif) | Rejto Jeno - Bradley Tamas visszaut.doc.zip | 2007-03-24 02:59 | 142K | |
![[ ]](/icons/compressed.gif) | Mongol eredetmondak es mitoszok.zip | 2007-03-24 02:58 | 142K | |
![[ ]](/icons/compressed.gif) | beljajev_alekszandr_a_keteltu_ember_hu_doc_nncl3039-706v1.zip | 2007-03-24 02:49 | 142K | |
![[ ]](/icons/unknown.gif) | Helstáb legendák.rtf | 2005-07-07 10:28 | 142K | |
![[ ]](/icons/unknown.gif) | 3.DOC | 2007-11-14 08:46 | 142K | |
![[ ]](/icons/compressed.gif) | Pamela Lyndon Travers-A csodalatos Mary visszater.zip | 2007-03-24 02:58 | 142K | |
![[ ]](/icons/compressed.gif) | szep.zip | 2007-08-04 15:29 | 142K | |
![[ ]](/icons/compressed.gif) | bradbury_ray_szep_arany_almait_a_nap.zip | 2007-03-24 02:59 | 142K | |
![[ ]](/icons/compressed.gif) | Ray Bradbury - Szép arany almáit a Nap.zip | 2006-08-24 23:30 | 142K | |
![[ ]](/icons/compressed.gif) | berkesi_andras_az_ezredes_hu_rtf_nncl2340-667v2.zip | 2007-03-24 02:50 | 142K | |
![[ ]](/icons/layout.gif) | Magic skillek - Varázslók és mágiahasználók képességei.pdf | 2007-05-03 06:40 | 142K | |
![[ ]](/icons/compressed.gif) | Rejto Jeno - Az eloretolt helyorseg.txt.zip | 2007-03-24 02:59 | 142K | |
![[ ]](/icons/layout.gif) | Bevezetés - Bemutatkozik az Aréna.pdf | 2007-05-03 07:10 | 142K | |
![[ ]](/icons/compressed.gif) | esterhazy_peter_hrabal_konyve_html.zip | 2007-03-24 02:53 | 141K | |
![[ ]](/icons/compressed.gif) | moorcock_michael_a_fekete_folyoso.zip | 2007-03-24 02:57 | 141K | |
![[ ]](/icons/compressed.gif) | malamud_bernard_a_beszelo_lo_hu_doc_nncl1851-60av2.zip | 2007-03-24 02:50 | 141K | |
![[ ]](/icons/unknown.gif) | mukator.ace | 2007-03-24 02:52 | 141K | |
![[ ]](/icons/unknown.gif) | Szent Agoston elete 2 | 2007-03-24 03:00 | 141K | |
![[ ]](/icons/compressed.gif) | Rejto Jeno - Piszkos Fred, a kapitany.txt.zip | 2007-03-24 02:59 | 141K | |
![[ ]](/icons/compressed.gif) | shan_darren_a_verszipoly_hu_rtf.zip | 2007-03-24 02:52 | 141K | |
![[ ]](/icons/compressed.gif) | douglas_garry_hegylako_hu_txt.zip | 2007-03-24 02:54 | 141K | |
![[ ]](/icons/compressed.gif) | Shan, Darren - A verszipoly_hu_rtf.zip | 2006-05-28 03:50 | 141K | |
![[ ]](/icons/compressed.gif) | Nemere István - Kalózok az űrben.zip | 2007-03-26 17:42 | 141K | |
![[ ]](/icons/compressed.gif) | Lando Calrissian és 1. Sharu varázskulcsa.zip | 2007-03-26 19:02 | 141K | |
![[ ]](/icons/compressed.gif) | harrison_harry_rozsdamentes_acelpatkany_hu_rtf.zip | 2007-03-24 02:55 | 141K | |
![[ ]](/icons/compressed.gif) | Harry Harryson - Rozsdamentes_acelpatkany_hu_rtf.zip | 2006-05-18 01:06 | 141K | |
![[ ]](/icons/compressed.gif) | brett_simon_gyilkossag_nyilt_szinen_hu_rtf_nncl499-36bv1.zip | 2007-03-24 03:00 | 141K | |
![[ ]](/icons/unknown.gif) | 15 - Aquir ereklyék.doc | 2007-03-24 02:54 | 141K | |
![[ ]](/icons/compressed.gif) | Dino park-novellas kotet.zip | 2007-03-24 02:49 | 140K | |
![[ ]](/icons/compressed.gif) | spielberg_steven_harmadik_tipusu_talalkozasok.zip | 2007-03-24 03:00 | 140K | |
![[ ]](/icons/compressed.gif) | boulle_pierre_hid_a_kwai_folyon.zip | 2007-03-24 02:58 | 140K | |
![[ ]](/icons/compressed.gif) | Manyi_Laszlo_hova_tunt_dorman_professzor_agya_hu_html.zip | 2006-05-30 21:31 | 140K | |
![[ ]](/icons/unknown.gif) | osszes12.ace | 2007-03-24 02:56 | 140K | |
![[ ]](/icons/compressed.gif) | tine_robert_az_utolso_akciohos_hu_html.zip | 2007-03-24 03:00 | 140K | |
![[ ]](/icons/compressed.gif) | Thoward Dethlefsen-Asors mint esely.zip | 2007-03-24 03:00 | 140K | |
![[ ]](/icons/compressed.gif) | Fehér Klára - A Földrengések Szigete.zip | 2004-06-21 11:45 | 140K | |
![[ ]](/icons/compressed.gif) | steinbeck_john_kek_obol_rtf.zip | 2007-03-24 02:56 | 140K | |
![[ ]](/icons/compressed.gif) | steinbeck_john_kedves_csirkefogok_rtf.zip | 2007-03-24 02:56 | 140K | |
![[ ]](/icons/compressed.gif) | padisak_mihaly_kanoc_az_eletmuvesz_hu_doc_nncl3091-706v1.zip | 2007-03-24 02:58 | 139K | |
![[ ]](/icons/layout.gif) | A Sigil Kövek - Képességei és típusai.pdf | 2007-05-03 06:54 | 139K | |
![[ ]](/icons/compressed.gif) | Harry Harrison-urpestis.zip | 2007-03-24 02:55 | 139K | |
![[ ]](/icons/compressed.gif) | jokai_mor_emleksorok_1848-49-bol_html.zip | 2007-03-24 02:56 | 139K | |
![[ ]](/icons/compressed.gif) | krall_hanna_egy_lepessel_az_uristen_elott_hu_rtf.zip | 2007-03-24 02:55 | 139K | |
![[ ]](/icons/compressed.gif) | Zsoldos Péter - Ellenpont doc .zip | 2007-03-19 18:58 | 139K | |
![[ ]](/icons/compressed.gif) | kosztolanyi_dezso_szurke_gloria_rtf.zip | 2007-03-24 02:55 | 139K | |
![[ ]](/icons/compressed.gif) | shan_darren_a_vampir_inasa_hu_rtf.zip | 2007-03-24 02:52 | 139K | |
![[ ]](/icons/compressed.gif) | Shan, Darren - A vampir_inasa_hu_rtf.zip | 2006-05-28 03:49 | 139K | |
![[ ]](/icons/compressed.gif) | berkesi_andras_alkonydomb_hu_txt.zip | 2007-03-24 02:50 | 139K | |
![[ ]](/icons/unknown.gif) | 77.rtf | 2007-03-24 02:57 | 139K | |
![[ ]](/icons/compressed.gif) | fazekas_laszlo_villanto_hu_doc_nncl3052-706v1.zip | 2007-03-24 02:54 | 139K | |
![[ ]](/icons/compressed.gif) | petecki_bohdan_messier13.zip | 2006-05-28 02:44 | 139K | |
![[ ]](/icons/compressed.gif) | petecki_bohdan_messier_13.zip | 2007-03-24 02:52 | 139K | |
![[ ]](/icons/compressed.gif) | messier13.zip | 2006-08-24 22:54 | 139K | |
![[ ]](/icons/compressed.gif) | cheyney_peter_a_hamis_kotvenyek_hu_rtf_nncl536-371v2.zip | 2007-03-24 02:58 | 139K | |
![[ ]](/icons/compressed.gif) | Erich Lange-Metamorfozisok az allatvilagban.zip | 2007-03-24 02:53 | 138K | |
![[ ]](/icons/compressed.gif) | tamasi_aron_szulofoldem_html.zip | 2007-03-24 03:00 | 138K | |
![[ ]](/icons/unknown.gif) | xtype.ace | 2007-03-24 02:56 | 138K | |
![[ ]](/icons/layout.gif) | Küldetések - Végigjátszás GreenFox tollából.pdf | 2007-05-03 07:14 | 138K | |
![[ ]](/icons/compressed.gif) | lll_a_lap_liderce.zip | 2007-03-20 00:16 | 138K | |
![[ ]](/icons/compressed.gif) | verne_jules_veres_drama_livoniaban_rtf.zip | 2007-03-24 02:56 | 138K | |
![[ ]](/icons/compressed.gif) | chase_james_hadley_aranyhal_hu_rtf.zip | 2007-03-24 02:55 | 138K | |
![[ ]](/icons/compressed.gif) | balzac_honore_de_az_elegans_elet_fiziologiaja_rtf.zip | 2007-03-24 02:55 | 138K | |
![[ ]](/icons/compressed.gif) | Samanizmus-Dioszegi Vilmos.zip | 2007-03-24 02:53 | 138K | |
![[ ]](/icons/compressed.gif) | roshwald_mordecai_a_hetedik_szint_hu_rtf_nncl2667-6c2v1.zip | 2007-03-24 02:58 | 138K | |
![[ ]](/icons/compressed.gif) | fulghum_robert_mar_langolt_amikor_rafekudtem_hu_doc_nncl2500-692v1.zip | 2007-03-24 02:59 | 138K | |
![[ ]](/icons/compressed.gif) | voldan_jan_egy_ur_az_y_ugyosztalyrol_hu_rtf.zip | 2007-03-24 02:56 | 138K | |
![[ ]](/icons/compressed.gif) | Fodor Sandor-Csipike.zip | 2007-03-24 02:54 | 138K | |
![[ ]](/icons/compressed.gif) | tolsztoj_aelita_rtf.zip | 2007-03-24 02:57 | 138K | |
![[ ]](/icons/compressed.gif) | nogradi_gabor_hecseki_es_a_gyermekrablok_hu_doc_nncl3083-706v1.zip | 2007-03-24 02:58 | 138K | |
![[ ]](/icons/compressed.gif) | wells_h_g_a_lathatatlan_ember_rtf.zip | 2007-03-24 02:55 | 138K | |
![[ ]](/icons/layout.gif) | Megérteni az Őrületet - (Understanding Madness).pdf | 2007-05-03 07:36 | 138K | |
![[ ]](/icons/compressed.gif) | figuli_margita_harom_gesztenyepej_hu_rtf_nncl419-33av1.zip | 2007-03-24 02:57 | 137K | |
![[ ]](/icons/compressed.gif) | Barta Ferenc Ace F. Rebrant sci-fi novellái .zip | 2007-03-21 19:20 | 137K | |
![[ ]](/icons/unknown.gif) | Kurt Vonnegut-Mesterlovesz | 2007-03-24 02:57 | 137K | |
![[ ]](/icons/compressed.gif) | Anatole France-Thaisz.zip | 2007-03-24 02:49 | 137K | |
![[ ]](/icons/compressed.gif) | wallace_edgar_a_biro_vetke_hu_rtf.zip | 2007-03-24 02:53 | 137K | |
![[ ]](/icons/compressed.gif) | van_vogt_a_e_kuldetes_a_csillagokhoz_hu_html.zip | 2007-03-24 02:49 | 137K | |
![[ ]](/icons/compressed.gif) | Fredric Brown - Marslakók mars haza.zip | 2007-03-22 17:44 | 137K | |
![[ ]](/icons/compressed.gif) | Nemere István - Az utolsó bolygó.zip | 2007-03-26 17:42 | 137K | |
![[ ]](/icons/compressed.gif) | faludy_gyorgy_villon_balladai_html.zip | 2007-03-24 02:55 | 137K | |
![[ ]](/icons/compressed.gif) | brackett_leigh_rhiannon_kardja_hu_rtf.zip | 2007-03-24 02:57 | 137K | |
![[ ]](/icons/compressed.gif) | porter_roy_ver_es_virtus_hu_rtf.zip | 2007-03-24 03:00 | 137K | |
![[ ]](/icons/compressed.gif) | exbrayat_charles_gyulolet_hu_rtf_nncl2227-64bv1.zip | 2007-03-24 02:52 | 137K | |
![[ ]](/icons/compressed.gif) | ball_john_forro_ejszaka_hu_rtf.zip | 2007-03-24 02:56 | 137K | |
![[ ]](/icons/compressed.gif) | Rejto Jeno - A tizennegy karatos auto.txt.zip | 2007-03-24 02:59 | 136K | |
![[ ]](/icons/compressed.gif) | Honore de Balzac-Az elegans elet filozofiaja.zip | 2007-03-24 02:55 | 136K | |
![[ ]](/icons/compressed.gif) | boulle_pierre_a_dzsungel_harcosai.zip | 2007-03-24 02:58 | 136K | |
![[ ]](/icons/unknown.gif) | g013.ace | 2007-03-24 02:52 | 136K | |
![[ ]](/icons/compressed.gif) | obrien_flann_a_faba_szorult_fereg_hu_rtf.zip | 2007-03-24 02:54 | 136K | |
![[ ]](/icons/compressed.gif) | Joe Alex-Magam vagyok a pokol.zip | 2007-03-24 02:56 | 136K | |
![[ ]](/icons/compressed.gif) | bilenkin_dmitrij_lecke_a_relativitasbol_hu_doc.zip | 2007-03-24 02:53 | 136K | |
![[ ]](/icons/compressed.gif) | Bilenkin, Dmitrij -Lecke a relativitasbol hu doc.zip | 2005-12-12 12:05 | 136K | |
![[ ]](/icons/compressed.gif) | sternhagen_kyle_predator.zip | 2007-03-24 02:57 | 136K | |
![[ ]](/icons/compressed.gif) | Ellenpont.zip | 2007-03-24 03:01 | 136K | |
![[ ]](/icons/unknown.gif) | podol.ace | 2007-03-24 02:52 | 136K | |
![[ ]](/icons/compressed.gif) | bioy_casares_adolfo_morel_talalmanya_hu_doc_nncl2521-696v1.zip | 2007-03-24 02:49 | 136K | |
![[ ]](/icons/compressed.gif) | hegedus_geza_a_meneskuti_csaladirtas_hu_rtf.zip | 2007-03-24 02:55 | 136K | |
![[ ]](/icons/compressed.gif) | zsoldos_peter_ellenpont.zip | 2007-03-24 03:01 | 136K | |
![[ ]](/icons/compressed.gif) | kosa_csaba_poganyko_hu_rtf.zip | 2007-03-24 02:56 | 136K | |
![[ ]](/icons/compressed.gif) | ronaszegi_miklos_gezenguzok_az_alpok_aljan_hu_doc_nncl3102-706v1.zip | 2007-03-24 03:00 | 136K | |
![[ ]](/icons/compressed.gif) | Jack Vance - Haldokló Föld.zip | 2007-03-26 19:32 | 136K | |
![[ ]](/icons/compressed.gif) | Herbert W. Franke - Elbeszélések2.zip | 2007-03-26 14:55 | 136K | |
![[ ]](/icons/unknown.gif) | 04 - A hosszúéletűek (Kasztok).doc | 2007-03-24 02:54 | 136K | |
![[ ]](/icons/compressed.gif) | Kee Kana Loo-Javatol keletre.zip | 2007-03-24 02:54 | 135K | |
![[ ]](/icons/compressed.gif) | konsztantyinovszkij_david_az_ido_fogva_tart_hu_rtf.zip | 2007-03-24 02:52 | 135K | |
![[ ]](/icons/compressed.gif) | a_jedi_hatalma.zip | 2007-03-24 02:54 | 135K | |
![[ ]](/icons/compressed.gif) | tine_robert_virus_hu_rtf.zip | 2007-03-24 03:00 | 135K | |
![[ ]](/icons/compressed.gif) | molnar_ferenc_a_pal_utcai_fiuk.zip | 2007-03-24 02:58 | 135K | |
![[ ]](/icons/layout.gif) | Küldetések - Végigjátszás Csomakk tollából.pdf | 2007-05-03 07:14 | 135K | |
![[ ]](/icons/compressed.gif) | Vámpír könyvek - 06. A vámpír herceg.zip | 2007-03-20 13:25 | 135K | |
![[ ]](/icons/compressed.gif) | zsoldos_peter_a_feladat.zip | 2007-03-24 03:01 | 135K | |
![[ ]](/icons/compressed.gif) | Zsoldos Péter - A Feladat.zip | 2006-08-24 22:07 | 135K | |
![[ ]](/icons/compressed.gif) | lengyel_jozsef_fegyverhordo_ndolo_naploja_hu_doc.zip | 2007-03-24 02:57 | 135K | |
![[ ]](/icons/unknown.gif) | QUARK fantasztikus fuzet 1 | 2007-03-24 02:58 | 135K | |
![[ ]](/icons/compressed.gif) | Fekete Jozsef novellai.zip | 2007-03-24 02:54 | 135K | |
![[ ]](/icons/compressed.gif) | Charles Dickens-Karacsonyi Enek.zip | 2007-03-24 02:52 | 135K | |
![[ ]](/icons/compressed.gif) | Vámpír könyvek - 02. A vámpír inasa.zip | 2007-03-20 13:25 | 134K | |
![[ ]](/icons/compressed.gif) | harrison_harry_halalvilag_2_hu_rtf.zip | 2007-03-24 02:55 | 134K | |
![[ ]](/icons/compressed.gif) | sheckley_robert_a_statuscivilizacio_hu_html.zip | 2007-03-24 02:59 | 134K | |
![[ ]](/icons/compressed.gif) | Robert Sheckley - A statuscivilizacio_hu_html.zip | 2006-05-28 03:52 | 134K | |
![[ ]](/icons/compressed.gif) | mccay_bill_lazadas_hu_html.zip | 2007-03-24 12:37 | 134K | |
![[ ]](/icons/compressed.gif) | Mccay, Bill - lazadas_hu_html.zip | 2006-05-28 02:14 | 134K | |
![[ ]](/icons/compressed.gif) | webster_malcolm_a_jedi_hatalma_hu_rtf.zip | 2007-03-24 02:57 | 134K | |
![[ ]](/icons/compressed.gif) | sheenard_anthony_ket_tuz kozott_halaloszto_2029_hu_rtf_nncl2006-61fv1.zip | 2007-03-24 02:49 | 134K | |
![[ ]](/icons/compressed.gif) | Czako Gabor-Banga Ferenc-Hetvenhet magyar remmese.zip | 2007-03-24 02:52 | 134K | |
![[ ]](/icons/compressed.gif) | auster_paul_a_vegso_dolgok_orszagaban_hu_rtf.zip | 2007-03-24 02:58 | 134K | |
![[ ]](/icons/compressed.gif) | roddenberry_gene_csillagosveny_hu_rtf_nncl2215-648v1.zip | 2007-03-24 02:54 | 134K | |
![[ ]](/icons/unknown.gif) | hobbit07.doc | 2007-03-24 02:54 | 134K | |
![[ ]](/icons/compressed.gif) | Vámpír könyvek - 03. A vérszipoly.zip | 2007-03-20 13:25 | 134K | |
![[ ]](/icons/compressed.gif) | Dashiell Hammett-A cingar feltalalo.zip | 2007-03-24 02:52 | 134K | |
![[ ]](/icons/compressed.gif) | verne_jules_a_chancellor_rtf.zip | 2007-03-24 02:56 | 134K | |
![[ ]](/icons/compressed.gif) | Stefan Zweig-Almok.zip | 2007-03-24 03:00 | 134K | |
![[ ]](/icons/compressed.gif) | Stone, Jeffrey - Az ej_kardja_hu_rtf.zip | 2006-05-28 04:11 | 134K | |
![[TXT]](/icons/text.gif) | Ezüst pisztolygolyók.htm | 2007-03-24 03:00 | 134K | |
![[ ]](/icons/compressed.gif) | vivian_e_charles_robin_hood_hu_rtf.zip | 2007-03-24 02:53 | 134K | |
![[ ]](/icons/compressed.gif) | lau_evelyn_friss_hus_hu_rtf_nncl2860-6efv1.zip | 2007-03-24 02:53 | 133K | |
![[ ]](/icons/compressed.gif) | Boulle, Pierre - A majmok bolygója.zip | 2007-03-22 10:13 | 133K | |
![[ ]](/icons/layout.gif) | Oblivion Textúrázás.pdf | 2007-05-03 06:58 | 133K | |
![[ ]](/icons/compressed.gif) | boulle_pierre_a_majmok_bolygoja.zip | 2007-03-24 02:58 | 133K | |
![[ ]](/icons/compressed.gif) | Jean-Paul Rouland-Claude Oliver-BAJOS HEKUS.zip | 2007-03-24 02:56 | 133K | |
![[ ]](/icons/compressed.gif) | ady_endre_novellak.zip | 2007-03-24 02:55 | 133K | |
![[ ]](/icons/compressed.gif) | nogradi_gabor_a_mi_kinizsink_hu_doc_nncl3082-706v1.zip | 2007-03-24 02:58 | 133K | |
![[ ]](/icons/compressed.gif) | rouland_olivier_bajos_hekus_hu_rtf.zip | 2007-03-24 02:56 | 133K | |
![[ ]](/icons/compressed.gif) | Rejto Jeno - Az elveszett cirkalo.doc.zip | 2007-03-24 02:59 | 133K | |
![[ ]](/icons/compressed.gif) | Kristo Tibor-Ego eden.zip | 2007-03-24 02:56 | 133K | |
![[ ]](/icons/unknown.gif) | 02 - Wayne Chapman - Toroni vér.doc | 2007-03-24 02:54 | 133K | |
![[ ]](/icons/compressed.gif) | Ace F Rebrant-Sci-fi novellak.zip | 2007-03-24 02:49 | 133K | |
![[ ]](/icons/compressed.gif) | Rejto Jeno - A pokol zsoldosai.txt.zip | 2007-03-24 02:59 | 133K | |
![[ ]](/icons/compressed.gif) | naha_ed_szellemirtok_2_hu_rtf.zip | 2007-03-24 02:58 | 133K | |
![[ ]](/icons/unknown.gif) | hobbit01.doc | 2007-03-24 02:54 | 133K | |
![[ ]](/icons/compressed.gif) | Adam Kennedy-A domino-elv.zip | 2007-03-24 02:49 | 132K | |
![[ ]](/icons/compressed.gif) | Illyes Gyula-Kharon ladikajan.zip | 2007-03-24 02:55 | 132K | |
![[ ]](/icons/compressed.gif) | frost_scott_dale_cooper_naploja_hu_rtf.zip | 2007-03-24 03:00 | 132K | |
![[ ]](/icons/compressed.gif) | girdo_e_a deli sark aranya_hu_rtf.zip | 2007-03-24 02:53 | 132K | |
![[ ]](/icons/compressed.gif) | kennedy_adam_a_domino_elv_hu_rtf.zip | 2007-03-24 02:49 | 132K | |
![[ ]](/icons/compressed.gif) | fontane_theodor_stine_hu_doc_nncl2633-6b9v1.zip | 2007-03-24 03:00 | 132K | |
![[ ]](/icons/compressed.gif) | Stone, Jeffrey - A hajnal_lovagja_hu_rtf.zip | 2006-05-28 04:07 | 132K | |
![[ ]](/icons/layout.gif) | worluk_vilagterkepe.pdf | 2007-03-24 02:54 | 132K | |
![[ ]](/icons/compressed.gif) | kertesz_imre_a_nyomkereso_html.zip | 2007-03-24 02:56 | 132K | |
![[ ]](/icons/compressed.gif) | sethfield_christopher_vervoros_hajnal_hu_rtf_nncl2180-63fv1.zip | 2007-03-24 03:00 | 132K | |
![[ ]](/icons/compressed.gif) | exbrayat_charles_remulet_az_ovarosban_hu_rtf_nncl1914-614v2.zip | 2007-03-24 02:52 | 132K | |
![[ ]](/icons/compressed.gif) | Rejto Jeno - Tigrisver.doc.zip | 2007-03-24 02:59 | 132K | |
![[ ]](/icons/compressed.gif) | nemere_istvan_tul_a_pluton_hu_txt.zip | 2007-03-24 02:58 | 132K | |
![[ ]](/icons/compressed.gif) | jokai_mor_a_feher_rozsa_html.zip | 2007-03-24 02:56 | 132K | |
![[ ]](/icons/compressed.gif) | sztrugackij_a_b_egymilliard_evvel_a_vilagvege_elott_hu_rtf.zip | 2007-03-24 02:49 | 132K | |
![[ ]](/icons/compressed.gif) | Sztrugackij, Arkagyij és Borisz - Egymilliard_evvel_a_vilagvege_elott.zip | 2006-05-10 06:44 | 132K | |
![[ ]](/icons/compressed.gif) | Philip José Farmer - Fenevadak hu rtf.zip | 2007-02-21 16:06 | 132K | |
![[ ]](/icons/compressed.gif) | budrys_algis_ki_vagy_hu_rtf_nncl3189-711v1.zip | 2007-03-24 02:49 | 131K | |
![[ ]](/icons/compressed.gif) | zebrowski_george_a_vegso_pont_hu_rtf.zip | 2007-03-24 02:54 | 131K | |
![[ ]](/icons/unknown.gif) | Raina Maria Rilke-Tortenetek a Joistenrol | 2007-03-24 02:58 | 131K | |
![[ ]](/icons/unknown.gif) | 05 - Jan van den Boomen - Üstökösláng.doc | 2007-03-24 02:54 | 131K | |
![[ ]](/icons/compressed.gif) | Merle - Ket nap az elet.zip | 2005-06-09 13:57 | 131K | |
![[ ]](/icons/compressed.gif) | duvic_patrice_vegallomas_hu_rtf.zip | 2007-03-24 02:58 | 131K | |
![[ ]](/icons/compressed.gif) | jokai_mor_egy_bujdoso_naploja_html.zip | 2007-03-24 02:56 | 131K | |
![[ ]](/icons/compressed.gif) | balint_agnes_az_elvarazsolt_egerkisasszony_hu_doc.zip | 2007-03-24 02:52 | 131K | |
![[ ]](/icons/compressed.gif) | J Castle-A Hailey-Remulet a levegoben.zip | 2007-03-24 02:49 | 131K | |
![[ ]](/icons/compressed.gif) | barsocchini_peter_mission_impossible.zip | 2007-03-24 02:50 | 130K | |
![[ ]](/icons/compressed.gif) | castle_hailey_remulet_a_levegoben_hu_rtf.zip | 2007-03-24 02:56 | 130K | |
![[ ]](/icons/layout.gif) | Szörny mini guide - Lények, akik az életünkre törhetnek.pdf | 2007-05-03 06:53 | 130K | |
![[ ]](/icons/compressed.gif) | Rejto Jeno - A harom testor Afrikaban.txt.zip | 2007-03-24 02:59 | 130K | |
![[ ]](/icons/compressed.gif) | vonnegut_kurt_mesterlovesz.zip | 2007-03-24 02:57 | 130K | |
![[ ]](/icons/compressed.gif) | Kurt Vonnegut - Mesterlovesz.zip | 2007-02-21 16:09 | 130K | |
![[ ]](/icons/compressed.gif) | kastner_erich_harom_ember_a_hoban_hu_rtf_nncl2256-651v2.zip | 2007-03-24 02:53 | 130K | |
![[TXT]](/icons/text.gif) | k05.html | 2007-11-14 08:47 | 130K | |
![[ ]](/icons/compressed.gif) | harrison_harry_halalvilag_3_hu_rtf.zip | 2007-03-24 02:55 | 130K | |
![[ ]](/icons/compressed.gif) | Sebestyen Gyula-A leanyok neveleserol.zip | 2007-03-24 03:00 | 129K | |
![[ ]](/icons/compressed.gif) | térbeli hallás.zip | 2007-03-24 03:01 | 129K | |
![[ ]](/icons/compressed.gif) | thompson_c_a_bolingbroke_kastely_kisertete_hu_rtf.zip | 2007-03-24 02:52 | 129K | |
![[ ]](/icons/compressed.gif) | nostlinger_christine_konzerv_konrad_hu_doc_nncl3085-706v1.zip | 2007-03-24 02:52 | 129K | |
![[ ]](/icons/compressed.gif) | comenius_johannes_amos_a_vilag_utvesztoje_hu_rtf_nncl2695-6c6v1.zip | 2007-03-24 02:56 | 129K | |
![[ ]](/icons/compressed.gif) | dane_tibor_negy_tenger_hajosa_hu_rtf.zip | 2007-03-24 02:52 | 129K | |
![[ ]](/icons/compressed.gif) | balzac_honore_de_elegans_elet_html.zip | 2007-03-24 02:55 | 129K | |
![[TXT]](/icons/text.gif) | EZER1_03.HTM | 2007-03-24 02:57 | 129K | |
![[ ]](/icons/compressed.gif) | cain_james_m_a_postas_mindig_ketszer_csenget_hu_rtf.zip | 2007-03-24 02:55 | 129K | |
![[ ]](/icons/unknown.gif) | 10 - A farkas-szellem gyermekei (Mágia).doc | 2007-03-24 02:54 | 129K | |
![[ ]](/icons/compressed.gif) | gion_nandor_testverem_joab_hu_rtf.zip | 2007-03-24 02:55 | 128K | |
![[ ]](/icons/compressed.gif) | Rejto Jeno - Texas Bill, a fenegyerek.doc.zip | 2007-03-24 02:59 | 128K | |
![[ ]](/icons/compressed.gif) | shan_darren_a_vampir_herceg.zip | 2007-03-24 02:52 | 128K | |
![[ ]](/icons/compressed.gif) | hoff_benjamin_micimacko_es_a_tao_hu_rtf.zip | 2007-03-24 02:50 | 128K | |
![[ ]](/icons/compressed.gif) | nostlinger_christine_orarend_randevuval_hu_doc_nncl3086-706v1.zip | 2007-03-24 02:52 | 128K | |
![[ ]](/icons/compressed.gif) | kosztolanyi_dezso_pacsirta_rtf.zip | 2007-03-24 02:55 | 128K | |
![[ ]](/icons/compressed.gif) | Manfred Kyber-A kis Veronika harom lampasa.zip | 2007-03-24 02:57 | 128K | |
![[ ]](/icons/compressed.gif) | Karel Capek-Abszolutum-gyar.zip | 2007-03-24 02:56 | 128K | |
![[ ]](/icons/compressed.gif) | Rejto Jeno - A lathatatlan legio.txt.zip | 2007-03-24 02:59 | 128K | |
![[ ]](/icons/compressed.gif) | Leigh Bracket - Rhiannon kardja.zip | 2007-03-22 10:16 | 128K | |
![[IMG]](/icons/image2.gif) | feist_raymond_e_rho3_krondor_az _istenek_konnye.JPG | 2007-03-24 02:54 | 128K | |
![[ ]](/icons/compressed.gif) | Sigmund Freud-Pszihoanalizis.zip | 2007-03-24 03:00 | 128K | |
![[TXT]](/icons/text.gif) | 25.txt | 2007-11-14 02:23 | 127K | |
![[ ]](/icons/compressed.gif) | keegan_josh_anthico_hu_txt.zip | 2006-05-18 04:55 | 127K | |
![[ ]](/icons/unknown.gif) | 01 - Alan O'Connor - Homályhozó.doc | 2007-03-24 02:54 | 127K | |
![[ ]](/icons/compressed.gif) | Heltai Gaspar-Szaz fabula.zip | 2007-03-24 02:57 | 127K | |
![[ ]](/icons/compressed.gif) | esterhazy_peter_fuggo_html.zip | 2007-03-24 02:53 | 127K | |
![[ ]](/icons/unknown.gif) | osszes49.ace | 2007-03-24 02:56 | 127K | |
![[ ]](/icons/compressed.gif) | twain_mark_a_lovatett_varos_rtf.zip | 2007-03-24 02:57 | 127K | |
![[ ]](/icons/compressed.gif) | Rejto Jeno - A Nema Revolverek Varosa.txt.zip | 2007-03-24 02:59 | 127K | |
![[ ]](/icons/compressed.gif) | ABu BARK IBN TUFAJL-A termeszetes ember.zip | 2007-03-24 02:53 | 127K | |
![[ ]](/icons/layout.gif) | Általános infók - Bemutatkozik a Mágusok Céhe.pdf | 2007-05-03 07:08 | 127K | |
![[ ]](/icons/compressed.gif) | feval_paul_a_fekete_brigad_hu_rtf.zip | 2007-03-24 02:58 | 127K | |
![[ ]](/icons/unknown.gif) | Mikrohullámú szakácskönyv2.doc | 2007-03-24 02:59 | 127K | |
![[ ]](/icons/unknown.gif) | A pokol zsoldosai .ace | 2007-03-24 02:59 | 126K | |
![[ ]](/icons/compressed.gif) | Karinthy Frigyes-Betegek es bolondok.zip | 2007-03-24 02:56 | 126K | |
![[ ]](/icons/compressed.gif) | Fabri Peter-Titkos konyv.zip | 2007-03-24 02:54 | 126K | |
![[ ]](/icons/layout.gif) | Lélekvadászat - avagy hogyan zárjuk kövekbe a lelkeket.pdf | 2007-05-03 06:55 | 126K | |
![[ ]](/icons/compressed.gif) | Hal Clement-Csillagfeny.zip | 2007-03-24 02:55 | 126K | |
![[ ]](/icons/compressed.gif) | Neale Donald Walsch-A gazdasagrol.zip | 2007-03-24 02:58 | 126K | |
![[ ]](/icons/compressed.gif) | Terry Prachett - Az elveszett próféciák.zip | 2007-03-26 18:20 | 126K | |
![[ ]](/icons/compressed.gif) | verne_jules_az_uj_hazaban_rtf.zip | 2007-03-24 02:56 | 126K | |
![[ ]](/icons/compressed.gif) | Arthur e Powell-Kauzalis test.zip | 2007-03-24 02:49 | 126K | |
![[ ]](/icons/compressed.gif) | tamasi_aron_magyari_rozsafa_html.zip | 2007-03-24 03:00 | 126K | |
![[ ]](/icons/compressed.gif) | doyle_arthur_conan_a_berill_fejek_rtf.zip | 2007-03-24 02:49 | 126K | |
![[ ]](/icons/compressed.gif) | Hegedus Geza- Az erdontuli veszedelem.zip | 2007-03-24 02:55 | 126K | |
![[ ]](/icons/compressed.gif) | hegedus_geza_az_erdontuli_veszedelem_hu_rtf.zip | 2007-03-24 02:55 | 126K | |
![[ ]](/icons/compressed.gif) | bach_richard_illuziok_hu_doc_nncl2585-6aav1.zip | 2007-03-24 02:59 | 126K | |
![[ ]](/icons/unknown.gif) | urania.ace | 2007-03-24 02:57 | 126K | |
![[ ]](/icons/unknown.gif) | 04 - Jan van den Boomen - Az idők peremén.doc | 2007-03-24 02:54 | 126K | |
![[TXT]](/icons/text.gif) | A golyoallo kisertet.htm | 2007-03-24 02:58 | 125K | |
![[ ]](/icons/compressed.gif) | padisak_mihaly_gyalog_juli_hu_doc_nncl3090-706v1.zip | 2007-03-24 02:58 | 125K | |
![[ ]](/icons/compressed.gif) | Vassy Zoltan-Schorodingerek macskaja es mas tortenetek.zip | 2007-03-24 03:01 | 125K | |
![[ ]](/icons/unknown.gif) | Az utolsó szó jogán.ace | 2007-03-24 02:59 | 125K | |
![[ ]](/icons/compressed.gif) | shaw_g_b_szent_johanna_hu_txt.zip | 2007-03-24 02:54 | 125K | |
![[ ]](/icons/compressed.gif) | DZSATAKAK-Buddhista szuletesregek.zip | 2007-03-24 02:53 | 125K | |
![[ ]](/icons/compressed.gif) | travers_p_l_a_csudalatos_mary_kinyitja_az_ajtot_hu_doc_nncl3115-706v1.zip | 2007-03-24 02:58 | 125K | |
![[ ]](/icons/unknown.gif) | Es_s 'vszak.doc | 2004-12-29 12:39 | 125K | |
![[ ]](/icons/compressed.gif) | jokai_mor_utazas_egy_sirdomb_korul_html.zip | 2007-03-24 02:56 | 124K | |
![[ ]](/icons/compressed.gif) | sethfield_christopher_a_gepisten_tevedese_hu_rtf_nncl2712_6cbv1.zip | 2007-03-24 03:00 | 124K | |
![[TXT]](/icons/text.gif) | Horváték.HTM | 2007-03-24 02:52 | 124K | |
![[ ]](/icons/unknown.gif) | bajnokok.rtf | 2007-04-15 13:50 | 124K | |
![[ ]](/icons/compressed.gif) | Rejto Jeno - A szoke ciklon.txt.zip | 2007-03-24 02:59 | 124K | |
![[ ]](/icons/compressed.gif) | arany_laszlo_magyar_nepmesek_rtf.zip | 2007-03-24 02:55 | 124K | |
![[ ]](/icons/compressed.gif) | hoch_edward_d_lidercek_nyomaban_hu_rtf_nncl2811-6e1v1.zip | 2007-03-24 02:53 | 124K | |
![[TXT]](/icons/text.gif) | k03.html | 2007-11-14 08:47 | 124K | |
![[VID]](/icons/movie.gif) | moldova.ace | 2007-03-24 02:52 | 124K | |
![[ ]](/icons/unknown.gif) | 04 - Juhász Viktor - A hősök hazatérnek.doc | 2007-03-24 02:54 | 124K | |
![[ ]](/icons/compressed.gif) | fekete_istvan_regi_karacsony_elbeszelesek_hu_rtf_nncl2226-64bv1.zip | 2007-03-24 02:57 | 124K | |
![[ ]](/icons/compressed.gif) | tolsztoj_hadzsi_murat_rtf.zip | 2007-03-24 02:57 | 124K | |
![[ ]](/icons/unknown.gif) | Joan D Vinge and Vernon Vinge - A vándorkereskedő meg a segédje.rtf | 2006-07-19 16:24 | 124K | |
![[ ]](/icons/compressed.gif) | moricz_zsigmond_kivilagos_virradatig_rtf.zip | 2007-03-24 02:58 | 123K | |
![[ ]](/icons/compressed.gif) | london_jack_orszaguton_hu_rtf.zip | 2007-03-24 02:55 | 123K | |
![[ ]](/icons/compressed.gif) | Harry Harryson - Ürpestis.txt.zip | 2007-02-21 16:36 | 123K | |
![[ ]](/icons/compressed.gif) | jokai_mor_trenk_frigyes_html.zip | 2007-03-24 02:56 | 123K | |
![[ ]](/icons/compressed.gif) | harrison_harry_urpestis.txt.zip | 2007-03-24 02:55 | 123K | |
![[ ]](/icons/compressed.gif) | Harry_Harrison-A rozsdamentes_acelpatkany_teged_akar.zip | 2007-02-21 16:15 | 123K | |
![[ ]](/icons/compressed.gif) | Rejto Jeno - Az ellopott futar.txt.zip | 2007-03-24 02:59 | 123K | |
![[ ]](/icons/compressed.gif) | harrison_harry_a_rozsdamentes_acelpatkany_teged_akar.zip | 2007-03-24 02:55 | 123K | |
![[ ]](/icons/compressed.gif) | Harry Harryson - A rozsdamentes_acelpatkany_teged_akar.zip | 2006-05-31 06:12 | 123K | |
![[ ]](/icons/compressed.gif) | Bicskei Gabor-Ott a helyed Joe.zip | 2007-03-24 02:51 | 123K | |
![[ ]](/icons/compressed.gif) | thompson_e_halalfejes lovas_hu_rtf.zip | 2007-03-24 02:53 | 122K | |
![[ ]](/icons/compressed.gif) | krudy_gyula_rozsa_sandor_hu_rtf.zip | 2007-03-24 02:56 | 122K | |
![[ ]](/icons/compressed.gif) | Jack London-Orszaguton.zip | 2007-03-24 02:55 | 122K | |
![[ ]](/icons/compressed.gif) | kastner_erich_emil_es_a_harom_iker_hu_doc_nncl3067-706v1.zip | 2007-03-24 02:53 | 122K | |
![[ ]](/icons/compressed.gif) | Nemere István - Műkincsrablók a kisbolygón.zip | 2007-03-26 17:42 | 122K | |
![[ ]](/icons/compressed.gif) | moldova_gyorgy_a_torveny_szolgaja_es_egyeb_tortenetek_html.zip | 2007-03-24 02:58 | 122K | |
![[ ]](/icons/unknown.gif) | orulet.ace | 2007-03-24 02:52 | 122K | |
![[ ]](/icons/compressed.gif) | DIDEROT-Az apaca.zip | 2007-03-24 02:52 | 122K | |
![[ ]](/icons/compressed.gif) | davids_paul_es_hollace_darth_vader_kesztyuje_hu_rtf.zip | 2007-03-24 02:54 | 122K | |
![[ ]](/icons/compressed.gif) | davids_paul_es_hollace_darth_vader_kesztyuje_hu_rtf(1).zip | 2006-05-10 07:02 | 122K | |
![[ ]](/icons/compressed.gif) | darth_vader_kesztyuje.zip | 2007-03-24 02:54 | 122K | |
![[ ]](/icons/compressed.gif) | Robert Sheckley - A státuscivilizáció.zip | 2007-03-26 18:47 | 122K | |
![[ ]](/icons/compressed.gif) | vonnegut_kurt_ej_anyank_hu_html.zip | 2007-03-24 02:57 | 121K | |
![[ ]](/icons/compressed.gif) | sethfield_christopher_rajtautes_halaloszto_2029_hu_doc.zip | 2007-03-24 03:00 | 121K | |
![[ ]](/icons/compressed.gif) | feher_klara_negyen_meg_a_beka_hu_doc_nncl3054-706v1.zip | 2007-03-24 02:54 | 121K | |
![[ ]](/icons/compressed.gif) | Magyarorszag leveltarai-Katalogus.zip | 2007-03-24 02:57 | 121K | |
![[ ]](/icons/compressed.gif) | Tamasi Aron-Szirom s Boly.zip | 2007-03-24 02:55 | 121K | |
![[ ]](/icons/compressed.gif) | Pierre Barbet - A psziborgok álmai.zip | 2007-03-21 19:18 | 121K | |
![[ ]](/icons/compressed.gif) | gray_david_worluk_atka_hu_rtf_nncl1424-50ev3.zip | 2007-03-24 02:52 | 121K | |
![[ ]](/icons/compressed.gif) | Rejto Jeno - A megkerult cirkalo.doc.zip | 2007-03-24 02:59 | 121K | |
![[ ]](/icons/compressed.gif) | calvino_italo_lathatatlan_varosok_hu_rtf_nncl2520-696v1.zip | 2007-03-24 02:55 | 121K | |
![[ ]](/icons/compressed.gif) | utolsoszo.zip | 2007-08-04 14:33 | 121K | |
![[ ]](/icons/compressed.gif) | milne_a_a_micimacko_kuckoja_html.zip | 2007-03-24 02:49 | 121K | |
![[ ]](/icons/layout.gif) | Alkimista tanfolyam - Mert főzőcskézni megéri Cyrodiilban is.pdf | 2007-05-03 06:51 | 121K | |
![[ ]](/icons/unknown.gif) | osszes18.ace | 2007-03-24 02:56 | 121K | |
![[ ]](/icons/compressed.gif) | komoroczy_geza_mezopotamia_tortenete.zip | 2007-03-24 02:56 | 121K | |
![[ ]](/icons/compressed.gif) | Utazás a koponyám körül.zip | 2007-03-24 02:56 | 121K | |
![[ ]](/icons/compressed.gif) | esterhazy_peter_ki_szavatol_a_lady_biztonsagaert_html.zip | 2007-03-24 02:53 | 121K | |
![[ ]](/icons/unknown.gif) | 2003.06.21.doc | 2007-03-24 02:53 | 121K | |
![[ ]](/icons/unknown.gif) | 01 - W Hamilton Green - Kőbúvár.doc | 2007-03-24 02:54 | 121K | |
![[ ]](/icons/compressed.gif) | hamvas_bela_henoch_apokalypsise_hu_html.zip | 2007-03-24 02:55 | 120K | |
![[ ]](/icons/compressed.gif) | Hamvas Bela_henoch_apokalypsise_hu_html.zip | 2006-05-17 07:38 | 120K | |
![[ ]](/icons/compressed.gif) | babits_mihaly_golyakalifa_doc.zip | 2007-03-24 02:55 | 120K | |
![[ ]](/icons/compressed.gif) | gardonyi_geza_abel_es_eszter_rtf.zip | 2007-03-24 02:54 | 120K | |
![[ ]](/icons/compressed.gif) | benedek_istvan_varazslas_es_orvoslas_hu_rtf.zip | 2007-03-24 02:50 | 120K | |
![[ ]](/icons/compressed.gif) | kosztolanyi_dezso_aranyfonal_rtf.zip | 2007-03-24 02:55 | 120K | |
![[ ]](/icons/compressed.gif) | Michael Moorcock - A fekete folyosó.zip | 2007-03-26 17:37 | 120K | |
![[ ]](/icons/compressed.gif) | Rejto Jeno - Az elatkozott part.txt.zip | 2007-03-24 02:59 | 120K | |
![[ ]](/icons/unknown.gif) | Bocs nat, nem t'ves.doc | 2004-12-29 12:39 | 120K | |
![[ ]](/icons/compressed.gif) | H P LOVECRAF-Agust Derleth-Arnyak a kapu elott.zip | 2007-03-24 02:55 | 120K | |
![[ ]](/icons/compressed.gif) | gardner_erle_stanley_a_felszemu_tanu_esete_hu_rtf_nncl1915-614v2.zip | 2007-03-24 02:53 | 120K | |
![[ ]](/icons/unknown.gif) | Jakob Bohme-Szent sovargas.ZIP | 2007-03-24 02:55 | 120K | |
![[ ]](/icons/unknown.gif) | fuvallat.ace | 2007-03-24 02:52 | 120K | |
![[ ]](/icons/compressed.gif) | Achilles Dent-Nyugalom,a hoszu elet ritka.zip | 2007-03-24 02:49 | 120K | |
![[ ]](/icons/unknown.gif) | hobbit02.doc | 2007-03-24 02:54 | 120K | |
![[ ]](/icons/compressed.gif) | milne_larry_szellemirtok_1_hu_rtf.zip | 2007-03-24 02:57 | 119K | |
![[ ]](/icons/compressed.gif) | moricz_zsigmond_az_isten_hata_mogott_rtf.zip | 2007-03-24 02:58 | 119K | |
![[ ]](/icons/compressed.gif) | Lang Attila-Jatekvilag.zip | 2007-03-24 02:57 | 119K | |
![[ ]](/icons/compressed.gif) | cooper_dennis_kozelebb_hu_rtf.zip | 2007-03-24 02:52 | 119K | |
![[ ]](/icons/compressed.gif) | jokai_mor_tegy_jot_rtf.zip | 2007-03-24 02:56 | 119K | |
![[ ]](/icons/unknown.gif) | 1997.09.doc | 2007-03-24 02:53 | 119K | |
![[ ]](/icons/unknown.gif) | 08 - Ray O'Sullivan - Tagore labirintusa.doc | 2007-03-24 02:54 | 119K | |
![[ ]](/icons/unknown.gif) | 06 - Jan van den Boomen - Fattyúgyik villám szerzetes.doc | 2007-03-24 02:54 | 119K | |
![[ ]](/icons/compressed.gif) | seabird_oliver_thomson_keteselyes_jatszma_halaloszto_2029_hu_rtf_NNCL1948-618v1.zip | 2007-03-24 03:00 | 119K | |
![[ ]](/icons/compressed.gif) | Lando Calrissian és 2. Oseon tüzvihara.zip | 2007-03-26 19:02 | 119K | |
![[ ]](/icons/compressed.gif) | dahl_roald_boszorkanyok_hu_rtf.zip | 2007-03-24 02:59 | 119K | |
![[ ]](/icons/compressed.gif) | Roald dahl--Boszorkanyok.zip | 2007-03-24 02:59 | 119K | |
![[ ]](/icons/unknown.gif) | 03 - A hosszúéletűek (Játéktechnikai megjegyzések).doc | 2007-03-24 02:54 | 119K | |
![[ ]](/icons/compressed.gif) | berzsenyi_daniel_osszes_versei.zip | 2007-03-24 02:55 | 118K | |
![[ ]](/icons/compressed.gif) | kereszty_andras_a_challenger_video_hu_txt.zip | 2007-03-24 02:56 | 118K | |
![[ ]](/icons/unknown.gif) | Új WordPad dokumentum.doc | 2007-03-24 02:54 | 118K | |
![[ ]](/icons/compressed.gif) | Hugh Lofting-Doktor Dolittle es az allatok.zip | 2007-03-24 02:55 | 118K | |
![[ ]](/icons/compressed.gif) | tamko_sirato_karoly_pinty_es_ponty_hu_doc.zip | 2007-03-24 03:00 | 118K | |
![[ ]](/icons/compressed.gif) | jozsef_attila_szabad-otletek_jegyzeke_pdf.zip | 2007-03-24 02:55 | 118K | |
![[ ]](/icons/compressed.gif) | William Shakespeare--Hamlet,Dan kiralyfi.zip | 2007-03-24 03:01 | 118K | |
![[ ]](/icons/compressed.gif) | Frederick Forsyth-A Pasztor.zip | 2007-03-24 02:54 | 118K | |
![[ ]](/icons/unknown.gif) | 2004.03.20.doc | 2007-03-24 02:53 | 118K | |
![[ ]](/icons/unknown.gif) | 3_4.doc | 2007-11-14 04:45 | 118K | |
![[ ]](/icons/unknown.gif) | osszes08.ace | 2007-03-24 02:56 | 117K | |
![[ ]](/icons/compressed.gif) | appleton_victor_tom_swift_2_hu_rtf.zip | 2007-03-24 03:01 | 117K | |
![[ ]](/icons/compressed.gif) | gardner_erle_stanley_az_alazatos_zsarolo_esete_hu_rtf_nncl2046-62av2.zip | 2007-03-24 02:53 | 117K | |
![[ ]](/icons/compressed.gif) | jokai_mor_a_baratfalvi_levita_html.zip | 2007-03-24 02:56 | 117K | |
![[ ]](/icons/compressed.gif) | f451.zip | 2007-03-24 02:59 | 117K | |
![[ ]](/icons/unknown.gif) | 2003.11.15.doc | 2007-03-24 02:53 | 117K | |
![[ ]](/icons/unknown.gif) | 06 - Novák Csanág - Alkony.doc | 2007-03-24 02:54 | 117K | |
![[ ]](/icons/compressed.gif) | Herodotosz-Kürosz-Xerxész.zip | 2007-03-24 02:55 | 117K | |
![[TXT]](/icons/text.gif) | 5SZAK03.HTM | 2007-03-24 02:59 | 117K | |
![[ ]](/icons/compressed.gif) | follett_ken_a_fuggony_lehull_hu_rtf.zip | 2007-03-24 02:56 | 117K | |
![[ ]](/icons/compressed.gif) | csukas_istvan_csicsoka_es_a_moszkitok_hu_doc_nncl3043-706v1.zip | 2007-03-24 02:57 | 117K | |
![[ ]](/icons/compressed.gif) | thompson_jim_szokesben_hu_htm.zip | 2007-03-24 02:56 | 116K | |
![[ ]](/icons/compressed.gif) | Murray Leinster - A Grekek ajándéka.zip | 2006-05-17 06:43 | 116K | |
![[ ]](/icons/compressed.gif) | Ray Bradbury - Fahrenheit 451.zip | 2007-03-22 16:59 | 116K | |
![[ ]](/icons/compressed.gif) | A E. Van Vogt - Madárfejűek Társasága.zip | 2006-05-28 04:34 | 116K | |
![[ ]](/icons/unknown.gif) | RAGADOZO2017-Kyle Stwrnhagen.ZIP | 2007-03-24 02:58 | 116K | |
![[TXT]](/icons/text.gif) | 5SZAK02.HTM | 2007-03-24 02:59 | 116K | |
![[ ]](/icons/compressed.gif) | kyle_sternhagen_predator.zip | 2006-05-18 11:06 | 116K | |
![[ ]](/icons/compressed.gif) | bende_ibolya_halalra_varva_hu_rtf_nncl666-3d5v1.zip | 2007-03-24 02:50 | 116K | |
![[ ]](/icons/compressed.gif) | Antonie de Saint-Exuperi-Az ember foldje.zip | 2007-03-24 03:00 | 116K | |
![[ ]](/icons/unknown.gif) | 1998.11.doc | 2007-03-24 02:53 | 116K | |
![[ ]](/icons/compressed.gif) | robert_sheckley-a_statuscivilizacio.zip | 2007-03-24 02:59 | 116K | |
![[ ]](/icons/compressed.gif) | asimov_isaac_a_humanika_torvenyei.zip | 2007-03-24 02:55 | 116K | |
![[ ]](/icons/unknown.gif) | hobbit05.doc | 2007-03-24 02:54 | 116K | |
![[ ]](/icons/unknown.gif) | A tápolás műveszete - avagy, hogyan csináljunk igazán erős karakter | 2007-05-03 06:54 | 115K | |
![[ ]](/icons/compressed.gif) | Jorge Luis Borges-Kepzelt lenyek konyve.zip | 2007-03-24 02:56 | 115K | |
![[ ]](/icons/unknown.gif) | Myles Na Gopaleen[Flann O Brien]-Afaba szorult fereg.ZIP | 2007-03-24 02:58 | 115K | |
![[ ]](/icons/compressed.gif) | Deepak Chopra-Merlin es Artur kiraly.zip | 2007-03-24 02:52 | 115K | |
![[ ]](/icons/compressed.gif) | marcus_aurelius_elmelkedesek_hu_txt.zip | 2007-03-24 02:57 | 115K | |
![[ ]](/icons/compressed.gif) | morgenstern_christian_akasztofa_enekek_hu_doc.zip | 2007-03-24 02:52 | 115K | |
![[ ]](/icons/compressed.gif) | exupery_a_kis_herceg.zip | 2007-03-24 02:53 | 115K | |
![[ ]](/icons/compressed.gif) | johannesson_olof_a_nagy_szamitogep_hu_rtf.zip | 2007-03-24 02:58 | 115K | |
![[ ]](/icons/compressed.gif) | Philip Reid-Harris csodaorszagban.zip | 2007-03-24 02:58 | 115K | |
![[ ]](/icons/compressed.gif) | reid_philip_harris_csodaorszagban.zip | 2007-03-24 02:58 | 115K | |
![[ ]](/icons/unknown.gif) | 05 - Aalish DMohlen - Fekete vér.doc | 2007-03-24 02:54 | 115K | |
![[ ]](/icons/compressed.gif) | hubbard_l_ron_retteges_hu_txt.zip | 2007-03-24 02:57 | 114K | |
![[ ]](/icons/compressed.gif) | Az elvarazsolt egerkisasszony.zip | 2007-03-24 02:52 | 114K | |
![[ ]](/icons/compressed.gif) | babits_mihaly_golyakalifa_html.zip | 2007-03-24 02:55 | 114K | |
![[TXT]](/icons/text.gif) | Az Álmosvölgy legendája.htm | 2007-03-24 03:01 | 114K | |
![[ ]](/icons/unknown.gif) | 5SZAKACS.02 | 2007-03-24 02:59 | 114K | |
![[ ]](/icons/compressed.gif) | Rejto Jeno - Menni vagy meghalni.txt.zip | 2007-03-24 02:59 | 114K | |
![[ ]](/icons/compressed.gif) | leinster_murray_a_grekek_ajandeka.zip | 2007-03-24 02:58 | 113K | |
![[ ]](/icons/unknown.gif) | Konrad Gyorgy-A latogato | 2007-03-24 02:56 | 113K | |
![[ ]](/icons/compressed.gif) | MS-fuves.zip | 2007-03-24 02:57 | 113K | |
![[ ]](/icons/compressed.gif) | Harry Harrison-A rozsdamentes acelpatkany teged akar.zip | 2007-03-24 02:55 | 113K | |
![[ ]](/icons/compressed.gif) | Carl Gustav Jung-Bevezetes a tudattalan pszihologiajaba.zip | 2007-03-24 02:52 | 113K | |
![[ ]](/icons/compressed.gif) | mann_thomas_elbeszelesek_rtf.zip | 2007-03-24 03:00 | 113K | |
![[ ]](/icons/compressed.gif) | Rejto Jeno - A Nevada szelleme.txt.zip | 2007-03-24 02:59 | 113K | |
![[TXT]](/icons/text.gif) | EZER1_02.HTM | 2007-03-24 02:57 | 113K | |
![[ ]](/icons/compressed.gif) | Immanuel Kant pedagogiaja.zip | 2007-03-24 02:55 | 113K | |
![[ ]](/icons/compressed.gif) | Rejto Jeno - Egy bolond szaz bajt csinal.doc.zip | 2007-03-24 02:59 | 113K | |
![[ ]](/icons/compressed.gif) | verne_jules_a_ket_kip_testver_rtf.zip | 2007-03-24 02:56 | 113K | |
![[ ]](/icons/compressed.gif) | Rejto Jeno - Nincs kegyelem.doc.zip | 2007-03-24 02:59 | 112K | |
![[ ]](/icons/layout.gif) | Imperial City - kalandok a fővárosban.pdf | 2007-05-03 07:24 | 112K | |
![[ ]](/icons/compressed.gif) | Elias Canetti-Marrakes hangjai.zip | 2007-03-24 02:53 | 112K | |
![[ ]](/icons/compressed.gif) | travers_p_l_a_csudalatos_mary_hu_doc_nncl3114-706v1.zip | 2007-03-24 02:58 | 112K | |
![[ ]](/icons/compressed.gif) | Stone, Jeffrey - Az ej istene hu rtf.zip | 2007-03-26 19:08 | 112K | |
![[ ]](/icons/unknown.gif) | 07 - Raoul Renier - Becsület dolga.doc | 2007-03-24 02:54 | 112K | |
![[TXT]](/icons/text.gif) | 5SZAK01.HTM | 2007-03-24 02:59 | 112K | |
![[ ]](/icons/compressed.gif) | gracian_balthasar_az_eletbolcsesseg_kezikonyve_hu_rtf.zip | 2007-03-24 02:49 | 112K | |
![[ ]](/icons/compressed.gif) | stone_jeffrey_az_ej_istene_hu_rtf.zip | 2007-03-24 02:58 | 112K | |
![[ ]](/icons/compressed.gif) | Stone, Jeffrey - Az ej_istene_hu_rtf.zip | 2006-05-28 04:09 | 112K | |
![[ ]](/icons/compressed.gif) | Kodolányi János-Jehuda bar Simon emlekiratai.zip | 2007-03-24 02:56 | 112K | |
![[ ]](/icons/compressed.gif) | Fahrenheit 451.htm.zip | 2007-03-24 02:59 | 112K | |
![[ ]](/icons/compressed.gif) | Bohumil Hrabal-A varoska,ahol megallt az ido.zip | 2007-03-24 02:52 | 112K | |
![[ ]](/icons/compressed.gif) | Hamis - A Jedi hatalma.zip | 2007-03-26 19:01 | 112K | |
![[ ]](/icons/unknown.gif) | Kiss Laszlo- zsebretett level[utolso szentbeszedek] | 2007-03-24 02:56 | 111K | |
![[ ]](/icons/compressed.gif) | vinci_simona_szegyentelenek_hu_txt.zip | 2007-03-24 03:00 | 111K | |
![[ ]](/icons/compressed.gif) | agh_istvan_felekiraly.zip | 2007-03-24 02:49 | 111K | |
![[ ]](/icons/compressed.gif) | rostand_edmond_cyrano_de_bergerac_rtf.zip | 2007-03-24 02:53 | 111K | |
![[ ]](/icons/compressed.gif) | vonnegut_kurt_ej_anyank_hu_txt.zip | 2007-03-24 02:57 | 111K | |
![[ ]](/icons/compressed.gif) | John Gregory Betancourt-Klanhaboru.zip | 2007-03-24 02:56 | 111K | |
![[ ]](/icons/compressed.gif) | Rejto Jeno - Pokol a hegyek kozott.txt.zip | 2007-03-24 02:59 | 111K | |
![[ ]](/icons/compressed.gif) | bradbury_ray_fahrenheit_451.zip | 2007-03-24 02:59 | 111K | |
![[ ]](/icons/compressed.gif) | Ottlik Geza-Tovabbelok.zip | 2007-03-24 02:58 | 111K | |
![[ ]](/icons/compressed.gif) | barker_clive_pokolkelto.zip | 2007-03-24 02:52 | 111K | |
![[ ]](/icons/compressed.gif) | betancourt_klanhaboru.zip | 2007-02-21 16:42 | 111K | |
![[ ]](/icons/compressed.gif) | Betancourt - Klanhaboru.zip | 2007-03-26 18:57 | 111K | |
![[ ]](/icons/compressed.gif) | filardi_peter_egyenesen_at_hu_rtf_nncl2264-651v2.zip | 2007-03-24 02:58 | 110K | |
![[ ]](/icons/unknown.gif) | 5SZAKACS.03 | 2007-03-24 02:59 | 110K | |
![[ ]](/icons/compressed.gif) | Isaac Asimov - Az űrvadász.zip | 2007-03-22 05:29 | 110K | |
![[ ]](/icons/compressed.gif) | mikszath_kalman_a_szelistyei_asszonyok_doc.zip | 2007-03-24 02:57 | 110K | |
![[ ]](/icons/compressed.gif) | balzac_honore_de_albert_savarus_rtf.zip | 2007-03-24 02:55 | 110K | |
![[ ]](/icons/compressed.gif) | ykpdf_becsulet.zip | 2007-03-24 02:54 | 110K | |
![[ ]](/icons/unknown.gif) | opium.ace | 2007-03-24 02:52 | 110K | |
![[ ]](/icons/compressed.gif) | A E. Van Vogt - Kuldetes_a_csillagokhoz_hu_html.zip | 2006-05-28 04:36 | 110K | |
![[ ]](/icons/unknown.gif) | 11 - Az aquirok.doc | 2007-03-24 02:54 | 110K | |
![[ ]](/icons/compressed.gif) | jung_c_g_gondolatok_a_termeszetrol_hu_rtf_nncl2642-6bav1.zip | 2007-03-24 02:52 | 110K | |
![[ ]](/icons/compressed.gif) | kertesz_esterhazy_egy_tortenet_hu_rtf.zip | 2007-03-24 02:56 | 110K | |
![[ ]](/icons/layout.gif) | Varázslatok listája II. - Illusion, Mysticism, Restoration.pdf | 2007-05-03 06:48 | 110K | |
![[ ]](/icons/unknown.gif) | humanika.ace | 2007-03-24 02:52 | 109K | |
![[ ]](/icons/compressed.gif) | zsoldos_peter_az_utolso_kisertes.zip | 2007-03-24 03:01 | 109K | |
![[ ]](/icons/compressed.gif) | Zsoldos Péter - Az utolsó kisertés.zip | 2006-05-31 07:31 | 109K | |
![[ ]](/icons/compressed.gif) | inoue_jaszusi_utazas_a_fudaraku_paradicsomba_hu_html.zip | 2007-03-24 02:56 | 109K | |
![[ ]](/icons/compressed.gif) | benyovszky_moric_madagaszkar_html.zip | 2007-03-24 02:50 | 109K | |
![[ ]](/icons/compressed.gif) | jokai_mor_sirko-album_rtf.zip | 2007-03-24 02:56 | 109K | |
![[ ]](/icons/unknown.gif) | mvm.ace | 2007-03-24 02:52 | 109K | |
![[ ]](/icons/compressed.gif) | nietzsche_versei_hu_rtf.zip | 2007-03-24 02:54 | 109K | |
![[ ]](/icons/compressed.gif) | Friedrich Nietzsche versei.zip | 2007-03-24 02:54 | 109K | |
![[ ]](/icons/unknown.gif) | hobbit12.doc | 2007-03-24 02:54 | 109K | |
![[ ]](/icons/compressed.gif) | panarello_melissa_minden_este_100_szor_kefevel_hu_doc_nncl3270-732v1.zip | 2007-03-24 02:57 | 108K | |
![[ ]](/icons/unknown.gif) | hobbit06.doc | 2007-03-24 02:54 | 108K | |
![[ ]](/icons/unknown.gif) | Az Elfeledett Királyság háborúja.doc | 2007-04-15 16:28 | 108K | |
![[ ]](/icons/compressed.gif) | Jokai Mor-Sirko--album.zip | 2007-03-24 02:56 | 108K | |
![[ ]](/icons/compressed.gif) | Az űrvadasz.zip | 2007-03-24 02:55 | 108K | |
![[ ]](/icons/compressed.gif) | Achilles Dent-Fail.zip | 2007-03-24 02:49 | 108K | |
![[ ]](/icons/unknown.gif) | 5SZAKACS.01 | 2007-03-24 02:59 | 108K | |
![[ ]](/icons/compressed.gif) | Robert Sheckley-Ugyanaz duplan.zip | 2007-03-24 02:59 | 108K | |
![[ ]](/icons/compressed.gif) | sheckley_robert_ugyanaz_duplan.zip | 2007-03-24 02:59 | 108K | |
![[ ]](/icons/compressed.gif) | rs2.zip | 2007-08-04 14:03 | 108K | |
![[ ]](/icons/compressed.gif) | Robert Sheckley - Ugyanaz duplán.zip | 2006-08-25 01:30 | 108K | |
![[TXT]](/icons/text.gif) | átváltozás.htm | 2007-03-24 02:54 | 108K | |
![[ ]](/icons/compressed.gif) | huxley_aldous_visszateres_a_szep_uj_vilaghoz_hu_rtf.zip | 2007-03-24 02:49 | 108K | |
![[ ]](/icons/unknown.gif) | 2003.07.27.doc | 2007-03-24 02:53 | 108K | |
![[ ]](/icons/unknown.gif) | Varázslatok listája I. - Alteration, Conjuration, Destruction.pd | 2007-05-03 06:47 | 107K | |
![[ ]](/icons/compressed.gif) | Terkepeken a vilagtortenelem.zip | 2007-03-24 03:00 | 107K | |
![[ ]](/icons/compressed.gif) | jokai_mor_a_ketszarvu_ember_rtf.zip | 2007-03-24 02:56 | 107K | |
![[ ]](/icons/compressed.gif) | Hamvas Bela ezoterizmusa.zip | 2007-03-24 02:53 | 107K | |
![[ ]](/icons/unknown.gif) | Ez_st pisztolygoly˘k.doc | 2004-12-29 12:39 | 107K | |
![[ ]](/icons/unknown.gif) | 2003.09.27.doc | 2007-03-24 02:53 | 107K | |
![[ ]](/icons/unknown.gif) | 4.doc | 2007-11-14 02:50 | 107K | |
![[ ]](/icons/compressed.gif) | Rejto Jeno - A feher folt.txt.zip | 2007-03-24 02:59 | 107K | |
![[ ]](/icons/compressed.gif) | Woody Allen-A szendvics feltalalasa.zip | 2007-03-24 03:01 | 107K | |
![[ ]](/icons/compressed.gif) | Karinthy Frigyes-Capillaria.zip | 2007-03-24 02:56 | 107K | |
![[ ]](/icons/compressed.gif) | Domonkos Istvan-Via Italia.zip | 2007-03-24 02:53 | 107K | |
![[ ]](/icons/compressed.gif) | Hal Clement - Csillagfény.zip | 2006-05-17 07:12 | 107K | |
![[ ]](/icons/compressed.gif) | sagan_francoise_kushado_kutya_hu_rtf.zip | 2007-03-24 02:54 | 106K | |
![[ ]](/icons/compressed.gif) | Isaac Asimov - Az aszteroidák kalózai.zip | 2003-01-30 11:50 | 106K | |
![[ ]](/icons/compressed.gif) | Isaac Asimov - Aszteroidak.zip | 2004-06-21 11:43 | 106K | |
![[ ]](/icons/compressed.gif) | Aszteroidák kalózai.zip | 2007-03-24 02:55 | 106K | |
![[ ]](/icons/compressed.gif) | lindgren_astrid_oroszlanszivu_testverek_hu_html.zip | 2007-03-24 02:49 | 106K | |
![[ ]](/icons/compressed.gif) | durrenmatt_friedrich_a_megbizas_hu_rtf.zip | 2007-03-24 02:54 | 106K | |
![[ ]](/icons/compressed.gif) | Tolkienmesek.zip | 2007-03-26 19:31 | 106K | |
![[ ]](/icons/compressed.gif) | Mario es a varazslo-elbeszelesek.zip | 2007-03-24 02:57 | 106K | |
![[ ]](/icons/unknown.gif) | Enchant, lépésről lépésre - Alkossunk mágikus tárgyakat, mert az jó | 2007-05-03 06:52 | 106K | |
![[ ]](/icons/compressed.gif) | Fridrich Durrenmatt-A megbizas.zip | 2007-03-24 02:54 | 106K | |
![[ ]](/icons/unknown.gif) | Az utolsó kísértés.ace | 2007-03-24 03:01 | 106K | |
![[ ]](/icons/compressed.gif) | apollinaire_guillaume_elbeszelesek_rtf.zip | 2007-03-24 02:55 | 106K | |
![[ ]](/icons/compressed.gif) | Burroughs, Edgar - A mars ura.zip | 2006-05-10 22:43 | 106K | |
![[ ]](/icons/compressed.gif) | vonnegut_kurt_borleszk_hu_txt.zip | 2007-03-24 02:57 | 106K | |
![[ ]](/icons/unknown.gif) | pokolhegy.ace | 2007-03-24 02:52 | 106K | |
![[ ]](/icons/unknown.gif) | 2003.01.12.doc | 2007-03-24 02:53 | 106K | |
![[ ]](/icons/compressed.gif) | Rejto Jeno - A boszorkanymester.txt.zip | 2007-03-24 02:59 | 105K | |
![[ ]](/icons/compressed.gif) | hand_elizabeth_a_jovo_a_tet_hu_rtf.zip | 2007-03-24 03:01 | 105K | |
![[ ]](/icons/compressed.gif) | Az őrület hegyei.zip | 2007-03-26 16:55 | 105K | |
![[TXT]](/icons/text.gif) | hking.htm | 2006-08-25 00:04 | 105K | |
![[ ]](/icons/unknown.gif) | Dale Avery - A renegát - függelék.doc | 2007-04-02 21:42 | 105K | |
![[ ]](/icons/unknown.gif) | 06 - Roland Morgan - Forró nyomon.doc | 2007-03-24 02:54 | 105K | |
![[ ]](/icons/compressed.gif) | dosztojevszkij_fjodor_feljegyzesek_az_egerlyukbol_rtf.zip | 2007-03-24 02:53 | 105K | |
![[ ]](/icons/compressed.gif) | mesek.zip | 2007-08-04 14:02 | 105K | |
![[ ]](/icons/compressed.gif) | kertesz_p_balazs_Hallgatag_Erik.zip | 2007-03-24 02:56 | 105K | |
![[ ]](/icons/unknown.gif) | osszes55.ace | 2007-03-24 02:56 | 105K | |
![[ ]](/icons/compressed.gif) | A Jupiter holdjai.zip | 2007-03-24 02:55 | 105K | |
![[ ]](/icons/compressed.gif) | irodalmiszotar.zip | 2007-03-24 02:55 | 104K | |
![[ ]](/icons/compressed.gif) | shaw_g_b_caesar_es_kleopatra_hu_rtf_nncl2128-637v1.zip | 2007-03-24 02:54 | 104K | |
![[ ]](/icons/compressed.gif) | Neumann Janos-A szamitogep es az agy.zip | 2007-03-24 02:58 | 104K | |
![[ ]](/icons/compressed.gif) | Erich Kestner-Az emberke.zip | 2007-03-24 02:53 | 104K | |
![[ ]](/icons/unknown.gif) | osszes40.ace | 2007-03-24 02:56 | 104K | |
![[ ]](/icons/compressed.gif) | Isaac Asimov - Venusz.zip | 2004-06-21 11:43 | 104K | |
![[ ]](/icons/compressed.gif) | Isaac Asimov - A Vénusz óceánjai.zip | 2003-01-30 11:50 | 104K | |
![[ ]](/icons/compressed.gif) | A Venusz óceánjai.zip | 2007-03-24 02:55 | 104K | |
![[ ]](/icons/compressed.gif) | Edgar Allan Poe-A Morgue utcai gyilkossag.zip | 2007-03-24 02:53 | 104K | |
![[ ]](/icons/compressed.gif) | Rejto Jeno - Vesztegzar a Grand Hotelban.txt.zip | 2007-03-24 02:59 | 104K | |
![[ ]](/icons/compressed.gif) | Jack London-Adam elott.zip | 2007-03-24 02:55 | 104K | |
![[ ]](/icons/compressed.gif) | goethe_johann_wolfgang_von_werther_szerelme_es_halala_rtf.zip | 2007-03-24 02:56 | 103K | |
![[ ]](/icons/unknown.gif) | Michel Demuth - A bumm-bumm madár vágtája.rtf | 2006-07-19 17:43 | 103K | |
![[ ]](/icons/compressed.gif) | dorta_marcello_a_lestrapalt_tanito_hu_rtf_nncl2850-6ebv1.zip | 2007-03-24 02:57 | 103K | |
![[ ]](/icons/compressed.gif) | Isaac Asimov - Jupiter.zip | 2004-06-21 11:43 | 103K | |
![[ ]](/icons/compressed.gif) | Isaac Asimov - A Jupiter holdjai.zip | 2003-01-30 11:50 | 103K | |
![[ ]](/icons/compressed.gif) | sethfield_christopher_orosz_rulett_hu_rtf_nncl2442-686v1.0.zip | 2007-03-24 03:00 | 103K | |
![[ ]](/icons/compressed.gif) | scholtz_andor_kaland_a_kek_niluson_hu_rtf.zip | 2007-03-24 02:49 | 103K | |
![[ ]](/icons/compressed.gif) | shaw_g_b_pigmalion_hu_rtf_nncl2130-637v1.zip | 2007-03-24 02:54 | 102K | |
![[ ]](/icons/compressed.gif) | kosztolanyi_dezso_ablakok_rtf.zip | 2007-03-24 02:55 | 102K | |
![[TXT]](/icons/text.gif) | k07.html | 2007-11-14 06:41 | 102K | |
![[ ]](/icons/compressed.gif) | A Szaturnusz gyűrűi.zip | 2007-03-24 02:55 | 102K | |
![[ ]](/icons/compressed.gif) | italok3.zip | 2007-03-24 02:58 | 102K | |
![[ ]](/icons/unknown.gif) | 2003.12.06.doc | 2007-03-24 02:53 | 102K | |
![[ ]](/icons/compressed.gif) | Ernst Müller - Zóhár (A Ragyogás Könyve).zip | 2007-03-24 02:53 | 102K | |
![[ ]](/icons/compressed.gif) | Kalman Maria-Felisten.zip | 2007-03-24 02:56 | 101K | |
![[ ]](/icons/compressed.gif) | si_king_dalok_konyve_hu_txt.zip | 2007-03-24 03:00 | 101K | |
![[ ]](/icons/compressed.gif) | hamori_tibor_piszkos_fred_es_a_tobbiek_hu_rtf.zip | 2007-03-24 02:55 | 101K | |
![[ ]](/icons/compressed.gif) | panik_piocaeknal.zip | 2007-03-24 02:57 | 101K | |
![[ ]](/icons/compressed.gif) | fust_milan_advent_html.zip | 2007-03-24 02:54 | 101K | |
![[ ]](/icons/unknown.gif) | I_08.doc | 2007-11-14 08:50 | 101K | |
![[ ]](/icons/compressed.gif) | fulghum_robert_mar_az_ovodaban_megtanultam_mindent_amit_tudni_erdemes_hu_rtf_nncl2499-692v1.zip | 2007-03-24 02:59 | 101K | |
![[ ]](/icons/compressed.gif) | Isaac Asimov - A Szaturnusz gyűrűi.zip | 2004-06-21 11:43 | 101K | |
![[ ]](/icons/compressed.gif) | ady_endre_sapadt_emberek_html.zip | 2007-03-24 02:55 | 101K | |
![[ ]](/icons/unknown.gif) | 2003.09.08.doc | 2007-03-24 02:53 | 101K | |
![[ ]](/icons/compressed.gif) | Greg Bear-Fejek.zip | 2007-03-24 02:55 | 100K | |
![[ ]](/icons/unknown.gif) | holisztikus.ace | 2007-03-24 02:52 | 100K | |
![[ ]](/icons/compressed.gif) | Zohar-A ragyogas konyve.zip | 2007-03-24 03:01 | 100K | |
![[ ]](/icons/unknown.gif) | 77.doc | 2007-03-24 02:57 | 100K | |
![[ ]](/icons/layout.gif) | Chorrol.pdf | 2007-05-03 07:07 | 100K | |
![[ ]](/icons/compressed.gif) | jung_c_g_gondolatok_a_szexualitasrol_es_a_szerelemrol_hu_rtf_nncl2643-6bav1.zip | 2007-03-24 02:52 | 100K | |
![[TXT]](/icons/text.gif) | Halálszárny.txt | 2007-03-24 02:52 | 100K | |
![[ ]](/icons/compressed.gif) | Euklidesz-Elemek1.zip | 2007-03-24 02:53 | 100K | |
![[ ]](/icons/unknown.gif) | Alekszandr Kolpakov - Az Eridanus Alfája.rtf | 2006-07-19 06:27 | 100K | |
![[ ]](/icons/unknown.gif) | 16.RTF | 2007-11-13 22:26 | 100K | |
![[ ]](/icons/unknown.gif) | osszes56.ace | 2007-03-24 02:56 | 100K | |
![[ ]](/icons/compressed.gif) | Csillagászati tankönyv kezdőknek és haladóknak.zip | 2007-03-24 02:52 | 100K | |
![[ ]](/icons/layout.gif) | Aries receptjei.pdf | 2007-03-24 02:59 | 100K | |
![[ ]](/icons/compressed.gif) | morris_desmond_miert_csinalja_a_macska_hu_rtf.zip | 2007-03-24 02:52 | 99K | |
![[ ]](/icons/compressed.gif) | eckhart_mester_beszedek_hu_html.zip | 2007-03-24 02:53 | 99K | |
![[ ]](/icons/compressed.gif) | Rejto Jeno - Bradley Tamas visszaut.txt.zip | 2007-03-24 02:59 | 99K | |
![[ ]](/icons/unknown.gif) | elrabolt.rtf | 2007-04-15 16:41 | 99K | |
![[ ]](/icons/compressed.gif) | Geothe-Werther szerelme es halala.zip | 2007-03-24 02:54 | 99K | |
![[ ]](/icons/compressed.gif) | cusick_richie_tankersley_a_vampirlakoma_hu_rtf.zip | 2007-03-24 02:59 | 99K | |
![[ ]](/icons/compressed.gif) | ECHART MESTER-Beszedek.zip | 2007-03-24 02:53 | 99K | |
![[ ]](/icons/compressed.gif) | jokai_mor_aki_a_szivet_a_homlokan_hordja_html.zip | 2007-03-24 02:56 | 99K | |
![[ ]](/icons/compressed.gif) | moricz_zsigmond_arvacska_rtf.zip | 2007-03-24 02:58 | 99K | |
![[ ]](/icons/compressed.gif) | Erich Kastner-Emil es a harom iker.zip | 2007-03-24 02:53 | 99K | |
![[ ]](/icons/compressed.gif) | dante_alighieri_pokol_rtf.zip | 2007-03-24 02:52 | 99K | |
![[ ]](/icons/unknown.gif) | 2003.05.17.doc | 2007-03-24 02:53 | 99K | |
![[TXT]](/icons/text.gif) | EZER1_01.HTM | 2007-03-24 02:57 | 98K | |
![[ ]](/icons/compressed.gif) | london_jack_a_vadon_szava_hu_doc_nncl3074-706v1.zip | 2007-03-24 02:55 | 98K | |
![[ ]](/icons/compressed.gif) | Gyorgy Attila-Malefica.zip | 2007-03-24 02:55 | 98K | |
![[ ]](/icons/compressed.gif) | A Merkur óriás napja.zip | 2007-03-24 02:55 | 98K | |
![[ ]](/icons/compressed.gif) | thompson_e_a_gyilkos_fak_szigete_hu_doc.zip | 2007-03-24 02:53 | 98K | |
![[ ]](/icons/compressed.gif) | Pilinsky Janos-Osszegyujtott versei.zip | 2007-03-24 02:55 | 98K | |
![[ ]](/icons/compressed.gif) | undset_sigrid_pogany_szerelem_hu_doc_nncl2208-647v1.zip | 2007-03-24 03:00 | 98K | |
![[ ]](/icons/compressed.gif) | Hegedus Geza-Tudniillik tudni illik.zip | 2007-03-24 02:55 | 98K | |
![[ ]](/icons/compressed.gif) | Gaspar Margit-A fekete csaszar.zip | 2007-03-24 02:54 | 98K | |
![[ ]](/icons/compressed.gif) | barany_tamas_palackposta_hu_rtf_nncl2694-6c6v1.zip | 2007-03-24 02:49 | 98K | |
![[ ]](/icons/compressed.gif) | rideg_sandor_indul_a_bakterhaz.zip | 2007-03-24 02:59 | 98K | |
![[ ]](/icons/unknown.gif) | 2002.11.23.doc | 2007-03-24 02:53 | 98K | |
![[ ]](/icons/compressed.gif) | Neale Donald Walsch-A kapcsolatokrol.zip | 2007-03-24 02:58 | 98K | |
![[ ]](/icons/compressed.gif) | csukas_istvan_agacska_html.zip | 2007-03-24 02:57 | 98K | |
![[ ]](/icons/compressed.gif) | dummerth_dezso_almos_az_aldozat_hu_rtf.zip | 2007-03-24 02:53 | 98K | |
![[ ]](/icons/unknown.gif) | osszes15.ace | 2007-03-24 02:56 | 98K | |
![[ ]](/icons/compressed.gif) | F M Dosztojevszkij-Feljegyzesek az egerlyukbol.zip | 2007-03-24 02:53 | 98K | |
![[ ]](/icons/unknown.gif) | C M Kornbluth - Menetelő maflák.rtf | 2006-07-19 06:38 | 98K | |
![[ ]](/icons/compressed.gif) | gogol_a_revizor.doc.zip | 2007-03-24 02:58 | 98K | |
![[ ]](/icons/compressed.gif) | Paul Claudel-Akelet megismerese[prozaversek].zip | 2007-03-24 02:58 | 98K | |
![[TXT]](/icons/text.gif) | 10.htm | 2007-11-13 20:59 | 97K | |
![[ ]](/icons/compressed.gif) | segal_erich_szerelmi_tortenet_hu_rtf.zip | 2007-03-24 02:53 | 97K | |
![[ ]](/icons/compressed.gif) | feher_klara_sargalaz_hu_doc_nncl3055-706v1.zip | 2007-03-24 02:54 | 97K | |
![[ ]](/icons/compressed.gif) | fekete_istvan_vuk_hu_rtf.zip | 2007-03-24 02:57 | 97K | |
![[IMG]](/icons/image2.gif) | TORONY1.JPG | 2007-04-15 16:13 | 97K | |
![[ ]](/icons/compressed.gif) | hegedus_geza_korosparti_metropolisz_hu_rtf.zip | 2007-03-24 02:55 | 97K | |
![[ ]](/icons/compressed.gif) | Hegedus Geza-korosparti metropolisz.zip | 2007-03-24 02:55 | 97K | |
![[ ]](/icons/unknown.gif) | 02 - A hosszúéletűek (Elfek népe címszavakban).doc | 2007-03-24 02:54 | 97K | |
![[ ]](/icons/compressed.gif) | kertesz_imre_az_angol_lobogo_pdf.zip | 2007-03-24 02:56 | 97K | |
![[ ]](/icons/unknown.gif) | osszes30.ace | 2007-03-24 02:56 | 97K | |
![[ ]](/icons/compressed.gif) | D Lopes F Pigafetta-A Kongo kiralysag.zip | 2007-03-24 02:52 | 97K | |
![[ ]](/icons/compressed.gif) | farkashazy_tivadar_mitisir_a_hogyishivjak_hu_rtf_nncl2402-67bv1.zip | 2007-03-24 02:54 | 97K | |
![[ ]](/icons/compressed.gif) | Rejto Jeno - Az elveszett cirkalo.txt.zip | 2007-03-24 02:59 | 97K | |
![[ ]](/icons/compressed.gif) | minahan_john_jeremy_hu_rtf.zip | 2007-03-24 02:56 | 96K | |
![[ ]](/icons/compressed.gif) | coelho_paulo_az_alkimista_hu_rtf_nncl1969-61av1.zip | 2007-03-24 02:58 | 96K | |
![[ ]](/icons/unknown.gif) | Poe.ace | 2007-03-24 02:52 | 96K | |
![[TXT]](/icons/text.gif) | Philip Stochmann Horrorlexikon.htm | 2007-03-24 02:58 | 96K | |
![[ ]](/icons/unknown.gif) | John Varley - A medencében.rtf | 2006-07-19 16:25 | 96K | |
![[ ]](/icons/compressed.gif) | james_henry_a_csavar_fordul_egyet.zip | 2007-03-24 02:55 | 96K | |
![[ ]](/icons/compressed.gif) | h_james-a_csavar_fordul_egyet.zip | 2006-05-30 18:26 | 96K | |
![[ ]](/icons/compressed.gif) | Szentmihalyi Sabo Peter--101Retenetes tortenet.zip | 2007-03-24 03:00 | 96K | |
![[ ]](/icons/compressed.gif) | mora_ferenc_a_rab_ember_fiai_doc.zip | 2007-03-24 02:58 | 96K | |
![[ ]](/icons/compressed.gif) | lee_tanith_a_kehely_titka_hu_html.zip | 2007-03-24 03:00 | 96K | |
![[ ]](/icons/compressed.gif) | Hery James-A csavar fordul egyet.zip | 2007-03-24 02:55 | 96K | |
![[ ]](/icons/layout.gif) | Tanuljunk könyvből - Skillek könyvecskéi.pdf | 2007-05-03 06:51 | 96K | |
![[ ]](/icons/unknown.gif) | Szent Agoston elete 1 | 2007-03-24 03:00 | 96K | |
![[ ]](/icons/unknown.gif) | 04 - Jan van den Boomen - Akár a csillagok.doc | 2007-03-24 02:54 | 96K | |
![[ ]](/icons/unknown.gif) | a_maple_stree-i_haz.rtf | 2005-03-03 18:02 | 95K | |
![[ ]](/icons/unknown.gif) | osszes31.ace | 2007-03-24 02:56 | 95K | |
![[ ]](/icons/unknown.gif) | Gyumolcsos finomsagok.PDF | 2007-03-24 02:59 | 95K | |
![[ ]](/icons/layout.gif) | Bevezetés - Bemutatkozik a Sötét Testvériség.pdf | 2007-05-03 07:13 | 95K | |
![[TXT]](/icons/text.gif) | 02 - Juhász Viktor - Varjúszárnyak.txt | 2007-03-24 02:54 | 95K | |
![[ ]](/icons/compressed.gif) | jokai_mor_a_haromszinu_kandur_html.zip | 2007-03-24 02:56 | 95K | |
![[ ]](/icons/compressed.gif) | esterhazy_peter_csokonai_lili-tizenket_hattyuk_html.zip | 2007-03-24 02:53 | 95K | |
![[ ]](/icons/compressed.gif) | Achilles Dent-TAROT.zip | 2007-03-24 02:49 | 95K | |
![[ ]](/icons/compressed.gif) | ykpdf_voroseskek.zip | 2007-03-24 02:54 | 95K | |
![[ ]](/icons/unknown.gif) | Mori Ógai- A vadlud.ace | 2007-03-24 02:58 | 95K | |
![[ ]](/icons/compressed.gif) | gravel_geary_batman-a_sarkany_es_a_denever.zip | 2007-03-24 02:54 | 95K | |
![[ ]](/icons/compressed.gif) | Rejto Jeno - Tigrisver.txt.zip | 2007-03-24 02:59 | 95K | |
![[ ]](/icons/compressed.gif) | bekes_pal_a_ketbalkezes_varazslo_hu_doc_nncl3038-706v1.zip | 2007-03-24 02:50 | 95K | |
![[ ]](/icons/unknown.gif) | Umberto Simonetta - Éjszakai utazók.ace | 2007-03-24 03:00 | 95K | |
![[ ]](/icons/compressed.gif) | kosztolanyi_dezso_esti_kornel_kalandjai_rtf.zip | 2007-03-24 02:55 | 95K | |
![[ ]](/icons/unknown.gif) | osszes63.ace | 2007-03-24 02:56 | 95K | |
![[ ]](/icons/compressed.gif) | Kevin J Anderson és Rebecca Moesta - Árnyakadémia.zip | 2007-03-26 18:58 | 95K | |
![[ ]](/icons/unknown.gif) | 1997.11.doc | 2007-03-24 02:53 | 95K | |
![[ ]](/icons/layout.gif) | Információk - Bemutatkozik a Harcosok Céhe.pdf | 2007-05-03 07:04 | 94K | |
![[ ]](/icons/compressed.gif) | arnyakademia.zip | 2006-05-06 07:42 | 94K | |
![[ ]](/icons/compressed.gif) | mikszath_kalman_a_beszelo_kontos_doc.zip | 2007-03-24 02:57 | 94K | |
![[ ]](/icons/compressed.gif) | karinthy_frigyes_osszes_koltemenye.zip | 2007-03-24 02:56 | 94K | |
![[ ]](/icons/compressed.gif) | morris_desmond_miert_csinalja_a_lo_hu_rtf.zip | 2007-03-24 02:52 | 94K | |
![[ ]](/icons/compressed.gif) | Pamela Lyndon Travers-A csodalatos Mary.zip | 2007-03-24 02:58 | 94K | |
![[ ]](/icons/compressed.gif) | Karinthy Frigyes-Igy irtok ti.zip | 2007-03-24 02:56 | 94K | |
![[ ]](/icons/compressed.gif) | E M Corder-A szarvasvadasz.zip | 2007-03-24 02:53 | 94K | |
![[ ]](/icons/layout.gif) | Leyawiin - helyi küldetések.pdf | 2007-05-03 07:24 | 94K | |
![[ ]](/icons/compressed.gif) | Wayne Chapman - Prófécia.zip | 2007-03-23 05:21 | 94K | |
![[ ]](/icons/unknown.gif) | 2003.08.30.doc | 2007-03-24 02:53 | 94K | |
![[ ]](/icons/unknown.gif) | Henry Kuttner - A Szem.rtf | 2006-07-19 08:26 | 93K | |
![[ ]](/icons/compressed.gif) | thayer_james_ejfel_utan_5_perccel_hu_rtf.zip | 2007-03-24 02:55 | 93K | |
![[ ]](/icons/unknown.gif) | III_02.doc | 2007-11-13 23:05 | 93K | |
![[ ]](/icons/compressed.gif) | jokai_mor_egy_ember_aki_mindent_tud_html.zip | 2007-03-24 02:56 | 93K | |
![[ ]](/icons/compressed.gif) | moldova_gyorgy_mehednek_gyumolcse_html.zip | 2007-03-24 02:58 | 93K | |
![[ ]](/icons/compressed.gif) | corder_e_m_a_szarvasvadasz.zip | 2007-03-24 02:53 | 93K | |
![[ ]](/icons/compressed.gif) | Rejto Jeno - Texas Bill, a fenegyerek.txt.zip | 2007-03-24 02:59 | 93K | |
![[ ]](/icons/compressed.gif) | Szentmihaji Szabo Peter--101 MINI SCI-FI.zip | 2007-03-24 03:00 | 93K | |
![[ ]](/icons/compressed.gif) | Sebestyen Mihaly -A vilag kozepe.zip | 2007-03-24 03:00 | 93K | |
![[ ]](/icons/compressed.gif) | balassi_balint_osszes_koltemenye_rtf.zip | 2007-03-24 02:55 | 93K | |
![[ ]](/icons/layout.gif) | Ajánlások feladatai - Bejutás az Egyetemre.pdf | 2007-05-03 07:09 | 93K | |
![[IMG]](/icons/image2.gif) | empireoftamriel.gif | 2007-05-03 07:44 | 93K | |
![[ ]](/icons/compressed.gif) | Bhagavad-Gita.zip | 2007-03-24 02:51 | 93K | |
![[ ]](/icons/compressed.gif) | london_jack_a_profi_hu_rtf.zip | 2007-03-24 02:55 | 93K | |
![[ ]](/icons/unknown.gif) | Ciolkovszkij_seta_a_holdon.rtf | 2007-11-14 05:15 | 92K | |
![[ ]](/icons/layout.gif) | Chorrol - helyi városi küldetések.pdf | 2007-05-03 07:24 | 92K | |
![[ ]](/icons/unknown.gif) | 03 - Jan Van Boomen - Téli égből.doc | 2007-03-24 02:54 | 92K | |
![[ ]](/icons/compressed.gif) | king_stephen_a_halalsoron_6_hu_html.zip | 2007-03-24 03:00 | 92K | |
![[ ]](/icons/compressed.gif) | esterhazy_peter_egy_no_html.zip | 2007-03-24 02:53 | 92K | |
![[TXT]](/icons/text.gif) | II_09.HTM | 2007-03-24 02:54 | 92K | |
![[ ]](/icons/compressed.gif) | Eszterhazy -Egy no.zip | 2007-03-24 02:53 | 92K | |
![[IMG]](/icons/image2.gif) | TORONY2.JPG | 2007-04-15 16:13 | 92K | |
![[ ]](/icons/compressed.gif) | Dankanits Adam-XVI Szazadi olvasmanyok.zip | 2007-03-24 02:52 | 92K | |
![[ ]](/icons/unknown.gif) | 10 - Ryan Hawkwood - Éjvarázs.doc | 2007-03-24 02:54 | 92K | |
![[ ]](/icons/compressed.gif) | meteorok_viharaban.zip | 2007-08-04 14:17 | 91K | |
![[ ]](/icons/compressed.gif) | jokai_mor_sarga_rozsa_html.zip | 2007-03-24 02:56 | 91K | |
![[ ]](/icons/compressed.gif) | Szophoklesz-Antigane.zip | 2007-03-24 03:00 | 91K | |
![[ ]](/icons/compressed.gif) | MoraF.PappD.GardonyiG.TomorkenyI.-novellak.zip | 2007-03-24 02:58 | 91K | |
![[ ]](/icons/compressed.gif) | cunningham_e_v_a_narancssarga_mauritius_esete_hu_rtf.zip | 2007-03-24 02:53 | 91K | |
![[TXT]](/icons/text.gif) | lenard-3.html | 2007-03-24 02:59 | 91K | |
![[ ]](/icons/compressed.gif) | magus_modul.zip | 2007-04-15 15:38 | 91K | |
![[ ]](/icons/unknown.gif) | Leigh Brackett - Az Örökre Elmentek Tava.rtf | 2006-07-19 16:53 | 90K | |
![[ ]](/icons/compressed.gif) | kertesz_imre_valaki_mas_html.zip | 2007-03-24 02:56 | 90K | |
![[ ]](/icons/compressed.gif) | Steve Sampson-Meghalhatod Isten hangjat.zip | 2007-03-24 03:00 | 90K | |
![[TXT]](/icons/text.gif) | Utazz velünk tevekaravánnal.htm | 2007-03-24 02:57 | 90K | |
![[ ]](/icons/unknown.gif) | munch.ace | 2007-03-24 02:52 | 90K | |
![[ ]](/icons/compressed.gif) | Fred Hoyle es Geoffrey Hoyle-Urhajok a Goncolszekerben.zip | 2007-03-24 02:54 | 90K | |
![[ ]](/icons/compressed.gif) | zola_emile_valogatott_elbeszelesek_html.zip | 2007-03-24 02:53 | 90K | |
![[ ]](/icons/compressed.gif) | karinthy_frigyes_igy_irtok_ti_rtf.zip | 2007-03-24 02:56 | 90K | |
![[ ]](/icons/compressed.gif) | ferris_stewart_hogyan_csipjunk_fel_csajokat_hu_rtf_nncl2994-703v1.zip | 2007-03-24 03:00 | 89K | |
![[ ]](/icons/compressed.gif) | Clever, Ted Az őrület szigete.zip | 2007-03-23 13:45 | 89K | |
![[TXT]](/icons/text.gif) | Új WordPad dokumentum.txt | 2007-03-24 02:54 | 89K | |
![[ ]](/icons/compressed.gif) | Gasnszovszki--Harom nap egy esztendo.zip | 2007-03-24 02:54 | 89K | |
![[ ]](/icons/compressed.gif) | Karazoni,J-Gyilkossag a patikaban.zip | 2007-03-24 02:55 | 89K | |
![[ ]](/icons/compressed.gif) | arany_laszlo_a_delibabok_hose_hu_doc_nncl1463-51bv1.zip | 2007-03-24 02:55 | 89K | |
![[ ]](/icons/compressed.gif) | A vér szava.zip | 2007-03-24 02:59 | 89K | |
![[ ]](/icons/compressed.gif) | kertesz_imre_felszamolas_html.zip | 2007-03-24 02:56 | 89K | |
![[ ]](/icons/compressed.gif) | stendhal_valogatott_elbeszelesek_html.zip | 2007-03-24 03:00 | 89K | |
![[ ]](/icons/compressed.gif) | faludy_gyorgy_vitorlan_kekovaba_html.zip | 2007-03-24 02:55 | 89K | |
![[ ]](/icons/compressed.gif) | ganszovszkij_szever_harom_nap_egy_esztendo_hu_rtf.zip | 2007-02-21 16:16 | 89K | |
![[ ]](/icons/compressed.gif) | ganszovszkij_szever_harom_nap_egy_esztendo.zip | 2007-03-24 03:00 | 89K | |
![[ ]](/icons/unknown.gif) | haegemonia.ace | 2007-03-24 02:52 | 89K | |
![[TXT]](/icons/text.gif) | k11.html | 2007-11-14 04:07 | 89K | |
![[ ]](/icons/compressed.gif) | Emile Zola-Valogatott elbeszelesek.zip | 2007-03-24 02:53 | 89K | |
![[ ]](/icons/compressed.gif) | Samanok es taltosok.zip | 2007-03-24 02:53 | 88K | |
![[ ]](/icons/compressed.gif) | borges_jorge_luis_kepzelt_lenyek_konyve_hu_txt.zip | 2007-03-24 02:56 | 88K | |
![[ ]](/icons/unknown.gif) | Kertesz P Balazs-Kulonos mendemondak Hallgatag Erikrol | 2007-03-24 02:56 | 88K | |
![[ ]](/icons/unknown.gif) | I_01.doc | 2007-11-14 02:25 | 88K | |
![[ ]](/icons/unknown.gif) | 05 - Jan Van Boomen - Az árnyékfestő.doc | 2007-03-24 02:54 | 88K | |
![[ ]](/icons/unknown.gif) | 01 - Jan van Den Boomen - Hol egykor majd a Kos országa elterül.doc | 2007-03-24 02:54 | 88K | |
![[ ]](/icons/compressed.gif) | faludy_gyorgy_bortonversek_1950-53_html.zip | 2007-03-24 02:55 | 88K | |
![[ ]](/icons/compressed.gif) | Magyar-Latin,Latin-Magyar szotar.zip | 2007-03-24 03:00 | 88K | |
![[TXT]](/icons/text.gif) | 03 - Roul Renier - Hideg karok ölelése.txt | 2007-03-24 02:54 | 88K | |
![[ ]](/icons/unknown.gif) | Sempiternin.doc | 2007-02-21 16:38 | 87K | |
![[ ]](/icons/compressed.gif) | Rejto Jeno - A megkerult cirkalo.txt.zip | 2007-03-24 02:59 | 87K | |
![[ ]](/icons/compressed.gif) | maugham_w_somerset_az_arnyek_testvere_hu_html_nncl2031-624v2.zip | 2007-03-24 03:00 | 87K | |
![[TXT]](/icons/text.gif) | Levesek 3.txt | 2007-03-24 02:59 | 87K | |
![[ ]](/icons/unknown.gif) | Meteorok viharaban[fantasztikus elbeszelesek] | 2007-03-24 02:57 | 87K | |
![[ ]](/icons/unknown.gif) | Buddha élete ASVAGHOSA.ZIP | 2007-03-24 02:53 | 86K | |
![[ ]](/icons/unknown.gif) | Kereszturi Akos-Csillagaszati tankonyv | 2007-03-24 02:56 | 86K | |
![[ ]](/icons/compressed.gif) | babula_vladimir_bumerang_hu_doc.zip | 2007-03-24 03:01 | 86K | |
![[ ]](/icons/compressed.gif) | George G. Ritchie - Visszatérés A Holnapból.DOC.zip | 2006-05-17 06:06 | 86K | |
![[ ]](/icons/layout.gif) | Fegyverek (Blade).pdf | 2007-05-03 06:45 | 86K | |
![[ ]](/icons/unknown.gif) | arnyekbolafenyre.doc | 2007-04-15 13:31 | 86K | |
![[ ]](/icons/compressed.gif) | dorta_marcello_en_remeljuk_meguszom_hu_rtf.zip | 2007-03-24 02:57 | 86K | |
![[ ]](/icons/compressed.gif) | machiavelli_a_fejedelem.zip | 2007-03-24 02:58 | 86K | |
![[ ]](/icons/compressed.gif) | jung_c_g_gondolatok_az_aparol_az_anyarol_es_a_gyermekrol_hu_rtf_nncl2640-6bav1.zip | 2007-03-24 02:52 | 86K | |
![[TXT]](/icons/text.gif) | lenard-2.html | 2007-03-24 02:59 | 86K | |
![[ ]](/icons/compressed.gif) | Anthony de Mello SJ-A sziv ebredese.zip | 2007-03-24 02:49 | 86K | |
![[ ]](/icons/layout.gif) | 101_pizza.pdf | 2007-03-24 02:59 | 86K | |
![[ ]](/icons/compressed.gif) | jung_c_g_gondolatok_a_szenvedesrol_es_a_gyogyitasrol_hu_rtf_nncl2644-6bav1.zip | 2007-03-24 02:52 | 85K | |
![[ ]](/icons/unknown.gif) | Az őrület hegyei.rar | 2007-03-24 02:55 | 85K | |
![[ ]](/icons/unknown.gif) | Lewis Padgett - Vasfedezet.rtf | 2006-07-19 16:54 | 85K | |
![[ ]](/icons/compressed.gif) | csath_geza_elbeszelesek_rtf.zip | 2007-03-24 02:52 | 85K | |
![[ ]](/icons/compressed.gif) | shaw_g_b_pygmalion.zip | 2007-03-24 02:54 | 85K | |
![[ ]](/icons/unknown.gif) | egyedul.rtf | 2007-04-15 15:37 | 85K | |
![[ ]](/icons/unknown.gif) | A megvilágosodás útja - Végigjátszás IV. rész.pd | 2007-05-03 07:01 | 85K | |
![[ ]](/icons/compressed.gif) | carroll_lewis_alice_tukororszagban_rtf.zip | 2007-03-24 02:57 | 85K | |
![[ ]](/icons/unknown.gif) | Moric Zsigmond-Arvacska | 2007-03-24 02:58 | 85K | |
![[ ]](/icons/unknown.gif) | 03 - Csicsás Gábor - Fekete farkasok.doc | 2007-03-24 02:54 | 85K | |
![[ ]](/icons/unknown.gif) | odessza.ace | 2007-03-24 02:52 | 84K | |
![[ ]](/icons/unknown.gif) | Gerd Maximovic - A segítő kéz.rtf | 2006-07-19 06:51 | 84K | |
![[ ]](/icons/compressed.gif) | A delszlav haboruk 1991-1995.zip | 2007-03-24 02:56 | 84K | |
![[ ]](/icons/compressed.gif) | Perzsa levelek-ember es polgar.zip | 2007-03-24 02:58 | 84K | |
![[ ]](/icons/compressed.gif) | ronaszegi_miklos_az_a_hires_hary_janos_hu_rtf_nncl2216-648v1.zip | 2007-03-24 03:00 | 84K | |
![[ ]](/icons/unknown.gif) | Zarándokút Kadathba.rar | 2007-03-24 02:55 | 84K | |
![[ ]](/icons/compressed.gif) | oidipusz A TALÁNY MEGFEJTŐJE.zip | 2007-03-24 03:00 | 84K | |
![[ ]](/icons/layout.gif) | Beszélgetés (minijáték) - sértésektől a lefizetésig - ismertető.pdf | 2007-05-03 06:51 | 84K | |
![[ ]](/icons/compressed.gif) | simonetta_umberto_ejszakai_utazok.zip | 2007-03-24 03:00 | 84K | |
![[ ]](/icons/compressed.gif) | Kalmar Peter-A ketezer eves papir.zip | 2007-03-24 02:56 | 83K | |
![[ ]](/icons/compressed.gif) | umberto_simonetta_ejszakai_utazok.zip | 2006-05-28 04:30 | 83K | |
![[ ]](/icons/compressed.gif) | merey_Lahor_Xween_bosszuja.zip | 2007-03-24 02:58 | 83K | |
![[ ]](/icons/compressed.gif) | Rancoise Sagan-Kushado kutya.zip | 2007-03-24 02:58 | 83K | |
![[IMG]](/icons/image2.gif) | SZI.GIF | 2007-03-24 02:59 | 83K | |
![[ ]](/icons/layout.gif) | Fegyverek (Blunt) - Tompa zúzó fegyverek.pdf | 2007-05-03 06:45 | 83K | |
![[ ]](/icons/unknown.gif) | Leigh Brackett - Rémség az űrből.rtf | 2006-07-19 16:53 | 83K | |
![[ ]](/icons/compressed.gif) | jokai_mor_a_szegenyseg_utja_html.zip | 2007-03-24 02:56 | 83K | |
![[ ]](/icons/compressed.gif) | jung_c_g_bevezetes_a_tudattalan_pszichologiajaba_rtf.zip | 2007-03-24 02:52 | 83K | |
![[ ]](/icons/compressed.gif) | gogol_az_arckep.doc.zip | 2007-03-24 02:58 | 83K | |
![[ ]](/icons/compressed.gif) | jokai_mor_a_ciganybaro_html.zip | 2007-03-24 02:56 | 83K | |
![[ ]](/icons/unknown.gif) | Konrad Fialkowski - Biohazárd.rtf | 2006-07-19 16:53 | 83K | |
![[TXT]](/icons/text.gif) | k01.html | 2007-11-13 21:03 | 83K | |
![[ ]](/icons/unknown.gif) | James Tiptree Jr - A nők akiket nem értenek a férfiak.rtf | 2006-05-29 11:00 | 82K | |
![[ ]](/icons/compressed.gif) | merey_peter_lahor_xween_bosszuja.zip | 2007-03-24 02:57 | 82K | |
![[ ]](/icons/compressed.gif) | merey_lahor_xween_bosszuja.zip | 2007-02-21 16:32 | 82K | |
![[ ]](/icons/compressed.gif) | esterhazy_peter_fancsiko_es_pinta_html.zip | 2007-03-24 02:53 | 82K | |
![[ ]](/icons/unknown.gif) | Fustolgo nyomokon.doc | 2007-04-15 15:41 | 82K | |
![[ ]](/icons/compressed.gif) | Wayne Chapman & Ed Fisher - Odalent.zip | 2007-03-23 05:21 | 82K | |
![[ ]](/icons/compressed.gif) | Lyman Frank Baum-Oz,a nagy varazslo.zip | 2007-03-24 02:57 | 82K | |
![[ ]](/icons/compressed.gif) | Brecht,Bertol-A Kaukazusi kretakor.zip | 2007-03-24 02:52 | 82K | |
![[ ]](/icons/compressed.gif) | Isvarakrisna-A szamkivetes megokolasa.zip | 2007-03-24 02:53 | 82K | |
![[ ]](/icons/unknown.gif) | Zsityinszkij ,Alekszander - A Brumm-hatás.rtf | 2006-07-19 06:26 | 82K | |
![[ ]](/icons/unknown.gif) | 09 - A farkas-szellem gyermekei (Játéktechnikai megjegyzések).doc | 2007-03-24 02:54 | 82K | |
![[ ]](/icons/compressed.gif) | Bükki Tamás A Vagyígyvanvagynem kert.zip | 2007-03-22 17:51 | 81K | |
![[ ]](/icons/compressed.gif) | augustinus_szent_szerelem_html.zip | 2007-03-24 02:49 | 81K | |
![[ ]](/icons/compressed.gif) | Kereszteny himnuszok es Szent Agoston tanitasai.zip | 2007-03-24 02:56 | 81K | |
![[ ]](/icons/compressed.gif) | foldmese.zip | 2007-03-24 02:54 | 81K | |
![[ ]](/icons/compressed.gif) | kurti_andras_mittalon_ugy.zip | 2007-03-24 02:57 | 81K | |
![[ ]](/icons/compressed.gif) | Kürti András - A mittalon ügy.zip | 2007-02-21 16:23 | 81K | |
![[ ]](/icons/compressed.gif) | moldova_gyorgy_a_kamfor_akcio_html.zip | 2007-03-24 02:58 | 81K | |
![[ ]](/icons/unknown.gif) | hobbit09.doc | 2007-03-24 02:54 | 81K | |
![[ ]](/icons/compressed.gif) | csath_geza_naplo_rtf.zip | 2007-03-24 02:52 | 81K | |
![[ ]](/icons/unknown.gif) | stephen_king_a_jaunt.rtf | 2007-11-13 21:37 | 81K | |
![[ ]](/icons/layout.gif) | Fegyverek (Bow) - Távolsági fegyverek és a muníció.pdf | 2007-05-03 06:46 | 80K | |
![[ ]](/icons/compressed.gif) | PUSKIN-Anyegin.zip | 2007-03-24 02:58 | 80K | |
![[ ]](/icons/compressed.gif) | Hermasz Pasztora-1 Latomas.zip | 2007-03-24 02:55 | 80K | |
![[ ]](/icons/compressed.gif) | kindelmann_gyozo_a_kincsesbarlang_hu_html.zip | 2007-03-24 02:56 | 80K | |
![[ ]](/icons/compressed.gif) | karinthy_ferenc_szabad_rablas_hu_rtf.zip | 2007-03-24 02:56 | 80K | |
![[ ]](/icons/compressed.gif) | Csuang Ce bolcsessege.zip | 2007-03-24 02:53 | 80K | |
![[ ]](/icons/layout.gif) | Áldozatok és jutalmak - Összefoglaló táblázat.pdf | 2007-05-03 07:23 | 80K | |
![[ ]](/icons/compressed.gif) | David Frost-Ballepesek konyve.zip | 2007-03-24 02:52 | 80K | |
![[ ]](/icons/compressed.gif) | Ambrose Bierce-Valogatott novellai.zip | 2007-03-24 02:49 | 80K | |
![[ ]](/icons/unknown.gif) | Henrich Altov - Kiscsacsi és axioma.rtf | 2006-07-19 08:25 | 80K | |
![[ ]](/icons/unknown.gif) | 01 - Raoul Renier - Fattyúrege.doc | 2007-03-24 02:54 | 80K | |
![[ ]](/icons/compressed.gif) | king_stephen_a_halalsoron_5_hu_html.zip | 2007-03-24 03:00 | 79K | |
![[ ]](/icons/compressed.gif) | Gustave Flanber--Harom mese.zip | 2007-03-24 02:55 | 79K | |
![[ ]](/icons/compressed.gif) | T Wilder-Szent Lajos kiraly hidja.zip | 2007-03-24 03:00 | 79K | |
![[ ]](/icons/compressed.gif) | Anonymus-Gesta Hungarorum.zip | 2007-03-24 02:49 | 78K | |
![[ ]](/icons/compressed.gif) | Mozes elso konyve.zip | 2007-03-24 02:58 | 78K | |
![[ ]](/icons/unknown.gif) | osszes36.ace | 2007-03-24 02:56 | 78K | |
![[ ]](/icons/unknown.gif) | otthoni_szules.rtf | 2005-03-03 18:09 | 78K | |
![[TXT]](/icons/text.gif) | k13.html | 2007-11-14 04:07 | 78K | |
![[ ]](/icons/compressed.gif) | Rejto Jeno - Egy bolond szaz bajt csinal.txt.zip | 2007-03-24 02:59 | 78K | |
![[ ]](/icons/compressed.gif) | Michail Bulgakov-Kutyasziv.zip | 2007-03-24 02:57 | 78K | |
![[TXT]](/icons/text.gif) | 01 - Wayne Chapman - Holtszezon.txt | 2007-03-24 02:54 | 78K | |
![[ ]](/icons/compressed.gif) | jung_c_g_gondolatok_a_vallasrol_es_a_keresztenysegrol_hu_rtf_nncl2641-6bav1.zip | 2007-03-24 02:52 | 77K | |
![[ ]](/icons/layout.gif) | Idorend.pdf | 2007-04-15 15:53 | 77K | |
![[ ]](/icons/compressed.gif) | faux_pierre_orult_ejszakak_hu_rtf.zip | 2007-03-24 02:58 | 77K | |
![[ ]](/icons/compressed.gif) | gereben_pal_a_boldogsag_dala_hu_rtf_nncl2845-6ebv1.zip | 2007-03-24 02:54 | 77K | |
![[ ]](/icons/unknown.gif) | Cordwainer Smith - Alfa Ralfa Körút.rtf | 2006-07-19 06:39 | 77K | |
![[ ]](/icons/compressed.gif) | apollinaire_guillaume_a_meggyilkolt_kolto_rtf.zip | 2007-03-24 02:55 | 77K | |
![[ ]](/icons/layout.gif) | Ismert kereskedők - Ismertebb árusok Cyrodiilban.pdf | 2007-05-03 06:55 | 77K | |
![[ ]](/icons/unknown.gif) | Cleve Cartmill - Sürgős küldetés.rtf | 2006-07-19 06:39 | 77K | |
![[ ]](/icons/compressed.gif) | Tasnadi Istvan-Kozellenseg.zip | 2007-03-24 03:00 | 77K | |
![[ ]](/icons/unknown.gif) | Ambrose Bierce.rar | 2007-03-24 02:49 | 77K | |
![[ ]](/icons/unknown.gif) | hobbit04.doc | 2007-03-24 02:54 | 77K | |
![[ ]](/icons/unknown.gif) | Árnyék Innsmouth fölött.rar | 2007-03-24 02:55 | 76K | |
![[TXT]](/icons/text.gif) | A mexikói.htm | 2007-03-24 02:55 | 76K | |
![[ ]](/icons/compressed.gif) | camus_albert_kozony_rtf.zip | 2007-03-24 02:49 | 76K | |
![[ ]](/icons/compressed.gif) | moricz_zsigmond_pipacsok_a_tengeren_rtf.zip | 2007-03-24 02:58 | 76K | |
![[ ]](/icons/unknown.gif) | fives_k.ace | 2007-03-24 02:52 | 76K | |
![[ ]](/icons/unknown.gif) | E-számok.rar | 2007-03-24 02:59 | 76K | |
![[ ]](/icons/compressed.gif) | William Shakespeare-Szonetek.zip | 2007-03-24 03:01 | 76K | |
![[ ]](/icons/unknown.gif) | osszes41.ace | 2007-03-24 02:56 | 76K | |
![[ ]](/icons/compressed.gif) | king_stephen_a_halalsoron_1_hu_html.zip | 2007-03-24 03:00 | 76K | |
![[ ]](/icons/unknown.gif) | hobbit17.doc | 2007-03-24 02:54 | 76K | |
![[ ]](/icons/unknown.gif) | Gorviki kém.doc | 2007-04-15 15:27 | 76K | |
![[ ]](/icons/compressed.gif) | king_stephen_a_halalsoron_3_hu_html.zip | 2007-03-24 03:00 | 75K | |
![[TXT]](/icons/text.gif) | Lent, a halottak között.htm | 2007-03-24 03:01 | 75K | |
![[ ]](/icons/unknown.gif) | Anna Rinonapoli - Időszakadék Giacomo Leopardi költeményében.rtf | 2006-07-19 06:27 | 75K | |
![[ ]](/icons/compressed.gif) | king_stephen_a_halalsoron_2_hu_html.zip | 2007-03-24 03:00 | 75K | |
![[ ]](/icons/layout.gif) | Az első kapu - Végigjátszás II. rész.pdf | 2007-05-03 07:00 | 75K | |
![[TXT]](/icons/text.gif) | kutya.htm | 2006-08-25 00:22 | 75K | |
![[ ]](/icons/unknown.gif) | E-SZAMOK.RTF | 2007-03-24 02:59 | 75K | |
![[ ]](/icons/layout.gif) | Egyetemi karrier - Kalandok a központban.pdf | 2007-05-03 07:09 | 75K | |
![[ ]](/icons/layout.gif) | Bruma - kalandok északon.pdf | 2007-05-03 07:25 | 74K | |
![[TXT]](/icons/text.gif) | szep_lovacskam.htm | 2004-12-29 12:36 | 74K | |
![[ ]](/icons/compressed.gif) | Hamvas Bela-Magia szutra.zip | 2007-03-24 02:53 | 74K | |
![[ ]](/icons/compressed.gif) | hamvas béla-mágia szutra.zip | 2007-03-24 02:55 | 74K | |
![[ ]](/icons/compressed.gif) | George Orwell - Állatfarm.zip | 2006-08-24 21:42 | 74K | |
![[TXT]](/icons/text.gif) | stalker.txt | 2007-11-14 02:42 | 74K | |
![[ ]](/icons/compressed.gif) | kertesz_imre_jegyzokonyv_pdf.zip | 2007-03-24 02:56 | 74K | |
![[ ]](/icons/compressed.gif) | king_stephen_a_halalsoron_4_hu_html.zip | 2007-03-24 03:00 | 74K | |
![[ ]](/icons/unknown.gif) | orvfiloz.ace | 2007-03-24 02:52 | 74K | |
![[ ]](/icons/compressed.gif) | moldova_gyorgy_akit_szerettek_a_nok_html.zip | 2007-03-24 02:58 | 74K | |
![[ ]](/icons/compressed.gif) | Carry, Kate Csak a szíved és semmi más....zip | 2007-03-23 05:11 | 74K | |
![[ ]](/icons/compressed.gif) | Ottlik Geza-Hajnali haztetok.zip | 2007-03-24 02:58 | 74K | |
![[ ]](/icons/compressed.gif) | Honore de Balzac-A voros vendegfogado.zip | 2007-03-24 02:55 | 74K | |
![[ ]](/icons/compressed.gif) | George Orwell-Alatfarm.zip | 2007-03-24 02:54 | 74K | |
![[ ]](/icons/compressed.gif) | arisztotelesz_poetika_hu_doc_nncl2071-62bv1.zip | 2007-03-24 02:49 | 73K | |
![[ ]](/icons/compressed.gif) | Wayne Chapman - Jutalomjáték.zip | 2007-03-23 05:21 | 73K | |
![[ ]](/icons/unknown.gif) | Bruce Sterling - A Raj.rtf | 2006-07-19 06:38 | 73K | |
![[ ]](/icons/compressed.gif) | jokai_mor_a_kalozkiraly_html.zip | 2007-03-24 02:56 | 73K | |
![[ ]](/icons/compressed.gif) | orwell_george_allatfarm_rtf.zip | 2007-03-24 02:54 | 73K | |
![[ ]](/icons/layout.gif) | Az uralkodó halála - Végigjátszás I. rész.pdf | 2007-05-03 06:59 | 73K | |
![[ ]](/icons/compressed.gif) | shaw_g_b_warrenne_mestersege_hu_rtf_nncl2025-623v1.zip | 2007-03-24 02:54 | 73K | |
![[ ]](/icons/unknown.gif) | I_05.doc | 2007-11-14 08:50 | 73K | |
![[TXT]](/icons/text.gif) | A canterville-i kísértet.htm | 2007-03-24 02:58 | 73K | |
![[ ]](/icons/compressed.gif) | csokonai_osszes_dorottya_rtf.zip | 2007-03-24 02:55 | 73K | |
![[ ]](/icons/compressed.gif) | rangane_oszi_hoppa_baba_szuletett_hu_rtf.zip | 2007-03-24 02:59 | 73K | |
![[TXT]](/icons/text.gif) | 01 - Aalish D'Mohlen - Ragadozók.txt | 2007-03-24 02:54 | 73K | |
![[ ]](/icons/compressed.gif) | S-SHANKARA--VIVEKACHUNDAMANI.zip | 2007-03-24 03:00 | 73K | |
![[ ]](/icons/compressed.gif) | Erich Kastner-A ket Lottti.zip | 2007-03-24 02:53 | 73K | |
![[ ]](/icons/unknown.gif) | 02.RTF | 2007-11-14 06:28 | 73K | |
![[ ]](/icons/layout.gif) | Gray Fox - A nagymester küldetései.pdf | 2007-05-03 07:13 | 73K | |
![[ ]](/icons/compressed.gif) | meilhart_jean_luc_a_beszelo_ora_hu_rtf.zip | 2007-03-24 02:56 | 73K | |
![[ ]](/icons/compressed.gif) | blixen_karen_babette_lakomaja_hu_rtf.zip | 2007-03-24 02:56 | 73K | |
![[TXT]](/icons/text.gif) | MENULISZ.HTM | 2007-03-24 02:59 | 73K | |
![[ ]](/icons/unknown.gif) | Vizek Városa.doc | 2007-04-15 15:42 | 73K | |
![[ ]](/icons/compressed.gif) | feher_klara_mi_szemuvegesek_hu_doc_nncl3053-706v1.zip | 2007-03-24 02:54 | 72K | |
![[ ]](/icons/compressed.gif) | Dr Schultheisz Emil-Medicina a reneszansz egyetemen.zip | 2007-03-24 02:53 | 72K | |
![[TXT]](/icons/text.gif) | lenard-1.html | 2007-03-24 02:59 | 72K | |
![[ ]](/icons/compressed.gif) | szent-gyorgyi_albert_az_orult_majom_hu_rtf.zip | 2007-03-24 03:00 | 72K | |
![[ ]](/icons/compressed.gif) | parti_nagy_lajos_a_test_angyala_hu_html.zip | 2007-03-24 02:58 | 72K | |
![[ ]](/icons/unknown.gif) | 05 - Juhász Viktor - A hős.doc | 2007-03-24 02:54 | 72K | |
![[ ]](/icons/unknown.gif) | Átkok Tornya.doc | 2007-04-15 15:38 | 72K | |
![[ ]](/icons/compressed.gif) | dickens_charles_karacsonyi_enek_rtf.zip | 2007-03-24 02:52 | 72K | |
![[ ]](/icons/compressed.gif) | ykpdf_utolso.zip | 2007-03-24 02:54 | 72K | |
![[ ]](/icons/unknown.gif) | osszes27.ace | 2007-03-24 02:56 | 72K | |
![[ ]](/icons/compressed.gif) | tolsztoj_harom_halal_html.zip | 2007-03-24 02:57 | 72K | |
![[ ]](/icons/compressed.gif) | Rejto Jeno - Nincs kegyelem.txt.zip | 2007-03-24 02:59 | 72K | |
![[ ]](/icons/unknown.gif) | 18.RTF | 2007-11-13 22:10 | 72K | |
![[ ]](/icons/compressed.gif) | Longyear - Kedves ellenségem.zip | 2007-02-21 16:05 | 72K | |
![[ ]](/icons/unknown.gif) | oidipusz.ace | 2007-03-24 02:52 | 72K | |
![[ ]](/icons/unknown.gif) | James Schmitz - A nagyapa.rtf | 2006-07-19 16:22 | 72K | |
![[ ]](/icons/compressed.gif) | Fridrich Durrenmatt-A csendestars.zip | 2007-03-24 02:54 | 72K | |
![[ ]](/icons/compressed.gif) | katona_jozsef_bank_ban_rtf.zip | 2007-03-24 02:56 | 71K | |
![[ ]](/icons/compressed.gif) | Buddha.zip | 2007-03-24 02:53 | 71K | |
![[ ]](/icons/compressed.gif) | csukas_istvan_pintyoke_cirkusz_vilagszam_html.zip | 2007-03-24 02:57 | 71K | |
![[ ]](/icons/unknown.gif) | Henrik Ibsen- A vadkacsa.ace | 2007-03-24 02:55 | 71K | |
![[TXT]](/icons/text.gif) | Janika.HTM | 2007-03-24 02:52 | 71K | |
![[ ]](/icons/compressed.gif) | julier_ferenc_a_hadvezetes_muveszete.zip | 2007-03-24 02:56 | 71K | |
![[ ]](/icons/layout.gif) | Kapuzárás és navigálás - Tájékozódás a kapukon túl.pdf | 2007-05-03 06:53 | 71K | |
![[ ]](/icons/unknown.gif) | A kezdet.doc | 2007-04-15 15:41 | 71K | |
![[ ]](/icons/compressed.gif) | jokai_mor_a_varchonitak_html.zip | 2007-03-24 02:56 | 71K | |
![[TXT]](/icons/text.gif) | k09.html | 2007-11-14 04:07 | 71K | |
![[ ]](/icons/compressed.gif) | barsi_odon_a_balvanyimado_hu_doc_nncl861-412v2.zip | 2007-03-24 02:50 | 71K | |
![[ ]](/icons/compressed.gif) | Ray Badbury-Guli.zip | 2007-03-24 02:59 | 71K | |
![[ ]](/icons/unknown.gif) | poetika.ace | 2007-03-24 02:52 | 71K | |
![[ ]](/icons/compressed.gif) | szepes_maria_a_mindennapi_elet_magiaja.zip | 2007-03-24 03:00 | 70K | |
![[ ]](/icons/compressed.gif) | Tiszta esz-Valogatott irasok.zip | 2007-03-24 03:00 | 70K | |
![[ ]](/icons/unknown.gif) | figaroha.ace | 2007-03-24 02:52 | 70K | |
![[ ]](/icons/compressed.gif) | csukas_istvan_mirr-mur_a_kandur_html.zip | 2007-03-24 02:57 | 70K | |
![[ ]](/icons/unknown.gif) | 05 - Alan O'Connor - Darton nevében.doc | 2007-03-24 02:54 | 70K | |
![[ ]](/icons/unknown.gif) | Ester Albaryu - A Torony.rtf | 2005-07-27 01:54 | 69K | |
![[ ]](/icons/unknown.gif) | Gordon R Dickson - Az a bizonyos homokszem.rtf | 2006-07-19 06:52 | 69K | |
![[ ]](/icons/compressed.gif) | shaw_g_b_az ordog cimboraja_hu_rtf_nncl2127-637v1.zip | 2007-03-24 02:54 | 69K | |
![[TXT]](/icons/text.gif) | rachel.htm | 2006-08-25 00:26 | 69K | |
![[ ]](/icons/compressed.gif) | ensler_eve_a_vagina_monologok_hu_rtf.zip | 2007-03-24 02:53 | 69K | |
![[ ]](/icons/compressed.gif) | arany_laszlo_osszes_koltemenye_rtf.zip | 2007-03-24 02:55 | 69K | |
![[ ]](/icons/unknown.gif) | 04 - Raoul Renier - Tűzvihar.doc | 2007-03-24 02:54 | 69K | |
![[ ]](/icons/unknown.gif) | Henrich Altov - Meteorok viharában.rtf | 2006-07-19 08:25 | 68K | |
![[ ]](/icons/compressed.gif) | William Shakespeare-Romeo es Julia.zip | 2007-03-24 03:01 | 68K | |
![[ ]](/icons/unknown.gif) | Gérard Klein - Rehabilitáció.rtf | 2006-07-19 06:52 | 68K | |
![[ ]](/icons/compressed.gif) | Havihegyi bucsuskonyv-szent enekek.zip | 2007-03-24 02:53 | 68K | |
![[ ]](/icons/unknown.gif) | 06 - Bridget Winters - Messzi part.doc | 2007-03-24 02:54 | 68K | |
![[ ]](/icons/compressed.gif) | brecht_bertolt_a_kaukazusi_kretakor.zip | 2007-03-24 02:51 | 68K | |
![[ ]](/icons/compressed.gif) | others.zip | 2007-08-04 08:26 | 68K | |
![[ ]](/icons/compressed.gif) | bradbury_ray_novellak.zip | 2007-03-24 02:59 | 68K | |
![[ ]](/icons/compressed.gif) | Ray Bradbury - Others.zip | 2006-08-24 23:27 | 68K | |
![[ ]](/icons/compressed.gif) | Hegedus Geza-FONATLANSAGOK 70 tortenelmi erdekesseg es hiteles pletyka.zip | 2007-03-24 02:55 | 68K | |
![[ ]](/icons/unknown.gif) | osszes35.ace | 2007-03-24 02:56 | 68K | |
![[ ]](/icons/unknown.gif) | Swami Vikananda-Patanjali joga.ZIP | 2007-03-24 03:00 | 68K | |
![[ ]](/icons/compressed.gif) | apollinaire_guillaume_tanulmanyok_rtf.zip | 2007-03-24 02:55 | 68K | |
![[ ]](/icons/unknown.gif) | Annie Besant A gondolaterő.rar | 2007-03-24 02:53 | 68K | |
![[ ]](/icons/compressed.gif) | William Shakespeare-Szeget szeggel.zip | 2007-03-24 03:01 | 68K | |
![[ ]](/icons/unknown.gif) | 1.DOC | 2007-11-13 22:43 | 68K | |
![[ ]](/icons/compressed.gif) | Juhani Nagy Janos-Neveto kislexikon.zip | 2007-03-24 02:56 | 67K | |
![[TXT]](/icons/text.gif) | k06.html | 2007-11-14 06:41 | 67K | |
![[ ]](/icons/layout.gif) | S'Krivva - Kalandok Bravil környékén.pdf | 2007-05-03 07:12 | 67K | |
![[ ]](/icons/compressed.gif) | Ernest Theodor Amadeus Hoffmann-Diotoro.zip | 2007-03-24 02:53 | 67K | |
![[IMG]](/icons/image2.gif) | chandler_raymond_visszajatszas.gif | 2007-03-24 02:59 | 67K | |
![[ ]](/icons/unknown.gif) | 09 - Jan Van Den Boomen - A vérgázlónál.doc | 2007-03-24 02:54 | 67K | |
![[ ]](/icons/compressed.gif) | orwell_george_az_oroszlan_es_az_egyszarvu_hu_rtf.zip | 2007-03-24 02:54 | 67K | |
![[ ]](/icons/unknown.gif) | poganyv.ace | 2007-03-24 02:52 | 67K | |
![[ ]](/icons/unknown.gif) | g165.ace | 2007-03-24 02:52 | 67K | |
![[ ]](/icons/unknown.gif) | osszes26.ace | 2007-03-24 02:56 | 67K | |
![[ ]](/icons/compressed.gif) | moldova_gyorgy_a_rovid_elet_titka_html.zip | 2007-03-24 02:58 | 67K | |
![[ ]](/icons/unknown.gif) | 2_12.doc | 2007-11-13 21:34 | 67K | |
![[ ]](/icons/layout.gif) | Cheydinhal.pdf | 2007-05-03 07:07 | 66K | |
![[ ]](/icons/unknown.gif) | hobbit15.doc | 2007-03-24 02:54 | 66K | |
![[TXT]](/icons/text.gif) | WOOTTON.TXT | 2007-03-24 02:54 | 66K | |
![[ ]](/icons/compressed.gif) | Szerdahelyi Szabolcs-Kejutazas.zip | 2007-03-24 03:00 | 66K | |
![[ ]](/icons/compressed.gif) | martin_les_x_aktak_tigris_tigris_hu_rtf.zip | 2007-03-24 02:57 | 66K | |
![[TXT]](/icons/text.gif) | 03 - Jan van den Boomen - Hősi kard.txt | 2007-03-24 02:54 | 66K | |
![[ ]](/icons/compressed.gif) | Lazar Ervin-A kisfiu meg az oroszlanok.zip | 2007-03-24 02:57 | 66K | |
![[ ]](/icons/unknown.gif) | hobbit03.doc | 2007-03-24 02:54 | 66K | |
![[ ]](/icons/compressed.gif) | lem_stanislaw_felteteles_reflex.zip | 2007-03-24 03:00 | 65K | |
![[ ]](/icons/compressed.gif) | Stanislaw Lem - Felteteles reflex.zip | 2006-05-31 08:48 | 65K | |
![[TXT]](/icons/text.gif) | Az Usher - ház vége.htm | 2007-03-24 02:53 | 65K | |
![[ ]](/icons/compressed.gif) | moricz_zsigmond_nem_elhetek_muzsikaszo_nelkul_rtf.zip | 2007-03-24 02:58 | 65K | |
![[ ]](/icons/unknown.gif) | Barry N Malzberg - A Róma nevű galaktika.rtf | 2006-07-19 06:31 | 65K | |
![[ ]](/icons/compressed.gif) | Lazar Ervin-A hetfeju tunder.zip | 2007-03-24 02:57 | 65K | |
![[ ]](/icons/compressed.gif) | Éjszakai látogató 1.DOC.zip | 2007-03-24 02:49 | 65K | |
![[TXT]](/icons/text.gif) | halottak.htm | 2006-08-25 00:00 | 65K | |
![[ ]](/icons/compressed.gif) | Hendrich Heine-Teli rege.zip | 2007-03-24 02:55 | 64K | |
![[ ]](/icons/compressed.gif) | Monty Python-Brian elete.zip | 2007-03-24 02:58 | 64K | |
![[ ]](/icons/compressed.gif) | Orkeny Istvan-Totek.zip | 2007-03-24 02:58 | 64K | |
![[ ]](/icons/unknown.gif) | III_01.doc | 2007-11-13 23:05 | 64K | |
![[ ]](/icons/unknown.gif) | A parázsszem_ek erdeje.doc | 2007-03-24 02:52 | 64K | |
![[ ]](/icons/unknown.gif) | 05 - Juhász Viktor - Szélvihar.doc | 2007-03-24 02:54 | 64K | |
![[ ]](/icons/unknown.gif) | 11.RTF | 2007-11-14 02:28 | 64K | |
![[ ]](/icons/compressed.gif) | Ivan Antonovics Jefremov - A Kígyó Szíve.zip | 2007-03-26 15:30 | 64K | |
![[ ]](/icons/compressed.gif) | heinlein_robert_korhinta.zip | 2007-03-24 02:59 | 64K | |
![[ ]](/icons/compressed.gif) | HeinleinKorhinta.zip | 2007-02-21 16:36 | 64K | |
![[ ]](/icons/compressed.gif) | Heinlein - Korhinta.zip | 2005-06-22 15:36 | 64K | |
![[ ]](/icons/unknown.gif) | 04 - Alish D'Mohlen - Hazatérés.doc | 2007-03-24 02:54 | 64K | |
![[ ]](/icons/compressed.gif) | schneider_margit_gyilkost_szeretek.zip | 2007-03-24 03:00 | 63K | |
![[ ]](/icons/compressed.gif) | Book of Enoch.zip | 2007-03-24 02:52 | 63K | |
![[ ]](/icons/compressed.gif) | Fábri Péter_Negyvenkilenc nap - kisregény - word.zip | 2006-01-07 09:08 | 63K | |
![[TXT]](/icons/text.gif) | Hu Bálint nemzetközösségi algakutató levelei az utókornak.htm | 2007-03-24 02:57 | 63K | |
![[ ]](/icons/unknown.gif) | A suttogás a sötétben.rar | 2007-03-24 02:55 | 63K | |
![[ ]](/icons/unknown.gif) | 2_10.doc | 2007-11-13 21:34 | 63K | |
![[ ]](/icons/unknown.gif) | 02 - Csigás Gábor - Ynevi dialógus.doc | 2007-03-24 02:54 | 63K | |
![[ ]](/icons/unknown.gif) | osszes54.ace | 2007-03-24 02:56 | 63K | |
![[ ]](/icons/compressed.gif) | faludy_gyorgy_a_pompeji_strazsan_html.zip | 2007-03-24 02:55 | 63K | |
![[ ]](/icons/unknown.gif) | hobbit14.doc | 2007-03-24 02:54 | 63K | |
![[ ]](/icons/unknown.gif) | III_03.doc | 2007-11-13 23:06 | 63K | |
![[ ]](/icons/unknown.gif) | napsugar.rtf | 2007-04-15 13:51 | 62K | |
![[ ]](/icons/compressed.gif) | William Shakespeare-Janos kiraly.zip | 2007-03-24 03:01 | 62K | |
![[ ]](/icons/unknown.gif) | Út a Felhők Templomába - Végigjátszás III. rész | 2007-05-03 07:00 | 62K | |
![[ ]](/icons/unknown.gif) | Lino Aldani - Az álomfilm.rtf | 2006-07-10 20:30 | 62K | |
![[TXT]](/icons/text.gif) | RPG_HU - - Mesélőknek - Khad rettenete (M_A_G_U_S_ kalandmodul-vázlat).htm | 2007-04-15 14:53 | 62K | |
![[IMG]](/icons/image2.gif) | borito.gif | 2004-10-04 05:12 | 62K | |
![[ ]](/icons/unknown.gif) | hobbit10.doc | 2007-03-24 02:54 | 62K | |
![[TXT]](/icons/text.gif) | Bradley-A HIV hitves.txt | 2006-05-29 10:56 | 62K | |
![[ ]](/icons/unknown.gif) | Annie Besant Az ember és testei.rar | 2007-03-24 02:53 | 62K | |
![[ ]](/icons/compressed.gif) | wreen_c_az_alarcos_fantom_hu_doc.zip | 2007-03-24 02:52 | 62K | |
![[ ]](/icons/unknown.gif) | 4.DOC | 2007-11-14 08:46 | 62K | |
![[TXT]](/icons/text.gif) | k04.html | 2007-11-14 08:47 | 62K | |
![[ ]](/icons/unknown.gif) | I_07.doc | 2007-11-14 08:50 | 62K | |
![[ ]](/icons/unknown.gif) | Címlap.doc | 2007-04-15 15:15 | 62K | |
![[TXT]](/icons/text.gif) | ufotort.txt | 2007-03-24 02:58 | 61K | |
![[TXT]](/icons/text.gif) | 02 - Jan van den Boomen - Kadal kedve szerint.txt | 2007-03-24 02:54 | 61K | |
![[IMG]](/icons/image2.gif) | 01.gif | 2007-11-14 09:46 | 61K | |
![[ ]](/icons/compressed.gif) | Buddhizmus Magyaroszagon.zip | 2007-03-24 02:53 | 61K | |
![[ ]](/icons/unknown.gif) | 14.RTF | 2007-11-13 22:26 | 61K | |
![[ ]](/icons/unknown.gif) | Ranoran átka.doc | 2007-04-15 16:30 | 61K | |
![[ ]](/icons/unknown.gif) | 17.RTF | 2007-11-13 22:10 | 61K | |
![[ ]](/icons/compressed.gif) | rose_reginald_12_duhos_ember_doc.zip | 2007-03-24 02:59 | 61K | |
![[ ]](/icons/compressed.gif) | ykpdf_dalparbaj.zip | 2007-03-24 02:54 | 61K | |
![[ ]](/icons/compressed.gif) | milne_a_a_micimacko_kuckoja.zip | 2007-03-24 02:49 | 61K | |
![[ ]](/icons/compressed.gif) | cannon_titus_vannak_meg_csodak_hu_doc.zip | 2007-03-24 03:00 | 61K | |
![[ ]](/icons/compressed.gif) | Arthur C Clarke - Éden előtt.zip | 2007-03-23 13:30 | 61K | |
![[ ]](/icons/unknown.gif) | H Beam Piper - Skizofrén történelem.rtf | 2006-07-10 19:51 | 61K | |
![[ ]](/icons/unknown.gif) | 03 - Damien Forestal - Rejtözö hold éji szem.doc | 2007-03-24 02:54 | 61K | |
![[ ]](/icons/compressed.gif) | Bindorffer Gyorgyi-Ter,ido,identitas.zip | 2007-03-24 02:51 | 60K | |
![[ ]](/icons/compressed.gif) | Knight, Damon_Négyes fogat - html.zip | 2006-01-07 08:52 | 60K | |
![[ ]](/icons/compressed.gif) | la_rochefoucauld_maximak_hu_html.zip | 2007-03-24 02:54 | 60K | |
![[ ]](/icons/unknown.gif) | hobbit13.doc | 2007-03-24 02:54 | 60K | |
![[ ]](/icons/compressed.gif) | Isaac Asimov - Robotváros I.zip | 2007-03-22 05:30 | 60K | |
![[ ]](/icons/compressed.gif) | hu_balint_nemzetkozossegi.zip | 2007-03-24 02:57 | 60K | |
![[ ]](/icons/unknown.gif) | Colin Kapp - A bűnfürkésző.rtf | 2006-07-10 19:36 | 60K | |
![[ ]](/icons/compressed.gif) | csukas_istvan_susuke_ujabb_kalandjai_html.zip | 2007-03-24 02:57 | 60K | |
![[ ]](/icons/compressed.gif) | mann_thomas_a_torveny_rtf.zip | 2007-03-24 03:00 | 60K | |
![[ ]](/icons/unknown.gif) | Szever Ganszovszkij - Jön az ember.RTF | 2006-06-25 07:20 | 60K | |
![[ ]](/icons/compressed.gif) | Lazar Ervin-A manogyar.zip | 2007-03-24 02:57 | 60K | |
![[ ]](/icons/compressed.gif) | lem_stanislaw_ismetles.zip | 2007-03-24 03:00 | 59K | |
![[ ]](/icons/compressed.gif) | Stanislaw Lem - Ismétlés.zip | 2006-05-29 11:27 | 59K | |
![[ ]](/icons/unknown.gif) | osszes53.ace | 2007-03-24 02:56 | 59K | |
![[TXT]](/icons/text.gif) | ZILAHY1.HTM | 2007-03-24 02:59 | 59K | |
![[ ]](/icons/compressed.gif) | William Shakespeare-Julius Caezar.zip | 2007-03-24 03:01 | 59K | |
![[ ]](/icons/compressed.gif) | feher_klara_lesz_nekem_egy_szigetem_hu_doc.zip | 2007-03-24 02:54 | 59K | |
![[TXT]](/icons/text.gif) | 11.HTM | 2007-03-24 02:55 | 59K | |
![[TXT]](/icons/text.gif) | ZILAHY5.HTM | 2007-03-24 02:59 | 59K | |
![[ ]](/icons/compressed.gif) | Abdurahman H H Aden-Szomali bolcsesegek.zip | 2007-03-24 02:53 | 59K | |
![[TXT]](/icons/text.gif) | horla.htm | 2006-08-24 18:23 | 59K | |
![[ ]](/icons/unknown.gif) | Szent Jakab apostol 5.konyve | 2007-03-24 03:00 | 59K | |
![[ ]](/icons/unknown.gif) | chapman_wayne_jutalomjatek.ZIP | 2007-03-24 03:01 | 59K | |
![[ ]](/icons/unknown.gif) | Brown, Eric - Időfogoly [HUN].rtf | 2006-05-29 11:02 | 59K | |
![[ ]](/icons/unknown.gif) | hobbit18.doc | 2007-03-24 02:54 | 59K | |
![[ ]](/icons/layout.gif) | Kémek - Végigjátszás V. rész.pdf | 2007-05-03 07:01 | 59K | |
![[TXT]](/icons/text.gif) | Esős évszak.htm | 2007-03-24 03:00 | 59K | |
![[ ]](/icons/unknown.gif) | H. P. Lovecraft - Árnyék az idon túlról.rar | 2007-03-24 02:55 | 59K | |
![[ ]](/icons/unknown.gif) | 06.RTF | 2007-11-14 02:28 | 59K | |
![[ ]](/icons/compressed.gif) | Éjszakai látogató 3.doc.zip | 2007-03-24 02:49 | 59K | |
![[ ]](/icons/unknown.gif) | II_01.doc | 2007-11-14 03:34 | 59K | |
![[ ]](/icons/unknown.gif) | Hajsza a lovakért2.doc | 2007-04-15 15:20 | 59K | |
![[ ]](/icons/unknown.gif) | Aries receptjei.doc | 2007-03-24 02:59 | 59K | |
![[ ]](/icons/unknown.gif) | A lány, akit holdfényb_l sz_tt a 300 éves mágia.DOC | 2007-03-24 02:52 | 59K | |
![[ ]](/icons/unknown.gif) | 03 - Novák Csanád - Ricaro tévedése.doc | 2007-03-24 02:54 | 59K | |
![[ ]](/icons/compressed.gif) | Sárga Nap.doc.zip | 2007-03-24 02:49 | 58K | |
![[ ]](/icons/compressed.gif) | wells_h_g_kokori_tortenet_rtf.zip | 2007-03-24 02:55 | 58K | |
![[ ]](/icons/compressed.gif) | karinthy_frigyes_tanar_ur_kerem_rtf.zip | 2007-03-24 02:56 | 58K | |
![[ ]](/icons/unknown.gif) | hobbit19.doc | 2007-03-24 02:54 | 58K | |
![[ ]](/icons/compressed.gif) | esterhazy_peter_bucsuszimfonia_html.zip | 2007-03-24 02:53 | 58K | |
![[ ]](/icons/compressed.gif) | Indian asszonyok bolcsessege.zip | 2007-03-24 02:53 | 58K | |
![[TXT]](/icons/text.gif) | ZILAHY6.HTM | 2007-03-24 02:59 | 58K | |
![[ ]](/icons/unknown.gif) | James Blish - Közös idő.rtf | 2006-07-10 20:15 | 58K | |
![[ ]](/icons/compressed.gif) | romhanyi_jozsef_nagy_szamarful_hu_rtf_nncl3218-722v1.zip | 2007-03-24 03:00 | 58K | |
![[ ]](/icons/compressed.gif) | Fekete Kristóf_Gonosz Manó FC - sci-fi - txt.zip | 2006-01-07 08:48 | 58K | |
![[ ]](/icons/compressed.gif) | Dummerth Dezso-Irastudok kuzdelmei.zip | 2007-03-24 02:53 | 58K | |
![[ ]](/icons/compressed.gif) | dorta_marcello_isten_ingyer_teremtett_bennunket_hu_rtf_nncl2823-6e4v2.zip | 2007-03-24 02:57 | 58K | |
![[ ]](/icons/compressed.gif) | baudrillard_jean_a_szimulakrum_elsobbsege_hu_doc.zip | 2007-03-24 02:56 | 58K | |
![[ ]](/icons/unknown.gif) | Walter M Miller Jr - Crucifixus etiam.rtf | 2006-06-25 07:34 | 58K | |
![[ ]](/icons/unknown.gif) | Ranil szeme.doc | 2007-04-15 16:30 | 58K | |
![[ ]](/icons/compressed.gif) | stingl_miloslav_az_indian_futo_hu_html.zip | 2007-03-24 02:58 | 57K | |
![[ ]](/icons/compressed.gif) | Samszu d-Din Muhammad Hafiz-Versek.zip | 2007-03-24 03:00 | 57K | |
![[ ]](/icons/compressed.gif) | Isaac Asimov - Robotváros II.zip | 2007-03-22 05:30 | 57K | |
![[ ]](/icons/unknown.gif) | Lewis Padgett - A Tvonki.rtf | 2006-07-10 20:29 | 57K | |
![[ ]](/icons/unknown.gif) | Scorba - Az Elefántember legendája.rtf | 2006-06-25 07:17 | 57K | |
![[ ]](/icons/compressed.gif) | Isaac Asimov - Alapítvány sorozat -Az Alapítvány félelme.zip | 2007-03-22 05:29 | 57K | |
![[ ]](/icons/compressed.gif) | Isaac Asimov - Alapítvány sorozat - Az Alapítvány félelme.zip | 2007-03-22 05:08 | 57K | |
![[ ]](/icons/compressed.gif) | mcqueen_eugene_a_remulet_napja_hu_doc_nncl2068-62bv2.zip | 2007-03-24 02:53 | 57K | |
![[ ]](/icons/compressed.gif) | montanus_ambrose_komics_hu_html.zip | 2007-03-24 02:49 | 57K | |
![[ ]](/icons/compressed.gif) | Ambrose Montanus-Az ordog es az idegen[KOMICS].zip | 2007-03-24 02:49 | 57K | |
![[ ]](/icons/compressed.gif) | Isaac Asimov - Az Alapítvány félelme.zip | 2007-03-22 05:08 | 57K | |
![[ ]](/icons/unknown.gif) | Annie Besant Reinkarnáció – az újraszületés törvénye.rar | 2007-03-24 02:53 | 57K | |
![[TXT]](/icons/text.gif) | A kút és az inga.htm | 2007-03-24 02:53 | 57K | |
![[ ]](/icons/layout.gif) | Borító Szöveg.pdf | 2007-03-24 02:54 | 57K | |
![[ ]](/icons/compressed.gif) | Fekete Kristóf_Ebbe tuti a föld is beleremeg - sci-fi - txt.zip | 2006-01-07 08:48 | 57K | |
![[ ]](/icons/compressed.gif) | heller_david_es_elisabeth_gyermekgondolatok_istenrol_hu_rtf.zip | 2007-03-24 02:53 | 57K | |
![[ ]](/icons/layout.gif) | A Daedra vére - Végigjátszás VI. rész.pdf | 2007-05-03 07:02 | 57K | |
![[ ]](/icons/unknown.gif) | William Tenn (Philip Klass) - A Föld felszabadítása.rtf | 2006-06-25 07:34 | 57K | |
![[ ]](/icons/unknown.gif) | Nemere_Istvan_Szomszedom_a_halal.sxw | 2007-03-24 02:58 | 57K | |
![[ ]](/icons/unknown.gif) | L G Ballard - Mindent a fogyasztóért.rtf | 2006-07-10 20:25 | 57K | |
![[ ]](/icons/layout.gif) | A brumai kapu - Végigjátszás VII. rész.pdf | 2007-05-03 07:02 | 57K | |
![[ ]](/icons/unknown.gif) | Nagy Lajos-Keptelen termeszetrajz.ZIP | 2007-03-24 02:58 | 57K | |
![[ ]](/icons/compressed.gif) | Edgard Allan Poe-Valogatott novellak.zip | 2007-03-24 02:53 | 57K | |
![[ ]](/icons/unknown.gif) | 1_6.doc | 2007-11-14 02:13 | 57K | |
![[ ]](/icons/compressed.gif) | Fekete Kristóf_Hullámvasút-effektus - sci-fi - txt.zip | 2006-01-07 08:48 | 56K | |
![[ ]](/icons/unknown.gif) | 10.DOC | 2007-11-13 22:43 | 56K | |
![[ ]](/icons/layout.gif) | Az Istenek vére - Végigjátszás VIII. rész.pdf | 2007-05-03 07:02 | 56K | |
![[ ]](/icons/unknown.gif) | Raffy4 - Legenda.rtf | 2006-06-25 06:40 | 56K | |
![[TXT]](/icons/text.gif) | ZILAHY8.HTM | 2007-03-24 02:59 | 56K | |
![[ ]](/icons/unknown.gif) | Richard Gehman - A gépezet.rtf | 2006-06-25 06:57 | 56K | |
![[ ]](/icons/compressed.gif) | J Goldenlane-Tundermesek.zip | 2007-03-24 02:55 | 56K | |
![[ ]](/icons/unknown.gif) | Kristof Attila-A vilagegyetem todogyulladasa.ZIP | 2007-03-24 02:56 | 56K | |
![[ ]](/icons/compressed.gif) | gogol_roma.doc.zip | 2007-03-24 02:58 | 56K | |
![[ ]](/icons/compressed.gif) | Drescher Pal-Regi magyar gyermekkonyvek 1538-1875.zip | 2007-03-24 02:57 | 56K | |
![[ ]](/icons/unknown.gif) | I_04.doc | 2007-11-14 02:25 | 56K | |
![[ ]](/icons/unknown.gif) | II_08.doc | 2007-11-13 21:29 | 56K | |
![[ ]](/icons/compressed.gif) | Nesta H Webster-A szabadkomuvesseg eredete 1-2.zip | 2007-03-24 02:58 | 56K | |
![[ ]](/icons/compressed.gif) | csukas_istvan_oriza-triznyak_html.zip | 2007-03-24 02:57 | 56K | |
![[ ]](/icons/compressed.gif) | huxley_aldous_az_eszleles_kapui.zip | 2007-03-24 02:49 | 56K | |
![[ ]](/icons/compressed.gif) | brecht_bertolt_koldusopera.zip | 2007-03-24 02:51 | 56K | |
![[ ]](/icons/unknown.gif) | Larry Niven - A birodalom emléke.rtf | 2006-07-10 20:27 | 56K | |
![[ ]](/icons/compressed.gif) | a_szazhetvenedik_orszag.zip | 2007-03-24 02:57 | 56K | |
![[ ]](/icons/compressed.gif) | babics_imre_a_kek_utem_lovagrend_hu_rtf_nncl2459-68ev1.zip | 2007-03-24 02:49 | 55K | |
![[TXT]](/icons/text.gif) | ZILAHY2.HTM | 2007-03-24 02:59 | 55K | |
![[ ]](/icons/compressed.gif) | a_vilagegyetem_tudogyulladasa.zip | 2007-02-21 16:27 | 55K | |
![[ ]](/icons/unknown.gif) | 2.DOC | 2007-11-14 08:46 | 55K | |
![[ ]](/icons/unknown.gif) | 07 - A kőfiak (Mágia).doc | 2007-03-24 02:54 | 55K | |
![[ ]](/icons/unknown.gif) | 03.RTF | 2007-11-14 06:28 | 55K | |
![[ ]](/icons/compressed.gif) | Rejto Jeno - Az elsikkasztott penztaros.doc.zip | 2007-03-24 02:59 | 55K | |
![[ ]](/icons/layout.gif) | Karrier - Ranglista és követelményei.pdf | 2007-05-03 07:12 | 55K | |
![[ ]](/icons/unknown.gif) | Jerome Bixby - Élni jó.rtf | 2006-07-10 20:15 | 55K | |
![[ ]](/icons/compressed.gif) | fox_jeremy_parizsi_kaland_hu_rtf.zip | 2007-03-24 02:56 | 55K | |
![[ ]](/icons/compressed.gif) | Lem, Stanislaw_Ismétlés - html.zip | 2006-01-07 08:50 | 55K | |
![[ ]](/icons/unknown.gif) | Árnyék az időn túlról.rar | 2007-03-24 02:55 | 55K | |
![[ ]](/icons/compressed.gif) | Isaac Asimov - Alapítvány sorozat -Alapítvány és Káosz.zip | 2007-03-22 05:29 | 55K | |
![[ ]](/icons/compressed.gif) | gogol_a_nyevszkij_proszpekt.doc.zip | 2007-03-24 02:58 | 55K | |
![[ ]](/icons/compressed.gif) | H G Wells-Kőkori tortenet.zip | 2007-03-24 02:55 | 54K | |
![[ ]](/icons/unknown.gif) | Jutalomjáték.ZIP | 2007-03-24 03:01 | 54K | |
![[ ]](/icons/compressed.gif) | kokori történetek.zip | 2006-08-24 18:21 | 54K | |
![[TXT]](/icons/text.gif) | 12.HTM | 2007-03-24 02:55 | 54K | |
![[ ]](/icons/compressed.gif) | Chapman, Wayne_Jutalomjáték - fantasy - txt.zip | 2006-01-07 08:52 | 54K | |
![[ ]](/icons/compressed.gif) | king_stephen_ezust_pisztolygolyok.zip | 2007-03-24 03:00 | 54K | |
![[ ]](/icons/unknown.gif) | C L Moore - Út az időbe.rtf | 2006-07-10 19:33 | 54K | |
![[ ]](/icons/unknown.gif) | 3_3.doc | 2007-11-13 22:05 | 54K | |
![[ ]](/icons/compressed.gif) | Éjszakai látogató 2.doc.zip | 2007-03-24 02:49 | 54K | |
![[ ]](/icons/compressed.gif) | gorkij_maxim_ejjeli_menedekhely_html.zip | 2007-03-24 02:57 | 54K | |
![[ ]](/icons/compressed.gif) | Orson Scott Card - Szemet szemért.zip | 2007-03-19 18:43 | 54K | |
![[TXT]](/icons/text.gif) | 03_04.HTM | 2007-03-24 02:55 | 54K | |
![[ ]](/icons/compressed.gif) | Goncz Arpad-Hazaerkezes.zip | 2007-03-24 02:55 | 54K | |
![[ ]](/icons/compressed.gif) | Carmina Burana-Kozepkori diakdalok.zip | 2007-03-24 02:52 | 54K | |
![[ ]](/icons/compressed.gif) | moricz_zsigmond_a_szerelmes_level_rtf.zip | 2007-03-24 02:58 | 54K | |
![[ ]](/icons/unknown.gif) | Robert F Young - Szeptemberi nap.rtf | 2006-06-25 07:08 | 54K | |
![[TXT]](/icons/text.gif) | k10.html | 2007-11-14 04:07 | 54K | |
![[ ]](/icons/unknown.gif) | 8.DOC | 2007-11-13 21:53 | 54K | |
![[ ]](/icons/unknown.gif) | Eric Brown - Időfogoly.rtf | 2006-07-10 19:43 | 54K | |
![[ ]](/icons/compressed.gif) | Devenyi Tibor-Gamma kommando.zip | 2007-03-24 02:52 | 53K | |
![[ ]](/icons/compressed.gif) | H P Blavatski-A csend hangja.zip | 2007-03-24 02:55 | 53K | |
![[ ]](/icons/compressed.gif) | moricz_zsigmond_nem_elhetek_muzsikaszo_nelkul_szindarab_rtf.zip | 2007-03-24 02:58 | 53K | |
![[ ]](/icons/unknown.gif) | P Schuyler Miller - A barlang.rtf | 2006-06-25 06:35 | 53K | |
![[ ]](/icons/compressed.gif) | William Shakespeare - Sok hűhó semmiért.zip | 2007-03-24 03:01 | 53K | |
![[TXT]](/icons/text.gif) | k12.html | 2007-11-14 04:07 | 53K | |
![[ ]](/icons/compressed.gif) | zweig_stefan_sakknovella_hu_rtf_nncl2207-647v2.zip | 2007-03-24 03:00 | 53K | |
![[ ]](/icons/unknown.gif) | Wiktor Zwikiewicz - Égi gyújtogatók.RTF | 2006-06-25 07:34 | 53K | |
![[ ]](/icons/unknown.gif) | Annie Besant Dharma.rar | 2007-03-24 02:53 | 53K | |
![[ ]](/icons/unknown.gif) | II_04.doc | 2007-11-14 03:34 | 53K | |
![[IMG]](/icons/image2.gif) | backcover.JPG | 2007-11-14 04:10 | 53K | |
![[TXT]](/icons/text.gif) | ZILAHY7.HTM | 2007-03-24 02:59 | 53K | |
![[ ]](/icons/layout.gif) | todvar_a3_p1.pdf | 2007-04-15 14:56 | 53K | |
![[ ]](/icons/compressed.gif) | Bigelbauer Pal-Az egeszseg sziveben.zip | 2007-03-24 02:51 | 53K | |
![[ ]](/icons/unknown.gif) | III_06.doc | 2007-11-14 03:34 | 53K | |
![[ ]](/icons/unknown.gif) | Főételek.doc | 2007-03-24 02:59 | 53K | |
![[ ]](/icons/unknown.gif) | 2_4.doc | 2007-11-13 20:51 | 53K | |
![[ ]](/icons/unknown.gif) | 13.RTF | 2007-11-13 22:26 | 52K | |
![[TXT]](/icons/text.gif) | martir.htm | 2006-08-24 18:23 | 52K | |
![[ ]](/icons/compressed.gif) | Baudelaire Verlaine Rimbaud-A romlas viragai.zip | 2007-03-24 02:50 | 52K | |
![[ ]](/icons/unknown.gif) | misi_mokus.ace | 2007-03-24 02:52 | 52K | |
![[ ]](/icons/compressed.gif) | csukas_istvan_a_versiro_kutya_html.zip | 2007-03-24 02:57 | 52K | |
![[ ]](/icons/unknown.gif) | mangorlo.rtf | 2005-03-03 18:11 | 52K | |
![[ ]](/icons/unknown.gif) | Richard Matheson - A vizsga.rtf | 2006-06-25 06:57 | 52K | |
![[ ]](/icons/unknown.gif) | 6.DOC | 2007-11-13 21:53 | 52K | |
![[ ]](/icons/compressed.gif) | Deepak Chopra-Az elet het torvenye.zip | 2007-03-24 02:52 | 52K | |
![[ ]](/icons/compressed.gif) | Wayne Chapman - Holtszezon.zip | 2007-03-23 05:21 | 52K | |
![[ ]](/icons/compressed.gif) | niven_larry_a_foldlako.zip | 2007-02-21 16:05 | 52K | |
![[ ]](/icons/compressed.gif) | Az igazsag es Tamas evangeliuma.zip | 2007-03-24 02:53 | 52K | |
![[ ]](/icons/compressed.gif) | martin_les_a_halal_mezeje_hu_rtf.zip | 2007-03-24 02:57 | 52K | |
![[TXT]](/icons/text.gif) | 05 - Jan van den Boomen - Üstökösláng.txt | 2007-03-24 02:54 | 52K | |
![[ ]](/icons/compressed.gif) | a_szemettelep.zip | 2007-03-24 02:57 | 52K | |
![[TXT]](/icons/text.gif) | BET6.HTM | 2007-03-24 02:58 | 52K | |
![[ ]](/icons/compressed.gif) | Iskaroti Judas sorsa a tulvilagon.zip | 2007-03-24 02:53 | 52K | |
![[ ]](/icons/compressed.gif) | Rejto Jeno - Pipacs, a fenegyerek.doc.zip | 2007-03-24 02:59 | 51K | |
![[ ]](/icons/layout.gif) | Paradise - Végigjátszás XI. rész.pdf | 2007-05-03 07:03 | 51K | |
![[ ]](/icons/compressed.gif) | Milne A A-Micimacko.zip | 2007-03-24 02:58 | 51K | |
![[ ]](/icons/unknown.gif) | Vjacseszlav Ribakov - A nagy szárazföld.rtf | 2006-06-25 07:32 | 51K | |
![[ ]](/icons/unknown.gif) | Turin - Tudathasadás.rtf | 2006-06-25 07:22 | 51K | |
![[ ]](/icons/compressed.gif) | Keresztelo Janos.zip | 2007-03-24 02:57 | 51K | |
![[ ]](/icons/compressed.gif) | gion_nandor-zongora_a_feher_kastelybol.zip | 2007-03-24 02:55 | 51K | |
![[TXT]](/icons/text.gif) | Az Ananda templom felszentelése.htm | 2007-03-24 02:56 | 51K | |
![[ ]](/icons/compressed.gif) | milne_a_a_micimacko.zip | 2007-03-24 02:49 | 51K | |
![[ ]](/icons/compressed.gif) | Isaac Asimov - Ameddig a szem ellát.zip | 2007-03-22 05:29 | 51K | |
![[ ]](/icons/compressed.gif) | moricz_zsigmond_uri_muri_szindarab_rtf.zip | 2007-03-24 02:58 | 51K | |
![[ ]](/icons/compressed.gif) | Szerdahelyi Szabolcs-Szex-tusa.zip | 2007-03-24 03:00 | 51K | |
![[ ]](/icons/compressed.gif) | fekete_istvan_csi_hu_rtf.zip | 2007-03-24 02:57 | 51K | |
![[ ]](/icons/unknown.gif) | II_03.doc | 2007-11-14 03:34 | 51K | |
![[ ]](/icons/compressed.gif) | William Shakespeare-A vihar.zip | 2007-03-24 03:01 | 50K | |
![[ ]](/icons/unknown.gif) | A Sárkánytűz fénye - A nagy finálé (XII rész).pd | 2007-05-03 07:04 | 50K | |
![[ ]](/icons/compressed.gif) | lao_ce_tao_te_king_hu_rtf.zip | 2007-03-24 02:53 | 50K | |
![[ ]](/icons/compressed.gif) | sheckley_robert_a_csata.zip | 2007-03-24 02:59 | 50K | |
![[ ]](/icons/compressed.gif) | sheckley_a_csata.zip | 2007-02-21 16:41 | 50K | |
![[TXT]](/icons/text.gif) | ZILAHY3.HTM | 2007-03-24 02:59 | 50K | |
![[ ]](/icons/compressed.gif) | Pickman modellje.zip | 2007-03-26 16:55 | 50K | |
![[TXT]](/icons/text.gif) | Bocsánat, nem téves.htm | 2007-03-24 03:00 | 50K | |
![[ ]](/icons/compressed.gif) | Paavo Haavikko-Hosszueletu Harald.zip | 2007-03-24 02:58 | 50K | |
![[ ]](/icons/compressed.gif) | biggle_lloyd_jr_milyen_gyonyoru_iskola.zip | 2007-03-24 02:57 | 50K | |
![[ ]](/icons/compressed.gif) | BiggleMilyengyonyoru.zip | 2007-02-21 16:10 | 50K | |
![[ ]](/icons/compressed.gif) | Biggle - Milyen gyonyoru.zip | 2005-06-22 17:00 | 50K | |
![[ ]](/icons/unknown.gif) | Bruma védelme - avagy a Nagy Kapu bezárása (X. r | 2007-05-03 07:03 | 50K | |
![[ ]](/icons/compressed.gif) | csukas_istvan_susu_ujabb_kalandjai_html.zip | 2007-03-24 02:57 | 50K | |
![[ ]](/icons/compressed.gif) | 160 Tibeti gyogynoveny.zip | 2007-03-24 03:00 | 50K | |
![[ ]](/icons/unknown.gif) | 15.RTF | 2007-11-13 22:26 | 50K | |
![[ ]](/icons/unknown.gif) | L Sprague de Camp - A harcosok népe.rtf | 2006-07-10 20:26 | 50K | |
![[ ]](/icons/unknown.gif) | Larry Niven - A szornyeteg.rar | 2007-02-21 16:45 | 50K | |
![[ ]](/icons/compressed.gif) | Rémület Dunwichben.zip | 2007-03-26 16:55 | 50K | |
![[ ]](/icons/compressed.gif) | hiszterezishurok.zip | 2007-02-21 16:36 | 50K | |
![[ ]](/icons/compressed.gif) | Varsavszkij, Ilja_A hiszterézishurok - sci-fi - word.zip | 2006-01-07 08:44 | 50K | |
![[ ]](/icons/unknown.gif) | II_02.doc | 2007-11-14 03:34 | 50K | |
![[ ]](/icons/compressed.gif) | A magyarnyelvű fantasy-irodalom bibliográfiája.ace.zip | 2007-03-24 02:49 | 49K | |
![[ ]](/icons/unknown.gif) | fohasz.ace | 2007-03-24 02:52 | 49K | |
![[ ]](/icons/compressed.gif) | gardener_mettew_hatodik_kakukk.zip | 2007-03-24 02:57 | 49K | |
![[ ]](/icons/compressed.gif) | A hatodik kakukkszó.zip | 2006-08-24 18:21 | 49K | |
![[ ]](/icons/unknown.gif) | Annie Besant Karma – Az ok-okozat törvénye.rar | 2007-03-24 02:53 | 49K | |
![[ ]](/icons/compressed.gif) | durrenmatt_friedrich_a_nagy_romulus_html.zip | 2007-03-24 02:54 | 49K | |
![[ ]](/icons/unknown.gif) | Andrassew Ivan-Peremkiralysag.ZIP | 2007-03-24 02:49 | 49K | |
![[ ]](/icons/compressed.gif) | Jack Vance - A beszéd ajándéka.zip | 2007-03-26 19:32 | 49K | |
![[ ]](/icons/compressed.gif) | Kemes Pal-Kozepkor tudomanyanak nehany jelemzoje.zip | 2007-03-24 02:53 | 49K | |
![[ ]](/icons/compressed.gif) | csukas_istvan_tukorbohocok_html.zip | 2007-03-24 02:57 | 49K | |
![[ ]](/icons/compressed.gif) | Janos nagyevangeliuma.zip | 2007-03-24 02:53 | 49K | |
![[ ]](/icons/unknown.gif) | Thumbs.db | 2007-04-09 13:33 | 49K | |
![[ ]](/icons/unknown.gif) | Lester Del Rey - Sötét küldetés.rtf | 2006-07-10 20:28 | 49K | |
![[ ]](/icons/unknown.gif) | Armand Christophe - Az első feladatok a Császári Főváro | 2007-05-03 07:12 | 49K | |
![[ ]](/icons/compressed.gif) | hamvas_bela_a_bor_filozofiaja.zip | 2007-03-24 02:55 | 49K | |
![[ ]](/icons/compressed.gif) | Wayne Chapman - Leviatán.zip | 2007-03-23 05:21 | 49K | |
![[ ]](/icons/compressed.gif) | folder_sir_jolin_murphy_hu_html.zip | 2007-03-24 02:54 | 49K | |
![[ ]](/icons/unknown.gif) | Konrad Fialkowski - Parancsnok életre keltése.rtf | 2006-07-10 20:23 | 49K | |
![[ ]](/icons/unknown.gif) | hobbit11.doc | 2007-03-24 02:54 | 49K | |
![[ ]](/icons/compressed.gif) | Sir Jolin Folder-Murphy Menedzser torvenye.zip | 2007-03-24 03:00 | 48K | |
![[ ]](/icons/unknown.gif) | Wayne Wightman - Bőrálca.RTF | 2006-06-25 07:34 | 48K | |
![[ ]](/icons/compressed.gif) | Fábri Péter_Az üzlet - tragikomédia - html.rtf.word.zip | 2006-01-07 09:08 | 48K | |
![[ ]](/icons/unknown.gif) | H_ P_ Blavatsky A csend hangja.rar | 2007-03-24 02:53 | 48K | |
![[ ]](/icons/unknown.gif) | I_02.doc | 2007-11-14 02:25 | 48K | |
![[ ]](/icons/unknown.gif) | 1_4.doc | 2007-11-14 02:13 | 48K | |
![[ ]](/icons/compressed.gif) | Junior - 1. Darth Vader kesztyüje.zip | 2007-03-26 19:02 | 48K | |
![[ ]](/icons/unknown.gif) | Jack Finney - Félek.rtf | 2006-07-10 20:15 | 48K | |
![[ ]](/icons/compressed.gif) | Klaszikus kinai tanmesek.zip | 2007-03-24 02:56 | 48K | |
![[ ]](/icons/compressed.gif) | Lovecraft, Howard Philips_Rémület Dunwichben - novella - rtf.zip | 2006-01-07 09:03 | 48K | |
![[ ]](/icons/compressed.gif) | Robert Bloch-ALKONY.zip | 2007-03-24 02:59 | 48K | |
![[TXT]](/icons/text.gif) | Megint világvége.htm | 2007-03-24 02:58 | 48K | |
![[ ]](/icons/compressed.gif) | kommentarok_a_rozsa_nevehez.zip | 2007-03-24 03:00 | 48K | |
![[ ]](/icons/unknown.gif) | II_05.doc | 2007-11-13 21:29 | 48K | |
![[ ]](/icons/unknown.gif) | A kámzsás idegen.doc | 2007-03-24 02:52 | 48K | |
![[ ]](/icons/unknown.gif) | A JÁRVÁNY.doc | 2007-04-15 14:15 | 48K | |
![[ ]](/icons/compressed.gif) | Bloch, Robert novellái - sci-fi - html.txt.zip | 2006-01-07 09:12 | 47K | |
![[ ]](/icons/compressed.gif) | nevek.zip | 2007-03-24 02:58 | 47K | |
![[ ]](/icons/unknown.gif) | Anthony Boucher - Bálám.rtf | 2006-07-10 19:27 | 47K | |
![[ ]](/icons/compressed.gif) | csukas_istvan_a_teli_tucsok_mesei_html.zip | 2007-03-24 02:57 | 47K | |
![[ ]](/icons/compressed.gif) | dorta_marcello_ha_nem_volna_nagyapam_ki_kene_talalni_hu_rtf_nncl2849-6ebv1.zip | 2007-03-24 02:57 | 47K | |
![[ ]](/icons/unknown.gif) | 39.rtf | 2007-11-13 22:36 | 47K | |
![[ ]](/icons/unknown.gif) | Wayne Wightman - Bőrálca.rtf | 2007-04-02 21:13 | 47K | |
![[ ]](/icons/layout.gif) | Miscarcand - Végigjátszás IX. rész.pdf | 2007-05-03 07:03 | 47K | |
![[ ]](/icons/compressed.gif) | asher_jane_101_dolog_a_gyerekekrol_hu_rtf.zip | 2007-03-24 02:56 | 47K | |
![[IMG]](/icons/image2.gif) | frontcover.JPG | 2007-11-14 04:10 | 47K | |
![[ ]](/icons/compressed.gif) | langelaan_george_a_legy.zip | 2007-03-24 02:54 | 47K | |
![[ ]](/icons/compressed.gif) | LangelaanAlegy.zip | 2007-02-21 15:59 | 47K | |
![[ ]](/icons/compressed.gif) | Leslie L. Lawrence - A láp lidérce.zip | 2007-03-24 02:57 | 47K | |
![[ ]](/icons/compressed.gif) | Michael Moorcock - Íme az ember.zip | 2007-03-26 17:37 | 47K | |
![[ ]](/icons/unknown.gif) | Raffy4 - Találkozás Nagyapóval.rtf | 2006-06-25 06:40 | 47K | |
![[ ]](/icons/compressed.gif) | Fábri Péter_Az élő álarc - avagy a hasonmás - dráma - word.zip | 2006-01-07 09:08 | 47K | |
![[ ]](/icons/unknown.gif) | Stephen Dedman - A trónkövetelő.rtf | 2006-07-10 19:23 | 47K | |
![[ ]](/icons/unknown.gif) | Vlagyimir Grigorjev - A bőségszaru.RTF | 2006-06-25 07:32 | 47K | |
![[ ]](/icons/compressed.gif) | abdal_kajguszuz_bolondok_konyve.zip | 2007-03-24 02:56 | 46K | |
![[TXT]](/icons/text.gif) | A vizsga.htm | 2007-03-24 02:59 | 46K | |
![[TXT]](/icons/text.gif) | 18.TXT | 2007-11-13 23:34 | 46K | |
![[ ]](/icons/unknown.gif) | Isten rabjai-Assisi Szent Ferenc.ZIP | 2007-03-24 02:53 | 46K | |
![[ ]](/icons/unknown.gif) | haxley.ace | 2007-03-24 02:52 | 46K | |
![[ ]](/icons/compressed.gif) | gogol_a_koponyeg.doc.zip | 2007-03-24 02:58 | 46K | |
![[ ]](/icons/compressed.gif) | Vadak.DOC.zip | 2007-03-24 02:49 | 46K | |
![[ ]](/icons/compressed.gif) | aiszkhulosz_oreszteia.zip | 2007-03-24 02:49 | 46K | |
![[TXT]](/icons/text.gif) | 05 - Aalish DMohlen - Fekete vér.txt | 2007-03-24 02:54 | 46K | |
![[ ]](/icons/unknown.gif) | paradicsom.doc | 2007-03-24 02:59 | 46K | |
![[ ]](/icons/compressed.gif) | ney_petersney_hogyan_mondjam_el_hu_txt.zip | 2007-03-24 02:58 | 46K | |
![[ ]](/icons/unknown.gif) | Tege - Bardon serlege.rtf | 2006-06-25 07:20 | 46K | |
![[TXT]](/icons/text.gif) | 06 - Jan van den Boomen - Fattyúgyik villám szerzetes.txt | 2007-03-24 02:54 | 46K | |
![[ ]](/icons/unknown.gif) | Karen Joy Fowler - A Poplar utcai tanulmány.rtf | 2006-07-10 20:20 | 46K | |
![[ ]](/icons/unknown.gif) | Arthur Sellings - Új életet kezdeni.rtf | 2006-07-10 19:29 | 46K | |
![[ ]](/icons/compressed.gif) | Moll Flanders-A tolvaj kurva.zip | 2007-03-24 02:58 | 46K | |
![[ ]](/icons/layout.gif) | todvar_a3_p3.pdf | 2007-04-15 16:47 | 46K | |
![[ ]](/icons/compressed.gif) | Fábri Péter_A három testőr - avagy mindenki magáért - vígjáték - word.zip | 2006-01-07 09:08 | 45K | |
![[ ]](/icons/compressed.gif) | Hamvas Bela-A bor filozofiaja.zip | 2007-03-24 02:53 | 45K | |
![[ ]](/icons/compressed.gif) | ashton_marty_101_dolog_a_nokrol_hu_rtf.zip | 2007-03-24 02:57 | 45K | |
![[ ]](/icons/compressed.gif) | durrenmatt_friedrich_a_fizilusok_rtf.zip | 2007-03-24 02:54 | 45K | |
![[ ]](/icons/unknown.gif) | kalandotletek.doc | 2007-04-15 14:46 | 45K | |
![[ ]](/icons/unknown.gif) | SÜTEMÉNYEK.doc | 2007-03-24 02:59 | 45K | |
![[ ]](/icons/unknown.gif) | Brian M Stableford - A mérnök és az ítéletvégrehajtó.rtf | 2006-07-10 19:30 | 45K | |
![[ ]](/icons/compressed.gif) | asher_jane_101_dolog_a_hazassagrol_hu_rtf.zip | 2007-03-24 02:56 | 45K | |
![[ ]](/icons/compressed.gif) | petofi_sandor_janos_vitez_doc.zip | 2007-03-24 02:55 | 45K | |
![[ ]](/icons/compressed.gif) | kertesz_imre_a_holocaust_mint_kultura_html.zip | 2007-03-24 02:56 | 45K | |
![[ ]](/icons/unknown.gif) | 05.RTF | 2007-11-14 06:28 | 45K | |
![[ ]](/icons/unknown.gif) | J A Deutch - A möbius-metró.rtf | 2006-07-10 20:03 | 45K | |
![[ ]](/icons/unknown.gif) | Robert Wells - Kaland a végeken.rtf | 2006-06-25 07:15 | 45K | |
![[TXT]](/icons/text.gif) | RPG_HU - - Mesélőknek - Kőrület (MAGUS modul).htm | 2007-04-15 15:22 | 45K | |
![[ ]](/icons/unknown.gif) | 04.RTF | 2007-11-14 06:28 | 45K | |
![[ ]](/icons/compressed.gif) | Gergei Albert-Argirus historiaja.zip | 2007-03-24 02:54 | 45K | |
![[ ]](/icons/unknown.gif) | I_03.doc | 2007-11-14 02:25 | 45K | |
![[ ]](/icons/unknown.gif) | Robert Bloch - A Poe-gyűjtő.rtf | 2006-06-25 07:03 | 44K | |
![[ ]](/icons/compressed.gif) | durrenmatt_friedrich_a_csendestars_rtf.zip | 2007-03-24 02:54 | 44K | |
![[ ]](/icons/compressed.gif) | Ivan Olbracht-A monarchia szereteterol.zip | 2007-03-24 02:55 | 44K | |
![[TXT]](/icons/text.gif) | RPG_HU - - Mesélőknek - A Madarak Szigete - modul.htm | 2007-04-15 15:10 | 44K | |
![[ ]](/icons/compressed.gif) | balassi_balint_szep_magyar_komedia_rtf.zip | 2007-03-24 02:55 | 44K | |
![[ ]](/icons/compressed.gif) | bardosjozsef.zip | 2007-02-21 16:09 | 44K | |
![[ ]](/icons/compressed.gif) | bardos_jozsef_novellai.zip | 2007-03-24 02:50 | 44K | |
![[ ]](/icons/unknown.gif) | 2_11.doc | 2007-11-13 21:34 | 44K | |
![[ ]](/icons/unknown.gif) | Pap Viola - A nagy per.rtf | 2006-06-25 06:36 | 44K | |
![[ ]](/icons/compressed.gif) | csukas_istvan_susu_a_sarkany_html.zip | 2007-03-24 02:57 | 44K | |
![[ ]](/icons/unknown.gif) | Túrin - Légsúlyúak.rtf | 2006-06-25 07:23 | 44K | |
![[ ]](/icons/unknown.gif) | Raon - Tenyérnyi csipkék börtönében.rtf | 2006-06-25 06:42 | 44K | |
![[ ]](/icons/compressed.gif) | angyal_firenze_felett.zip | 2007-03-24 02:57 | 44K | |
![[ ]](/icons/unknown.gif) | III_04.doc | 2007-11-14 03:34 | 44K | |
![[ ]](/icons/unknown.gif) | 3_2.doc | 2007-11-13 22:05 | 44K | |
![[ ]](/icons/unknown.gif) | 0.doc | 2007-11-14 02:58 | 44K | |
![[ ]](/icons/unknown.gif) | az_otodik_negyed.rtf | 2005-03-03 18:06 | 43K | |
![[TXT]](/icons/text.gif) | harcgame.htm | 2006-08-24 18:23 | 43K | |
![[ ]](/icons/compressed.gif) | Theodore Sturgeon - Ha aggódsz, ha szeretsz.zip | 2006-05-29 11:27 | 43K | |
![[TXT]](/icons/text.gif) | I_08.HTM | 2007-03-24 02:54 | 43K | |
![[ ]](/icons/unknown.gif) | Annie Besant A három ösvény.rar | 2007-03-24 02:53 | 43K | |
![[ ]](/icons/unknown.gif) | Cordwainer Smith - Patkány-sárkány játék.rtf | 2006-07-10 19:36 | 43K | |
![[ ]](/icons/unknown.gif) | Harlan Ellison - Szája sincsen, úgy üvölt.rtf | 2006-07-10 19:51 | 43K | |
![[ ]](/icons/unknown.gif) | 2_7.doc | 2007-11-13 20:51 | 43K | |
![[ ]](/icons/unknown.gif) | Gordon R Dixon - Black Charlie.rtf | 2006-07-10 19:49 | 43K | |
![[ ]](/icons/unknown.gif) | H. P. Lovecraft - Rémület Dunwichben.rar | 2007-03-24 02:55 | 43K | |
![[ ]](/icons/unknown.gif) | Mircea Oprita - Alcora.rtf | 2006-07-10 20:36 | 43K | |
![[ ]](/icons/compressed.gif) | csath_geza_horvatek_rtf.zip | 2007-03-24 02:52 | 43K | |
![[ ]](/icons/compressed.gif) | Fábri Péter_Kolumbusz, az őrült spanyol hányattatásai szárazon és vízen - rockopera szövegkönyve .zip | 2006-01-07 09:08 | 43K | |
![[ ]](/icons/compressed.gif) | csukas_istvan_a_hazorzo_macska_html.zip | 2007-03-24 02:57 | 43K | |
![[ ]](/icons/compressed.gif) | a_hatlabu_jegesmedve.zip | 2007-03-24 02:57 | 43K | |
![[ ]](/icons/compressed.gif) | Lorincz L. László_A hatlábú jegesmedve - novella - html.zip | 2006-05-29 10:58 | 43K | |
![[ ]](/icons/unknown.gif) | oreszt.ace | 2007-03-24 02:52 | 43K | |
![[TXT]](/icons/text.gif) | A hosszúkás láda.htm | 2007-03-24 02:53 | 43K | |
![[ ]](/icons/compressed.gif) | esterhazy_peter_a_szavak_csodalatos_eletebol_html.zip | 2007-03-24 02:53 | 42K | |
![[ ]](/icons/unknown.gif) | sws - A szép és a szörnyeteg.rtf | 2006-06-25 07:18 | 42K | |
![[ ]](/icons/compressed.gif) | tunde_szotar.zip | 2006-05-10 06:28 | 42K | |
![[ ]](/icons/unknown.gif) | Henry Kuttner - Amire szükségük van.rtf | 2006-07-10 19:52 | 42K | |
![[ ]](/icons/unknown.gif) | 12.DOC | 2007-11-13 22:43 | 42K | |
![[ ]](/icons/unknown.gif) | Zeld - Hősök Lobogója.rtf | 2006-06-25 07:35 | 42K | |
![[ ]](/icons/unknown.gif) | 2_8.doc | 2007-11-13 20:51 | 42K | |
![[ ]](/icons/unknown.gif) | 5.DOC | 2007-11-14 08:46 | 42K | |
![[TXT]](/icons/text.gif) | Az ötödik negyed.htm | 2007-03-24 03:00 | 42K | |
![[ ]](/icons/compressed.gif) | Friedrich Nietzsche-A gorog irodalom tortenete.zip | 2007-03-24 02:54 | 42K | |
![[ ]](/icons/compressed.gif) | balzac_honore_de_elhagyott_asszony_html.zip | 2007-03-24 02:55 | 42K | |
![[ ]](/icons/compressed.gif) | balzac_honore_de_az_elhagyott_asszony_html.zip | 2007-03-24 02:55 | 42K | |
![[ ]](/icons/compressed.gif) | Isaac Asimov - A pozitron-ember.zip | 2007-03-22 05:29 | 42K | |
![[ ]](/icons/layout.gif) | Bravil - kalandok délkeleten.pdf | 2007-05-03 07:25 | 42K | |
![[ ]](/icons/compressed.gif) | Karinthy Frigyes-Utazas Faremidoba.zip | 2007-03-24 02:56 | 42K | |
![[ ]](/icons/compressed.gif) | blake_william_a_tapasztalas_dalai_html.zip | 2007-03-24 03:01 | 42K | |
![[ ]](/icons/compressed.gif) | a_jelolt.zip | 2007-03-24 02:57 | 42K | |
![[ ]](/icons/unknown.gif) | II_07.doc | 2007-11-13 21:29 | 42K | |
![[ ]](/icons/unknown.gif) | 04 - Csicsás Gábor - Büntetés.doc | 2007-03-24 02:54 | 42K | |
![[TXT]](/icons/text.gif) | fertoz.htm | 2006-08-24 18:22 | 41K | |
![[ ]](/icons/compressed.gif) | Monty Pithonnak az o Repulo Cirkusza 1.zip | 2007-03-24 02:58 | 41K | |
![[ ]](/icons/unknown.gif) | H_ P_ Blavatsky Az ezoterikus filozófia alapjai.rar | 2007-03-24 02:53 | 41K | |
![[ ]](/icons/compressed.gif) | almonds_suzy_101_dolog_ferfiakrol_hu_rtf.zip | 2007-03-24 03:00 | 41K | |
![[ ]](/icons/compressed.gif) | Isaac Asimov - A találkozás.zip | 2007-03-22 05:29 | 41K | |
![[ ]](/icons/compressed.gif) | Wayne Chapman - A bárd és a démonok.zip | 2007-03-23 05:20 | 41K | |
![[ ]](/icons/unknown.gif) | Lövei Júlia - Vizsga.rtf | 2006-07-10 20:33 | 41K | |
![[ ]](/icons/compressed.gif) | Anthony de Mello-A csend szava.zip | 2007-03-24 02:49 | 41K | |
![[ ]](/icons/unknown.gif) | haiku.ace | 2007-03-24 02:52 | 41K | |
![[ ]](/icons/compressed.gif) | aldiss_brian_w_neander.zip | 2007-03-24 02:52 | 41K | |
![[ ]](/icons/unknown.gif) | H_ P_ Blavatsky Gyakorlati okkultizmus.rar | 2007-03-24 02:53 | 41K | |
![[ ]](/icons/layout.gif) | todvar_a3_p2.pdf | 2007-04-15 14:32 | 41K | |
![[ ]](/icons/compressed.gif) | Terry Prachett - A tenger és a kis halak.zip | 2007-03-26 18:19 | 41K | |
![[ ]](/icons/unknown.gif) | hobbit16.doc | 2007-03-24 02:54 | 41K | |
![[ ]](/icons/unknown.gif) | 2_6.doc | 2007-11-13 20:51 | 41K | |
![[ ]](/icons/unknown.gif) | H L Gold - Az összerakott ember.rtf | 2006-07-10 19:51 | 41K | |
![[ ]](/icons/compressed.gif) | Homokkiralyok-GeorgeR R Martin.zip | 2007-03-24 02:54 | 41K | |
![[ ]](/icons/compressed.gif) | Sztrugackij, Arkagyij és Borisz - Piknik a senki földjén.zip | 2007-03-26 19:17 | 41K | |
![[TXT]](/icons/text.gif) | 06.HTM | 2007-03-24 02:55 | 41K | |
![[ ]](/icons/compressed.gif) | Howard, Robert Erwin novellái - fantasy - html.txt.zip | 2006-01-07 08:49 | 41K | |
![[ ]](/icons/compressed.gif) | Charles K Roy-Trigger.zip | 2007-03-24 02:52 | 41K | |
![[ ]](/icons/compressed.gif) | a_pupos.zip | 2007-03-24 02:57 | 41K | |
![[ ]](/icons/compressed.gif) | Pohl, Frederik_Az éjszaka gyermekei - sci-fi - rtf.zip | 2006-01-07 08:55 | 41K | |
![[ ]](/icons/unknown.gif) | 3_6.doc | 2007-11-14 04:45 | 41K | |
![[ ]](/icons/unknown.gif) | 1_8.doc | 2007-11-14 02:13 | 41K | |
![[ ]](/icons/compressed.gif) | Robert Sheckley - A Tranai.zip | 2006-05-29 11:22 | 40K | |
![[ ]](/icons/compressed.gif) | gibson_william_johnny_mnemonic_txt_html.zip | 2007-03-24 03:01 | 40K | |
![[ ]](/icons/compressed.gif) | Marx Gyorgy-Fiatalok es a jovo.zip | 2007-03-24 02:57 | 40K | |
![[ ]](/icons/compressed.gif) | csukas_istvan_hogyan_lettem_filmszinesz_hu_doc_nncl3044-706v1.zip | 2007-03-24 02:57 | 40K | |
![[IMG]](/icons/image2.gif) | DOZA.JPG | 2007-03-24 02:59 | 40K | |
![[ ]](/icons/unknown.gif) | Joanna Russ - Mindennapi depressziók.rtf | 2006-07-10 20:16 | 40K | |
![[ ]](/icons/unknown.gif) | 11.DOC | 2007-11-13 22:43 | 40K | |
![[TXT]](/icons/text.gif) | BET5.HTM | 2007-03-24 02:58 | 40K | |
![[ ]](/icons/unknown.gif) | Platon-Szokratesz halala | 2007-03-24 02:58 | 40K | |
![[ ]](/icons/compressed.gif) | Stephen King - Ezüst pisztolygolyók.zip | 2007-03-26 15:34 | 40K | |
![[ ]](/icons/unknown.gif) | Chad Oliver - Transzformátor.rtf | 2006-07-10 19:34 | 40K | |
![[ ]](/icons/unknown.gif) | szárnyasok.doc | 2007-03-24 02:59 | 40K | |
![[ ]](/icons/unknown.gif) | 3_5.doc | 2007-11-14 04:45 | 40K | |
![[ ]](/icons/unknown.gif) | 1_3.doc | 2007-11-14 02:13 | 40K | |
![[ ]](/icons/unknown.gif) | 1_2.doc | 2007-11-13 22:08 | 40K | |
![[ ]](/icons/unknown.gif) | okkultizmus.ace | 2007-03-24 02:52 | 40K | |
![[ ]](/icons/compressed.gif) | forster_e_m_a_gep_megall.zip | 2007-03-24 02:53 | 40K | |
![[ ]](/icons/compressed.gif) | Foster, Alan Dean - A Gep.zip | 2005-06-22 17:00 | 40K | |
![[ ]](/icons/compressed.gif) | ForsterAGep.zip | 2007-02-21 16:45 | 40K | |
![[ ]](/icons/compressed.gif) | Frederik Pohl - Az éjszaka gyermekei.zip | 2007-03-26 18:10 | 40K | |
![[ ]](/icons/compressed.gif) | George R. R. Martin - Homokkirályok.zip | 2006-05-29 11:03 | 40K | |
![[ ]](/icons/compressed.gif) | lll_gyilkossag_az_olimpian.zip | 2007-03-20 00:12 | 40K | |
![[ ]](/icons/compressed.gif) | gyilkossag_az_olimpian.zip | 2007-03-24 02:57 | 40K | |
![[ ]](/icons/compressed.gif) | Philip K Dick - A kettes változat.zip | 2006-05-29 11:13 | 40K | |
![[ ]](/icons/unknown.gif) | Rémület Dunwichben.rar | 2007-03-24 02:55 | 40K | |
![[ ]](/icons/compressed.gif) | Kahlil Gibran Bolond-Homok es tajtek.zip | 2007-03-24 02:56 | 40K | |
![[ ]](/icons/compressed.gif) | Jég és láng.htm.zip | 2007-03-24 02:59 | 40K | |
![[ ]](/icons/unknown.gif) | A teljesség felé.ace | 2007-03-24 03:01 | 40K | |
![[ ]](/icons/compressed.gif) | Chad Oliver - Kint a terepen.zip | 2007-03-23 05:13 | 40K | |
![[ ]](/icons/compressed.gif) | Dick, Philip K._A kettes változat - sci-fi - rtf.zip | 2006-01-07 09:13 | 39K | |
![[ ]](/icons/unknown.gif) | 7. A Warhammer 40 000 univerzum idővonala.rtf | 2007-03-06 02:22 | 39K | |
![[ ]](/icons/compressed.gif) | Brian W. Aldiss - Neanderbolygo.zip | 2006-05-29 11:00 | 39K | |
![[ ]](/icons/compressed.gif) | Martin, George R. R._Homokkirályok - html.zip | 2006-01-07 08:47 | 39K | |
![[ ]](/icons/compressed.gif) | maclean_katherine_ha_eljon_az_esos_evszek.zip | 2007-03-24 02:56 | 39K | |
![[ ]](/icons/compressed.gif) | MacLeanHaeljon.zip | 2007-02-21 16:07 | 39K | |
![[TXT]](/icons/text.gif) | III_02.HTM | 2007-03-24 02:54 | 39K | |
![[ ]](/icons/unknown.gif) | 4.3 | 2007-03-24 02:54 | 39K | |
![[ ]](/icons/unknown.gif) | 4.2 | 2007-03-24 02:54 | 39K | |
![[ ]](/icons/unknown.gif) | 4.1 | 2007-03-24 02:54 | 39K | |
![[ ]](/icons/unknown.gif) | 4.0 | 2007-03-24 02:54 | 39K | |
![[ ]](/icons/unknown.gif) | 2.1 | 2007-03-24 02:54 | 39K | |
![[ ]](/icons/unknown.gif) | 2.0 | 2007-03-24 02:54 | 39K | |
![[ ]](/icons/unknown.gif) | 1.0 | 2007-03-24 02:54 | 39K | |
![[ ]](/icons/unknown.gif) | 0.0 | 2007-03-24 02:54 | 39K | |
![[ ]](/icons/compressed.gif) | Karinthy Frigyes-Egyugyu lexikon.zip | 2007-03-24 02:56 | 39K | |
![[ ]](/icons/compressed.gif) | karinthy_frigyes_egyugyu_lexikon_hu_rtf.zip | 2007-03-24 02:56 | 39K | |
![[ ]](/icons/compressed.gif) | Isaac Asimov - Harcijáték.zip | 2007-03-22 05:29 | 39K | |
![[ ]](/icons/unknown.gif) | babgulyás, sólet.doc | 2007-03-24 02:59 | 39K | |
![[ ]](/icons/unknown.gif) | 2_3.doc | 2007-11-13 21:34 | 39K | |
![[ ]](/icons/unknown.gif) | 2_2.doc | 2007-11-13 21:34 | 39K | |
![[ ]](/icons/compressed.gif) | agh_istvan_struga_mano_csongolodzik.zip | 2007-03-24 02:49 | 39K | |
![[ ]](/icons/compressed.gif) | Van Vogt, A. E._Az elhatározás - sci-fi - rtf.zip | 2006-01-07 08:45 | 39K | |
![[ ]](/icons/compressed.gif) | Manfred Kyber--3 elbeszeles.zip | 2007-03-24 02:57 | 39K | |
![[ ]](/icons/compressed.gif) | A E. Van Vogt - Az elhatározás.zip | 2007-03-21 16:07 | 39K | |
![[ ]](/icons/compressed.gif) | silverberg_robert_vegy_egy_katonat.zip | 2007-03-24 02:59 | 39K | |
![[ ]](/icons/compressed.gif) | Robert Silverberg - Végy egy katonát....zip | 2006-05-29 11:23 | 39K | |
![[ ]](/icons/compressed.gif) | Rejto Jeno - Az elsikkasztott penztaros.txt.zip | 2007-03-24 02:59 | 39K | |
![[TXT]](/icons/text.gif) | holnap.htm | 2006-08-24 18:23 | 39K | |
![[ ]](/icons/compressed.gif) | balzac_honore_de_a_voros_vendegfogado_rtf.zip | 2007-03-24 02:55 | 39K | |
![[IMG]](/icons/image2.gif) | COVER.JPG | 2007-03-24 02:54 | 39K | |
![[ ]](/icons/compressed.gif) | gogol_az_orr.doc.zip | 2007-03-24 02:58 | 39K | |
![[ ]](/icons/unknown.gif) | karácsonyi menü.doc | 2007-03-24 02:59 | 39K | |
![[ ]](/icons/unknown.gif) | 2_9.doc | 2007-11-13 22:05 | 39K | |
![[ ]](/icons/unknown.gif) | 07 - Csicsás Gábor - Átutazók.doc | 2007-03-24 02:54 | 39K | |
![[ ]](/icons/compressed.gif) | Frederik Pohl - Alagút a világ alatt.zip | 2007-03-26 18:10 | 38K | |
![[TXT]](/icons/text.gif) | thrupp.htm | 2006-08-24 18:24 | 38K | |
![[ ]](/icons/unknown.gif) | Lewis Padgett - Isten áldja professzor úr.rtf | 2006-07-10 20:29 | 38K | |
![[IMG]](/icons/image2.gif) | BIOSUTI1.JPG | 2007-03-24 02:59 | 38K | |
![[ ]](/icons/compressed.gif) | plautus_titus_maccius_a_hetvenkedo_katona.zip | 2007-03-24 03:00 | 38K | |
![[ ]](/icons/unknown.gif) | Baranyai töltött vöröskáposzta.doc | 2007-03-24 02:59 | 38K | |
![[ ]](/icons/compressed.gif) | Fábri Péter_Rinaldo Rinaldini, avagy rablóból lesz a legjobb rabló - vígjáték - html.zip | 2006-01-07 09:09 | 38K | |
![[ ]](/icons/compressed.gif) | radnoti_miklos_eroltetett_menet-valogatas_html.zip | 2007-03-24 02:55 | 38K | |
![[IMG]](/icons/image2.gif) | 10.gif | 2007-11-14 09:18 | 38K | |
![[ ]](/icons/compressed.gif) | warrior_petro_a_varazslosag_alapelvei.zip | 2007-03-24 03:01 | 38K | |
![[ ]](/icons/compressed.gif) | virata.zip | 2007-03-24 03:01 | 38K | |
![[ ]](/icons/unknown.gif) | sohasem_reszket_a_kezem.doc | 2007-03-24 02:58 | 38K | |
![[ ]](/icons/unknown.gif) | 2_5.doc | 2007-11-13 20:51 | 38K | |
![[ ]](/icons/unknown.gif) | 1_7.doc | 2007-11-14 02:13 | 38K | |
![[ ]](/icons/unknown.gif) | orpheusz.ace | 2007-03-24 02:52 | 37K | |
![[TXT]](/icons/text.gif) | Oszd meg - velem....htm | 2007-03-24 02:56 | 37K | |
![[ ]](/icons/unknown.gif) | Salimov - Találkozás a régi energiatelepen.rtf | 2006-06-25 07:15 | 37K | |
![[ ]](/icons/unknown.gif) | Jack Finney - A másik feleség.rtf | 2006-07-10 20:14 | 37K | |
![[IMG]](/icons/image2.gif) | 09.gif | 2007-11-14 09:18 | 37K | |
![[ ]](/icons/unknown.gif) | Receptek.doc | 2007-03-24 02:59 | 37K | |
![[ ]](/icons/unknown.gif) | Dotha-Fabioni udvarház.ppt | 2007-04-15 15:01 | 37K | |
![[ ]](/icons/unknown.gif) | Red Hook.rar | 2007-03-24 02:55 | 37K | |
![[TXT]](/icons/text.gif) | Nhil Bhog.txt | 2007-03-24 02:54 | 37K | |
![[ ]](/icons/compressed.gif) | A MISTICIZMUS es az ezoterikus tanok LEXIKONA.zip | 2007-03-24 02:53 | 37K | |
![[ ]](/icons/unknown.gif) | 02.rtf | 2007-11-13 22:10 | 37K | |
![[ ]](/icons/compressed.gif) | John Wyndham - Találom-próba.zip | 2007-03-26 19:55 | 37K | |
![[ ]](/icons/compressed.gif) | Francois Villon balladai.zip | 2007-03-24 02:55 | 37K | |
![[ ]](/icons/unknown.gif) | Villányi Dániel - A daru.rtf | 2006-06-25 07:30 | 37K | |
![[ ]](/icons/compressed.gif) | harangozo_andras_ujfold_hu_rtf.zip | 2007-03-24 02:55 | 37K | |
![[ ]](/icons/compressed.gif) | harangozo_andras_ujfold.zip | 2007-03-24 02:55 | 37K | |
![[TXT]](/icons/text.gif) | Miért nem vagyok keresztény.txt | 2007-03-24 02:51 | 37K | |
![[ ]](/icons/compressed.gif) | Mihaleczky Péter_Az uralkodó álma - sci-fi novella - html.txt.zip | 2006-01-07 09:00 | 37K | |
![[ ]](/icons/unknown.gif) | Halál.doc | 2007-03-24 02:52 | 37K | |
![[ ]](/icons/compressed.gif) | Rejto Jeno - A drotnelkuli gyilkossag.rtf.zip | 2007-03-24 02:59 | 36K | |
![[TXT]](/icons/text.gif) | I_01.HTM | 2007-03-24 02:54 | 36K | |
![[TXT]](/icons/text.gif) | eanyagok.htm | 2007-03-24 02:53 | 36K | |
![[ ]](/icons/compressed.gif) | asimov_isaac_fiatalsag.zip | 2007-03-24 02:55 | 36K | |
![[ ]](/icons/compressed.gif) | Isaac Asimov - Fiatalsag.zip | 2006-05-10 06:20 | 36K | |
![[ ]](/icons/compressed.gif) | AsimovFiatalsag.zip | 2007-02-21 16:03 | 36K | |
![[ ]](/icons/compressed.gif) | A bezárt szoba.zip | 2007-03-26 16:56 | 36K | |
![[TXT]](/icons/text.gif) | Az elsietett temetés.htm | 2007-03-24 02:53 | 36K | |
![[ ]](/icons/compressed.gif) | csukas_istvan_egy_kiscsacsi_tortenete_html.zip | 2007-03-24 02:57 | 36K | |
![[ ]](/icons/compressed.gif) | Wayne Chapman - Toroni vér.zip | 2007-03-23 05:21 | 36K | |
![[TXT]](/icons/text.gif) | MENU5.HTM | 2007-03-24 02:59 | 36K | |
![[ ]](/icons/compressed.gif) | esterhazy_peter_fuharosok_html.zip | 2007-03-24 02:53 | 36K | |
![[ ]](/icons/unknown.gif) | gonosz2.doc | 2006-05-29 11:04 | 36K | |
![[ ]](/icons/unknown.gif) | 3_1.doc | 2007-11-13 22:05 | 36K | |
![[ ]](/icons/unknown.gif) | 1_1.doc | 2007-11-13 22:08 | 36K | |
![[ ]](/icons/unknown.gif) | 09.rtf | 2007-11-13 22:28 | 36K | |
![[ ]](/icons/unknown.gif) | abs_nehez_istennek_lenni_a_hetfo_szombaton_kezdodoik_hu_ful.rtf | 2007-11-13 21:00 | 36K | |
![[ ]](/icons/compressed.gif) | Henry Sienkiewic-A vilagitotorony ore.zip | 2007-03-24 02:55 | 36K | |
![[ ]](/icons/compressed.gif) | irving_washington_sleepy_hollow.zip | 2007-03-24 03:01 | 36K | |
![[TXT]](/icons/text.gif) | BET4.HTM | 2007-03-24 02:58 | 36K | |
![[TXT]](/icons/text.gif) | 04 - Jan van den Boomen - Akár a csillagok.txt | 2007-03-24 02:54 | 36K | |
![[ ]](/icons/unknown.gif) | Scorba - A kísértet.rtf | 2006-06-25 07:17 | 36K | |
![[ ]](/icons/unknown.gif) | Czeslaw Chruszczewski - A Málnavörös Oah Tó.rtf | 2006-07-10 19:37 | 36K | |
![[ ]](/icons/compressed.gif) | Clive Barker - Egy halotti lepel vallomásai.zip | 2007-03-21 19:19 | 36K | |
![[ ]](/icons/compressed.gif) | blake_william_versei_rtf.zip | 2007-03-24 03:01 | 36K | |
![[ ]](/icons/unknown.gif) | William Gibson - New Rose Hotel.rtf | 2006-07-10 20:47 | 36K | |
![[ ]](/icons/unknown.gif) | Raon - Thrillion kincsei - A Sors útjai.rtf | 2006-06-25 06:42 | 36K | |
![[ ]](/icons/compressed.gif) | DEKALOG vagy a TIZPARANCSOLAT magyarazata.zip | 2007-03-24 02:53 | 36K | |
![[ ]](/icons/unknown.gif) | Chan Davis - Levél Ellennek.rtf | 2006-07-10 19:35 | 36K | |
![[ ]](/icons/unknown.gif) | 9.DOC | 2007-11-13 21:53 | 36K | |
![[TXT]](/icons/text.gif) | 05.HTM | 2007-03-24 02:55 | 36K | |
![[ ]](/icons/unknown.gif) | Kis Laszlo-A delfin | 2007-03-24 02:56 | 36K | |
![[ ]](/icons/compressed.gif) | Clifford D Simak - Árnyék-világ.zip | 2007-03-26 18:53 | 36K | |
![[ ]](/icons/compressed.gif) | A E. van Vogt - Beteljesülés.zip | 2007-03-21 16:07 | 36K | |
![[IMG]](/icons/image2.gif) | 77.gif | 2007-03-24 02:57 | 35K | |
![[ ]](/icons/compressed.gif) | barker_clive_egy_halotti_lepel_vallomasai.zip | 2007-03-24 02:52 | 35K | |
![[ ]](/icons/compressed.gif) | robotok.zip | 2007-02-21 16:30 | 35K | |
![[ ]](/icons/compressed.gif) | cooper_edmund_robotok_es_gyerekek.zip | 2007-03-24 02:53 | 35K | |
![[IMG]](/icons/image2.gif) | 08.gif | 2007-11-14 09:18 | 35K | |
![[ ]](/icons/unknown.gif) | 10.RTF | 2007-11-14 02:28 | 35K | |
![[ ]](/icons/unknown.gif) | Sambucus - Hurok.rtf | 2006-06-25 07:16 | 35K | |
![[ ]](/icons/compressed.gif) | Van Vogt, A. E._Fekete torpedóromboló - sci-fi - rtf.zip | 2006-01-07 08:45 | 35K | |
![[ ]](/icons/compressed.gif) | Szín az űrből.zip | 2007-03-26 16:56 | 35K | |
![[ ]](/icons/unknown.gif) | 09.RTF | 2007-11-14 02:28 | 35K | |
![[ ]](/icons/unknown.gif) | töltöttkáposzta.doc | 2007-03-24 02:59 | 35K | |
![[ ]](/icons/unknown.gif) | I_06.doc | 2007-11-14 08:50 | 35K | |
![[ ]](/icons/compressed.gif) | Lem, Stanislaw_A XX. század fegyverrendszerei, avagy a tótágas evolúció - rtf.zip | 2006-01-07 08:50 | 35K | |
![[ ]](/icons/compressed.gif) | Rejto Jeno - Pipacs, a fenegyerek.txt.zip | 2007-03-24 02:59 | 35K | |
![[ ]](/icons/compressed.gif) | A E. van Vogt - Fekete torpedóromboló.zip | 2007-03-21 16:07 | 35K | |
![[ ]](/icons/compressed.gif) | Fábri Péter_Zrínyi - dráma - word.zip | 2006-01-07 09:08 | 35K | |
![[TXT]](/icons/text.gif) | 09.txt | 2007-11-13 21:46 | 35K | |
![[IMG]](/icons/image2.gif) | 04.gif | 2007-11-13 21:50 | 35K | |
![[TXT]](/icons/text.gif) | EANYAGOK.HTM | 2007-03-24 02:59 | 35K | |
![[ ]](/icons/unknown.gif) | Kem Bennett - A csapda.rtf | 2006-07-10 20:21 | 35K | |
![[IMG]](/icons/image2.gif) | 05.gif | 2007-11-14 09:12 | 34K | |
![[ ]](/icons/unknown.gif) | D F Hannigan - A vén Rutherford doktor.rtf | 2006-07-10 19:38 | 34K | |
![[ ]](/icons/unknown.gif) | William T Powers - Allegória.rtf | 2006-06-25 07:34 | 34K | |
![[TXT]](/icons/text.gif) | kisertet5.htm | 2006-08-24 18:23 | 34K | |
![[ ]](/icons/unknown.gif) | 07.rtf | 2007-11-13 22:28 | 34K | |
![[ ]](/icons/compressed.gif) | Stanislaw Lem-A XXI szazad fegyverrendszerei.zip | 2007-03-24 03:00 | 34K | |
![[ ]](/icons/compressed.gif) | clarke_baxter_a_drot_kontinuum_hu_rtf.zip | 2007-02-21 16:32 | 34K | |
![[ ]](/icons/compressed.gif) | clarke-baxter_a_drot_kontinuum_hu_rtf.zip | 2007-03-24 02:49 | 34K | |
![[ ]](/icons/compressed.gif) | Arthur C Clarke - Drót kontinum.zip | 2007-03-23 13:30 | 34K | |
![[ ]](/icons/unknown.gif) | Vaszilij - Megbabonázva.rtf | 2006-06-25 07:30 | 34K | |
![[ ]](/icons/compressed.gif) | Eryx falai között.zip | 2007-03-26 16:55 | 34K | |
![[ ]](/icons/compressed.gif) | Csan buddhista anekdotakincs.zip | 2007-03-24 02:53 | 34K | |
![[TXT]](/icons/text.gif) | A Teremtés Sorozat Tizenkettedik Leckéje ``Az új kapcsolatotok a Szellemmel''.htm | 2007-03-24 02:53 | 34K | |
![[ ]](/icons/compressed.gif) | a_lap_liderce.zip | 2007-03-24 02:57 | 34K | |
![[ ]](/icons/unknown.gif) | IV_03.doc | 2007-11-13 21:39 | 34K | |
![[ ]](/icons/unknown.gif) | 1_5.doc | 2007-11-14 02:13 | 34K | |
![[ ]](/icons/unknown.gif) | David Grinnell - A Liszenko-labirintus.rtf | 2006-07-10 19:39 | 34K | |
![[ ]](/icons/compressed.gif) | balzac_honore_de_voros_vendegfogado.zip | 2007-03-24 02:55 | 34K | |
![[ ]](/icons/compressed.gif) | Pogany Csaba-Intelligens gyerekek-Intelligens felnottek.zip | 2007-03-24 02:58 | 34K | |
![[ ]](/icons/unknown.gif) | Jean-Pierre Andrevon - Mégis belopózik.rtf | 2006-07-10 20:15 | 34K | |
![[TXT]](/icons/text.gif) | 23.TXT | 2007-11-13 23:34 | 34K | |
![[ ]](/icons/compressed.gif) | Slobodan Antonic-Slobodan Milosevic 1987-1997.zip | 2007-03-24 03:00 | 34K | |
![[TXT]](/icons/text.gif) | ellenseg.htm | 2006-08-24 18:22 | 34K | |
![[ ]](/icons/unknown.gif) | 4.4 | 2007-03-24 02:54 | 34K | |
![[ ]](/icons/layout.gif) | mumus.pdf | 2001-10-30 10:46 | 34K | |
![[ ]](/icons/compressed.gif) | Chandler, Bertram A._Hosszú zuhanás - sci-fi novella - rtf.zip | 2006-01-07 09:10 | 34K | |
![[TXT]](/icons/text.gif) | 17.HTM | 2007-03-24 02:55 | 34K | |
![[ ]](/icons/unknown.gif) | 12.RTF | 2007-11-13 22:26 | 34K | |
![[ ]](/icons/unknown.gif) | 1.1 | 2007-03-24 02:54 | 34K | |
![[TXT]](/icons/text.gif) | felejt.htm | 2006-08-24 18:22 | 33K | |
![[ ]](/icons/unknown.gif) | Witold Zegalski - Kalandok a Szaturnusz gyűrűkben.RTF | 2006-06-25 07:35 | 33K | |
![[ ]](/icons/compressed.gif) | lem_stanislaw_patkany_a_labirintusban.zip | 2007-03-24 03:00 | 33K | |
![[ ]](/icons/compressed.gif) | Stanislaw Lem - Patkany a labirintusban.zip | 2006-05-29 11:27 | 33K | |
![[ ]](/icons/compressed.gif) | A doktor esete.zip | 2007-04-15 04:01 | 33K | |
![[ ]](/icons/unknown.gif) | H. P. Lovecraft - Cthulhu hívása.rar | 2007-03-24 02:55 | 33K | |
![[ ]](/icons/unknown.gif) | Cyrus - Ascens Morga.rtf | 2006-06-25 06:32 | 33K | |
![[ ]](/icons/unknown.gif) | 2_1.doc | 2007-11-13 21:34 | 33K | |
![[ ]](/icons/compressed.gif) | Lovecraft, Howard Philips_A bezárt szoba - novella - rtf.zip | 2006-01-07 09:03 | 33K | |
![[ ]](/icons/compressed.gif) | Örökség.txt.zip | 2007-03-24 02:49 | 33K | |
![[ ]](/icons/compressed.gif) | Herbert W. Franke - Menedék.zip | 2006-05-29 11:08 | 33K | |
![[ ]](/icons/unknown.gif) | Warren Earle - A Forbes elleni vád.rtf | 2006-06-25 07:34 | 33K | |
![[ ]](/icons/compressed.gif) | Bogáti Péter - Az eljátszott teremtés.zip | 2007-03-23 15:30 | 33K | |
![[ ]](/icons/compressed.gif) | king_stephen_a_doktor_esete.zip | 2007-03-24 03:00 | 33K | |
![[ ]](/icons/compressed.gif) | Herbert W. Franke - Einstein orokosei.zip | 2006-05-29 13:25 | 33K | |
![[ ]](/icons/unknown.gif) | Kim Antieau - Egy másik világ.rtf | 2006-07-10 20:21 | 33K | |
![[ ]](/icons/compressed.gif) | Ray Bradbury - Eltunt város a Marson.zip | 2007-03-22 16:58 | 33K | |
![[ ]](/icons/unknown.gif) | Az ezüstkulcs kapuin (át).rar | 2007-03-24 02:55 | 33K | |
![[ ]](/icons/unknown.gif) | Az ezüstkulcs kapuin át.rar | 2007-03-24 02:55 | 33K | |
![[ ]](/icons/unknown.gif) | Lisa Tuttle - Útvesztőben.rtf | 2006-07-10 20:31 | 33K | |
![[ ]](/icons/compressed.gif) | Franke, Herbert W._Einstein örökösei - sci-fi novella - rtf.zip | 2006-01-07 09:08 | 33K | |
![[ ]](/icons/unknown.gif) | Ljuben Dilov - Emberiség előre.rtf | 2006-07-10 20:31 | 33K | |
![[ ]](/icons/unknown.gif) | Rébeli Szabó Ferenc - Shielar története.rtf | 2006-06-25 07:15 | 33K | |
![[ ]](/icons/unknown.gif) | 1_9.doc | 2007-11-14 02:13 | 33K | |
![[TXT]](/icons/text.gif) | BET3.HTM | 2007-03-24 02:58 | 32K | |
![[TXT]](/icons/text.gif) | Egy szellemjárta ház hiteles története.htm | 2007-03-24 02:56 | 32K | |
![[ ]](/icons/compressed.gif) | K E Ciolkovszkij-Seta a holdon.zip | 2007-03-24 02:56 | 32K | |
![[IMG]](/icons/image2.gif) | CIMLAP.JPG | 2007-03-24 02:54 | 32K | |
![[ ]](/icons/compressed.gif) | William Tenn - Gyermekjatek.zip | 2006-05-29 11:28 | 32K | |
![[ ]](/icons/unknown.gif) | 20.rtf | 2007-11-14 05:28 | 32K | |
![[ ]](/icons/compressed.gif) | simak_clifford_d_a_szomszed.zip | 2007-03-24 02:52 | 32K | |
![[ ]](/icons/compressed.gif) | SimakAszomszed.zip | 2007-02-21 16:35 | 32K | |
![[ ]](/icons/compressed.gif) | Clifford D Simak - A szomszed.zip | 2005-06-22 15:42 | 32K | |
![[ ]](/icons/unknown.gif) | Vincent Gavalliert - Mikor az arany az élet.rtf | 2006-06-25 07:31 | 32K | |
![[ ]](/icons/unknown.gif) | TIBETKNY.ZIP | 2007-03-24 02:59 | 32K | |
![[ ]](/icons/unknown.gif) | George Sumner Albee - Legfelül.rtf | 2006-07-10 19:49 | 32K | |
![[ ]](/icons/compressed.gif) | lll_a_halal_kisvasuton_erkezik.zip | 2007-03-20 00:16 | 32K | |
![[ ]](/icons/compressed.gif) | a_halal_kisvasuton_erkezik.zip | 2007-03-24 02:57 | 32K | |
![[ ]](/icons/unknown.gif) | William Morrison (Joseph Samachson) - Az ideális bíró.rtf | 2006-06-25 07:34 | 32K | |
![[ ]](/icons/compressed.gif) | ciolkovszkij_seta_a_holdon.zip | 2007-02-21 16:35 | 32K | |
![[ ]](/icons/compressed.gif) | ciolkovszkij_k_e_seta_a_holdon.zip | 2007-03-24 02:56 | 32K | |
![[ ]](/icons/compressed.gif) | Ciolkovszkij, K. E._Séta a Holdon - rtf.zip | 2006-01-07 08:48 | 32K | |
![[ ]](/icons/compressed.gif) | gogol_egy_orult_naploja.doc.zip | 2007-03-24 02:58 | 32K | |
![[ ]](/icons/compressed.gif) | redfield_james_mprof_zsk.zip | 2006-05-10 06:27 | 32K | |
![[ ]](/icons/unknown.gif) | 01.RTF | 2007-11-14 06:28 | 32K | |
![[ ]](/icons/compressed.gif) | Damon Knight - Négyes fogat.zip | 2007-03-26 15:36 | 32K | |
![[ ]](/icons/unknown.gif) | Raon - Okkult tanok börtönében.rtf | 2006-06-25 06:42 | 32K | |
![[ ]](/icons/unknown.gif) | Konrad Fialkowski - A glóriás ember.rtf | 2006-07-10 20:23 | 32K | |
![[ ]](/icons/compressed.gif) | Roger_Zelazny_A_December_Klub.zip | 2007-03-24 03:00 | 32K | |
![[ ]](/icons/compressed.gif) | Csigás Gábor - Homályos emlék csupán.zip | 2007-03-23 20:22 | 32K | |
![[ ]](/icons/compressed.gif) | DŰNE-B Herbert K J Anderson.zip | 2007-03-24 02:49 | 32K | |
![[ ]](/icons/unknown.gif) | Túró torta,Fanta szele,Banános Túrótorta,Remegös rétes.doc | 2007-03-24 02:59 | 32K | |
![[ ]](/icons/unknown.gif) | Rezepte.doc | 2007-03-24 02:59 | 32K | |
![[ ]](/icons/compressed.gif) | idoutazas.zip | 2007-03-24 02:57 | 31K | |
![[ ]](/icons/unknown.gif) | Raffy4 - A szappan utáni élet.rtf | 2006-06-25 06:40 | 31K | |
![[ ]](/icons/unknown.gif) | Czeslaw Chruszczewski - A város, amely lesz.rtf | 2006-07-10 19:38 | 31K | |
![[ ]](/icons/compressed.gif) | vu-ce_a_haboru_utja.zip | 2007-03-24 03:01 | 31K | |
![[ ]](/icons/compressed.gif) | A nő halvanykék illata.zip | 2007-03-24 02:49 | 31K | |
![[ ]](/icons/compressed.gif) | Wyndham, John_Bamba Mars-lakó - sci-fi novella - rtf.zip | 2006-01-07 08:42 | 31K | |
![[TXT]](/icons/text.gif) | Hótündér.htm | 2007-03-24 02:56 | 31K | |
![[ ]](/icons/compressed.gif) | Brian W. Aldiss - A verkeringes.zip | 2006-05-29 11:00 | 31K | |
![[ ]](/icons/compressed.gif) | varro_daniel_bogre_azur_hu_doc.zip | 2007-03-24 03:01 | 31K | |
![[TXT]](/icons/text.gif) | 21.TXT | 2007-11-13 23:34 | 31K | |
![[ ]](/icons/compressed.gif) | Lovecraft, Howard Philips_Eryx fala között - novella - rtf.zip | 2006-01-07 09:03 | 31K | |
![[ ]](/icons/compressed.gif) | csukas_istvan_a_mu_susu-a_buvos_virag_html.zip | 2007-03-24 02:57 | 31K | |
![[TXT]](/icons/text.gif) | RPG_HU - - Mesélőknek - Doran, te drága___ (Modul).htm | 2007-04-15 15:37 | 31K | |
![[ ]](/icons/unknown.gif) | Adrian Bogoz - A sztochasztikus istenek oltára.rtf | 2006-07-10 19:25 | 31K | |
![[ ]](/icons/compressed.gif) | 22csapda.zip | 2007-03-24 02:56 | 31K | |
![[ ]](/icons/compressed.gif) | Theodore Sturgeon-Butelia Drogeria.zip | 2007-03-24 03:00 | 31K | |
![[ ]](/icons/unknown.gif) | Cthulhu hívása.rar | 2007-03-24 02:55 | 31K | |
![[ ]](/icons/unknown.gif) | Saláták.doc | 2007-03-24 02:59 | 31K | |
![[ ]](/icons/unknown.gif) | Túrin - Szentségtörés.rtf | 2006-06-25 07:23 | 31K | |
![[ ]](/icons/compressed.gif) | halvanykek.zip | 2007-02-21 16:50 | 31K | |
![[ ]](/icons/compressed.gif) | Apáti Miklós_ A nő halványkék illata - sci-fi - word.zip | 2006-01-07 08:45 | 31K | |
![[ ]](/icons/unknown.gif) | Sinicsi Hosi - Három történet.rtf | 2006-06-25 07:17 | 31K | |
![[ ]](/icons/compressed.gif) | Bester, Alfred_Szívélyes Fahrenheit - sci-fi - rtf.zip | 2006-01-07 09:13 | 31K | |
![[ ]](/icons/compressed.gif) | Budhista kozeput filozofiaja--Feher Judit.zip | 2007-03-24 02:53 | 31K | |
![[IMG]](/icons/image2.gif) | 06.gif | 2007-11-14 09:18 | 31K | |
![[ ]](/icons/unknown.gif) | Sokkoppantói legenda.rtf | 2006-07-10 19:23 | 31K | |
![[ ]](/icons/compressed.gif) | esterhazy_peter_elet_es_irodalom_html.zip | 2007-03-24 02:53 | 31K | |
![[ ]](/icons/compressed.gif) | csath_geza_a_janika_rtf.zip | 2007-03-24 02:52 | 31K | |
![[ ]](/icons/compressed.gif) | Theodore Sturgeon - Butélia Drogéria.zip | 2006-05-29 11:27 | 31K | |
![[ ]](/icons/unknown.gif) | George Griffith - Villámsarok.rtf | 2006-07-10 19:48 | 31K | |
![[ ]](/icons/unknown.gif) | A kisertetjárta ház.doc | 2007-04-15 14:07 | 31K | |
![[ ]](/icons/compressed.gif) | foldiekkel_jatszo.zip | 2007-03-24 02:57 | 30K | |
![[ ]](/icons/unknown.gif) | Scorba - Az utolsó villamos.rtf | 2006-06-25 07:17 | 30K | |
![[IMG]](/icons/image2.gif) | ALAGSOR.JPG | 2007-04-15 15:46 | 30K | |
![[ ]](/icons/compressed.gif) | John Wyndham - Bamba Marslako.zip | 2006-05-29 11:12 | 30K | |
![[ ]](/icons/compressed.gif) | Lem, Stanislaw_Patkány a labirintusban - sci-fi - rtf.zip | 2006-01-07 09:03 | 30K | |
![[ ]](/icons/compressed.gif) | jokai_mor_a_nagyenyedi_ket_fuzfa_doc.zip | 2007-03-24 02:56 | 30K | |
![[ ]](/icons/unknown.gif) | oedipus.ace | 2007-03-24 02:52 | 30K | |
![[ ]](/icons/compressed.gif) | Oscar Wide-A Canterville-i kisertet.zip | 2007-03-24 02:58 | 30K | |
![[TXT]](/icons/text.gif) | 19.TXT | 2007-11-13 23:34 | 30K | |
![[TXT]](/icons/text.gif) | I_05.HTM | 2007-03-24 02:54 | 30K | |
![[ ]](/icons/unknown.gif) | reival.doc | 2007-04-15 13:41 | 30K | |
![[ ]](/icons/unknown.gif) | pacal különlegesen.doc | 2007-03-24 02:59 | 30K | |
![[ ]](/icons/unknown.gif) | 3_7.doc | 2007-11-14 04:45 | 30K | |
![[ ]](/icons/unknown.gif) | mese.zip2 | 2007-03-24 02:57 | 30K | |
![[ ]](/icons/compressed.gif) | ykpdf_konnycsepp.zip | 2007-03-24 02:54 | 30K | |
![[IMG]](/icons/image2.gif) | 02.gif | 2007-11-14 09:12 | 30K | |
![[ ]](/icons/unknown.gif) | MALAJKNY.ZIP | 2007-03-24 02:59 | 30K | |
![[ ]](/icons/compressed.gif) | Card, Orson Scott_Kutyafuttató - sci-fi novella - rtf.zip | 2006-01-07 09:10 | 30K | |
![[ ]](/icons/unknown.gif) | Az üzlet.ace | 2007-03-24 02:54 | 30K | |
![[ ]](/icons/compressed.gif) | russell_eric_frank_probako.zip | 2007-03-24 02:53 | 30K | |
![[ ]](/icons/compressed.gif) | RussellProbako.zip | 2007-02-21 16:28 | 30K | |
![[ ]](/icons/compressed.gif) | Julio Cotazar-Dulimanok es famak.zip | 2007-03-24 02:56 | 30K | |
![[ ]](/icons/unknown.gif) | Pomona - Sodrásban.rtf | 2006-06-25 06:39 | 30K | |
![[ ]](/icons/unknown.gif) | H. P. Lovecraft - Szín az _rb_l.rar | 2007-03-24 02:55 | 30K | |
![[ ]](/icons/compressed.gif) | asimov_isaac_tukorkep.zip | 2007-03-24 02:55 | 30K | |
![[ ]](/icons/unknown.gif) | III_05.doc | 2007-11-14 03:34 | 30K | |
![[ ]](/icons/compressed.gif) | Larry Niven - Az ellenség.zip | 2007-03-26 17:46 | 29K | |
![[ ]](/icons/compressed.gif) | Brian W. Aldiss - Mondjátok el nekik.zip | 2006-05-29 11:00 | 29K | |
![[ ]](/icons/compressed.gif) | csukas_istvan_mirr-mur_nyomoz_html.zip | 2007-03-24 02:57 | 29K | |
![[ ]](/icons/unknown.gif) | Szappanos Szabolcs - Az Éjszemű.rtf | 2006-06-25 07:19 | 29K | |
![[ ]](/icons/compressed.gif) | Szun-Ce-Ahadviseles torvenyei.zip | 2007-03-24 03:00 | 29K | |
![[TXT]](/icons/text.gif) | alapa.htm | 2006-08-24 18:22 | 29K | |
![[ ]](/icons/compressed.gif) | brown_h_jackson_ujabb_kis_utmutato_hu_txt.zip | 2007-03-24 02:55 | 29K | |
![[ ]](/icons/unknown.gif) | Sergio Turone - Kozmikus kompromisszum.rtf | 2006-06-25 07:17 | 29K | |
![[ ]](/icons/unknown.gif) | Virág Attila - A Sors útjai.rtf | 2006-06-25 07:31 | 29K | |
![[IMG]](/icons/image2.gif) | CIMLAP_K.JPG | 2007-03-24 02:54 | 29K | |
![[ ]](/icons/compressed.gif) | Richard Dawkins - szivarvanybontas.zip | 2006-05-10 06:27 | 29K | |
![[TXT]](/icons/text.gif) | II_04-06.HTM | 2007-03-24 02:58 | 29K | |
![[ ]](/icons/compressed.gif) | Henrich Altov - Kiscsacsi és axioma.zip | 2007-03-21 19:09 | 29K | |
![[ ]](/icons/compressed.gif) | asimov_isaac_rogeszme.zip | 2007-03-24 02:55 | 29K | |
![[ ]](/icons/compressed.gif) | Isaac Asimov - Rogeszme.zip | 2006-05-10 06:21 | 29K | |
![[ ]](/icons/compressed.gif) | AsimovRogeszme.zip | 2007-02-21 16:03 | 29K | |
![[ ]](/icons/compressed.gif) | A E. Van Vogt - A varázslónő álma.zip | 2007-03-21 16:07 | 29K | |
![[ ]](/icons/compressed.gif) | Elt_nt város a Marson.htm.zip | 2007-03-24 02:59 | 29K | |
![[ ]](/icons/unknown.gif) | Csatatér.doc | 2007-03-24 02:52 | 29K | |
![[ ]](/icons/compressed.gif) | William Tenn - Lent, a halottak kozott.zip | 2006-05-29 11:28 | 29K | |
![[ ]](/icons/compressed.gif) | Kahlil Gibrain-A profeta.zip | 2007-03-24 02:56 | 29K | |
![[ ]](/icons/compressed.gif) | Van Vogt, A. E._A varázslónő álma - sci-fi - rtf.zip | 2006-01-07 08:45 | 29K | |
![[ ]](/icons/compressed.gif) | herzum.zip | 2007-02-21 16:36 | 29K | |
![[ ]](/icons/unknown.gif) | Herzum Peter-Hataraink.ZIP | 2007-03-24 02:55 | 29K | |
![[TXT]](/icons/text.gif) | Disznótoros receptek 2_ - Szalámik 1_.txt | 2007-03-24 02:59 | 29K | |
![[TXT]](/icons/text.gif) | A m_alkotás filozófiája.htm | 2007-03-24 02:53 | 29K | |
![[ ]](/icons/unknown.gif) | Tobias - A bosszú.rtf | 2006-06-25 07:22 | 29K | |
![[TXT]](/icons/text.gif) | Eltevések - Barack 2_ Kajszibarack, Őszibarack 1_.txt | 2007-03-24 02:59 | 29K | |
![[TXT]](/icons/text.gif) | Isaac Asimov - 5-6-7.txt | 2006-12-13 08:58 | 29K | |
![[TXT]](/icons/text.gif) | ZILAHY4.HTM | 2007-03-24 02:59 | 29K | |
![[ ]](/icons/compressed.gif) | brown_h_jackson_kis_utmutato_hu_txt.zip | 2007-03-24 02:55 | 29K | |
![[ ]](/icons/compressed.gif) | A SZEMFÉNYVESZTÉS LELEPLEZÉSÉNEK .zip | 2007-03-24 02:52 | 29K | |
![[ ]](/icons/compressed.gif) | card_orson_scott_kutyafuttato.zip | 2007-03-24 02:58 | 29K | |
![[ ]](/icons/compressed.gif) | Orson Scott Card - Kutyafuttató.zip | 2006-05-29 10:55 | 29K | |
![[ ]](/icons/compressed.gif) | Fialkowski, Konrad_Biohazard - sci-fi novella - rtf.zip | 2006-01-07 09:08 | 29K | |
![[ ]](/icons/unknown.gif) | William Hope Hodgson - Hang az éjszakában.rtf | 2006-06-25 07:34 | 29K | |
![[ ]](/icons/compressed.gif) | A E. Van Vogt - Szunnyado.zip | 2007-03-25 05:26 | 29K | |
![[ ]](/icons/unknown.gif) | MARHA.DOC | 2007-03-24 02:59 | 29K | |
![[ ]](/icons/compressed.gif) | szunnyado.zip | 2007-02-21 15:53 | 28K | |
![[ ]](/icons/compressed.gif) | Renier, Raoul, vagyis Kornya Zsolt_A szerepjátékok első húsz éve - html.zip | 2006-01-07 08:54 | 28K | |
![[ ]](/icons/compressed.gif) | Smith, Cordwainer_Alfa ralfa körút - sci-fi - rtf.zip | 2006-01-07 08:53 | 28K | |
![[ ]](/icons/compressed.gif) | vladko.zip | 2007-02-21 16:09 | 28K | |
![[ ]](/icons/unknown.gif) | Vlodimir Vladko-A Hold nem a Fold.ZIP | 2007-03-24 03:01 | 28K | |
![[TXT]](/icons/text.gif) | Brokkolis receptek.txt | 2007-03-24 02:59 | 28K | |
![[ ]](/icons/compressed.gif) | Fábri Péter_A Tandori Taniroda - cikkek, versek - word.zip | 2006-01-07 09:08 | 28K | |
![[TXT]](/icons/text.gif) | napbomba.htm | 2006-08-24 18:23 | 28K | |
![[ ]](/icons/compressed.gif) | lem_stanislaw_117 m_25e1sodperc.zip | 2007-03-24 03:00 | 28K | |
![[ ]](/icons/compressed.gif) | Stanislaw Lem - 117 másodperc.zip | 2006-05-29 11:24 | 28K | |
![[ ]](/icons/compressed.gif) | csukas_istvan_hogyan_fogtam_el_settenkedo_todort_html.zip | 2007-03-24 02:57 | 28K | |
![[ ]](/icons/compressed.gif) | king_stephen_a_jaunt_hu_rtf.zip | 2007-03-24 03:00 | 28K | |
![[ ]](/icons/compressed.gif) | Lem, Stanislaw_Százharminchét másodperc - rtf.zip | 2006-01-07 09:03 | 28K | |
![[ ]](/icons/compressed.gif) | Brian W. Aldiss - A lét és a halál.zip | 2006-05-29 10:59 | 28K | |
![[ ]](/icons/compressed.gif) | Balint Agnes-Mazsola.zip | 2007-03-24 02:52 | 28K | |
![[ ]](/icons/unknown.gif) | 08.RTF | 2007-11-14 02:28 | 28K | |
![[TXT]](/icons/text.gif) | Szomjúság.htm | 2007-03-24 02:53 | 28K | |
![[ ]](/icons/unknown.gif) | Jean-Pierre Andrevon - Ide nekem a csillagokat!.rtf | 2006-07-10 20:15 | 28K | |
![[ ]](/icons/unknown.gif) | Larry Eisenberg - Az apám korában.rtf | 2006-07-10 20:26 | 28K | |
![[ ]](/icons/unknown.gif) | Saláta.doc | 2007-03-24 02:59 | 28K | |
![[TXT]](/icons/text.gif) | 10.HTM | 2007-03-24 02:55 | 28K | |
![[ ]](/icons/unknown.gif) | H. P. Lovecraft - Eryx falai között.rar | 2007-03-24 02:55 | 28K | |
![[ ]](/icons/unknown.gif) | Olga Larionova - Válás Mars módra.rtf | 2006-06-25 06:35 | 28K | |
![[ ]](/icons/unknown.gif) | orult.ace | 2007-03-24 02:52 | 28K | |
![[ ]](/icons/unknown.gif) | Raon - Béke Haza Becsület.rtf | 2006-06-25 06:42 | 28K | |
![[IMG]](/icons/image2.gif) | ehatter.gif | 2007-03-24 02:53 | 28K | |
![[TXT]](/icons/text.gif) | II_07-09.HTM | 2007-03-24 02:58 | 28K | |
![[ ]](/icons/compressed.gif) | 117.zip | 2007-02-21 15:49 | 28K | |
![[ ]](/icons/unknown.gif) | Samuel B Kingstone - Vámpírsárkány.rtf | 2006-06-25 07:16 | 28K | |
![[ ]](/icons/compressed.gif) | Tolkien, John Ronald Reuel_A woottoni kovácsmester - txt.zip | 2006-01-07 08:51 | 28K | |
![[ ]](/icons/unknown.gif) | Varga C Alice - Sárkányhercegnő.rtf | 2006-06-25 07:24 | 28K | |
![[ ]](/icons/unknown.gif) | A bezárt szoba.rar | 2007-03-24 02:55 | 28K | |
![[ ]](/icons/compressed.gif) | A Wootton-i Kovácsmester.zip | 2007-03-26 19:31 | 28K | |
![[ ]](/icons/compressed.gif) | Hamvas Bela-Extazis.zip | 2007-03-24 02:53 | 28K | |
![[ ]](/icons/compressed.gif) | tolkien_jrr_a_wootoni_kovacsmester_hu_txt.zip | 2007-03-24 02:54 | 28K | |
![[IMG]](/icons/image2.gif) | ZSEMLE.JPG | 2007-03-24 02:59 | 28K | |
![[ ]](/icons/unknown.gif) | Vaszilij - Performansz.rtf | 2006-06-25 07:30 | 28K | |
![[ ]](/icons/unknown.gif) | Marietta Csudakova - A létezés tere.rtf | 2006-07-10 20:33 | 28K | |
![[ ]](/icons/unknown.gif) | Night Phoenix - Hagyd meghalni.rtf | 2006-06-25 06:33 | 28K | |
![[ ]](/icons/compressed.gif) | Wyndham, John_Túlélni - sci-fi novella - rtf.zip | 2006-01-07 08:42 | 28K | |
![[ ]](/icons/unknown.gif) | Sztorm - Átokföldje meséi-Parancs.rtf | 2006-06-25 07:20 | 28K | |
![[ ]](/icons/compressed.gif) | Knight, Damon_A hajósinas - sci-fi novella - rtf.zip | 2006-01-07 09:05 | 28K | |
![[TXT]](/icons/text.gif) | ufoestud.txt | 2007-03-24 02:58 | 28K | |
![[ ]](/icons/compressed.gif) | csath_geza_anyagyilkossag.zip | 2007-03-24 02:52 | 28K | |
![[ ]](/icons/unknown.gif) | Marhahús.doc | 2007-03-24 02:59 | 28K | |
![[ ]](/icons/compressed.gif) | Renier, Raoul, vagyis Kornya Zsolt_A griffmadár - html.zip | 2006-01-07 08:54 | 27K | |
![[ ]](/icons/unknown.gif) | Sichetti - Nyomot hagyni.rtf | 2006-06-25 07:17 | 27K | |
![[ ]](/icons/compressed.gif) | london_jack_a_mexikoi_hu_doc_nncl3022-708v1.zip | 2007-03-24 02:55 | 27K | |
![[ ]](/icons/compressed.gif) | Damon Knight - A hajósinas.zip | 2007-03-26 15:35 | 27K | |
![[ ]](/icons/compressed.gif) | Dick, Philip K._Az előszemélyek - sci-fi novella - rtf.zip | 2006-01-07 09:09 | 27K | |
![[ ]](/icons/compressed.gif) | Philip K Dick - Az eloszemelyek.zip | 2006-05-29 11:13 | 27K | |
![[ ]](/icons/unknown.gif) | 45.rtf | 2007-11-13 22:36 | 27K | |
![[ ]](/icons/unknown.gif) | Pat Murphy-A szerelmes Rachel | 2007-03-24 02:58 | 27K | |
![[ ]](/icons/compressed.gif) | John Wyndham - Tulelni.zip | 2006-05-29 11:12 | 27K | |
![[ ]](/icons/unknown.gif) | Szín az űrből.rar | 2007-03-24 02:55 | 27K | |
![[ ]](/icons/compressed.gif) | Dale Avery - A renegát - függelék.zip | 2007-04-06 11:07 | 27K | |
![[TXT]](/icons/text.gif) | Video - ember.htm | 2007-03-24 02:58 | 27K | |
![[ ]](/icons/compressed.gif) | Godwin, Tom_Rideg egyenletek - sci-fi novella - word.zip | 2006-01-07 09:08 | 27K | |
![[ ]](/icons/compressed.gif) | Camilo Jose Cela-Arhidonai bajdorong hostette.zip | 2007-03-24 02:52 | 27K | |
![[TXT]](/icons/text.gif) | thozzaszol.htm | 2007-04-15 13:22 | 27K | |
![[ ]](/icons/unknown.gif) | 34.rtf | 2007-11-14 05:30 | 27K | |
![[ ]](/icons/compressed.gif) | simak_clifford_d_a_rossz_pelda.zip | 2007-03-24 02:52 | 27K | |
![[ ]](/icons/compressed.gif) | SimakArossz.zip | 2007-02-21 16:35 | 27K | |
![[ ]](/icons/compressed.gif) | Clifford D Simak - A rossz példa.zip | 2005-06-22 17:00 | 27K | |
![[ ]](/icons/compressed.gif) | Pat Murphy - A szerelmes Rachel.zip | 2006-05-29 11:13 | 27K | |
![[IMG]](/icons/image2.gif) | 03.gif | 2007-11-14 09:12 | 27K | |
![[ ]](/icons/unknown.gif) | Howard Fast - Az óriás-hangya.rtf | 2006-07-10 19:59 | 27K | |
![[IMG]](/icons/image2.gif) | 07.gif | 2007-11-14 09:18 | 27K | |
![[ ]](/icons/unknown.gif) | Juan G Atienza - Egy ember egyedül maradt.rtf | 2006-07-10 20:18 | 27K | |
![[ ]](/icons/compressed.gif) | Dévényi-Novellák.zip | 2007-03-23 21:40 | 27K | |
![[ ]](/icons/unknown.gif) | H. P. Lovecraft - Herbert West, az újjáéleszt_.rar | 2007-03-24 02:55 | 27K | |
![[ ]](/icons/unknown.gif) | Annie Besant A lélek létezésének bizonyítékai.rar | 2007-03-24 02:53 | 27K | |
![[ ]](/icons/unknown.gif) | 10.rtf | 2007-11-13 22:28 | 27K | |
![[ ]](/icons/compressed.gif) | Theodore Sturgeon - Butil es Fuvo.zip | 2006-05-29 11:27 | 27K | |
![[ ]](/icons/unknown.gif) | 19.RTF | 2007-11-13 22:10 | 27K | |
![[ ]](/icons/compressed.gif) | Elektronikus konyvtari ertelmezo szotar.zip | 2007-03-24 02:53 | 27K | |
![[TXT]](/icons/text.gif) | thozzaszol.h | 2007-04-15 14:13 | 27K | |
![[TXT]](/icons/text.gif) | III_01.HTM | 2007-03-24 02:54 | 27K | |
![[ ]](/icons/unknown.gif) | Robert Bloch - Richard Clayton különös repülése.rtf | 2006-06-25 08:16 | 27K | |
![[ ]](/icons/unknown.gif) | tálalás.doc | 2007-03-24 02:59 | 27K | |
![[ ]](/icons/unknown.gif) | kínai kel.doc | 2007-03-24 02:59 | 27K | |
![[ ]](/icons/unknown.gif) | Beigli.doc | 2007-03-24 02:59 | 27K | |
![[IMG]](/icons/image2.gif) | BORITO.JPG | 2007-03-24 02:54 | 26K | |
![[ ]](/icons/compressed.gif) | finney_jack_eltunt_emberek_hu_doc_nncl2531-69cv1.zip | 2007-03-24 02:55 | 26K | |
![[TXT]](/icons/text.gif) | RPG_HU - - Mesélőknek - A Mélysivatag Legendája - modul.htm | 2007-04-15 16:52 | 26K | |
![[ ]](/icons/compressed.gif) | Murphy, Pat_A szerelmes Rachel - sci-fi novella - html.zip | 2006-01-07 08:59 | 26K | |
![[ ]](/icons/unknown.gif) | Tiaro - A völgy.rtf | 2006-06-25 07:21 | 26K | |
![[TXT]](/icons/text.gif) | Délutáni álom.htm | 2007-03-24 02:52 | 26K | |
![[ ]](/icons/compressed.gif) | Alan E Nourse - A hamisítvány.zip | 2007-03-26 17:49 | 26K | |
![[ ]](/icons/compressed.gif) | William Tenn (Philip Klass) - Lent, a halottak között.zip | 2006-05-29 11:28 | 26K | |
![[ ]](/icons/compressed.gif) | asimov_isaac_mit_neveznek_szerelem.zip | 2007-03-24 02:55 | 26K | |
![[ ]](/icons/compressed.gif) | Cannibal Holocaust HUN - SB.zip | 2006-05-29 11:02 | 26K | |
![[ ]](/icons/compressed.gif) | Isaac Asimov - Bibliografia.zip | 2007-03-22 05:29 | 26K | |
![[TXT]](/icons/text.gif) | III_03.HTM | 2007-03-24 02:54 | 26K | |
![[ ]](/icons/unknown.gif) | Eryx falai között.rar | 2007-03-24 02:55 | 26K | |
![[ ]](/icons/unknown.gif) | kelbimbó.doc | 2007-03-24 02:59 | 26K | |
![[ ]](/icons/unknown.gif) | 12 - Függelék.doc | 2007-03-24 02:54 | 26K | |
![[ ]](/icons/compressed.gif) | moricz_zsigmond_osszes_koltemenye_rtf.zip | 2007-03-24 02:58 | 26K | |
![[ ]](/icons/unknown.gif) | Joan Aiken - Szereti Ön Grieget.rtf | 2006-07-10 20:15 | 26K | |
![[TXT]](/icons/text.gif) | Varázslat.htm | 2007-03-24 02:53 | 26K | |
![[ ]](/icons/unknown.gif) | d.class | 2007-03-24 02:54 | 26K | |
![[TXT]](/icons/text.gif) | III04-06.HTM | 2007-03-24 02:58 | 26K | |
![[ ]](/icons/compressed.gif) | USA Fugetlensegi nyilatkozata.zip | 2007-03-24 03:00 | 26K | |
![[ ]](/icons/compressed.gif) | Lem, Stanislaw_Az igazság - sci-fi novella - rtf.zip | 2006-01-07 09:03 | 26K | |
![[ ]](/icons/unknown.gif) | Villányi Dániel - Expedíció a Vörös Bolygóra.rtf | 2006-06-25 07:30 | 26K | |
![[ ]](/icons/unknown.gif) | Turpi Úrfi - Egy más világ.rtf | 2006-06-25 07:22 | 26K | |
![[ ]](/icons/compressed.gif) | Algys Budrys - A nyár vége.zip | 2007-03-21 19:24 | 26K | |
![[ ]](/icons/compressed.gif) | lem_stanislaw_az_igazsag.zip | 2007-03-24 03:00 | 26K | |
![[ ]](/icons/compressed.gif) | Stanislaw Lem - Az igazsag.zip | 2006-05-29 11:24 | 26K | |
![[TXT]](/icons/text.gif) | A választás.htm | 2007-03-24 02:56 | 26K | |
![[TXT]](/icons/text.gif) | kivegzes.htm | 2006-08-24 18:23 | 26K | |
![[ ]](/icons/compressed.gif) | Ray Bradbury - Novellák2.zip | 2007-03-22 17:00 | 26K | |
![[ ]](/icons/unknown.gif) | Valgab - És a többi már történelem.rtf | 2006-06-25 07:24 | 26K | |
![[TXT]](/icons/text.gif) | BET2.HTM | 2007-03-24 02:58 | 26K | |
![[ ]](/icons/compressed.gif) | Mark Twain-Ádám naploja.zip | 2007-03-24 02:57 | 26K | |
![[ ]](/icons/unknown.gif) | Virág Attila - Szemében holt fénysugár.rtf | 2006-06-25 07:32 | 26K | |
![[TXT]](/icons/text.gif) | 03.TXT | 2007-11-13 21:46 | 26K | |
![[ ]](/icons/unknown.gif) | Margit szelet.doc | 2007-03-24 02:59 | 26K | |
![[ ]](/icons/unknown.gif) | A merdzsó.doc | 2006-05-29 11:01 | 26K | |
![[ ]](/icons/compressed.gif) | Tom Godwin-Rideg egyenletek.zip | 2007-03-24 03:00 | 25K | |
![[ ]](/icons/compressed.gif) | Tolvajvér.txt.zip | 2007-03-24 02:49 | 25K | |
![[ ]](/icons/compressed.gif) | Brian W. Aldiss - Ez is muveszet.zip | 2006-05-29 11:00 | 25K | |
![[ ]](/icons/unknown.gif) | Samuel B Kingstone - Királygepárd.rtf | 2006-06-25 07:16 | 25K | |
![[ ]](/icons/compressed.gif) | kesey_ken_adaz_hu_txt.zip | 2007-03-24 02:56 | 25K | |
![[ ]](/icons/compressed.gif) | Clarke, Arthur C._A mentés - sci-fi novella - rtf.zip | 2006-01-07 09:10 | 25K | |
![[ ]](/icons/unknown.gif) | Mihail Puhov - Eltűnt egy űrhajó.rtf | 2006-07-10 20:34 | 25K | |
![[TXT]](/icons/text.gif) | tart.html | 2007-03-24 02:59 | 25K | |
![[ ]](/icons/compressed.gif) | jozsef_attila_szabad-otletek_jegyzeke_rtf.zip | 2007-03-24 02:55 | 25K | |
![[ ]](/icons/unknown.gif) | A sötétség lakója.rar | 2007-03-24 02:55 | 25K | |
![[ ]](/icons/compressed.gif) | Brian W. Aldiss - H. A. B..zip | 2007-03-19 18:00 | 25K | |
![[ ]](/icons/unknown.gif) | Zenna Henderson - A holmi.rtf | 2006-06-25 07:35 | 25K | |
![[ ]](/icons/unknown.gif) | Povi - Különös ízek.rtf | 2006-06-25 06:39 | 25K | |
![[ ]](/icons/unknown.gif) | Ranagol60 - Pech.rtf | 2006-06-25 06:41 | 25K | |
![[ ]](/icons/compressed.gif) | Arthur C Clarke - A mentés.zip | 2007-03-23 13:30 | 25K | |
![[ ]](/icons/unknown.gif) | Mihail Puhov - Rakétastoppal.rtf | 2006-07-10 20:36 | 25K | |
![[ ]](/icons/unknown.gif) | sertéshusok.doc | 2007-03-24 02:59 | 25K | |
![[ ]](/icons/unknown.gif) | Római tál.doc | 2007-03-24 02:59 | 25K | |
![[ ]](/icons/unknown.gif) | A halálos nyílpuska.doc | 2007-04-15 14:48 | 25K | |
![[ ]](/icons/unknown.gif) | újházi tyúkhúsleves.doc | 2007-03-24 02:59 | 25K | |
![[TXT]](/icons/text.gif) | gyozelem.htm | 2006-08-24 18:22 | 25K | |
![[TXT]](/icons/text.gif) | remkopp.txt | 2006-05-29 13:31 | 25K | |
![[ ]](/icons/unknown.gif) | Raffy4 - Hercegnő hazudtam.rtf | 2006-06-25 06:40 | 25K | |
![[ ]](/icons/compressed.gif) | Arthur C. Clarke - Novellák.zip | 2007-03-23 13:34 | 25K | |
![[ ]](/icons/unknown.gif) | Imprisoned with the Pharaos.rar | 2007-03-24 02:55 | 25K | |
![[TXT]](/icons/text.gif) | A fekete macska.htm | 2007-03-24 02:53 | 25K | |
![[ ]](/icons/unknown.gif) | Pap Viola - Egy randevú tükrében.rtf | 2006-06-25 06:36 | 25K | |
![[TXT]](/icons/text.gif) | Hó, tükör, almák.htm | 2007-03-24 02:58 | 25K | |
![[ ]](/icons/compressed.gif) | Bester, Alfred_Gyilkos idő - sci-fi - rtf.zip | 2006-01-07 09:13 | 25K | |
![[ ]](/icons/compressed.gif) | Stepen Leacock novellai.zip | 2007-03-24 03:00 | 25K | |
![[ ]](/icons/unknown.gif) | Captain H G Bishop - A megfagyott jégtröszt.rtf | 2006-07-10 19:34 | 25K | |
![[ ]](/icons/unknown.gif) | shan_darren_demonmester_ful_hu_nncl3182-70fv0.doc | 2007-03-30 20:11 | 25K | |
![[TXT]](/icons/text.gif) | III07-09.HTM | 2007-03-24 02:58 | 24K | |
![[TXT]](/icons/text.gif) | I_07-09.HTM | 2007-03-24 02:58 | 24K | |
![[TXT]](/icons/text.gif) | 05 - Alan O'Connor - Darton nevében.txt | 2007-03-24 02:54 | 24K | |
![[ ]](/icons/unknown.gif) | Sambucus - Assasin.rtf | 2006-06-25 07:15 | 24K | |
![[ ]](/icons/unknown.gif) | 01.rtf | 2007-11-13 22:10 | 24K | |
![[ ]](/icons/unknown.gif) | Bob Shaw - Régmúlt napok fénye.rtf | 2006-07-10 19:29 | 24K | |
![[ ]](/icons/unknown.gif) | Opiario - Holtfény.rtf | 2006-06-25 06:35 | 24K | |
![[ ]](/icons/compressed.gif) | J B S Haldane-Aranycsinalok.zip | 2007-03-24 02:55 | 24K | |
![[ ]](/icons/unknown.gif) | Herbert West,az újjáélesztő.rar | 2007-03-24 02:55 | 24K | |
![[ ]](/icons/compressed.gif) | bester_alfred_gyilkos_ido.zip | 2007-03-24 02:49 | 24K | |
![[ ]](/icons/compressed.gif) | Alfred Bester - Gyilkos ido.zip | 2006-05-29 10:59 | 24K | |
![[ ]](/icons/unknown.gif) | nagyembe.ace | 2007-03-24 02:52 | 24K | |
![[ ]](/icons/unknown.gif) | terítés.doc | 2007-03-24 02:59 | 24K | |
![[ ]](/icons/unknown.gif) | krémsajt.doc | 2007-03-24 02:59 | 24K | |
![[ ]](/icons/unknown.gif) | Sambucus - Viadal.doc | 2006-06-25 07:16 | 24K | |
![[ ]](/icons/unknown.gif) | Padlizsán.doc | 2007-03-24 02:59 | 24K | |
![[ ]](/icons/unknown.gif) | Levesek.doc | 2007-03-24 02:59 | 24K | |
![[ ]](/icons/unknown.gif) | Karácsonyi aprósütemény.doc | 2007-03-24 02:59 | 24K | |
![[ ]](/icons/unknown.gif) | Aranygaluska.doc | 2007-03-24 02:59 | 24K | |
![[ ]](/icons/unknown.gif) | Almáspite.doc | 2007-03-24 02:59 | 24K | |
![[ ]](/icons/compressed.gif) | Stoker, Bram_A Bíró Háza - sci-fi novella - rtf.zip | 2006-01-07 08:52 | 24K | |
![[TXT]](/icons/text.gif) | I_04-06.HTM | 2007-03-24 02:58 | 24K | |
![[ ]](/icons/unknown.gif) | Sambucus - Vírus.rtf | 2006-06-25 07:16 | 24K | |
![[ ]](/icons/compressed.gif) | rodari_gianni_a_kozmikus_csibe_hu_doc.zip | 2007-03-24 02:55 | 24K | |
![[ ]](/icons/compressed.gif) | schneider_rolf_kenyszerleszallas.zip | 2007-03-24 03:00 | 24K | |
![[ ]](/icons/compressed.gif) | SchneiderKenyszerleszallas.zip | 2007-02-21 16:28 | 24K | |
![[IMG]](/icons/image2.gif) | CSOKIMAZ.JPG | 2007-03-24 02:59 | 24K | |
![[ ]](/icons/compressed.gif) | mesterhazi_lajos_sempiternin.zip | 2007-03-24 02:57 | 24K | |
![[ ]](/icons/compressed.gif) | Mesterházi Lajos_Sempiternin - sci-fi - word.zip | 2006-01-07 09:00 | 24K | |
![[ ]](/icons/compressed.gif) | Bilenkin, Dmitrij_A bizonytalanság elve - sci-fi novella - rtf.zip | 2006-01-07 09:10 | 24K | |
![[TXT]](/icons/text.gif) | I_07.HTM | 2007-03-24 02:54 | 24K | |
![[ ]](/icons/compressed.gif) | DR OTKER KOKTELOK es kevert italok.zip | 2007-03-24 02:59 | 24K | |
![[ ]](/icons/unknown.gif) | stargazer - Kezdetben.rtf | 2006-06-25 07:18 | 24K | |
![[TXT]](/icons/text.gif) | A hajnal egy legendája.htm | 2007-03-24 02:57 | 24K | |
![[TXT]](/icons/text.gif) | BET.HTM | 2007-03-24 02:58 | 24K | |
![[ ]](/icons/unknown.gif) | 07.RTF | 2007-11-14 02:28 | 24K | |
![[ ]](/icons/unknown.gif) | Zyro - A Riport.rtf | 2006-06-25 07:35 | 24K | |
![[ ]](/icons/compressed.gif) | asimov_isaac_gyonyoru_ido_van.zip | 2007-03-24 02:55 | 24K | |
![[TXT]](/icons/text.gif) | Gyümölcsfélék eltevése - Alma 1_.txt | 2007-03-24 02:59 | 24K | |
![[ ]](/icons/compressed.gif) | Theodore Sturgeon - Villám és rózsák.zip | 2007-03-26 19:14 | 24K | |
![[TXT]](/icons/text.gif) | Disznótoros receptek 11_ Kolbászreceptek 2_.txt | 2007-03-24 02:59 | 24K | |
![[TXT]](/icons/text.gif) | 08.TXT | 2007-11-13 21:46 | 24K | |
![[ ]](/icons/compressed.gif) | Rotterdami Erasmus-Az orvostudomany dicserete.zip | 2007-03-24 03:00 | 24K | |
![[ ]](/icons/compressed.gif) | Dmitrij Alekszandrovics Bilenkin - A bizonytalanság elve.zip | 2007-03-21 19:26 | 24K | |
![[ ]](/icons/compressed.gif) | James,Montague Rhodes-Az alkimista bosszuja.zip | 2007-03-24 02:55 | 24K | |
![[ ]](/icons/unknown.gif) | jókai bableves.doc | 2007-03-24 02:59 | 24K | |
![[ ]](/icons/unknown.gif) | IV_04.doc | 2007-11-13 21:39 | 24K | |
![[ ]](/icons/unknown.gif) | Hordós savanyúság.doc | 2007-03-24 02:59 | 24K | |
![[ ]](/icons/unknown.gif) | 4_1.doc | 2007-11-14 04:45 | 24K | |
![[ ]](/icons/compressed.gif) | Henrich Altov - Meteorok viharában.zip | 2007-03-21 19:09 | 23K | |
![[ ]](/icons/compressed.gif) | A Démon Üdve.DOC.zip | 2007-03-24 02:49 | 23K | |
![[TXT]](/icons/text.gif) | Őszi este.htm | 2007-03-24 02:52 | 23K | |
![[ ]](/icons/compressed.gif) | tibetdal.zip | 2007-03-24 03:00 | 23K | |
![[ ]](/icons/compressed.gif) | sebesz.html.zip | 2007-03-24 02:59 | 23K | |
![[ ]](/icons/compressed.gif) | maupassant_horla.zip | 2007-03-24 02:55 | 23K | |
![[ ]](/icons/compressed.gif) | Maupassant - Horla.zip | 2006-05-29 11:12 | 23K | |
![[ ]](/icons/compressed.gif) | Az arab orvostudomany.zip | 2007-03-24 02:49 | 23K | |
![[ ]](/icons/compressed.gif) | Van Vogt, A. E._Az utánzók - sci-fi novella - rtf.zip | 2006-01-07 08:45 | 23K | |
![[TXT]](/icons/text.gif) | 02_10.HTM | 2007-03-24 02:55 | 23K | |
![[ ]](/icons/unknown.gif) | H. P. Lovecraft - Patkányok a falban.rar | 2007-03-24 02:55 | 23K | |
![[TXT]](/icons/text.gif) | I_10-12.HTM | 2007-03-24 02:58 | 23K | |
![[TXT]](/icons/text.gif) | II_01.HTM | 2007-03-24 02:54 | 23K | |
![[ ]](/icons/compressed.gif) | Horla.htm.zip | 2007-03-24 02:55 | 23K | |
![[ ]](/icons/compressed.gif) | Ivan Jefremov-A Helen titkok.zip | 2007-03-24 02:55 | 23K | |
![[ ]](/icons/unknown.gif) | Night Phoenix - Amikor játszanak az istenek.rtf | 2006-06-25 06:33 | 23K | |
![[ ]](/icons/unknown.gif) | sültcsirke.doc | 2007-03-24 02:59 | 23K | |
![[ ]](/icons/unknown.gif) | gombás marhatokány.doc | 2007-03-24 02:59 | 23K | |
![[ ]](/icons/unknown.gif) | II_06.doc | 2007-11-13 21:29 | 23K | |
![[ ]](/icons/compressed.gif) | horla.zip | 2007-03-24 02:57 | 23K | |
![[ ]](/icons/unknown.gif) | Raffy4 - Az igéző.rtf | 2006-06-25 06:40 | 23K | |
![[ ]](/icons/unknown.gif) | Jacek Sawaszkiewicz - Várakozás.rtf | 2006-07-10 20:14 | 23K | |
![[TXT]](/icons/text.gif) | MENU3.HTM | 2007-03-24 02:59 | 23K | |
![[ ]](/icons/unknown.gif) | Ragnar Tornquist - A szabály az szabály.rtf | 2006-06-25 06:41 | 23K | |
![[TXT]](/icons/text.gif) | II_01-03.HTM | 2007-03-24 02:58 | 23K | |
![[ ]](/icons/compressed.gif) | A E. Van Vogt - Az utánzók.zip | 2007-03-21 16:07 | 23K | |
![[ ]](/icons/unknown.gif) | Koniszi Gaku - A Föld alatti Paradicsom.rtf | 2006-07-10 20:23 | 23K | |
![[TXT]](/icons/text.gif) | 16.TXT | 2007-11-13 21:46 | 23K | |
![[ ]](/icons/unknown.gif) | Bill Brown - A csillagkacsák.rtf | 2006-07-10 19:29 | 23K | |
![[TXT]](/icons/text.gif) | 17.TXT | 2007-11-13 23:34 | 23K | |
![[ ]](/icons/compressed.gif) | Brian W. Aldiss - A valószínűtlen csillag.zip | 2006-05-29 11:00 | 23K | |
![[ ]](/icons/unknown.gif) | Vlagyimir Oszinszkij - Az űrhajó.rtf | 2006-06-25 07:32 | 23K | |
![[ ]](/icons/compressed.gif) | William Shakespeare-Macbet.zip | 2007-03-24 03:01 | 23K | |
![[ ]](/icons/compressed.gif) | Klein, Gerard_Rehabilitáció - sci-fi novella - html.zip | 2006-01-07 09:05 | 23K | |
![[ ]](/icons/compressed.gif) | Macskabölcs_.zip | 2007-03-24 02:57 | 23K | |
![[TXT]](/icons/text.gif) | II_08.HTM | 2007-03-24 02:54 | 23K | |
![[ ]](/icons/unknown.gif) | rózsatorta.doc | 2007-03-24 02:59 | 23K | |
![[ ]](/icons/unknown.gif) | gombás ételek.doc | 2007-03-24 02:59 | 23K | |
![[ ]](/icons/unknown.gif) | görög csirkeleves.doc | 2007-03-24 02:59 | 23K | |
![[ ]](/icons/unknown.gif) | csirke szecsuáni módra.doc | 2007-03-24 02:59 | 23K | |
![[ ]](/icons/unknown.gif) | Pizza.doc | 2007-03-24 02:59 | 23K | |
![[ ]](/icons/unknown.gif) | Pekingi kacsa.doc | 2007-03-24 02:59 | 23K | |
![[ ]](/icons/unknown.gif) | PACAL.DOC | 2007-03-24 02:59 | 23K | |
![[ ]](/icons/unknown.gif) | Bécsi tányérhús.doc | 2007-03-24 02:59 | 23K | |
![[ ]](/icons/unknown.gif) | 5SZAKACS.MEK | 2007-03-24 02:59 | 22K | |
![[ ]](/icons/compressed.gif) | Carneiro, André_Sötétség - sci-fi novella - rtf.zip | 2006-01-07 09:10 | 22K | |
![[ ]](/icons/unknown.gif) | Kaszás István - Tréfa a javából.rtf | 2006-07-10 20:20 | 22K | |
![[ ]](/icons/compressed.gif) | Mobile, Frank_A dimenzióablak - sci-fi novella - html.txt.zip | 2006-01-07 09:00 | 22K | |
![[ ]](/icons/compressed.gif) | Georke R R Martin-A keresztes a sarkany utja.zip | 2007-03-24 02:54 | 22K | |
![[ ]](/icons/unknown.gif) | R Duck - Letűnt hatalmak reneszánsza.rtf | 2006-06-25 06:39 | 22K | |
![[ ]](/icons/unknown.gif) | Khalil Gibran-A profeta kertje | 2007-03-24 02:56 | 22K | |
![[ ]](/icons/compressed.gif) | Mihaleczky Péter_A Syrius döntése - sci-fi novella - html.txt.zip | 2006-01-07 09:00 | 22K | |
![[ ]](/icons/unknown.gif) | Janusz A Zajdél - Tudósítás a pincéből.rtf | 2006-07-10 20:15 | 22K | |
![[IMG]](/icons/image2.gif) | huxley_aldous_szep_uj_vilag.JPG | 2007-03-24 02:49 | 22K | |
![[TXT]](/icons/text.gif) | 02_12.HTM | 2007-03-24 02:55 | 22K | |
![[TXT]](/icons/text.gif) | I_01-03.HTM | 2007-03-24 02:58 | 22K | |
![[TXT]](/icons/text.gif) | Pacalreceptek.txt | 2007-03-24 02:59 | 22K | |
![[ ]](/icons/unknown.gif) | H. P. Lovecraft - A lopakodó félelem.rar | 2007-03-24 02:55 | 22K | |
![[ ]](/icons/unknown.gif) | tojáskrém,májkrém,kapros_túrókrém,besamel.doc | 2007-03-24 02:59 | 22K | |
![[ ]](/icons/unknown.gif) | szalontüdő.doc | 2007-03-24 02:59 | 22K | |
![[ ]](/icons/unknown.gif) | sültpaprika saláta.doc | 2007-03-24 02:59 | 22K | |
![[ ]](/icons/unknown.gif) | kolbász.doc | 2007-03-24 02:59 | 22K | |
![[ ]](/icons/unknown.gif) | jókai bableves 2.doc | 2007-03-24 02:59 | 22K | |
![[ ]](/icons/unknown.gif) | fülszöveg.doc | 2005-10-02 20:45 | 22K | |
![[ ]](/icons/unknown.gif) | dobostorta.doc | 2007-03-24 02:59 | 22K | |
![[ ]](/icons/unknown.gif) | GOFRI.DOC | 2007-03-24 02:59 | 22K | |
![[ ]](/icons/unknown.gif) | Déligyümölcs.doc | 2007-03-24 02:59 | 22K | |
![[ ]](/icons/compressed.gif) | asimov_isaac_csak_mi_vagyunk_itt.zip | 2007-03-24 02:55 | 22K | |
![[ ]](/icons/compressed.gif) | Nyiri Kristof-Bolcsessegtudomanyok az irasbeliseg utan.zip | 2007-03-24 02:58 | 22K | |
![[ ]](/icons/compressed.gif) | Martin, George R. R._A kereszt és a sárkány útja - novella - html.zip | 2006-01-07 08:48 | 22K | |
![[ ]](/icons/compressed.gif) | Josep Heller-Yossarian,a tulelo.zip | 2007-03-24 02:56 | 22K | |
![[TXT]](/icons/text.gif) | bice.htm | 2006-08-24 18:22 | 22K | |
![[TXT]](/icons/text.gif) | 15.HTM | 2007-03-24 02:55 | 22K | |
![[ ]](/icons/compressed.gif) | bester_alfred_szivelyes_fahrenheit.zip | 2007-03-24 02:49 | 22K | |
![[ ]](/icons/compressed.gif) | Alfred Bester - Szívélyes Fahrenheit.zip | 2006-05-29 10:59 | 22K | |
![[TXT]](/icons/text.gif) | 12.TXT | 2007-11-13 21:46 | 22K | |
![[ ]](/icons/compressed.gif) | William Tenn - A Fold felszabaditasa.zip | 2006-05-29 11:28 | 22K | |
![[ ]](/icons/compressed.gif) | Van Vogt, A. E._Messzi Centaurus - sci-fi - rtf.zip | 2006-01-07 08:45 | 22K | |
![[ ]](/icons/compressed.gif) | ernst_paul_a_holdon_a_helyzet_valtozatlan.zip | 2007-03-24 02:58 | 22K | |
![[ ]](/icons/compressed.gif) | ErnstAHoldon.zip | 2007-02-21 16:45 | 22K | |
![[ ]](/icons/compressed.gif) | kertesz_imre_a_stockholmi_beszed_html.zip | 2007-03-24 02:56 | 22K | |
![[ ]](/icons/unknown.gif) | Rorimack - Gorkij 17.rtf | 2006-06-25 07:15 | 22K | |
![[ ]](/icons/compressed.gif) | A toronyszoba ablaka.zip | 2007-03-26 16:55 | 22K | |
![[TXT]](/icons/text.gif) | Kéz a kézben.htm | 2007-03-24 02:58 | 22K | |
![[ ]](/icons/compressed.gif) | king_stephen_esos_evszak.zip | 2007-03-24 03:00 | 22K | |
![[ ]](/icons/unknown.gif) | Syttha - Hagyomány.rtf | 2006-06-25 07:19 | 22K | |
![[ ]](/icons/unknown.gif) | Torn - Féltem, nagyon féltem.rtf | 2006-06-25 07:22 | 22K | |
![[ ]](/icons/unknown.gif) | Gordon R Dickson - Az antenna.rtf | 2006-07-10 19:49 | 22K | |
![[ ]](/icons/compressed.gif) | Álmok a boszorkányházban.zip | 2007-03-26 16:55 | 22K | |
![[TXT]](/icons/text.gif) | III01-03.HTM | 2007-03-24 02:58 | 22K | |
![[ ]](/icons/compressed.gif) | A E. Van Vogt - Messzi Centurus.zip | 2007-03-21 16:07 | 22K | |
![[ ]](/icons/unknown.gif) | tavol_a_foldtol_ful.doc | 2007-11-14 05:15 | 22K | |
![[ ]](/icons/unknown.gif) | sangria ital.doc | 2007-03-24 02:59 | 22K | |
![[ ]](/icons/unknown.gif) | pulykamell paprikamártásban.doc | 2007-03-24 02:59 | 22K | |
![[ ]](/icons/unknown.gif) | lúdláb.doc | 2007-03-24 02:59 | 22K | |
![[ ]](/icons/unknown.gif) | kelbimbóról.doc | 2007-03-24 02:59 | 22K | |
![[ ]](/icons/unknown.gif) | Zöldséges-csirkés rizs.doc | 2007-03-24 02:59 | 22K | |
![[ ]](/icons/unknown.gif) | Méretek és mértékek.doc | 2007-03-24 02:59 | 22K | |
![[ ]](/icons/unknown.gif) | Lecsó.doc | 2007-03-24 02:59 | 22K | |
![[ ]](/icons/unknown.gif) | Édes-savanyú kacsamell.doc | 2007-03-24 02:59 | 22K | |
![[ ]](/icons/unknown.gif) | Ádám Éva kacsa.doc | 2007-03-24 02:59 | 22K | |
![[ ]](/icons/unknown.gif) | Wyquin - A város.rtf | 2006-06-25 07:35 | 21K | |
![[TXT]](/icons/text.gif) | I_04.HTM | 2007-03-24 02:54 | 21K | |
![[ ]](/icons/unknown.gif) | Lord Dunsany - A hajnal egy legendája.rtf | 2006-07-10 20:31 | 21K | |
![[ ]](/icons/compressed.gif) | Brown, Fredric_A csillagegér - sci-fi novella - rtf.zip | 2006-01-07 09:07 | 21K | |
![[ ]](/icons/compressed.gif) | Niven, Larry_A birodalom emléke - sci-fi novella - rtf.zip | 2006-01-07 08:57 | 21K | |
![[ ]](/icons/unknown.gif) | Kurt Vonnegut-Aldja meg az isten,dr Kevorkian | 2007-03-24 02:57 | 21K | |
![[TXT]](/icons/text.gif) | 16.HTM | 2007-03-24 02:55 | 21K | |
![[ ]](/icons/compressed.gif) | M dervis-A SZUFI ut.zip | 2007-03-24 02:57 | 21K | |
![[ ]](/icons/unknown.gif) | Vaszilij - Múlandó szépség.rtf | 2006-06-25 07:30 | 21K | |
![[ ]](/icons/unknown.gif) | Normal - Egy bukott angyal naplója.rtf | 2006-06-25 06:34 | 21K | |
![[TXT]](/icons/text.gif) | A vörös halál álarca.htm | 2007-03-24 02:53 | 21K | |
![[ ]](/icons/unknown.gif) | A patkányok a falban.rar | 2007-03-24 02:55 | 21K | |
![[ ]](/icons/compressed.gif) | Poul Anderson - A mártír.zip | 2004-06-21 11:41 | 21K | |
![[ ]](/icons/compressed.gif) | Poul Anderson-A martir.zip | 2007-03-24 02:58 | 21K | |
![[ ]](/icons/compressed.gif) | aiszkhulosz_lelancolt_prometheusz.zip | 2007-03-24 02:49 | 21K | |
![[ ]](/icons/unknown.gif) | tejszines husi.doc | 2007-03-24 02:59 | 21K | |
![[ ]](/icons/unknown.gif) | túrótorta.doc | 2007-03-24 02:59 | 21K | |
![[ ]](/icons/unknown.gif) | sajtkészítés.doc | 2007-03-24 02:59 | 21K | |
![[ ]](/icons/unknown.gif) | pusztasek serpenyős.doc | 2007-03-24 02:59 | 21K | |
![[ ]](/icons/unknown.gif) | nemere_istvan_allatkert_a_kozmoszban_ful_hu_nncl3298-73ev1.doc | 2006-07-30 12:04 | 21K | |
![[ ]](/icons/unknown.gif) | káposztás sztrapacska.doc | 2007-03-24 02:59 | 21K | |
![[ ]](/icons/unknown.gif) | hegyaljai tarkabableves.doc | 2007-03-24 02:59 | 21K | |
![[ ]](/icons/unknown.gif) | gyümölcsrízs.doc | 2007-03-24 02:59 | 21K | |
![[ ]](/icons/unknown.gif) | frankfurti leves.doc | 2007-03-24 02:59 | 21K | |
![[ ]](/icons/unknown.gif) | ezer_ev_a_venuszon_ful.doc | 2007-11-13 22:12 | 21K | |
![[ ]](/icons/unknown.gif) | Túrógombóc.doc | 2007-03-24 02:59 | 21K | |
![[ ]](/icons/unknown.gif) | Jézus és a drogok.doc | 2006-05-29 11:23 | 21K | |
![[TXT]](/icons/text.gif) | Bice - béka.htm | 2007-03-24 02:53 | 21K | |
![[ ]](/icons/compressed.gif) | dahl_roald_a_sebesz_hu_txt.zip | 2007-03-24 02:59 | 21K | |
![[ ]](/icons/compressed.gif) | nyikorgo.zip | 2007-02-21 16:05 | 21K | |
![[ ]](/icons/compressed.gif) | bester_alfred_nyikorgo_idegen.zip | 2007-03-24 02:49 | 21K | |
![[ ]](/icons/compressed.gif) | Robert Sheckley - Az intezet.zip | 2006-05-29 11:22 | 21K | |
![[TXT]](/icons/text.gif) | édességek.htm | 2007-03-24 02:59 | 21K | |
![[ ]](/icons/unknown.gif) | Pierre Versins - A kutya.rtf | 2006-06-25 06:38 | 21K | |
![[ ]](/icons/compressed.gif) | vonnegut_kurt_aldja_meg_az_isten_dr_kevorkian_hu_txt.zip | 2007-03-24 02:57 | 21K | |
![[TXT]](/icons/text.gif) | M. Valdemar kóresete tényszer_ megvilágításban.htm | 2007-03-24 02:53 | 21K | |
![[ ]](/icons/compressed.gif) | Fredric Brown - A csillagegér.zip | 2007-03-22 17:44 | 21K | |
![[TXT]](/icons/text.gif) | 10.TXT | 2007-11-13 21:46 | 21K | |
![[TXT]](/icons/text.gif) | III_06.HTM | 2007-03-24 02:54 | 21K | |
![[ ]](/icons/compressed.gif) | Kurt Vonnegut - Áldja meg az Isten, dr. Kevorkian.zip | 2007-03-26 19:44 | 21K | |
![[ ]](/icons/compressed.gif) | Brian W. Aldiss - A gengolem.zip | 2006-05-29 10:59 | 21K | |
![[TXT]](/icons/text.gif) | I_13-15.HTM | 2007-03-24 02:58 | 21K | |
![[ ]](/icons/compressed.gif) | orwell_george_a_politika_es_az_angol_nyelv_hu_rtf.zip | 2007-03-24 02:54 | 21K | |
![[ ]](/icons/compressed.gif) | George Orwell - A politika_es_az_angol_nyelv_hu_rtf.zip | 2006-05-10 06:25 | 21K | |
![[ ]](/icons/compressed.gif) | Niven, Larry_Neutroncsillag - sci-fi novella - rtf.zip | 2006-01-07 08:56 | 21K | |
![[TXT]](/icons/text.gif) | MENUCS.HTM | 2007-03-24 02:59 | 21K | |
![[ ]](/icons/compressed.gif) | Algys Budrys - Csillámló fal éji szem.zip | 2007-03-21 19:24 | 21K | |
![[ ]](/icons/unknown.gif) | 7.DOC | 2007-11-13 21:53 | 21K | |
![[ ]](/icons/compressed.gif) | Anderson, Poul_A mártír - html.zip | 2006-01-07 08:46 | 21K | |
![[ ]](/icons/compressed.gif) | Damon Knight - Különleges teher.zip | 2007-03-26 15:36 | 21K | |
![[ ]](/icons/unknown.gif) | Zyro - A Sivatag.rtf | 2006-06-25 07:35 | 21K | |
![[ ]](/icons/unknown.gif) | Damiano Malabaila - A mimete néhány felhasználási módja.rtf | 2006-07-10 19:38 | 21K | |
![[ ]](/icons/unknown.gif) | Torma Gábor - Az orr rejtély.rtf | 2006-06-25 07:22 | 21K | |
![[ ]](/icons/compressed.gif) | A tó szüze.htm.zip | 2007-03-24 02:59 | 21K | |
![[ ]](/icons/compressed.gif) | Juhász György_Újvilág - sci-fi novella - html.zip | 2006-01-07 09:05 | 21K | |
![[ ]](/icons/unknown.gif) | szokeveny_robot_ful.doc | 2007-11-14 02:31 | 21K | |
![[ ]](/icons/unknown.gif) | sajttal göngyölt sertés.doc | 2007-03-24 02:59 | 21K | |
![[ ]](/icons/unknown.gif) | rántott, töltött paprika.doc | 2007-03-24 02:59 | 21K | |
![[ ]](/icons/unknown.gif) | nyúl vörösborban.doc | 2007-03-24 02:59 | 21K | |
![[ ]](/icons/unknown.gif) | mérleg hiányában.doc | 2007-03-24 02:59 | 21K | |
![[ ]](/icons/unknown.gif) | fulszoveg.doc | 2003-09-28 15:30 | 21K | |
![[ ]](/icons/unknown.gif) | egy_bolygo_robinzonjai_ful.doc | 2007-11-13 21:45 | 21K | |
![[ ]](/icons/unknown.gif) | bájital.doc | 2007-03-24 02:59 | 21K | |
![[ ]](/icons/unknown.gif) | alföldi leves.doc | 2007-03-24 02:59 | 21K | |
![[ ]](/icons/unknown.gif) | TZATZIKI.DOC | 2007-03-24 02:59 | 21K | |
![[ ]](/icons/unknown.gif) | SANGRIA.DOC | 2007-03-24 02:59 | 21K | |
![[ ]](/icons/unknown.gif) | Hamuban sült sonkás - zöldséges béles.doc | 2007-03-24 02:59 | 21K | |
![[ ]](/icons/compressed.gif) | aldani_lino_alomfilm.zip | 2007-03-24 02:57 | 20K | |
![[TXT]](/icons/text.gif) | MENU4.HTM | 2007-03-24 02:59 | 20K | |
![[ ]](/icons/compressed.gif) | Robert Sheckley - Hagyma és répa.zip | 2006-05-29 11:23 | 20K | |
![[ ]](/icons/compressed.gif) | Isaac Asimov - A robbanó napok.zip | 2007-03-22 05:29 | 20K | |
![[TXT]](/icons/text.gif) | Az éhez_m_vész.htm | 2007-03-24 02:54 | 20K | |
![[ ]](/icons/compressed.gif) | Frank Herbert - Szerencsés menekülés.zip | 2007-03-26 14:46 | 20K | |
![[ ]](/icons/compressed.gif) | Theodore Sturgeon - E ketto kell neki.zip | 2006-05-29 11:27 | 20K | |
![[ ]](/icons/compressed.gif) | Julio Cortazar-Cora kisasszony.zip | 2007-03-24 02:56 | 20K | |
![[ ]](/icons/compressed.gif) | Ballard, L. G._Mindent a fogyasztóért - sci-fi novella - rtf.zip | 2006-01-07 09:15 | 20K | |
![[TXT]](/icons/text.gif) | II_04.HTM | 2007-03-24 02:54 | 20K | |
![[ ]](/icons/compressed.gif) | Larry Niven - Neutroncsillag.zip | 2007-03-26 17:46 | 20K | |
![[ ]](/icons/unknown.gif) | Fülöp Tamás - Átokföldje meséi - Az üzlet.rtf | 2006-06-25 06:32 | 20K | |
![[ ]](/icons/compressed.gif) | gogol_a_hinto.doc.zip | 2007-03-24 02:58 | 20K | |
![[ ]](/icons/compressed.gif) | Hamvas Bela-A Vizonto.zip | 2007-03-24 02:53 | 20K | |
![[ ]](/icons/compressed.gif) | Brown, Eric_Időfogoly - sci-fi - rtf.zip | 2006-01-07 09:06 | 20K | |
![[ ]](/icons/compressed.gif) | greene_graham_az_utolso_szavak.zip | 2007-03-24 02:55 | 20K | |
![[ ]](/icons/compressed.gif) | GreeneAzutolso.zip | 2007-02-21 15:54 | 20K | |
![[ ]](/icons/unknown.gif) | 38.rtf | 2007-11-13 22:36 | 20K | |
![[ ]](/icons/unknown.gif) | 33.rtf | 2007-11-14 05:30 | 20K | |
![[ ]](/icons/compressed.gif) | Etika és vallás.zip | 2007-03-24 02:53 | 20K | |
![[ ]](/icons/compressed.gif) | Dick, Philip K._Harcjáték - sci-fi novella - rtf.zip | 2006-01-07 09:09 | 20K | |
![[ ]](/icons/unknown.gif) | glassfloor.rtf | 2003-12-15 20:04 | 20K | |
![[ ]](/icons/unknown.gif) | pusztasek.doc | 2007-03-24 02:59 | 20K | |
![[ ]](/icons/unknown.gif) | pecsenyekacsa vörösborban.doc | 2007-03-24 02:59 | 20K | |
![[ ]](/icons/unknown.gif) | nemere_kozmosz_fulszov.doc | 2007-03-24 02:58 | 20K | |
![[ ]](/icons/unknown.gif) | marhahus majorannával.doc | 2007-03-24 02:59 | 20K | |
![[ ]](/icons/unknown.gif) | káposzta savanyuság.doc | 2007-03-24 02:59 | 20K | |
![[ ]](/icons/unknown.gif) | idegen_bolygon_szuletett_ful.doc | 2007-11-14 02:34 | 20K | |
![[ ]](/icons/unknown.gif) | Raffaello.doc | 2007-03-24 02:59 | 20K | |
![[ ]](/icons/unknown.gif) | Római Bólé.doc | 2007-03-24 02:59 | 20K | |
![[ ]](/icons/unknown.gif) | Krampampuli Bólé.doc | 2007-03-24 02:59 | 20K | |
![[ ]](/icons/unknown.gif) | Habos túros.doc | 2007-03-24 02:59 | 20K | |
![[ ]](/icons/unknown.gif) | Húsvéti ananászos sonka.doc | 2007-03-24 02:59 | 20K | |
![[ ]](/icons/unknown.gif) | Grillezett padlizsán.doc | 2007-03-24 02:59 | 20K | |
![[ ]](/icons/unknown.gif) | Chokitó.doc | 2007-03-24 02:59 | 20K | |
![[ ]](/icons/unknown.gif) | Articsóka töltve.doc | 2007-03-24 02:59 | 20K | |
![[TXT]](/icons/text.gif) | T_zember.htm | 2007-03-24 02:58 | 20K | |
![[ ]](/icons/compressed.gif) | swanwick-holtak.zip | 2007-02-21 16:36 | 20K | |
![[ ]](/icons/unknown.gif) | 11.rtf | 2007-11-13 22:28 | 20K | |
![[ ]](/icons/compressed.gif) | KilworthUtazzon.zip | 2007-02-21 16:36 | 20K | |
![[ ]](/icons/compressed.gif) | Brian W. Aldiss - A repulo fereg.zip | 2006-05-29 11:00 | 20K | |
![[ ]](/icons/unknown.gif) | A lopakodó félelem.rar | 2007-03-24 02:55 | 20K | |
![[ ]](/icons/compressed.gif) | Mayumura, Taku_Világkiállítás - sci-fi novella - html.zip | 2006-01-07 09:00 | 20K | |
![[TXT]](/icons/text.gif) | MENUSZ.HTM | 2007-03-24 02:59 | 20K | |
![[TXT]](/icons/text.gif) | 08.HTM | 2007-03-24 02:55 | 20K | |
![[TXT]](/icons/text.gif) | Epreskremes palacsinta.htm | 2007-03-24 02:59 | 20K | |
![[TXT]](/icons/text.gif) | 01_06.HTM | 2007-03-24 02:55 | 20K | |
![[ ]](/icons/compressed.gif) | Ray Bradbury - A betonkeverő.zip | 2007-03-22 16:55 | 20K | |
![[ ]](/icons/compressed.gif) | Eric Brown - Időfogoly.zip | 2007-03-21 08:21 | 20K | |
![[ ]](/icons/unknown.gif) | Johnny Mnemonic.ZIP | 2007-03-24 03:01 | 20K | |
![[TXT]](/icons/text.gif) | III10-12.HTM | 2007-03-24 02:58 | 20K | |
![[ ]](/icons/compressed.gif) | idofogoly.zip | 2007-02-21 15:44 | 20K | |
![[ ]](/icons/compressed.gif) | brown_eric_idofogoly.zip | 2007-03-24 02:53 | 20K | |
![[ ]](/icons/unknown.gif) | Henrich Altov - Ikarosz és Dedalosz.rtf | 2006-07-10 19:52 | 20K | |
![[ ]](/icons/compressed.gif) | Pohl, Frederik_Nemes lelkű lények - sci-fi novella - rtf.zip | 2006-01-07 08:55 | 20K | |
![[TXT]](/icons/text.gif) | Tengeri halak, csigák....txt | 2007-03-24 02:59 | 20K | |
![[ ]](/icons/unknown.gif) | Zé a Kósza - Mestermunka.rtf | 2006-06-25 07:36 | 20K | |
![[ ]](/icons/unknown.gif) | Opiario - Pandora kinyitja a szelencét.rtf | 2006-06-25 06:35 | 20K | |
![[ ]](/icons/compressed.gif) | Borbely Laszlo-Forro italok.zip | 2007-03-24 02:52 | 20K | |
![[ ]](/icons/compressed.gif) | Ray Bradbury - A lángléggömbök.zip | 2007-03-22 16:55 | 20K | |
![[ ]](/icons/unknown.gif) | zöldbab főzelék.doc | 2007-03-24 02:59 | 20K | |
![[ ]](/icons/unknown.gif) | tojásos padlizsán.doc | 2007-03-24 02:59 | 20K | |
![[ ]](/icons/unknown.gif) | túrós ételek.doc | 2007-03-24 02:59 | 20K | |
![[ ]](/icons/unknown.gif) | káposztás béles.doc | 2007-03-24 02:59 | 20K | |
![[ ]](/icons/unknown.gif) | Túrós-almás Turmix.doc | 2007-03-24 02:59 | 20K | |
![[ ]](/icons/unknown.gif) | RUM.DOC | 2007-03-24 02:59 | 20K | |
![[ ]](/icons/unknown.gif) | Padlizsánkrém.doc | 2007-03-24 02:59 | 20K | |
![[ ]](/icons/unknown.gif) | Ohio black beauty.doc | 2007-03-24 02:59 | 20K | |
![[ ]](/icons/unknown.gif) | Meggylikőr.doc | 2007-03-24 02:59 | 20K | |
![[ ]](/icons/unknown.gif) | Marcipán recept.doc | 2007-03-24 02:59 | 20K | |
![[ ]](/icons/unknown.gif) | Konfetti Bólé.doc | 2007-03-24 02:59 | 20K | |
![[ ]](/icons/unknown.gif) | Knock Out Drink.doc | 2007-03-24 02:59 | 20K | |
![[ ]](/icons/unknown.gif) | Jeges kávé.doc | 2007-03-24 02:59 | 20K | |
![[ ]](/icons/unknown.gif) | Green Widow.doc | 2007-03-24 02:59 | 20K | |
![[ ]](/icons/unknown.gif) | Bum Bum Tequila.doc | 2007-03-24 02:59 | 20K | |
![[ ]](/icons/unknown.gif) | Birsalmasajt 3.doc | 2007-03-24 02:59 | 20K | |
![[ ]](/icons/unknown.gif) | Birsalma sajt.doc | 2007-03-24 02:59 | 20K | |
![[TXT]](/icons/text.gif) | Hagymáslepény.htm | 2007-03-24 02:59 | 19K | |
![[ ]](/icons/compressed.gif) | Brunner, John_A brit vezetők följegyzései - sci-fi novella - rtf.zip | 2006-01-07 09:05 | 19K | |
![[ ]](/icons/unknown.gif) | idofogoly.ace | 2007-03-24 02:52 | 19K | |
![[TXT]](/icons/text.gif) | II_03.HTM | 2007-03-24 02:54 | 19K | |
![[TXT]](/icons/text.gif) | KENYEREK.HTM | 2007-03-24 02:59 | 19K | |
![[TXT]](/icons/text.gif) | FOCOMB.HTM | 2007-03-24 02:59 | 19K | |
![[ ]](/icons/compressed.gif) | Gibson, William - Johnny_Mnemonic_[H].zip | 2007-03-26 19:50 | 19K | |
![[ ]](/icons/unknown.gif) | Alan Nelson - Narapoia.rtf | 2006-07-10 19:25 | 19K | |
![[TXT]](/icons/text.gif) | A kaszás képmása.htm | 2007-03-24 03:00 | 19K | |
![[ ]](/icons/compressed.gif) | Damon Knight - Anachron.zip | 2007-03-26 15:35 | 19K | |
![[TXT]](/icons/text.gif) | A királyn_ könnyeinek próbája.htm | 2007-03-24 02:57 | 19K | |
![[TXT]](/icons/text.gif) | 11.TXT | 2007-11-13 21:46 | 19K | |
![[TXT]](/icons/text.gif) | 03 - Novák Csanád - Ricaro tévedése.txt | 2007-03-24 02:54 | 19K | |
![[ ]](/icons/unknown.gif) | Szemi - A bosszú.rtf | 2006-06-25 07:19 | 19K | |
![[ ]](/icons/compressed.gif) | Eric Frank Russel - Tucat Jay.zip | 2007-03-26 18:31 | 19K | |
![[ ]](/icons/compressed.gif) | Fritz Leiber - A füstkísértet.zip | 2007-03-26 16:28 | 19K | |
![[ ]](/icons/unknown.gif) | Kiss Dénes - Másik bolygó (Változatok 2).rtf | 2006-07-10 20:23 | 19K | |
![[ ]](/icons/unknown.gif) | 3.0 | 2007-03-24 02:54 | 19K | |
![[TXT]](/icons/text.gif) | HIDEG.HTM | 2007-03-24 02:59 | 19K | |
![[ ]](/icons/unknown.gif) | 12.rtf | 2007-11-13 22:28 | 19K | |
![[TXT]](/icons/text.gif) | főételek.htm | 2007-03-24 02:59 | 19K | |
![[IMG]](/icons/image2.gif) | KORETEK.JPG | 2007-03-24 02:59 | 19K | |
![[TXT]](/icons/text.gif) | Pizza.htm | 2007-03-24 02:59 | 19K | |
![[IMG]](/icons/image2.gif) | pease_allan_testbeszed_hu.jpeg | 2007-03-24 02:49 | 19K | |
![[TXT]](/icons/text.gif) | MENU2.HTM | 2007-03-24 02:59 | 19K | |
![[ ]](/icons/unknown.gif) | Carol Emshwiller - A vadászrobot.rtf | 2006-07-10 19:34 | 19K | |
![[ ]](/icons/compressed.gif) | Epiktetos-Epiktetos kezikonyvecskeje.zip | 2007-03-24 02:53 | 19K | |
![[ ]](/icons/unknown.gif) | Platon-Timaiosz es Kritiasz | 2007-03-24 02:58 | 19K | |
![[ ]](/icons/compressed.gif) | Clifford D Simak - Halál a házban.zip | 2007-03-26 18:54 | 19K | |
![[ ]](/icons/compressed.gif) | Nourse, Alan E._Fertőzöttek - sci-fi - rtf.zip | 2006-01-07 08:56 | 19K | |
![[ ]](/icons/unknown.gif) | Michael Swanwick-A vilag peremen | 2007-03-24 02:57 | 19K | |
![[ ]](/icons/compressed.gif) | Az ős.zip | 2007-03-26 16:55 | 19K | |
![[ ]](/icons/compressed.gif) | Herbert W. Franke - Ver es dicsoseg.zip | 2006-05-29 11:09 | 19K | |
![[ ]](/icons/unknown.gif) | Julio Cortázar - Axolotl.rtf | 2006-07-10 20:18 | 19K | |
![[ ]](/icons/compressed.gif) | Lovecraft, Howard Philips_A toronyszoba ablaka - novella - rtf.zip | 2006-01-07 09:03 | 19K | |
![[ ]](/icons/compressed.gif) | Lovecraft, Howard Philips_Pickman modellje - novella - rtf.zip | 2006-01-07 09:03 | 19K | |
![[ ]](/icons/unknown.gif) | Syttha - Álmok.rtf | 2006-06-25 07:19 | 19K | |
![[ ]](/icons/compressed.gif) | John Brunner - A brit vezetők följegyzései.zip | 2007-03-22 17:46 | 19K | |
![[ ]](/icons/unknown.gif) | Kacsasült háziasan.doc | 2007-03-24 02:59 | 19K | |
![[ ]](/icons/unknown.gif) | Gorviki kém címlap.doc | 2007-04-15 15:27 | 19K | |
![[ ]](/icons/unknown.gif) | Birsalmasajt 2.doc | 2007-03-24 02:59 | 19K | |
![[ ]](/icons/compressed.gif) | Van Vogt, A. E._A szörnyeteg - sci-fi novella - rtf.zip | 2006-01-07 08:45 | 19K | |
![[ ]](/icons/compressed.gif) | A betonkever_.htm.zip | 2007-03-24 02:59 | 19K | |
![[ ]](/icons/unknown.gif) | Richelieu - Álomvilág.rtf | 2006-06-25 08:16 | 19K | |
![[IMG]](/icons/image2.gif) | SAJTKREM.JPG | 2007-03-24 02:59 | 19K | |
![[TXT]](/icons/text.gif) | II_05.HTM | 2007-03-24 02:54 | 19K | |
![[ ]](/icons/compressed.gif) | Eric Frank Russel - Halandzsa.zip | 2007-03-26 18:31 | 19K | |
![[ ]](/icons/unknown.gif) | 04.rtf | 2007-11-13 22:10 | 19K | |
![[ ]](/icons/compressed.gif) | Frederik Pohl - Nemes lelku lenyek.zip | 2006-05-29 11:02 | 19K | |
![[ ]](/icons/compressed.gif) | Robert Sheckley - Rossz orvossag.zip | 2006-05-29 11:23 | 19K | |
![[ ]](/icons/compressed.gif) | zen ut a megvilágosodáshoz.zip | 2007-03-24 02:53 | 19K | |
![[ ]](/icons/compressed.gif) | zen.zip | 2007-03-24 02:53 | 19K | |
![[ ]](/icons/compressed.gif) | swanwick_edge.zip | 2007-02-21 16:36 | 19K | |
![[TXT]](/icons/text.gif) | Anyagyilkosság.htm | 2007-03-24 02:52 | 19K | |
![[ ]](/icons/unknown.gif) | Andrzej Czechowski - Követek.rtf | 2006-07-10 19:27 | 19K | |
![[TXT]](/icons/text.gif) | killer.htm | 2006-08-24 18:23 | 19K | |
![[ ]](/icons/compressed.gif) | Boucher, Anthony_Bálám - sci-fi - rtf.zip | 2006-01-07 09:12 | 19K | |
![[ ]](/icons/compressed.gif) | Heim Attila_Csillagpor - sci-fi novella - html.zip | 2006-01-07 09:06 | 19K | |
![[ ]](/icons/compressed.gif) | buddha beszédei.zip | 2007-03-24 02:53 | 19K | |
![[ ]](/icons/compressed.gif) | Ganszovszkij, Szever_Jön az ember - sci-fi novella - rtf.zip | 2006-01-07 09:08 | 19K | |
![[ ]](/icons/unknown.gif) | Rozmaring Péter - A vásár.rtf | 2006-06-25 07:15 | 19K | |
![[ ]](/icons/compressed.gif) | Bixby, Jerome_Élni jó - sci-fi novella - word.zip | 2006-01-07 09:13 | 19K | |
![[TXT]](/icons/text.gif) | MENU1.HTM | 2007-03-24 02:59 | 19K | |
![[ ]](/icons/compressed.gif) | Egypercesek.zip | 2007-03-24 02:55 | 19K | |
![[ ]](/icons/compressed.gif) | Az ezüstkulcs.zip | 2007-03-26 16:55 | 19K | |
![[ ]](/icons/unknown.gif) | Volodimir Mihanovszkij - A vendég.rtf | 2006-06-25 07:32 | 19K | |
![[ ]](/icons/compressed.gif) | Nietzche es Freud-filozofiatortenet.zip | 2007-03-24 02:54 | 19K | |
![[TXT]](/icons/text.gif) | II_02.HTM | 2007-03-24 02:54 | 19K | |
![[ ]](/icons/compressed.gif) | A lángléggömbök.htm.zip | 2007-03-24 02:59 | 19K | |
![[ ]](/icons/unknown.gif) | hitlernotes.ace | 2007-03-24 02:52 | 19K | |
![[ ]](/icons/unknown.gif) | TOROKKNY.ZIP | 2007-03-24 02:59 | 19K | |
![[ ]](/icons/unknown.gif) | Rudy Rucker - Mesék Houdiniről.RTF | 2006-06-25 07:15 | 19K | |
![[ ]](/icons/compressed.gif) | egypercesek.zip | 2007-02-21 16:45 | 19K | |
![[ ]](/icons/compressed.gif) | Franke, Herbert W. novellái - html.zip | 2006-01-07 08:50 | 19K | |
![[ ]](/icons/unknown.gif) | IV_02.doc | 2007-11-13 21:39 | 19K | |
![[ ]](/icons/compressed.gif) | Kapp, Colin_A bűnfürkésző - sci-fi novella - html.zip | 2006-01-07 09:05 | 18K | |
![[ ]](/icons/unknown.gif) | Rorimack - Malanor rózsái.rtf | 2006-06-25 07:15 | 18K | |
![[ ]](/icons/unknown.gif) | 0. Warhammer 40000 elöszó.rtf | 2007-03-06 02:21 | 18K | |
![[ ]](/icons/compressed.gif) | Brian W. Aldiss - Ámen és kész.zip | 2007-03-19 18:01 | 18K | |
![[ ]](/icons/compressed.gif) | Robert Sheckley - A prototipus.zip | 2006-05-29 11:22 | 18K | |
![[ ]](/icons/unknown.gif) | hrabal.ace | 2007-03-24 02:52 | 18K | |
![[ ]](/icons/compressed.gif) | lem_stanislaw_mosogeptragedia.zip | 2007-03-24 03:00 | 18K | |
![[ ]](/icons/compressed.gif) | Stanislaw Lem - Mosogeptragedia.zip | 2006-05-29 11:27 | 18K | |
![[ ]](/icons/compressed.gif) | H.P.Lovecraft - Az Ős.zip | 2007-03-26 16:57 | 18K | |
![[ ]](/icons/compressed.gif) | filar_darius_jovevenyek.zip | 2007-03-24 02:52 | 18K | |
![[ ]](/icons/compressed.gif) | FilarJovevenyek.zip | 2007-02-21 16:45 | 18K | |
![[ ]](/icons/binary.gif) | Profile.bin | 2006-09-16 22:48 | 18K | |
![[ ]](/icons/unknown.gif) | Juan Luis Herrero - Telekinézis.rtf | 2006-07-10 20:18 | 18K | |
![[ ]](/icons/compressed.gif) | herbert_frank_szerences_menekules.zip | 2007-03-24 02:54 | 18K | |
![[ ]](/icons/compressed.gif) | Larry Niven - A lyukember.zip | 2007-03-26 17:46 | 18K | |
![[ ]](/icons/compressed.gif) | Ivan Antonovics Jefremov - A hegyi szellemek tava.zip | 2007-03-26 15:30 | 18K | |
![[ ]](/icons/unknown.gif) | Vlagyimir Scserbakov - Szuharev visszatérése.rtf | 2006-06-25 07:32 | 18K | |
![[ ]](/icons/compressed.gif) | Vonnegut, Kurt_Isten hozott a majomházban - sci-fi novella - rtf.zip | 2006-01-07 08:43 | 18K | |
![[TXT]](/icons/text.gif) | I_02.HTM | 2007-03-24 02:54 | 18K | |
![[ ]](/icons/compressed.gif) | A E. Van Vogt - A szornyeteg.zip | 2007-03-20 13:18 | 18K | |
![[ ]](/icons/compressed.gif) | Johannes Kepler-Alom.zip | 2007-03-24 02:56 | 18K | |
![[ ]](/icons/compressed.gif) | Hal Clement - A bizonyíték.zip | 2007-03-23 13:44 | 18K | |
![[ ]](/icons/compressed.gif) | asimov_isaac_a_dalolo_harang.zip | 2007-03-24 02:55 | 18K | |
![[ ]](/icons/unknown.gif) | Zé - A külső sötétségbe.rtf | 2006-06-25 07:36 | 18K | |
![[ ]](/icons/unknown.gif) | Szilárd Leó - Jelentés a Centrál pályaudvarról.rtf | 2006-06-25 07:20 | 18K | |
![[ ]](/icons/compressed.gif) | Philip K Dick - Harcjáték.zip | 2006-05-29 11:13 | 18K | |
![[ ]](/icons/compressed.gif) | Robert Sheckley - A szabály.zip | 2006-05-29 11:22 | 18K | |
![[ ]](/icons/unknown.gif) | Villányi Dániel - Az utolsó madár.rtf | 2006-06-25 07:30 | 18K | |
![[ ]](/icons/unknown.gif) | Redguy - Idegen közöttünk.rtf | 2006-06-25 06:57 | 18K | |
![[ ]](/icons/compressed.gif) | Wayne Wightman - Bőrálca.zip | 2007-04-06 11:07 | 18K | |
![[ ]](/icons/compressed.gif) | Robert Sheckley - Menüett.zip | 2006-05-29 11:23 | 18K | |
![[ ]](/icons/unknown.gif) | Lord Dunsany - A királynő könnyeinek próbája.rtf | 2006-07-10 20:31 | 18K | |
![[ ]](/icons/unknown.gif) | William Tenn - A Pszt-hadművelet.rtf | 2006-06-25 07:35 | 18K | |
![[ ]](/icons/unknown.gif) | 14.rtf | 2007-11-13 22:28 | 18K | |
![[TXT]](/icons/text.gif) | 14.TXT | 2007-11-13 21:46 | 18K | |
![[ ]](/icons/unknown.gif) | IV_01.doc | 2007-11-13 21:39 | 18K | |
![[ ]](/icons/compressed.gif) | ZwikiewiczTalalkozas.zip | 2007-02-21 16:51 | 17K | |
![[ ]](/icons/compressed.gif) | Az etet_nél.htm.zip | 2007-03-24 02:59 | 17K | |
![[ ]](/icons/compressed.gif) | Harry Harryson - Askelon utcái.zip | 2007-03-26 15:07 | 17K | |
![[ ]](/icons/unknown.gif) | mumus.ace | 2007-03-24 02:52 | 17K | |
![[IMG]](/icons/image2.gif) | merle_robert_veszedelem_es_dicsoseg.gif | 2007-03-24 02:59 | 17K | |
![[ ]](/icons/compressed.gif) | Knight, Damon_Dilibot - sci-fi - rtf.zip | 2006-01-07 09:05 | 17K | |
![[ ]](/icons/unknown.gif) | Ottmár Andrea - Ki tudja örökre-e.rtf | 2006-06-25 06:35 | 17K | |
![[ ]](/icons/unknown.gif) | Cucui - Körkörös elágazások.rtf | 2006-07-10 19:37 | 17K | |
![[ ]](/icons/unknown.gif) | Tiaro - Otthon.rtf | 2006-06-25 07:21 | 17K | |
![[ ]](/icons/compressed.gif) | Grigorjev, Vlagyimir_A bőségszaru - sci-fi novella - rtf.zip | 2006-01-07 09:08 | 17K | |
![[ ]](/icons/unknown.gif) | Tiaro - Mindenek ura.rtf | 2006-06-25 07:21 | 17K | |
![[TXT]](/icons/text.gif) | Csirkecomb.txt | 2007-03-24 02:59 | 17K | |
![[ ]](/icons/compressed.gif) | Kurt Vonnegut - Beszamolo a Barnhouse effektusrol.zip | 2004-06-21 11:51 | 17K | |
![[TXT]](/icons/text.gif) | A hatlábú jegesmedve.htm | 2007-03-24 02:57 | 17K | |
![[TXT]](/icons/text.gif) | vvesszo.txt | 2007-03-24 02:58 | 17K | |
![[ ]](/icons/compressed.gif) | Robert Silverberg - Naptánc.zip | 2007-03-26 18:26 | 17K | |
![[ ]](/icons/compressed.gif) | John Brunner - Az utolsó magányos ember.zip | 2007-03-22 17:46 | 17K | |
![[ ]](/icons/unknown.gif) | Wágner B. György - Nosztalgia-viadal.rtf | 2006-06-25 07:35 | 17K | |
![[TXT]](/icons/text.gif) | NOVELLA8.HTM | 2007-03-24 03:01 | 17K | |
![[ ]](/icons/unknown.gif) | Csernai Zoltán - Kövek.rtf | 2006-07-10 19:37 | 17K | |
![[ ]](/icons/compressed.gif) | orwell_george_arthur_koestler_hu_rtf.zip | 2007-03-24 02:54 | 17K | |
![[ ]](/icons/compressed.gif) | George Orwell - Arthur_koestler_hu_rtf.zip | 2006-05-10 06:25 | 17K | |
![[ ]](/icons/unknown.gif) | 28.rtf | 2007-11-14 05:28 | 17K | |
![[ ]](/icons/compressed.gif) | Kurt Vonnegut - Isten hozott a majomházban.zip | 2004-06-21 11:51 | 17K | |
![[ ]](/icons/compressed.gif) | orwell_george_az_irodalom_felszamolasa_hu_rtf.zip | 2007-03-24 02:54 | 17K | |
![[ ]](/icons/unknown.gif) | Annie Besant A vegetarizmus teozófiai megvilágításban.rar | 2007-03-24 02:53 | 17K | |
![[ ]](/icons/unknown.gif) | Ő.ZIP | 2007-03-26 16:55 | 17K | |
![[ ]](/icons/compressed.gif) | albaryu_esther_a_torony_hu_rtf.zip | 2007-03-24 02:53 | 17K | |
![[ ]](/icons/compressed.gif) | Kálmán Mária_Köd előtte, köd utána... - sci-fi novella - word.zip | 2006-01-07 09:04 | 17K | |
![[ ]](/icons/compressed.gif) | zen buddhista koanok.zip | 2007-03-24 02:53 | 17K | |
![[ ]](/icons/compressed.gif) | Damon Knight - Dilibot.zip | 2007-03-26 15:36 | 17K | |
![[ ]](/icons/unknown.gif) | Szarvas Balázs - Hazug szerelem.rtf | 2006-06-25 07:19 | 17K | |
![[ ]](/icons/compressed.gif) | Ray Bradbury - A látogató.zip | 2007-03-22 16:56 | 17K | |
![[ ]](/icons/compressed.gif) | Bester, Alfred_Hobson választása - sci-fi - rtf.zip | 2006-01-07 09:14 | 17K | |
![[ ]](/icons/unknown.gif) | Esős évszak.rar | 2006-05-29 11:03 | 17K | |
![[ ]](/icons/compressed.gif) | Káin gyermekei.zip | 2007-03-24 02:49 | 17K | |
![[ ]](/icons/compressed.gif) | szemtanu.zip | 2007-08-04 13:45 | 17K | |
![[ ]](/icons/compressed.gif) | asimov_isaac_szemtanu.zip | 2007-03-24 02:55 | 17K | |
![[ ]](/icons/compressed.gif) | A szemtanu.zip | 2007-03-24 02:55 | 17K | |
![[TXT]](/icons/text.gif) | 24.txt | 2007-11-13 23:34 | 17K | |
![[ ]](/icons/unknown.gif) | 25.rtf | 2007-11-14 05:28 | 17K | |
![[ ]](/icons/unknown.gif) | ZILAHY.MEK | 2007-03-24 02:59 | 17K | |
![[TXT]](/icons/text.gif) | Az Álomváros.htm | 2007-03-24 02:57 | 17K | |
![[ ]](/icons/unknown.gif) | Pampalini - Utójáték.rtf | 2006-06-25 06:36 | 17K | |
![[ ]](/icons/compressed.gif) | Kálmán Mária_Az Aetna árnyai - sci-fi novella - word.zip | 2006-01-07 09:04 | 17K | |
![[ ]](/icons/compressed.gif) | Ray Bradbury - Kanikula.zip | 2007-02-21 16:47 | 17K | |
![[ ]](/icons/compressed.gif) | BradburyKanikula.zip | 2007-02-21 16:47 | 17K | |
![[ ]](/icons/unknown.gif) | Pampalini - Amikor Fortuna elkerül.rtf | 2006-06-25 06:35 | 17K | |
![[ ]](/icons/compressed.gif) | Brian W. Aldiss - A vér szava.zip | 2006-05-29 11:00 | 17K | |
![[ ]](/icons/unknown.gif) | Richard Paul Russo - Kilátás fentről.RTF | 2006-06-25 06:58 | 17K | |
![[ ]](/icons/compressed.gif) | Stephen Debman-A tronkovetelo.zip | 2007-03-24 03:00 | 17K | |
![[ ]](/icons/unknown.gif) | 2.2 | 2007-03-24 02:54 | 17K | |
![[TXT]](/icons/text.gif) | E-TAB1.HTM | 2007-03-24 02:59 | 17K | |
![[TXT]](/icons/text.gif) | 03_03.HTM | 2007-03-24 02:55 | 17K | |
![[ ]](/icons/unknown.gif) | Viktor Kolupajev - Táborkert.rtf | 2006-06-25 07:30 | 17K | |
![[ ]](/icons/compressed.gif) | Vonnegut, Kurt_Holnap, holnap, holnap - sci-fi novella - rtf.zip | 2006-01-07 08:43 | 17K | |
![[ ]](/icons/compressed.gif) | Stefan Zweig-Rahel perbe szall Istennell.zip | 2007-03-24 03:00 | 17K | |
![[TXT]](/icons/text.gif) | A perverzió démona.htm | 2007-03-24 02:53 | 17K | |
![[ ]](/icons/compressed.gif) | Lem, Stanislaw_Mosógéptragédia - sci-fi - rtf.zip | 2006-01-07 09:03 | 16K | |
![[ ]](/icons/compressed.gif) | Ellison, Harlan_Szája sincsen, úgy üvölt - sci-fi novella - rtf.zip | 2006-01-07 09:09 | 16K | |
![[ ]](/icons/compressed.gif) | Isten hozott a majomházban.zip | 2007-03-24 02:57 | 16K | |
![[ ]](/icons/compressed.gif) | king_stephen_bocsanat_nem_teves.zip | 2007-03-24 03:00 | 16K | |
![[ ]](/icons/compressed.gif) | bester_alfred_hobson_valasztasa.zip | 2007-03-24 02:49 | 16K | |
![[ ]](/icons/compressed.gif) | Brown, Fredric_Tébolyult hely a Placet - sci-fi novella - rtf.zip | 2006-01-07 09:06 | 16K | |
![[ ]](/icons/compressed.gif) | Alfred Bester - Hobson valasztasa.zip | 2006-05-29 10:59 | 16K | |
![[ ]](/icons/unknown.gif) | Zékósza - A visszatérő.rtf | 2006-06-25 07:36 | 16K | |
![[ ]](/icons/unknown.gif) | Ren the Unclean - A be nem zárult kör.rtf | 2006-06-25 06:57 | 16K | |
![[ ]](/icons/compressed.gif) | Theodore Sturgeon - A magány csészealja.zip | 2007-03-26 19:14 | 16K | |
![[ ]](/icons/compressed.gif) | Norbert Weiner-Az Agy.zip | 2007-03-24 02:58 | 16K | |
![[ ]](/icons/compressed.gif) | Arthur Jermyn.zip | 2007-03-26 16:55 | 16K | |
![[ ]](/icons/compressed.gif) | king_stephen_az_otodik_negyed.zip | 2007-03-24 03:00 | 16K | |
![[TXT]](/icons/text.gif) | I_03.HTM | 2007-03-24 02:54 | 16K | |
![[ ]](/icons/compressed.gif) | Ray Bradbury - A róka és az erdő.zip | 2007-03-22 16:56 | 16K | |
![[IMG]](/icons/image2.gif) | trendal.gif | 2004-04-14 18:02 | 16K | |
![[ ]](/icons/compressed.gif) | Dick, Philip K._A betolakodó - sci-fi novella - rtf.zip | 2006-01-07 09:09 | 16K | |
![[ ]](/icons/unknown.gif) | udmurt.ace | 2007-03-24 02:52 | 16K | |
![[ ]](/icons/unknown.gif) | 18.rtf | 2007-11-13 22:28 | 16K | |
![[TXT]](/icons/text.gif) | NOVELLA6.HTM | 2007-03-24 03:01 | 16K | |
![[ ]](/icons/unknown.gif) | Rnaggol - Szabadság.rtf | 2006-06-25 07:03 | 16K | |
![[ ]](/icons/compressed.gif) | Lovecraft, Howard Philips_Az ezüstkulcs - novella - rtf.zip | 2006-01-07 09:03 | 16K | |
![[ ]](/icons/compressed.gif) | Stableford, Brian M._A mérnök és az ítélet-végrehajtó - sci-fi novella - rtf.zip | 2006-01-07 08:53 | 16K | |
![[ ]](/icons/unknown.gif) | Lord Dunsany - Az Álomváros.rtf | 2006-07-10 20:32 | 16K | |
![[ ]](/icons/unknown.gif) | Annie Besant Sötét hatalmak a természetben.rar | 2007-03-24 02:53 | 16K | |
![[ ]](/icons/unknown.gif) | Zé - Mind fölött.rtf | 2006-06-25 07:36 | 16K | |
![[ ]](/icons/compressed.gif) | Robert Sheckley - Alak.zip | 2006-05-29 11:22 | 16K | |
![[ ]](/icons/compressed.gif) | Theodore Sturgeon - A magany cseszealja.zip | 2006-05-29 11:27 | 16K | |
![[ ]](/icons/unknown.gif) | ELOSZO.DOC | 2007-11-13 21:53 | 16K | |
![[ ]](/icons/compressed.gif) | Robert Sheckley - Nyomorszinten.zip | 2006-05-29 11:23 | 16K | |
![[TXT]](/icons/text.gif) | Disznótoros receptek 5_ - Egyéb májas hurkák.txt | 2007-03-24 02:59 | 16K | |
![[ ]](/icons/compressed.gif) | Illes Apokalipszise.zip | 2007-03-24 02:53 | 16K | |
![[ ]](/icons/compressed.gif) | Az iszlám alapelvei.zip | 2007-03-24 02:53 | 16K | |
![[ ]](/icons/compressed.gif) | C. Klein András_A Jézusevők - sci-fi novella - html.zip | 2006-01-07 09:11 | 16K | |
![[ ]](/icons/compressed.gif) | Ray Bradbury - És újra a föld.zip | 2007-03-22 16:59 | 16K | |
![[ ]](/icons/compressed.gif) | Anderson, Poul_Uram, irgalmazz - sci-fi novella - rtf.zip | 2006-01-07 08:58 | 16K | |
![[ ]](/icons/unknown.gif) | Juan G Atienza - Egy kisbolygó elsiratása.rtf | 2006-07-10 20:18 | 16K | |
![[TXT]](/icons/text.gif) | Kolbász sütés.txt | 2007-03-24 02:59 | 16K | |
![[ ]](/icons/compressed.gif) | Avram Davidson - Tűz sem ég itt már.zip | 2007-03-23 21:40 | 16K | |
![[ ]](/icons/compressed.gif) | Brian M. Stableford - A mérnök és az ítélet-végrehajtó.zip | 2006-05-29 10:59 | 16K | |
![[ ]](/icons/compressed.gif) | Robert Sheckley - Menyasszony utánvéttel.zip | 2007-03-26 18:49 | 16K | |
![[ ]](/icons/unknown.gif) | 46.rtf | 2007-11-13 22:36 | 16K | |
![[IMG]](/icons/image2.gif) | INDIAI.JPG | 2007-03-24 02:59 | 16K | |
![[ ]](/icons/unknown.gif) | Night Phoenix - Én a harcos.rtf | 2006-06-25 06:34 | 16K | |
![[TXT]](/icons/text.gif) | Vodka alapú italok.htm | 2007-03-24 02:59 | 16K | |
![[ ]](/icons/compressed.gif) | Kir Bulicsov - Az Ananda templom felszentelése.zip | 2007-03-22 17:48 | 16K | |
![[ ]](/icons/compressed.gif) | petofi_sandor_a_helyseg_kalapacsa_txt.zip | 2007-03-24 02:55 | 16K | |
![[ ]](/icons/compressed.gif) | Frederic Brown - Tébolyult hely a Placet.zip | 2007-03-22 17:44 | 16K | |
![[ ]](/icons/compressed.gif) | Caraker, Mary_Thrrup a tanárnőnek. - sci-fi novella - html.zip | 2006-01-07 09:10 | 16K | |
![[ ]](/icons/compressed.gif) | Philip K Dick - A betolakodó.zip | 2007-03-23 21:40 | 16K | |
![[ ]](/icons/unknown.gif) | Richard Stallman - Az olvasáshoz való jog.rtf | 2006-06-25 06:58 | 16K | |
![[ ]](/icons/compressed.gif) | Ray Bradbury - R, mint rakéta.zip | 2007-03-22 17:00 | 16K | |
![[ ]](/icons/compressed.gif) | A róka és az es_.htm.zip | 2007-03-24 02:59 | 16K | |
![[ ]](/icons/compressed.gif) | Smith, Cordwainer_Patkány-sárkány játék - sci-fi novella - rtf.zip | 2006-01-07 08:53 | 16K | |
![[ ]](/icons/compressed.gif) | anderson_poul_uram_irgalmazz.zip | 2007-03-24 02:58 | 16K | |
![[ ]](/icons/compressed.gif) | Poul Anderson - Uram irgalmazz.zip | 2006-05-29 11:13 | 16K | |
![[ ]](/icons/unknown.gif) | 08.rtf | 2007-11-13 22:28 | 16K | |
![[ ]](/icons/unknown.gif) | Campaign.sav | 2006-09-16 22:50 | 16K | |
![[ ]](/icons/unknown.gif) | holnap.ace | 2007-03-24 02:52 | 16K | |
![[TXT]](/icons/text.gif) | Fogadás.htm | 2007-03-24 02:58 | 16K | |
![[TXT]](/icons/text.gif) | III_04.HTM | 2007-03-24 02:54 | 16K | |
![[ ]](/icons/unknown.gif) | 03.rtf | 2007-11-13 22:10 | 16K | |
![[ ]](/icons/compressed.gif) | Robert Silverberg - A férfi, aki sosem felejt.zip | 2007-03-26 18:26 | 16K | |
![[ ]](/icons/unknown.gif) | Hamburger.doc | 2007-03-24 02:59 | 16K | |
![[ ]](/icons/compressed.gif) | Kurt Vonnegut - Holnap, holnap, holnap.zip | 2004-06-21 11:51 | 15K | |
![[ ]](/icons/compressed.gif) | Kurt Vonnegut - Holnap,_holnap,_holnap.zip | 2004-06-21 11:41 | 15K | |
![[ ]](/icons/compressed.gif) | Ursula K Le Guin - Az út iránya.zip | 2007-03-26 15:44 | 15K | |
![[ ]](/icons/unknown.gif) | H. P. Lovecraft - A névtelen város.rar | 2007-03-24 02:55 | 15K | |
![[TXT]](/icons/text.gif) | Májételek.txt | 2007-03-24 02:59 | 15K | |
![[ ]](/icons/compressed.gif) | brown_fredric_tebolyult_hely_a_placet.zip | 2007-03-24 02:54 | 15K | |
![[TXT]](/icons/text.gif) | 01.HTM | 2007-03-24 02:55 | 15K | |
![[ ]](/icons/compressed.gif) | Robert Sheckley - Doktor Zombi és az o kis szoros baratai.zip | 2006-05-29 11:23 | 15K | |
![[ ]](/icons/unknown.gif) | 16.rtf | 2007-11-13 22:28 | 15K | |
![[ ]](/icons/compressed.gif) | dick_philip_k_a_betolakodo.zip | 2007-03-24 02:58 | 15K | |
![[ ]](/icons/compressed.gif) | aldiss_brian_w_jajj_a_tigrisnek.zip | 2007-03-24 02:52 | 15K | |
![[ ]](/icons/compressed.gif) | Brian W. Aldiss - Jaj a tigrisnek.zip | 2006-05-29 11:00 | 15K | |
![[ ]](/icons/compressed.gif) | Janos jelenesek konyvenek magyarazata.zip | 2007-03-24 02:53 | 15K | |
![[ ]](/icons/compressed.gif) | Ursula K Le Guin - A minta.zip | 2007-03-26 15:44 | 15K | |
![[ ]](/icons/unknown.gif) | Karen A Szimonjan - Hívogató hívogató világ.rtf | 2006-07-10 20:19 | 15K | |
![[ ]](/icons/compressed.gif) | És újra a Föld.htm.zip | 2007-03-24 02:59 | 15K | |
![[ ]](/icons/compressed.gif) | asimov_isaac_robotalmok.zip | 2007-03-24 02:55 | 15K | |
![[ ]](/icons/unknown.gif) | Damiano Malabaila - Glauonia Rapida.rtf | 2006-07-10 19:38 | 15K | |
![[ ]](/icons/compressed.gif) | Ray Bradbury - A száműzöttek.zip | 2007-03-22 16:56 | 15K | |
![[ ]](/icons/compressed.gif) | Stephen King - Harvey álma.zip | 2007-03-26 15:34 | 15K | |
![[ ]](/icons/compressed.gif) | A különös, magas ház a ködben.zip | 2007-03-26 16:54 | 15K | |
![[ ]](/icons/compressed.gif) | Newman, Kim_Álmodók - sci-fi novella - rtf.zip | 2006-01-07 08:59 | 15K | |
![[ ]](/icons/compressed.gif) | Gaiman,Neil-Megint vilagvege.zip | 2007-03-24 02:54 | 15K | |
![[ ]](/icons/compressed.gif) | A kép a házban.zip | 2007-03-26 16:56 | 15K | |
![[ ]](/icons/unknown.gif) | Ren the Unclean - Jéghideg.rtf | 2006-06-25 06:57 | 15K | |
![[TXT]](/icons/text.gif) | elvvaros.txt | 2007-03-24 02:58 | 15K | |
![[ ]](/icons/compressed.gif) | Jose Saramago-Mese az ismeretlen szigetrol.zip | 2007-03-24 02:56 | 15K | |
![[TXT]](/icons/text.gif) | Az ajándék.htm | 2007-03-24 02:58 | 15K | |
![[ ]](/icons/unknown.gif) | Pickman modellje.rar | 2007-03-24 02:55 | 15K | |
![[ ]](/icons/unknown.gif) | 42.rtf | 2007-11-13 22:36 | 15K | |
![[ ]](/icons/compressed.gif) | kim_newman_-_Álmodók.zip | 2004-06-21 11:42 | 15K | |
![[ ]](/icons/compressed.gif) | Kim Newman - Álmodók.zip | 2006-05-29 11:12 | 15K | |
![[ ]](/icons/compressed.gif) | Ray Bradbury - Talán álmodni.zip | 2007-03-22 17:00 | 15K | |
![[ ]](/icons/unknown.gif) | fogadalom.ace | 2007-03-24 02:52 | 15K | |
![[ ]](/icons/unknown.gif) | Álmok a boszorkányházban.rar | 2007-03-24 02:55 | 15K | |
![[ ]](/icons/compressed.gif) | R, mint rakéta.htm.zip | 2007-03-24 02:59 | 15K | |
![[ ]](/icons/compressed.gif) | visnu.zip | 2007-03-24 03:01 | 15K | |
![[ ]](/icons/compressed.gif) | Stoker,Bram-Indian asszony.zip | 2007-03-24 03:00 | 15K | |
![[ ]](/icons/compressed.gif) | Friedrich Nietzsche.zip | 2007-03-24 02:54 | 15K | |
![[ ]](/icons/unknown.gif) | A toronyszoba ablaka.rar | 2007-03-24 02:55 | 15K | |
![[ ]](/icons/compressed.gif) | Dnyeprov, Anatolij_Csak kérdezni kell... sci-fi novella - rtf.zip | 2006-01-07 09:09 | 15K | |
![[TXT]](/icons/text.gif) | adalhava.txt | 2007-04-15 15:27 | 15K | |
![[ ]](/icons/compressed.gif) | Morland,keith-A ket pava.zip | 2007-03-24 02:58 | 15K | |
![[ ]](/icons/compressed.gif) | Mobile, Frank_A gravitációs hullámok szörfösei - sci-fi novella - html.zip | 2006-01-07 09:00 | 15K | |
![[ ]](/icons/compressed.gif) | Ray Bradbury - A lapály.zip | 2007-03-22 16:56 | 15K | |
![[TXT]](/icons/text.gif) | II_07.HTM | 2007-03-24 02:54 | 15K | |
![[ ]](/icons/compressed.gif) | Vonnegut, Kurt_A következő lépés - sci-fi novella - rtf.zip | 2006-01-07 08:43 | 15K | |
![[ ]](/icons/compressed.gif) | Lovecraft, Howard Phillips_Iranon útja - novella - html.txt.zip | 2006-01-07 09:03 | 15K | |
![[IMG]](/icons/image2.gif) | BULGUR.JPG | 2007-03-24 02:59 | 15K | |
![[ ]](/icons/compressed.gif) | asimov_isaac_ocsi.zip | 2007-03-24 02:55 | 15K | |
![[TXT]](/icons/text.gif) | e-tab1.htm | 2007-03-24 02:53 | 15K | |
![[TXT]](/icons/text.gif) | 02_04.HTM | 2007-03-24 02:55 | 15K | |
![[ ]](/icons/unknown.gif) | Zékósza - Dzsungelláz.rtf | 2006-06-25 07:36 | 15K | |
![[ ]](/icons/unknown.gif) | WiLDoR - Halálcsapda.rtf | 2006-06-25 07:34 | 15K | |
![[TXT]](/icons/text.gif) | Szörny az _rben.htm | 2007-03-24 02:58 | 15K | |
![[ ]](/icons/compressed.gif) | Erich Zann muzsikája.zip | 2007-03-26 16:55 | 15K | |
![[TXT]](/icons/text.gif) | 20.TXT | 2007-11-13 23:34 | 15K | |
![[ ]](/icons/compressed.gif) | Robert Sheckley - Specialista.zip | 2006-05-29 11:23 | 15K | |
![[ ]](/icons/compressed.gif) | Ray Bradbury - Arnyalatnyi ingerultseg.zip | 2007-02-21 16:47 | 15K | |
![[ ]](/icons/compressed.gif) | BradburyArnyalatnyi.zip | 2007-02-21 16:47 | 15K | |
![[ ]](/icons/unknown.gif) | Jurij Scserbak - A kihallgatás.rtf | 2006-07-10 20:18 | 15K | |
![[ ]](/icons/unknown.gif) | Zeld - A kocka.rtf | 2006-06-25 07:35 | 15K | |
![[ ]](/icons/compressed.gif) | korso.zip | 2007-02-21 15:59 | 15K | |
![[ ]](/icons/compressed.gif) | Knight, Damon_Ember a korsóban - rtf.zip | 2006-01-07 08:47 | 15K | |
![[ ]](/icons/compressed.gif) | Damon Knight-Ember a korsoban.zip | 2007-03-24 02:52 | 15K | |
![[ ]](/icons/compressed.gif) | Damon Knight - Ember a korsóban.zip | 2006-08-24 18:24 | 15K | |
![[TXT]](/icons/text.gif) | 04.txt | 2007-11-13 21:46 | 15K | |
![[ ]](/icons/compressed.gif) | fogadalom_atka.zip | 2007-02-21 16:45 | 15K | |
![[ ]](/icons/compressed.gif) | diamond_b_tim_fogadalom_atka.zip | 2007-03-24 03:00 | 15K | |
![[ ]](/icons/compressed.gif) | Diamond, Tim B._A fogadalom átka - sci-fi - rtf.zip | 2006-01-07 08:46 | 15K | |
![[ ]](/icons/compressed.gif) | Lovecraft, Howard Phillips_Celephais - novella - html.txt.zip | 2006-01-07 09:03 | 15K | |
![[ ]](/icons/unknown.gif) | Samuel B Kingstone - Gyűrű.rtf | 2006-06-25 07:16 | 15K | |
![[TXT]](/icons/text.gif) | abosszu.txt | 2007-04-15 14:04 | 15K | |
![[ ]](/icons/compressed.gif) | Herbert W. Franke - Novellák.zip | 2007-03-26 14:55 | 15K | |
![[ ]](/icons/compressed.gif) | A vadászat.htm.zip | 2007-03-24 02:59 | 15K | |
![[ ]](/icons/compressed.gif) | Nesvadba, Josef_Vámpír, 20 év múlva - sci-fi novella - rtf.zip | 2006-01-07 08:57 | 15K | |
![[ ]](/icons/compressed.gif) | new rose hotel.zip | 2007-03-24 03:01 | 15K | |
![[ ]](/icons/compressed.gif) | asimov_isaac_theszpisz.zip | 2007-03-24 02:55 | 15K | |
![[ ]](/icons/compressed.gif) | AsimovTheszpisz.zip | 2007-02-21 16:03 | 15K | |
![[ ]](/icons/compressed.gif) | John Wyndham - Ördögi szerencse.zip | 2007-03-26 19:55 | 15K | |
![[ ]](/icons/compressed.gif) | SinicsiFogyokura.zip | 2007-02-21 16:35 | 14K | |
![[ ]](/icons/compressed.gif) | Barbet, Pierre_A bódító bolygó - sci-fi novella - rtf.zip | 2006-01-07 09:14 | 14K | |
![[ ]](/icons/compressed.gif) | A szám_zöttek.htm.zip | 2007-03-24 02:59 | 14K | |
![[ ]](/icons/compressed.gif) | Deutch, J. A._A Möbius-metró - sci-fi novella - html.zip | 2006-01-07 09:09 | 14K | |
![[TXT]](/icons/text.gif) | Brokkoli.txt | 2007-03-24 02:59 | 14K | |
![[ ]](/icons/compressed.gif) | Ray Bradbury - Ritka muveszet, ihlet es csoda.zip | 2006-05-29 11:20 | 14K | |
![[ ]](/icons/compressed.gif) | kisertet5.zip | 2007-03-24 02:59 | 14K | |
![[ ]](/icons/compressed.gif) | vonnegut_kurt_baratom_multivac.zip | 2007-03-24 02:57 | 14K | |
![[ ]](/icons/compressed.gif) | VonnegutBaratom.zip | 2007-02-21 16:09 | 14K | |
![[ ]](/icons/compressed.gif) | Arthur C Clarke - Csöndet kérek.zip | 2007-03-23 13:30 | 14K | |
![[ ]](/icons/compressed.gif) | Wodehose P G-Ebek orome.zip | 2007-03-24 03:01 | 14K | |
![[TXT]](/icons/text.gif) | Ismeretlen gy_ztes.htm | 2007-03-24 03:01 | 14K | |
![[ ]](/icons/compressed.gif) | silverberg_robert_a_ferfi_aki_sosem_felejt.zip | 2007-03-24 02:59 | 14K | |
![[ ]](/icons/compressed.gif) | robert_silverberg_-_a_férfi,_aki_sosem_felejt.zip | 2004-06-21 11:42 | 14K | |
![[ ]](/icons/compressed.gif) | Ray Bradbury - Bőrük sötét volt s a szemük arany.zip | 2007-03-22 16:58 | 14K | |
![[ ]](/icons/unknown.gif) | Wyquin - Mestermunka.rtf | 2006-06-25 07:35 | 14K | |
![[TXT]](/icons/text.gif) | idolatog.txt | 2007-03-24 02:58 | 14K | |
![[ ]](/icons/compressed.gif) | A lapály.htm.zip | 2007-03-24 02:59 | 14K | |
![[TXT]](/icons/text.gif) | NOVELLA7.HTM | 2007-03-24 03:01 | 14K | |
![[ ]](/icons/compressed.gif) | Pierre Barbet - A bódító bolygó.zip | 2007-03-21 19:18 | 14K | |
![[ ]](/icons/compressed.gif) | Gennagyij Gor - A kert.zip | 2006-05-29 11:03 | 14K | |
![[ ]](/icons/compressed.gif) | aldiss_brian_w_a_mi_tudasunk.zip | 2007-03-24 02:52 | 14K | |
![[ ]](/icons/compressed.gif) | Brian W. Aldiss - A mi tudásunk.zip | 2004-06-21 11:40 | 14K | |
![[ ]](/icons/unknown.gif) | Tiaro - Beszélgetés a temetőben.rtf | 2006-06-25 07:21 | 14K | |
![[ ]](/icons/compressed.gif) | A Hold-láp_elemei.zip | 2007-03-26 16:54 | 14K | |
![[ ]](/icons/compressed.gif) | A Hold-láp.zip | 2007-03-26 16:52 | 14K | |
![[TXT]](/icons/text.gif) | Csillagjáró.htm | 2007-03-24 02:58 | 14K | |
![[ ]](/icons/compressed.gif) | kisch_egon_erwin_csodatevo_vizben_furdom_hu_txt.zip | 2007-03-24 02:53 | 14K | |
![[ ]](/icons/unknown.gif) | Pete Sears - Egy lovecraft-i karácsony.rtf | 2006-06-25 06:36 | 14K | |
![[ ]](/icons/compressed.gif) | Renier, Raoul, vagyis Kornya Zsolt versei és versfordításai - html.zip | 2006-01-07 08:54 | 14K | |
![[TXT]](/icons/text.gif) | Intelligenciahányadosa 184.htm | 2007-03-24 02:54 | 14K | |
![[ ]](/icons/compressed.gif) | Robert Sheckley - Ugyanaz duplan.zip | 2006-05-29 11:23 | 14K | |
![[ ]](/icons/compressed.gif) | niven_larry_az_ellenseg.zip | 2007-03-24 02:58 | 14K | |
![[ ]](/icons/compressed.gif) | Fialkowski, Konrad_Parancsnok életre keltése - sci-fi novella - rtf.zip | 2006-01-07 09:08 | 14K | |
![[ ]](/icons/compressed.gif) | Kuttner, Henry_Amire szükségük van - sci-fi novella - html.zip | 2006-01-07 09:05 | 14K | |
![[ ]](/icons/compressed.gif) | Pohl, Frederik - Kornbluth, C. M._A gyűlés - sci-fi novella - rtf.zip | 2006-01-07 08:55 | 14K | |
![[TXT]](/icons/text.gif) | Egy hordó amontillado.htm | 2007-03-24 02:53 | 14K | |
![[ ]](/icons/unknown.gif) | 05.rtf | 2007-11-13 22:28 | 14K | |
![[TXT]](/icons/text.gif) | I_16-17.HTM | 2007-03-24 02:58 | 14K | |
![[ ]](/icons/unknown.gif) | Sambucus - Halál.rtf | 2006-06-25 07:15 | 14K | |
![[ ]](/icons/unknown.gif) | Raon - Mestermunka - Dolna anya.rtf | 2006-06-25 06:42 | 14K | |
![[ ]](/icons/compressed.gif) | Philip K Dick - Az álapa.zip | 2007-03-23 21:40 | 14K | |
![[ ]](/icons/compressed.gif) | Kurt Vonnegut Jr - A következő lépés.zip | 2004-06-21 11:41 | 14K | |
![[ ]](/icons/compressed.gif) | Kurt Vonnegut - A következo lépés.zip | 2004-06-21 11:51 | 14K | |
![[ ]](/icons/compressed.gif) | redfield_james_a_mennyei_profecia_zsebkalauz_hu_rtf.zip | 2007-03-24 02:55 | 14K | |
![[ ]](/icons/compressed.gif) | James Radefield-Zsebkalauz a kilenc felismereshez.zip | 2007-03-24 02:55 | 14K | |
![[ ]](/icons/compressed.gif) | Ray Bradbury - A mennydörgés hangja.zip | 2007-03-22 16:56 | 14K | |
![[ ]](/icons/compressed.gif) | Robert Sheckley - Rutinmunka.zip | 2006-05-29 11:23 | 14K | |
![[ ]](/icons/compressed.gif) | Terry pratchett-Az ej korongjai.zip | 2007-03-24 03:00 | 14K | |
![[IMG]](/icons/image2.gif) | _khad-sid.jp | 2007-04-15 15:22 | 14K | |
![[ ]](/icons/compressed.gif) | Robert Sheckley - Dobozolt menyasszony.zip | 2006-05-29 11:23 | 14K | |
![[TXT]](/icons/text.gif) | kemek.txt | 2007-03-24 02:58 | 14K | |
![[ ]](/icons/compressed.gif) | sheckley_robert_kisertet-5.zip | 2007-03-24 02:59 | 14K | |
![[ ]](/icons/compressed.gif) | Robert Sheckley - Kísértet-5.zip | 2006-05-29 11:22 | 14K | |
![[ ]](/icons/compressed.gif) | Ray Bradbury - A hosszú eső.zip | 2007-03-22 16:55 | 14K | |
![[ ]](/icons/compressed.gif) | aldiss_brian_w___es_a_sziv_renyhesege.zip | 2007-03-24 02:52 | 14K | |
![[ ]](/icons/compressed.gif) | Brian W. Aldiss - És a sziv renyhesege.zip | 2006-05-29 10:59 | 14K | |
![[ ]](/icons/compressed.gif) | Robert Sheckley - Erzel valamit amikor ezt csinalom.zip | 2006-05-29 11:23 | 14K | |
![[ ]](/icons/compressed.gif) | Ebek Öröme.zip | 2007-03-24 02:58 | 14K | |
![[ ]](/icons/compressed.gif) | Ray Bradbury - Esik eső, egyre esik.zip | 2007-03-22 16:59 | 14K | |
![[ ]](/icons/compressed.gif) | jokai_anna_ima_magyarorszagert_html.zip | 2007-03-24 02:56 | 14K | |
![[ ]](/icons/compressed.gif) | aldiss_brian_w_az_ido_kisiklasanak_ejszakaja.zip | 2007-03-24 02:52 | 14K | |
![[ ]](/icons/compressed.gif) | AldissAzido.zip | 2007-02-21 16:20 | 14K | |
![[ ]](/icons/compressed.gif) | grimfiaegill.zip | 2007-03-24 02:56 | 14K | |
![[ ]](/icons/compressed.gif) | Dick, Philip K._Az álapa - sci-fi novella - rtf.zip | 2006-01-07 09:09 | 14K | |
![[TXT]](/icons/text.gif) | Citromfű - MiMi.htm | 2007-03-24 02:59 | 14K | |
![[ ]](/icons/unknown.gif) | Leon Miller - A Worp-reakcióra vonatkozó hiteles adalékok.rtf | 2006-07-10 20:28 | 14K | |
![[ ]](/icons/compressed.gif) | Ray Bradbury - Vigyázat, tigris.zip | 2007-03-22 17:00 | 14K | |
![[IMG]](/icons/image2.gif) | TORTILLA.JPG | 2007-03-24 02:59 | 14K | |
![[ ]](/icons/compressed.gif) | B_rük sötét volt s a szemük arany.htm.zip | 2007-03-24 02:59 | 14K | |
![[TXT]](/icons/text.gif) | 22.TXT | 2007-11-13 23:34 | 14K | |
![[ ]](/icons/unknown.gif) | Salman Rushide-A Profeta haja szala | 2007-03-24 03:00 | 14K | |
![[ ]](/icons/compressed.gif) | Ballard, J. G._Prima Belladonna - sci-fi novella - html.zip | 2006-01-07 09:14 | 14K | |
![[ ]](/icons/unknown.gif) | A névtelen város.rar | 2007-03-24 02:55 | 14K | |
![[ ]](/icons/compressed.gif) | Dmitrij Alekszandrovics Bilenkin - Éjszaka kis izgalommal.zip | 2007-03-21 19:26 | 14K | |
![[ ]](/icons/compressed.gif) | Bőr.htm.zip | 2007-03-24 02:59 | 14K | |
![[TXT]](/icons/text.gif) | Eleonora.htm | 2007-03-24 02:53 | 14K | |
![[ ]](/icons/compressed.gif) | Alhazred lámpája.zip | 2006-05-10 06:22 | 14K | |
![[ ]](/icons/compressed.gif) | Frederik Pohl és C M Cornbluth - A gyűlés.zip | 2007-03-26 18:11 | 14K | |
![[ ]](/icons/compressed.gif) | Günther Krupkat - Látogató az Antibolygóról.zip | 2007-03-26 15:39 | 14K | |
![[ ]](/icons/compressed.gif) | Robert Sheckley - Nugent Miller es a lanyok.zip | 2006-05-29 11:23 | 14K | |
![[ ]](/icons/compressed.gif) | aldiss_brian_w_konfluencia.zip | 2007-03-24 02:52 | 14K | |
![[ ]](/icons/compressed.gif) | Anton Pavlovics Csehov-A csinovnyik halala.zip | 2007-03-24 02:49 | 14K | |
![[ ]](/icons/compressed.gif) | Robert Sheckley - Zarandokut a Foldre.zip | 2006-05-29 11:23 | 14K | |
![[ ]](/icons/compressed.gif) | Ray Bradbury - A nagy fekete-fehér játszma.zip | 2007-03-22 16:56 | 14K | |
![[ ]](/icons/compressed.gif) | Ray Bradbury - Itt oroszlánok vannak.zip | 2007-03-22 16:59 | 14K | |
![[ ]](/icons/compressed.gif) | Mobile, Frank_Az isten meg a többiek - sci-fi novella - html.zip | 2006-01-07 09:00 | 14K | |
![[ ]](/icons/compressed.gif) | gilgames.zip | 2007-03-24 02:55 | 13K | |
![[ ]](/icons/compressed.gif) | Clarke, Arthur C._A mélyben - sci-fi novella - rtf.zip | 2006-01-07 09:10 | 13K | |
![[ ]](/icons/compressed.gif) | Ilja Varsavszkij - Riasztó szimptómák nincsenek.zip | 2007-03-26 19:37 | 13K | |
![[ ]](/icons/compressed.gif) | A fürd_kád.htm.zip | 2007-03-24 02:59 | 13K | |
![[ ]](/icons/compressed.gif) | Ray Bradbury - Gyerekszoba.zip | 2007-03-22 16:59 | 13K | |
![[ ]](/icons/compressed.gif) | James,Montague Rhodes-Mr Poynter naploja.zip | 2007-03-24 02:55 | 13K | |
![[ ]](/icons/compressed.gif) | Sheckley, Robert_Valamit Semmiért - sci-fi novella - rtf.zip | 2006-01-07 08:53 | 13K | |
![[TXT]](/icons/text.gif) | okirat.txt | 2007-04-15 15:42 | 13K | |
![[ ]](/icons/unknown.gif) | zsebpiszok - Patkányok (SLA Industries).rtf | 2006-06-25 07:35 | 13K | |
![[ ]](/icons/unknown.gif) | 22.rtf | 2007-11-14 05:28 | 13K | |
![[ ]](/icons/unknown.gif) | Salman Rushidie-Cekov es Zulu | 2007-03-24 03:00 | 13K | |
![[ ]](/icons/compressed.gif) | szentmihalyi_szabo_peter_idoharang.zip | 2007-03-24 03:00 | 13K | |
![[ ]](/icons/compressed.gif) | idoharang.zip | 2007-02-21 15:44 | 13K | |
![[ ]](/icons/compressed.gif) | Szentmihályi Szabó Péter - idoharang.zip | 2005-06-22 15:37 | 13K | |
![[ ]](/icons/unknown.gif) | Uhrin Tamás - Cathan Igazsága.rtf | 2006-06-25 07:23 | 13K | |
![[ ]](/icons/compressed.gif) | Robert Sheckley - A mentocsonak.zip | 2006-05-29 11:22 | 13K | |
![[ ]](/icons/unknown.gif) | Szabados Ernő - Egy üveg szilvalekvár.rtf | 2006-06-25 07:19 | 13K | |
![[ ]](/icons/compressed.gif) | Az arcnélküli Isten.htm.zip | 2007-03-24 02:59 | 13K | |
![[ ]](/icons/compressed.gif) | Arthur C Clarke - Nehéz a bennszülöttekkel.zip | 2007-03-23 13:30 | 13K | |
![[ ]](/icons/compressed.gif) | Lang Zsolt-Bestarium Transylvaniae.zip | 2007-03-24 02:57 | 13K | |
![[ ]](/icons/compressed.gif) | Larry Niven - Ellenség.zip | 2007-03-26 17:46 | 13K | |
![[TXT]](/icons/text.gif) | NOVELLA9.HTM | 2007-03-24 03:01 | 13K | |
![[ ]](/icons/unknown.gif) | idoharang.ace | 2007-03-24 02:52 | 13K | |
![[IMG]](/icons/image2.gif) | Dungeon-foldszint.gif | 2007-04-15 15:44 | 13K | |
![[ ]](/icons/compressed.gif) | Isaac Asimov - A Hold tragédiája.zip | 2007-03-22 05:29 | 13K | |
![[ ]](/icons/compressed.gif) | Ray Bradbury - Az a nagy, tágas világ.zip | 2007-03-22 16:57 | 13K | |
![[ ]](/icons/compressed.gif) | Lovecraft, Howard Philips_Arthur Jermyn - novella - rtf.zip | 2006-01-07 09:03 | 13K | |
![[ ]](/icons/compressed.gif) | A mennydörgés hangja.htm.zip | 2007-03-24 02:59 | 13K | |
![[TXT]](/icons/text.gif) | rec-szot.html | 2007-03-24 02:59 | 13K | |
![[ ]](/icons/compressed.gif) | Mihaleczky Péter_John Derinack Smith - sci-fi novella - html.zip | 2006-01-07 09:00 | 13K | |
![[ ]](/icons/compressed.gif) | Wyndham, John_El, szövőpók, itt ne járj - sci-fi novella - rtf.zip | 2006-01-07 08:42 | 13K | |
![[ ]](/icons/compressed.gif) | Esik es_, egyre esik.htm.zip | 2007-03-24 02:59 | 13K | |
![[ ]](/icons/compressed.gif) | A csillag.zip | 2007-03-24 02:49 | 13K | |
![[ ]](/icons/unknown.gif) | Stöki - A korcskirály.rtf | 2006-06-25 07:18 | 13K | |
![[ ]](/icons/compressed.gif) | Fridrich Durrenmatt-Minotaurosz.zip | 2007-03-24 02:54 | 13K | |
![[ ]](/icons/unknown.gif) | Petrus - Nem lehet kikapcsolni.rtf | 2006-06-25 06:36 | 13K | |
![[ ]](/icons/unknown.gif) | 43.rtf | 2007-11-13 22:36 | 13K | |
![[ ]](/icons/unknown.gif) | 23.rtf | 2007-11-14 05:28 | 13K | |
![[ ]](/icons/compressed.gif) | gibson_william_new_rose_hotel.zip | 2007-03-24 03:01 | 13K | |
![[ ]](/icons/compressed.gif) | A kaszás képmása.zip | 2007-04-15 04:01 | 13K | |
![[ ]](/icons/compressed.gif) | pohl-kornbluth_a_gyules.zip | 2007-03-24 02:54 | 13K | |
![[ ]](/icons/compressed.gif) | Vigyázat, tigris.htm.zip | 2007-03-24 02:59 | 13K | |
![[ ]](/icons/compressed.gif) | Robert Sheckley - Valamit semmiert.zip | 2006-05-29 11:23 | 13K | |
![[ ]](/icons/compressed.gif) | Az alkimista.zip | 2006-05-10 06:22 | 13K | |
![[ ]](/icons/compressed.gif) | A hangfogó.htm.zip | 2007-03-24 02:59 | 13K | |
![[ ]](/icons/compressed.gif) | Gor, Gennagyij_A kert - sci-fi novella - html.zip | 2006-01-07 09:08 | 13K | |
![[ ]](/icons/compressed.gif) | Gogol,Nyikolaj Vasziljevics-A hinto.zip | 2007-03-24 02:55 | 13K | |
![[ ]](/icons/unknown.gif) | 17.rtf | 2007-11-13 22:28 | 13K | |
![[ ]](/icons/unknown.gif) | Az ős.rar | 2007-03-24 02:55 | 13K | |
![[ ]](/icons/compressed.gif) | Gibson, William - New Rose Hotel_[H].zip | 2007-03-26 19:50 | 13K | |
![[ ]](/icons/unknown.gif) | 29.rtf | 2007-11-14 05:28 | 13K | |
![[ ]](/icons/compressed.gif) | king_stephen_mumus.zip | 2007-03-24 03:00 | 13K | |
![[ ]](/icons/compressed.gif) | Dagon.zip | 2007-03-26 16:55 | 13K | |
![[ ]](/icons/compressed.gif) | vmf547.zip | 2007-03-24 03:01 | 13K | |
![[ ]](/icons/compressed.gif) | W. R. Thompson - VFM-547.zip | 2006-08-24 18:24 | 13K | |
![[ ]](/icons/compressed.gif) | Iványosi Szabó Gábor_Kutatóhajó - sci-fi novella - html.zip | 2006-01-07 09:05 | 13K | |
![[ ]](/icons/compressed.gif) | Itt oroszlánok vannak.htm.zip | 2007-03-24 02:59 | 13K | |
![[ ]](/icons/compressed.gif) | Sir Gawain es a Zold lovag.zip | 2007-03-24 03:00 | 13K | |
![[ ]](/icons/compressed.gif) | Damon Knight - A hasonmások.zip | 2007-03-26 15:35 | 13K | |
![[ ]](/icons/compressed.gif) | Gyerekszoba.htm.zip | 2007-03-24 02:59 | 13K | |
![[ ]](/icons/compressed.gif) | Robert Sheckley - A megkövült világ.zip | 2006-05-29 11:22 | 13K | |
![[ ]](/icons/unknown.gif) | gyerekek.ace | 2007-03-24 02:52 | 13K | |
![[ ]](/icons/unknown.gif) | Szajkó - Az Élet.rtf | 2006-06-25 07:19 | 13K | |
![[ ]](/icons/compressed.gif) | clarke_arthur_c_nehez_a_bennszulottekkel.zip | 2007-03-24 02:49 | 13K | |
![[ ]](/icons/compressed.gif) | Ray Bradbury - A Toynbee konvektor.zip | 2007-03-22 16:57 | 13K | |
![[ ]](/icons/unknown.gif) | hajfarm.ace | 2007-03-24 02:52 | 13K | |
![[ ]](/icons/compressed.gif) | Robert Sheckley - A világűr polgára.zip | 2007-03-26 18:48 | 13K | |
![[ ]](/icons/compressed.gif) | Robert Sheckley - Kiruccanás.zip | 2006-05-29 11:23 | 13K | |
![[TXT]](/icons/text.gif) | noe.txt | 2007-03-24 02:58 | 13K | |
![[ ]](/icons/compressed.gif) | Bajzafi Ferenc_Umat gyémántjai - sci-fi novella - html.zip | 2006-01-07 09:11 | 13K | |
![[ ]](/icons/compressed.gif) | Németh István - Árkádia.zip | 2007-03-26 17:42 | 13K | |
![[TXT]](/icons/text.gif) | 03_02.HTM | 2007-03-24 02:55 | 13K | |
![[ ]](/icons/compressed.gif) | Krupkat, Günther_A párbaj - sci-fi novella - rtf.zip | 2006-01-07 09:05 | 13K | |
![[ ]](/icons/compressed.gif) | NAGARDZSUNA-Dragakofuzer.zip | 2007-03-24 02:58 | 13K | |
![[TXT]](/icons/text.gif) | Az ovális arckép.htm | 2007-03-24 02:53 | 13K | |
![[ ]](/icons/unknown.gif) | muj.ace | 2007-03-24 02:52 | 13K | |
![[TXT]](/icons/text.gif) | elvesely.txt | 2007-03-24 02:58 | 13K | |
![[ ]](/icons/compressed.gif) | Arthur C Clarke - Bele az üstökösbe.zip | 2007-03-23 13:30 | 13K | |
![[TXT]](/icons/text.gif) | Cipóban-kenyérben sült_____.txt | 2007-03-24 02:59 | 13K | |
![[TXT]](/icons/text.gif) | asziv.htm | 2006-08-24 18:22 | 13K | |
![[ ]](/icons/compressed.gif) | maupassant_az_utod.zip | 2007-03-24 02:55 | 13K | |
![[ ]](/icons/compressed.gif) | MaupassantAzUtod.zip | 2007-02-21 16:07 | 13K | |
![[ ]](/icons/compressed.gif) | baldhead_valdemar_a_sakkisten.zip | 2007-03-24 03:00 | 13K | |
![[ ]](/icons/compressed.gif) | BaldheadASakkisten.zip | 2007-02-21 16:09 | 13K | |
![[ ]](/icons/compressed.gif) | Robert Sheckley - A Mnemon.zip | 2006-05-29 11:22 | 13K | |
![[IMG]](/icons/image2.gif) | _komplexum.j | 2007-04-15 15:22 | 13K | |
![[TXT]](/icons/text.gif) | Morella.htm | 2007-03-24 02:53 | 13K | |
![[ ]](/icons/unknown.gif) | 15.rtf | 2007-11-13 22:28 | 13K | |
![[ ]](/icons/unknown.gif) | Varga László - Emlék.rtf | 2006-06-25 07:24 | 13K | |
![[ ]](/icons/unknown.gif) | Sambucus - Álom.rtf | 2006-06-25 07:16 | 13K | |
![[ ]](/icons/compressed.gif) | clarke_arthur_c_a_melyben.zip | 2007-03-24 02:49 | 12K | |
![[TXT]](/icons/text.gif) | INDEX.HTM | 2007-03-24 02:59 | 12K | |
![[TXT]](/icons/text.gif) | 07.txt | 2007-11-13 21:46 | 12K | |
![[ ]](/icons/compressed.gif) | Ray Bradbury - Ahol sosem virrad meg.zip | 2007-03-22 16:57 | 12K | |
![[ ]](/icons/compressed.gif) | Celephais.zip | 2007-03-26 16:55 | 12K | |
![[ ]](/icons/compressed.gif) | Ray Bradbury - És ettől kezdve folyvást esett.zip | 2007-03-22 16:58 | 12K | |
![[ ]](/icons/compressed.gif) | Mobile, Frank_Új zenék temploma - sci-fi novella - html.zip | 2006-01-07 09:00 | 12K | |
![[ ]](/icons/unknown.gif) | 26.rtf | 2007-11-14 05:28 | 12K | |
![[ ]](/icons/compressed.gif) | LarionovaAtengernel.zip | 2007-02-21 15:59 | 12K | |
![[ ]](/icons/compressed.gif) | Dilov, Ljuben_Emberiség, előre - sci-fi novella - rtf.zip | 2006-01-07 09:09 | 12K | |
![[ ]](/icons/compressed.gif) | A kívülálló.zip | 2007-03-26 16:56 | 12K | |
![[ ]](/icons/unknown.gif) | Az ezüstkulcs.rar | 2007-03-24 02:55 | 12K | |
![[TXT]](/icons/text.gif) | Vámpír a szerpentinen.htm | 2007-03-24 02:52 | 12K | |
![[TXT]](/icons/text.gif) | rcsokor.txt | 2007-03-24 02:58 | 12K | |
![[ ]](/icons/compressed.gif) | Michael Moorcock - Az utolsó varázslat.zip | 2007-03-26 17:37 | 12K | |
![[ ]](/icons/compressed.gif) | Darlton, Carl - Artner, Robert_A napbomba - sci-fi novella - rtf.zip | 2006-01-07 09:09 | 12K | |
![[ ]](/icons/compressed.gif) | Orson Scott Card - Hájfarm.zip | 2007-03-26 17:51 | 12K | |
![[ ]](/icons/unknown.gif) | 35.rtf | 2007-11-14 05:30 | 12K | |
![[ ]](/icons/unknown.gif) | Zyro - A Táncos és a lelkész.rtf | 2006-06-25 07:36 | 12K | |
![[ ]](/icons/compressed.gif) | nesvadba_josef_vampir20.zip | 2006-05-10 06:23 | 12K | |
![[TXT]](/icons/text.gif) | Húsos saláták.txt | 2007-03-24 02:59 | 12K | |
![[TXT]](/icons/text.gif) | 01_02.HTM | 2007-03-24 02:55 | 12K | |
![[ ]](/icons/compressed.gif) | Csupor Béla_Kálváriák - sci-fi novella - html.zip | 2006-01-07 09:09 | 12K | |
![[ ]](/icons/compressed.gif) | Kirill Bulicsov - Oszd meg velem.zip | 2007-03-22 17:48 | 12K | |
![[TXT]](/icons/text.gif) | tudosok.txt | 2007-03-24 02:58 | 12K | |
![[ ]](/icons/unknown.gif) | 37.rtf | 2007-11-14 05:30 | 12K | |
![[ ]](/icons/compressed.gif) | Fialkowski, Konrad_A glóriás ember - sci-fi novella - rtf.zip | 2006-01-07 09:08 | 12K | |
![[ ]](/icons/compressed.gif) | Randolph Carter vallomása.zip | 2007-03-26 16:55 | 12K | |
![[ ]](/icons/compressed.gif) | hajfarm.zip | 2007-02-21 16:50 | 12K | |
![[ ]](/icons/compressed.gif) | card_orson_scott_hajfarm.zip | 2007-03-24 02:58 | 12K | |
![[TXT]](/icons/text.gif) | Az áruló szív.htm | 2007-03-24 02:53 | 12K | |
![[TXT]](/icons/text.gif) | A szavak ereje.htm | 2007-03-24 02:53 | 12K | |
![[TXT]](/icons/text.gif) | rec-abc.html | 2007-03-24 02:59 | 12K | |
![[ ]](/icons/compressed.gif) | sawaszkiewicz_jacek_a_felderito.zip | 2007-03-24 02:55 | 12K | |
![[ ]](/icons/unknown.gif) | Sztorm - Katonák.rtf | 2006-06-25 07:20 | 12K | |
![[ ]](/icons/compressed.gif) | SawaszkiewiczAfelderito.zip | 2007-02-21 16:28 | 12K | |
![[ ]](/icons/compressed.gif) | quark_mell.zip | 2007-03-24 02:49 | 12K | |
![[ ]](/icons/compressed.gif) | dick_philip_k_az_alapa.zip | 2007-03-24 02:58 | 12K | |
![[ ]](/icons/compressed.gif) | Philip K. Dick - Az álapa.zip | 2006-05-29 11:13 | 12K | |
![[ ]](/icons/compressed.gif) | Günther Krupkat - A párbaj.zip | 2007-03-26 15:39 | 12K | |
![[ ]](/icons/compressed.gif) | William Morris-Az ismeretlen templom tortenete.zip | 2007-03-24 03:01 | 12K | |
![[ ]](/icons/compressed.gif) | Ray Bradbury - A másik oldal.zip | 2007-03-22 16:56 | 12K | |
![[ ]](/icons/compressed.gif) | vasarhelyi_lajos_a_mennyiseg_bajnoka_hu_rtf_nncl3245-72av1.zip | 2007-03-24 03:01 | 12K | |
![[ ]](/icons/compressed.gif) | Az árnyék.DOC.zip | 2007-03-24 02:49 | 12K | |
![[TXT]](/icons/text.gif) | titeltun.txt | 2007-03-24 02:58 | 12K | |
![[ ]](/icons/unknown.gif) | Neil Gaiman-Goliat | 2007-03-24 02:58 | 12K | |
![[ ]](/icons/compressed.gif) | Hamvas Bela---SZUFI.zip | 2007-03-24 02:53 | 12K | |
![[TXT]](/icons/text.gif) | eletfk.txt | 2007-03-24 02:58 | 12K | |
![[ ]](/icons/compressed.gif) | John Wyndham - El szövopók, itt ne járj.zip | 2006-05-29 11:12 | 12K | |
![[ ]](/icons/unknown.gif) | Sipos Zoltán - Arthiz és a fekete seregek.rtf | 2006-06-25 07:17 | 12K | |
![[ ]](/icons/unknown.gif) | Nera - Találkozás.rtf | 2006-06-25 06:33 | 12K | |
![[ ]](/icons/compressed.gif) | aldiss_brian_w_a_vilag_minden_konnye.zip | 2007-03-24 02:52 | 12K | |
![[ ]](/icons/compressed.gif) | Brian W. Aldiss - A világ minden könnye.zip | 2006-05-29 11:00 | 12K | |
![[TXT]](/icons/text.gif) | 02_08.HTM | 2007-03-24 02:55 | 12K | |
![[ ]](/icons/compressed.gif) | aldiss_brian_w_vetelkedo.zip | 2007-03-24 02:52 | 12K | |
![[ ]](/icons/compressed.gif) | Brian W. Aldiss - Vetélkedő.zip | 2006-05-29 11:01 | 12K | |
![[ ]](/icons/compressed.gif) | gaiman_neil_goliat.zip | 2007-03-24 02:58 | 12K | |
![[ ]](/icons/compressed.gif) | Az a nagy tágas Világ.htm.zip | 2007-03-24 02:59 | 12K | |
![[ ]](/icons/unknown.gif) | 41.rtf | 2007-11-13 22:36 | 12K | |
![[ ]](/icons/compressed.gif) | aldiss_brian_w_egy_falusi_szelhamos.zip | 2007-03-24 02:52 | 12K | |
![[ ]](/icons/compressed.gif) | Brian W. Aldiss - Egy falusi szelhamos.zip | 2006-05-29 11:00 | 12K | |
![[ ]](/icons/compressed.gif) | Julio Cortazar-A jatek vege.zip | 2007-03-24 02:56 | 12K | |
![[TXT]](/icons/text.gif) | 09.HTM | 2007-03-24 02:55 | 12K | |
![[ ]](/icons/unknown.gif) | Urman Ivan-Nehany eszrevetel Bombadil Tomarol | 2007-03-24 03:00 | 12K | |
![[ ]](/icons/compressed.gif) | Szerb Antal-Szerelem a palackban.zip | 2007-03-24 03:00 | 12K | |
![[ ]](/icons/compressed.gif) | A látogató.htm.zip | 2007-03-24 02:59 | 12K | |
![[TXT]](/icons/text.gif) | A sebész.htm | 2007-03-24 02:52 | 12K | |
![[ ]](/icons/compressed.gif) | Kir Bulicsov - A választás.zip | 2007-03-22 17:47 | 12K | |
![[ ]](/icons/compressed.gif) | Dick, Philip K._Az ingázó - sci-fi novella - rtf.zip | 2006-01-07 09:09 | 12K | |
![[ ]](/icons/compressed.gif) | Brian W Aldiss - Az idő kisiklásának éjszakája.zip | 2007-03-19 17:57 | 12K | |
![[ ]](/icons/unknown.gif) | nosfi - Király Lány.rtf | 2006-06-25 06:34 | 12K | |
![[ ]](/icons/compressed.gif) | Lizzie Borden fejszét fogott.htm.zip | 2007-03-24 02:59 | 12K | |
![[ ]](/icons/unknown.gif) | Shade - Csata Kevin kocsmájában.rtf | 2006-06-25 07:17 | 12K | |
![[TXT]](/icons/text.gif) | meteokat.txt | 2007-03-24 02:58 | 12K | |
![[ ]](/icons/unknown.gif) | 32.rtf | 2007-11-14 05:30 | 12K | |
![[ ]](/icons/unknown.gif) | Michael Swanwick-Holtak | 2007-03-24 02:57 | 12K | |
![[TXT]](/icons/text.gif) | 14.HTM | 2007-03-24 02:55 | 12K | |
![[ ]](/icons/unknown.gif) | Xellos - A csaló.rtf | 2006-06-25 07:35 | 12K | |
![[TXT]](/icons/text.gif) | Hegyszoros.htm | 2007-03-24 02:52 | 12K | |
![[ ]](/icons/compressed.gif) | Ursula K Le Guin - EQ.zip | 2007-03-26 15:44 | 12K | |
![[TXT]](/icons/text.gif) | ALAP.CSS | 2007-03-24 02:59 | 12K | |
![[ ]](/icons/unknown.gif) | 24.rtf | 2007-11-14 05:28 | 12K | |
![[ ]](/icons/compressed.gif) | Bogoz, Adrian_A sztochaikus istenek oltára - sci-fi novella - rtf.zip | 2006-01-07 09:12 | 12K | |
![[TXT]](/icons/text.gif) | input.cfg | 2006-09-16 22:49 | 12K | |
![[ ]](/icons/compressed.gif) | A nagy fekete - fehér játszma.htm.zip | 2007-03-24 02:59 | 12K | |
![[TXT]](/icons/text.gif) | Az Id_ és az Istenek.htm | 2007-03-24 02:57 | 12K | |
![[ ]](/icons/compressed.gif) | Mobile, Frank_Az istenprogram - sci-fi novella - html.zip | 2006-01-07 09:00 | 12K | |
![[TXT]](/icons/text.gif) | contents.html | 2007-11-13 21:03 | 12K | |
![[TXT]](/icons/text.gif) | A béka.htm | 2007-03-24 02:52 | 12K | |
![[ ]](/icons/compressed.gif) | Arthur C Clarke - A mélyben.zip | 2007-03-23 13:30 | 12K | |
![[ ]](/icons/compressed.gif) | Robert Sheckley - Ez mind te vagy.zip | 2006-05-29 11:23 | 12K | |
![[TXT]](/icons/text.gif) | 04 - Csicsás Gábor - Büntetés.txt | 2007-03-24 02:54 | 12K | |
![[ ]](/icons/compressed.gif) | Krupkat, Günther_Látogató az Antibolygóról - sci-fi novella - html.zip | 2006-01-07 09:05 | 12K | |
![[ ]](/icons/compressed.gif) | Pohl, Frederik - Kornbluth, C. M._A gyűlés - html.zip | 2006-01-07 08:52 | 12K | |
![[ ]](/icons/compressed.gif) | Asimov világa.zip | 2007-03-22 05:08 | 12K | |
![[ ]](/icons/compressed.gif) | kisch_egon_erwin_a_tetovalt_arckep_hu_txt.zip | 2007-03-24 02:53 | 12K | |
![[TXT]](/icons/text.gif) | A nagylelk_ játékos.htm | 2007-03-24 02:52 | 12K | |
![[ ]](/icons/unknown.gif) | Joan Aiken - Krikett.rtf | 2006-07-10 20:15 | 12K | |
![[TXT]](/icons/text.gif) | darwinel.txt | 2007-03-24 02:58 | 12K | |
![[ ]](/icons/compressed.gif) | Kemény András_Emberek vagyunk - sci-fi novella - html.zip | 2006-01-07 09:05 | 12K | |
![[ ]](/icons/unknown.gif) | Neil Gaiman-Shoggoth kulonleges | 2007-03-24 02:58 | 12K | |
![[TXT]](/icons/text.gif) | 02_06.HTM | 2007-03-24 02:55 | 12K | |
![[ ]](/icons/unknown.gif) | 30.rtf | 2007-11-14 05:30 | 12K | |
![[ ]](/icons/compressed.gif) | Stephen King - A mumus.zip | 2007-03-26 15:34 | 12K | |
![[TXT]](/icons/text.gif) | szonda.htm | 2007-03-24 02:58 | 12K | |
![[ ]](/icons/compressed.gif) | A pokoli operátor naplója.zip | 2007-03-24 02:49 | 12K | |
![[ ]](/icons/compressed.gif) | Calvino, Italo_A Hold-leányok - sci-fi novella - html.zip | 2006-01-07 09:13 | 12K | |
![[TXT]](/icons/text.gif) | Polly.htm | 2007-03-24 02:58 | 12K | |
![[ ]](/icons/unknown.gif) | CIGANYSZ.ZIP | 2007-03-24 03:00 | 12K | |
![[TXT]](/icons/text.gif) | I_06.HTM | 2007-03-24 02:54 | 12K | |
![[ ]](/icons/compressed.gif) | Frederik Pohl - Gyűlés.zip | 2007-03-26 18:11 | 12K | |
![[TXT]](/icons/text.gif) | Dinnye.txt | 2007-03-24 02:59 | 12K | |
![[TXT]](/icons/text.gif) | imasegit.txt | 2007-03-24 02:58 | 12K | |
![[ ]](/icons/compressed.gif) | A. R. Major - A kivégzés.zip | 2006-05-29 10:59 | 12K | |
![[ ]](/icons/unknown.gif) | Hosi Sinicsi - Elvesztettük barátunkat.rtf | 2006-07-10 19:59 | 12K | |
![[TXT]](/icons/text.gif) | otodik.txt | 2007-03-24 02:58 | 12K | |
![[ ]](/icons/unknown.gif) | 36.rtf | 2007-11-14 05:30 | 11K | |
![[ ]](/icons/compressed.gif) | A másik oldal.htm.zip | 2007-03-24 02:59 | 11K | |
![[ ]](/icons/compressed.gif) | Andrevon, Jean-Pierre_Ide nekem a csillagokat - sci-fi novella - rtf.zip | 2006-01-07 08:58 | 11K | |
![[ ]](/icons/unknown.gif) | EGY ÜZENET KÖZÉPFÖLDÉRE.ace | 2007-03-24 03:00 | 11K | |
![[ ]](/icons/unknown.gif) | NGábor - Valami történt.rtf | 2006-06-25 06:33 | 11K | |
![[ ]](/icons/compressed.gif) | Bilenkin, Dmitrij_Az élet súlya - sci-fi novella - rtf.zip | 2006-01-07 09:07 | 11K | |
![[ ]](/icons/compressed.gif) | A Mennyország útja.htm.zip | 2007-03-24 02:59 | 11K | |
![[ ]](/icons/unknown.gif) | Urman Ivan-Trollok termeszetrajzahoz | 2007-03-24 03:00 | 11K | |
![[TXT]](/icons/text.gif) | 01_08.HTM | 2007-03-24 02:55 | 11K | |
![[TXT]](/icons/text.gif) | ufoall.txt | 2007-03-24 02:58 | 11K | |
![[ ]](/icons/compressed.gif) | Clarke, Arthur C._Nehéz a bennszülöttekkel - novella - html.zip | 2006-01-07 09:10 | 11K | |
![[ ]](/icons/unknown.gif) | Az ünnep.rar | 2007-03-24 02:55 | 11K | |
![[TXT]](/icons/text.gif) | Tölteléktöl dagad a dagadó.htm | 2007-03-24 02:59 | 11K | |
![[ ]](/icons/compressed.gif) | Robert Sheckley - Vedelem.zip | 2006-05-29 11:23 | 11K | |
![[ ]](/icons/compressed.gif) | LomerAparazitak.zip | 2007-02-21 15:59 | 11K | |
![[ ]](/icons/unknown.gif) | Wyquin - Okirathamisítás.rtf | 2006-06-25 07:35 | 11K | |
![[ ]](/icons/unknown.gif) | Uray Hunor - Színtelenül.rtf | 2006-06-25 07:23 | 11K | |
![[ ]](/icons/unknown.gif) | Karen A Szimonjan - Csak hárman térnek vissza a Földre.rtf | 2006-07-10 20:19 | 11K | |
![[ ]](/icons/unknown.gif) | Kalman Maria-Az Iferit hold.ZIP | 2007-03-24 02:56 | 11K | |
![[TXT]](/icons/text.gif) | Gin alapú koktélok.htm | 2007-03-24 02:59 | 11K | |
![[ ]](/icons/compressed.gif) | Ray Bradbury - A halál és a lányka.zip | 2007-02-21 16:47 | 11K | |
![[ ]](/icons/compressed.gif) | BradburyAhalal.zip | 2007-02-21 16:47 | 11K | |
![[ ]](/icons/compressed.gif) | moorcock_michael_az_utolso_varazslat.zip | 2007-03-24 02:57 | 11K | |
![[ ]](/icons/compressed.gif) | Dinker tava.htm.zip | 2007-03-24 02:59 | 11K | |
![[ ]](/icons/compressed.gif) | Ray Bradbury - Éjszakai telefon.zip | 2007-03-22 16:58 | 11K | |
![[TXT]](/icons/text.gif) | Erdélyben jártunk, receptet cseréltünk.htm | 2007-03-24 02:59 | 11K | |
![[ ]](/icons/compressed.gif) | Fábri Péter versei - word.zip | 2006-01-07 09:08 | 11K | |
![[ ]](/icons/compressed.gif) | clark_darlton_-_robert_artner_-_a_napbomba.zip | 2004-06-21 11:42 | 11K | |
![[ ]](/icons/compressed.gif) | Clark Darlton - Robert Artner - A napbomba.zip | 2006-05-29 11:01 | 11K | |
![[TXT]](/icons/text.gif) | semmi.htm | 2006-08-24 18:23 | 11K | |
![[ ]](/icons/compressed.gif) | Lovecraft, Howard Phillips_A más istenek - novella - html.txt.zip | 2006-01-07 09:03 | 11K | |
![[ ]](/icons/compressed.gif) | aldiss_brian_w_a_to_tulpartja.zip | 2007-03-24 02:52 | 11K | |
![[ ]](/icons/compressed.gif) | Brian W. Aldiss - A tó túlpartja.zip | 2004-06-21 11:40 | 11K | |
![[ ]](/icons/compressed.gif) | aldiss_brian_w_urbanisztika.zip | 2007-03-24 02:52 | 11K | |
![[ ]](/icons/compressed.gif) | Brian W. Aldiss - Urbanisztika.zip | 2006-05-29 11:01 | 11K | |
![[ ]](/icons/unknown.gif) | Zalka Csenge - Szellem a palackban.rtf | 2006-06-25 07:35 | 11K | |
![[ ]](/icons/unknown.gif) | Sterr J E - Utolsó este.rtf | 2006-06-25 07:18 | 11K | |
![[TXT]](/icons/text.gif) | IV_03.HTM | 2007-03-24 02:54 | 11K | |
![[ ]](/icons/unknown.gif) | Wyquin - Emlék.rtf | 2006-06-25 07:35 | 11K | |
![[ ]](/icons/compressed.gif) | dick_philip_k_az_ingazo.zip | 2007-03-24 02:58 | 11K | |
![[ ]](/icons/compressed.gif) | Philip K. Dick - Az ingázó.zip | 2006-05-29 11:13 | 11K | |
![[ ]](/icons/compressed.gif) | Philip K Dick - Az ingázó.zip | 2007-03-23 21:40 | 11K | |
![[TXT]](/icons/text.gif) | 15.TXT | 2007-11-13 21:46 | 11K | |
![[ ]](/icons/unknown.gif) | Ő.rar | 2007-03-24 02:55 | 11K | |
![[ ]](/icons/compressed.gif) | Kálmán Mária_Iferit - sci-fi novella - html.zip | 2006-01-07 09:04 | 11K | |
![[ ]](/icons/unknown.gif) | Evelyn E Smith - A jó férj.rtf | 2006-07-10 19:43 | 11K | |
![[ ]](/icons/unknown.gif) | Az álom fala mögött.rar | 2007-03-24 02:55 | 11K | |
![[ ]](/icons/compressed.gif) | Major, A. R._A kivégzés - sci-fi novella - html.zip | 2006-01-07 09:01 | 11K | |
![[TXT]](/icons/text.gif) | tucsalok.txt | 2007-03-24 02:58 | 11K | |
![[TXT]](/icons/text.gif) | Bombadil2.htm | 2007-03-24 02:54 | 11K | |
![[ ]](/icons/compressed.gif) | Lovecraft, Howard Philips_A Hold-láp - novella - rtf.zip | 2006-01-07 09:03 | 11K | |
![[ ]](/icons/compressed.gif) | Terry Prachett - Az éj korongjai.zip | 2007-03-26 18:20 | 11K | |
![[ ]](/icons/compressed.gif) | Dmitrij Alekszandrovics Bilenkin - Az élet súlya.zip | 2007-03-21 19:26 | 11K | |
![[ ]](/icons/unknown.gif) | Roger Zelazny - S egyedül magam.rtf | 2006-07-10 20:47 | 11K | |
![[ ]](/icons/unknown.gif) | Zalka Csenge - A fűz és a folyó.rtf | 2006-06-25 07:35 | 11K | |
![[ ]](/icons/compressed.gif) | Avram Davidson - Ha a tengerek minden osztrigája.zip | 2007-03-23 21:40 | 11K | |
![[ ]](/icons/compressed.gif) | Fa-Hien[Fa-hszien]utazasa.zip | 2007-03-24 02:54 | 11K | |
![[ ]](/icons/compressed.gif) | Ilja Varsavszkij - Utazás Penfieldbe.zip | 2007-03-26 19:37 | 11K | |
![[TXT]](/icons/text.gif) | 01_04.HTM | 2007-03-24 02:55 | 11K | |
![[ ]](/icons/compressed.gif) | Ray Bradbury - Az űrhajós.zip | 2007-03-22 16:58 | 11K | |
![[ ]](/icons/compressed.gif) | Stephen Leacock-Hinarba aztatva.zip | 2007-03-24 03:00 | 11K | |
![[ ]](/icons/compressed.gif) | Ray Bradbury - Gyümölcsök a tál alján.zip | 2007-03-22 16:59 | 11K | |
![[TXT]](/icons/text.gif) | Kolbászok.txt | 2007-03-24 02:59 | 11K | |
![[ ]](/icons/compressed.gif) | Brown, Fredric_És akkor kopogtak - sci-fi novella - rtf.zip | 2006-01-07 09:06 | 11K | |
![[ ]](/icons/compressed.gif) | Bóza Kornél_Két napló - sci-fi novella - html.zip | 2006-01-07 09:04 | 11K | |
![[ ]](/icons/compressed.gif) | Pandolfi, Massimo_A Fehér tenger - sci-fi novella - rtf.zip | 2006-01-07 08:56 | 11K | |
![[ ]](/icons/compressed.gif) | Ray Bradbury - Az ember.zip | 2007-03-22 16:57 | 11K | |
![[ ]](/icons/unknown.gif) | TimeRobber - A galamb.rtf | 2006-06-25 07:21 | 11K | |
![[ ]](/icons/unknown.gif) | Walt Sheldon - A vadászok.rtf | 2006-06-25 07:33 | 11K | |
![[ ]](/icons/compressed.gif) | Robert Sheckley - A csapda.zip | 2006-05-29 11:22 | 11K | |
![[ ]](/icons/compressed.gif) | Csupor Béla_Su - sci-fi novella - html.zip | 2006-01-07 09:09 | 11K | |
![[ ]](/icons/compressed.gif) | Bulicsov, Kir_A Hótündér - sci-fi novella - html.zip | 2006-01-07 09:05 | 11K | |
![[ ]](/icons/compressed.gif) | A más istenek.zip | 2007-03-26 16:54 | 11K | |
![[ ]](/icons/unknown.gif) | Zyro - Kártyavár.rtf | 2006-06-25 07:36 | 11K | |
![[TXT]](/icons/text.gif) | 02_11.HTM | 2007-03-24 02:55 | 11K | |
![[TXT]](/icons/text.gif) | Tavaszok.htm | 2007-03-24 02:52 | 11K | |
![[ ]](/icons/compressed.gif) | Carleton, William_Sokkoppantói legenda - sci-fi novella - html.zip | 2006-01-07 09:10 | 11K | |
![[ ]](/icons/compressed.gif) | És ett_l kezdve folyvást esett.htm.zip | 2007-03-24 02:59 | 11K | |
![[ ]](/icons/unknown.gif) | hotunder.ace | 2007-03-24 02:52 | 11K | |
![[ ]](/icons/unknown.gif) | 19.rtf | 2007-11-13 22:28 | 11K | |
![[ ]](/icons/compressed.gif) | Ray Bradbury - A villanytelep.zip | 2007-03-22 16:57 | 11K | |
![[ ]](/icons/unknown.gif) | Frank Mobile-A Magus.ZIP | 2007-03-24 02:54 | 11K | |
![[ ]](/icons/unknown.gif) | H. P. Lovecraft - A kép a házban.rar | 2007-03-24 02:55 | 11K | |
![[ ]](/icons/unknown.gif) | Arthur Feldman - A matematikusok.rtf | 2006-07-10 19:28 | 11K | |
![[ ]](/icons/compressed.gif) | Fritz Leiber - A nagy ünnep.zip | 2007-03-26 16:28 | 11K | |
![[ ]](/icons/compressed.gif) | Éjszakai telefon.htm.zip | 2007-03-24 02:59 | 11K | |
![[ ]](/icons/unknown.gif) | Alekszandr Gorbovszkij - A véletlen.rtf | 2006-07-10 19:26 | 11K | |
![[ ]](/icons/compressed.gif) | Thomas Mann-A ruhasszekreny.zip | 2007-03-24 03:00 | 11K | |
![[TXT]](/icons/text.gif) | anna.htm | 2006-08-24 18:22 | 11K | |
![[ ]](/icons/compressed.gif) | Az _rhajó.htm.zip | 2007-03-24 02:59 | 11K | |
![[ ]](/icons/compressed.gif) | Karádi Kázmér_A pszichodonor - sci-fi novella - html.txt.zip | 2006-01-07 09:05 | 11K | |
![[ ]](/icons/compressed.gif) | William Carleton-Sokkoppantoi legenda.zip | 2007-03-24 03:01 | 11K | |
![[ ]](/icons/unknown.gif) | Carlos Cabada - Nem tudott olvasni.rtf | 2006-07-10 19:34 | 11K | |
![[IMG]](/icons/image2.gif) | graf3.gif | 2007-11-13 22:08 | 11K | |
![[ ]](/icons/compressed.gif) | gaiman_neil_matrix.zip | 2007-03-24 02:58 | 11K | |
![[ ]](/icons/unknown.gif) | A sír.rar | 2007-03-24 02:55 | 11K | |
![[ ]](/icons/unknown.gif) | 06.rtf | 2007-11-13 22:28 | 11K | |
![[TXT]](/icons/text.gif) | 02_07.HTM | 2007-03-24 02:55 | 11K | |
![[ ]](/icons/unknown.gif) | Sztorm - Átokföldje meséi - Valami nyugaton (Fallout).rtf | 2006-06-25 07:20 | 11K | |
![[TXT]](/icons/text.gif) | Fozelék.txt | 2007-03-24 02:59 | 11K | |
![[TXT]](/icons/text.gif) | Főzelék.txt | 2007-03-24 02:59 | 11K | |
![[ ]](/icons/compressed.gif) | A b_vészbolt.htm.zip | 2007-03-24 02:55 | 11K | |
![[ ]](/icons/unknown.gif) | 31.rtf | 2007-11-14 05:30 | 11K | |
![[ ]](/icons/unknown.gif) | napford.ace | 2007-03-24 02:52 | 11K | |
![[ ]](/icons/compressed.gif) | buzzati_dino_a_cseszealj_leszallt.zip | 2007-03-24 02:52 | 11K | |
![[ ]](/icons/compressed.gif) | BuzzatiAcseszealj.zip | 2007-02-21 16:47 | 11K | |
![[ ]](/icons/unknown.gif) | McChickenR.doc | 2007-03-24 02:59 | 11K | |
![[ ]](/icons/unknown.gif) | French Fries.doc | 2007-03-24 02:59 | 11K | |
![[ ]](/icons/unknown.gif) | Egg McMuffinR.doc | 2007-03-24 02:59 | 11K | |
![[ ]](/icons/unknown.gif) | Chicken McNuggetsR.doc | 2007-03-24 02:59 | 11K | |
![[ ]](/icons/unknown.gif) | Chicken Fajitas.doc | 2007-03-24 02:59 | 11K | |
![[ ]](/icons/unknown.gif) | Szajkó - Valóság.rtf | 2006-06-25 07:19 | 10K | |
![[ ]](/icons/compressed.gif) | donald_westlake_-_győzelem.zip | 2004-06-21 11:42 | 10K | |
![[TXT]](/icons/text.gif) | 03_06.HTM | 2007-03-24 02:55 | 10K | |
![[ ]](/icons/compressed.gif) | Az ember.htm.zip | 2007-03-24 02:59 | 10K | |
![[TXT]](/icons/text.gif) | Déligyümölcs-bólé.htm | 2007-03-24 02:59 | 10K | |
![[TXT]](/icons/text.gif) | vendetta.htm | 2006-08-24 18:24 | 10K | |
![[ ]](/icons/unknown.gif) | SunDown - A kősivatag.rtf | 2006-06-25 07:18 | 10K | |
![[ ]](/icons/unknown.gif) | 21.rtf | 2007-11-14 05:28 | 10K | |
![[TXT]](/icons/text.gif) | 05.txt | 2007-11-13 21:46 | 10K | |
![[ ]](/icons/unknown.gif) | Roger Zelazny - Nem a hírnök a bűnös.rtf | 2006-07-10 20:47 | 10K | |
![[ ]](/icons/compressed.gif) | orwell_george_w_b_yeats_hu_rtf.zip | 2007-03-24 02:54 | 10K | |
![[ ]](/icons/compressed.gif) | aldiss_brian_w_az_arenaban.zip | 2007-03-24 02:52 | 10K | |
![[ ]](/icons/compressed.gif) | Brian W. Aldiss - Az arenaban.zip | 2006-05-29 11:00 | 10K | |
![[ ]](/icons/compressed.gif) | Bulicsov, Kir_A választás - sci-fi novella - html.zip | 2006-01-07 09:05 | 10K | |
![[ ]](/icons/compressed.gif) | Rossz hír.htm.zip | 2007-03-24 02:59 | 10K | |
![[ ]](/icons/compressed.gif) | Frederic Brown - És akkor kopogtak.zip | 2007-03-22 17:43 | 10K | |
![[IMG]](/icons/image2.gif) | Dungeon_felso_szint.gif | 2007-04-15 15:44 | 10K | |
![[TXT]](/icons/text.gif) | Rum alapú italok.htm | 2007-03-24 02:59 | 10K | |
![[ ]](/icons/unknown.gif) | San - Tüzes szekér.rtf | 2006-06-25 07:16 | 10K | |
![[TXT]](/icons/text.gif) | Mesék, amelyek rosszul végz_dnek.htm | 2007-03-24 02:52 | 10K | |
![[TXT]](/icons/text.gif) | 01.txt | 2007-11-13 21:54 | 10K | |
![[ ]](/icons/compressed.gif) | agoston_gabor_rabnok_agyasok_szultanak.zip | 2007-03-24 02:49 | 10K | |
![[ ]](/icons/compressed.gif) | Robert Sheckley - Hutocso katasztrofa.zip | 2006-05-29 11:23 | 10K | |
![[TXT]](/icons/text.gif) | A fekete csönd.htm | 2007-03-24 02:52 | 10K | |
![[ ]](/icons/compressed.gif) | Robert Sheckley - Világok boltja.zip | 2007-03-26 18:49 | 10K | |
![[ ]](/icons/compressed.gif) | Ray Bradbury - Nulla óra.zip | 2007-03-22 17:00 | 10K | |
![[TXT]](/icons/text.gif) | 02_02.HTM | 2007-03-24 02:55 | 10K | |
![[ ]](/icons/unknown.gif) | Pampalini - Nem mind arany.rtf | 2006-06-25 06:36 | 10K | |
![[TXT]](/icons/text.gif) | novella10.htm | 2007-03-24 03:01 | 10K | |
![[TXT]](/icons/text.gif) | japatlan.txt | 2007-03-24 02:58 | 10K | |
![[TXT]](/icons/text.gif) | 01_07.HTM | 2007-03-24 02:55 | 10K | |
![[ ]](/icons/unknown.gif) | Arthur Jermyn.rar | 2007-03-24 02:55 | 10K | |
![[ ]](/icons/compressed.gif) | Ray Bradbury - Az űrhajó.zip | 2007-03-22 16:58 | 10K | |
![[ ]](/icons/compressed.gif) | Richard Clayton különös repülése.htm.zip | 2007-03-24 02:59 | 10K | |
![[ ]](/icons/compressed.gif) | John Wyndham - Különös.zip | 2007-03-26 19:55 | 10K | |
![[ ]](/icons/compressed.gif) | ShawElfekvo.zip | 2007-02-21 16:38 | 10K | |
![[ ]](/icons/compressed.gif) | kisch_egon_erwin_tetovalasaim_hu_txt.zip | 2007-03-24 02:53 | 10K | |
![[ ]](/icons/compressed.gif) | Nesvadba, Josef_Az utolsó ítélet angyala -sci-fi novella - rtf.zip | 2006-01-07 08:57 | 10K | |
![[ ]](/icons/compressed.gif) | mihanovszkij_volodimir_az_utolso_zseton.zip | 2007-03-24 03:01 | 10K | |
![[ ]](/icons/compressed.gif) | MihanovszkijAzutolso.zip | 2007-02-21 16:12 | 10K | |
![[TXT]](/icons/text.gif) | 01_01.HTM | 2007-03-24 02:55 | 10K | |
![[ ]](/icons/compressed.gif) | Angela Carter-Farkasok tarsasaga.zip | 2007-03-24 02:49 | 10K | |
![[ ]](/icons/compressed.gif) | Herbert W. Franke - A koordinator asszony.zip | 2006-05-29 11:03 | 10K | |
![[ ]](/icons/compressed.gif) | orwell_george_wells_hitler_es_a_vilagallam_hu_rtf.zip | 2007-03-24 02:54 | 10K | |
![[ ]](/icons/compressed.gif) | Robert Sheckley - Hideg, meleg.zip | 2006-05-29 11:23 | 10K | |
![[ ]](/icons/compressed.gif) | Herbert W. Franke - Ne becsuld le az ellenseged!.zip | 2006-05-29 11:08 | 10K | |
![[TXT]](/icons/text.gif) | 02.TXT | 2007-11-13 21:46 | 10K | |
![[ ]](/icons/unknown.gif) | ARAB_KOLTOK.versei | 2007-03-24 02:55 | 10K | |
![[ ]](/icons/compressed.gif) | aldiss_brian_w_kek_fellab.zip | 2007-03-24 02:52 | 10K | |
![[ ]](/icons/compressed.gif) | Brian W. Aldiss - Kek félláb.zip | 2006-05-29 11:00 | 10K | |
![[ ]](/icons/compressed.gif) | Gyümölcsök a tál alján.htm.zip | 2007-03-24 02:59 | 10K | |
![[ ]](/icons/unknown.gif) | H. P. Lovecraft - A különös, magas ház a ködben.rar | 2007-03-24 02:55 | 10K | |
![[ ]](/icons/compressed.gif) | egy ember délről.zip | 2007-03-24 02:59 | 10K | |
![[IMG]](/icons/image2.gif) | HATTER.GIF | 2007-03-24 03:01 | 10K | |
![[ ]](/icons/unknown.gif) | H. P. Lovecraft - Erich Zann muzsikája.rar | 2007-03-24 02:55 | 10K | |
![[TXT]](/icons/text.gif) | 02_05.HTM | 2007-03-24 02:55 | 10K | |
![[ ]](/icons/unknown.gif) | Sarics - Ami nem öl meg erősebbé tesz.rtf | 2006-06-25 07:16 | 10K | |
![[ ]](/icons/unknown.gif) | 27.rtf | 2007-11-14 05:28 | 10K | |
![[ ]](/icons/compressed.gif) | A sólyom-foki halász.zip | 2007-03-26 16:55 | 10K | |
![[ ]](/icons/compressed.gif) | Shaw, Bob_Régmúlt napok fénye - sci-fi novella - rtf.zip | 2006-01-07 08:53 | 10K | |
![[TXT]](/icons/text.gif) | Kékszakáll.htm | 2007-03-24 02:56 | 10K | |
![[ ]](/icons/compressed.gif) | niven_larry_szexi_beszelgetes_hu_txt.zip | 2007-03-24 02:58 | 10K | |
![[ ]](/icons/unknown.gif) | Breakfast Burrito.doc | 2007-03-24 02:59 | 10K | |
![[ ]](/icons/unknown.gif) | Big X-traR.doc | 2007-03-24 02:59 | 10K | |
![[ ]](/icons/unknown.gif) | Arch DeluxeR.doc | 2007-03-24 02:59 | 10K | |
![[ ]](/icons/compressed.gif) | aldiss_brian_w_minden_idoke_o.zip | 2007-03-24 02:52 | 10K | |
![[ ]](/icons/compressed.gif) | Brian W. Aldiss - Minden időké ő.zip | 2006-05-29 11:00 | 10K | |
![[ ]](/icons/compressed.gif) | cholnoky_viktor_a_kover_ember_hu_rtf_nncl3005-704v1.zip | 2007-03-24 02:52 | 10K | |
![[ ]](/icons/compressed.gif) | brown_fredric_es_akkor_kopogtak.zip | 2007-03-24 02:54 | 10K | |
![[TXT]](/icons/text.gif) | Gyors ételek.htm | 2007-03-24 02:59 | 10K | |
![[ ]](/icons/compressed.gif) | clarke_arthur_c_a_zold_ujjak.zip | 2007-03-24 02:49 | 10K | |
![[ ]](/icons/compressed.gif) | ClarkeAzoldujjak.zip | 2007-02-21 16:47 | 10K | |
![[ ]](/icons/unknown.gif) | Povi - Kórterem.rtf | 2006-06-25 06:39 | 10K | |
![[ ]](/icons/compressed.gif) | Vonnegut, Kurt_Harrison Bergeron - sci-fi novella - rtf.zip | 2006-01-07 08:43 | 10K | |
![[ ]](/icons/compressed.gif) | A villanytelep.htm.zip | 2007-03-24 02:59 | 9.9K | |
![[ ]](/icons/compressed.gif) | Graham Greene-A hazajaro Josephine.zip | 2007-03-24 02:55 | 9.9K | |
![[TXT]](/icons/text.gif) | NOVELLA4.HTM | 2007-03-24 03:01 | 9.9K | |
![[ ]](/icons/compressed.gif) | Neale Donald Walsch-Beszelgetesek Istennel.zip | 2007-03-24 02:58 | 9.9K | |
![[ ]](/icons/unknown.gif) | Sambucus - Vidra.rtf | 2006-06-25 07:16 | 9.9K | |
![[ ]](/icons/compressed.gif) | Ahol sosem virrad meg.htm.zip | 2007-03-24 02:59 | 9.9K | |
![[ ]](/icons/compressed.gif) | VandeVetNagyapo.zip | 2007-02-21 16:18 | 9.9K | |
![[TXT]](/icons/text.gif) | 03_05.HTM | 2007-03-24 02:55 | 9.9K | |
![[ ]](/icons/compressed.gif) | Nulla óra.htm.zip | 2007-03-24 02:59 | 9.8K | |
![[TXT]](/icons/text.gif) | embrhold.txt | 2007-03-24 02:58 | 9.8K | |
![[ ]](/icons/compressed.gif) | Brown, Fredric_Harmagedón - sci-fi novella - rtf.zip | 2006-01-07 09:06 | 9.8K | |
![[TXT]](/icons/text.gif) | 02_09.HTM | 2007-03-24 02:55 | 9.8K | |
![[ ]](/icons/compressed.gif) | Polaris.zip | 2007-03-26 16:55 | 9.8K | |
![[ ]](/icons/unknown.gif) | Vinkovics Judit - Kalmük receptek.rar | 2007-03-24 02:59 | 9.8K | |
![[ ]](/icons/compressed.gif) | Krampusz Károly.htm.zip | 2007-03-24 02:59 | 9.8K | |
![[ ]](/icons/compressed.gif) | KozinyecPenteken.zip | 2007-02-21 15:59 | 9.8K | |
![[ ]](/icons/compressed.gif) | Méreg.htm.zip | 2007-03-24 02:59 | 9.8K | |
![[ ]](/icons/compressed.gif) | Ray Bradbury - Az eperszínű ablakszem.zip | 2007-03-22 16:57 | 9.8K | |
![[ ]](/icons/unknown.gif) | Aldo A Rinaldi - Az idegenek.rtf | 2006-07-10 19:26 | 9.8K | |
![[ ]](/icons/compressed.gif) | Ray Bradbury - Tengerpart alkonyatkor.zip | 2007-03-22 17:00 | 9.8K | |
![[ ]](/icons/unknown.gif) | H. P. Lovecraft - A kutya.rar | 2007-03-24 02:55 | 9.7K | |
![[ ]](/icons/compressed.gif) | Simak, Clifford D._Sétálni egy város utcáin - sci-fi novella - rtf.zip | 2006-01-07 08:53 | 9.7K | |
![[ ]](/icons/compressed.gif) | Maruzs Éva_Lőj már - sci-fi novella - html.zip | 2006-01-07 09:01 | 9.7K | |
![[ ]](/icons/compressed.gif) | Lovecraft, Howard Phillips_A különös magas ház a ködben - novella - txt.zip | 2006-01-07 09:03 | 9.7K | |
![[TXT]](/icons/text.gif) | A koldus és a gyémánt.htm | 2007-03-24 03:00 | 9.7K | |
![[ ]](/icons/compressed.gif) | E.A.Poe - Bice-béka (Hop-frog).zip | 2006-05-29 11:01 | 9.7K | |
![[ ]](/icons/compressed.gif) | Ray Bradbury - Áprilisi Boszorkány.zip | 2007-03-22 16:57 | 9.7K | |
![[ ]](/icons/compressed.gif) | coppel_alfred_az_almodozo.zip | 2007-03-24 02:49 | 9.7K | |
![[ ]](/icons/compressed.gif) | CoppelAzalmodozo.zip | 2007-02-21 16:05 | 9.7K | |
![[ ]](/icons/compressed.gif) | Ray Bradbury - Az ismeretlen felé.zip | 2007-03-22 16:57 | 9.7K | |
![[ ]](/icons/compressed.gif) | vonnegut_kurt_az_itt_a_kerdes_hu_rtf.zip | 2007-03-24 02:57 | 9.7K | |
![[TXT]](/icons/text.gif) | tartosito.htm | 2007-03-24 02:59 | 9.7K | |
![[TXT]](/icons/text.gif) | Eltevések - Egres.txt | 2007-03-24 02:59 | 9.7K | |
![[ ]](/icons/compressed.gif) | Brendel Mátyás_Csoda - sci-fi novella - html.zip | 2006-01-07 09:08 | 9.7K | |
![[ ]](/icons/compressed.gif) | Mihaleczky Péter_Mella és én - sci-fi novella - html.zip | 2006-01-07 09:00 | 9.6K | |
![[ ]](/icons/compressed.gif) | A nagy ünnep.htm.zip | 2007-03-24 02:54 | 9.6K | |
![[ ]](/icons/compressed.gif) | Herbert W. Franke - Az utolso programozo.zip | 2006-05-29 11:04 | 9.6K | |
![[ ]](/icons/compressed.gif) | Ray Bradbury - A tömeg.zip | 2007-03-22 16:57 | 9.6K | |
![[ ]](/icons/compressed.gif) | bradbury_ray_varosok_a_holdon_hu_txt.zip | 2007-03-24 02:59 | 9.6K | |
![[ ]](/icons/compressed.gif) | Ray Bradbury - Varosok a holdon hu txt.zip | 2007-02-21 16:47 | 9.6K | |
![[TXT]](/icons/text.gif) | 02_03.HTM | 2007-03-24 02:55 | 9.6K | |
![[ ]](/icons/unknown.gif) | poe_bb.ace | 2007-03-24 02:52 | 9.6K | |
![[ ]](/icons/compressed.gif) | Szilard leo-Mark Gable.zip | 2007-03-24 03:00 | 9.6K | |
![[ ]](/icons/compressed.gif) | Damon Knight - Embert szolgálni.zip | 2007-03-26 15:36 | 9.6K | |
![[ ]](/icons/compressed.gif) | ward_kevin_pici_szivek_titka_hu_rtf.zip | 2007-03-24 02:56 | 9.6K | |
![[ ]](/icons/compressed.gif) | Clarke, Arthur C._Isten kilencmilliárd neve - novella - word.zip | 2006-01-07 09:10 | 9.5K | |
![[ ]](/icons/compressed.gif) | Ray Bradbury - Kaleidoszkóp.zip | 2007-03-22 16:59 | 9.5K | |
![[ ]](/icons/compressed.gif) | cholnoky_viktor_taddeusz_lovag_vacsoraja_hu_rtf_nncl3007-704v1.zip | 2007-03-24 02:52 | 9.5K | |
![[TXT]](/icons/text.gif) | Alma 2_ Barack 1 befőttek.txt | 2007-03-24 02:59 | 9.5K | |
![[ ]](/icons/compressed.gif) | Terry Prachett - Éjkorongjai.zip | 2007-03-26 20:00 | 9.5K | |
![[TXT]](/icons/text.gif) | Császár receptek.txt | 2007-03-24 02:59 | 9.5K | |
![[ ]](/icons/compressed.gif) | Lovecraft, Howard Phillips_Polaris - novella - html.txt.zip | 2006-01-07 09:03 | 9.5K | |
![[TXT]](/icons/text.gif) | uzenszel.txt | 2007-03-24 02:58 | 9.4K | |
![[ ]](/icons/compressed.gif) | Pohl, Frederik_A népszámlálók - sci-fi novella - rtf.zip | 2006-01-07 08:55 | 9.4K | |
![[ ]](/icons/compressed.gif) | Ray Bradbury - A gyilkos.zip | 2007-03-22 16:55 | 9.4K | |
![[ ]](/icons/compressed.gif) | Ray Bradbury - A pusztító.zip | 2007-03-22 16:56 | 9.4K | |
![[TXT]](/icons/text.gif) | 04.HTM | 2007-03-24 02:55 | 9.4K | |
![[IMG]](/icons/image2.gif) | ELFMAN.JPG | 2007-03-24 02:58 | 9.4K | |
![[IMG]](/icons/image2.gif) | korakasmap1.gif | 2007-04-15 16:35 | 9.4K | |
![[ ]](/icons/compressed.gif) | Pohl, Frederik_Millió Nap - sci-fi novella - rtf.zip | 2006-01-07 08:55 | 9.4K | |
![[TXT]](/icons/text.gif) | 01_03.HTM | 2007-03-24 02:55 | 9.4K | |
![[ ]](/icons/compressed.gif) | Kurt Vonnegut - Harrison Bergeron.zip | 2004-06-21 11:41 | 9.3K | |
![[TXT]](/icons/text.gif) | konnyu.htm | 2006-08-24 18:23 | 9.3K | |
![[TXT]](/icons/text.gif) | 06.txt | 2007-11-13 21:46 | 9.3K | |
![[ ]](/icons/unknown.gif) | A kép a házban.rar | 2007-03-24 02:55 | 9.3K | |
![[ ]](/icons/compressed.gif) | Lovecraft, Howard Philips_A kívülálló - novella - rtf.zip | 2006-01-07 09:03 | 9.3K | |
![[ ]](/icons/unknown.gif) | a.class | 2007-03-24 02:54 | 9.3K | |
![[ ]](/icons/compressed.gif) | Ernest Hemingway-A halottak termeszetrajza.zip | 2007-03-24 02:53 | 9.3K | |
![[TXT]](/icons/text.gif) | NOVELLA3.HTM | 2007-03-24 03:01 | 9.3K | |
![[TXT]](/icons/text.gif) | Bombadil.htm | 2007-03-24 02:54 | 9.3K | |
![[ ]](/icons/compressed.gif) | Hidy Mátyás_Noé - sci-fi novella - html.zip | 2006-01-07 09:06 | 9.3K | |
![[ ]](/icons/compressed.gif) | Tengerpart alkonyatkor.htm.zip | 2007-03-24 02:59 | 9.3K | |
![[ ]](/icons/compressed.gif) | Herbert W. Franke - Az oregek lazadasa.zip | 2006-05-29 11:04 | 9.3K | |
![[ ]](/icons/compressed.gif) | Robert Sheckley - A szörnyetegek.zip | 2006-05-29 11:22 | 9.3K | |
![[ ]](/icons/compressed.gif) | Mihaleczky Péter_Találkozás - sci-fi novella - html.zip | 2006-01-07 09:00 | 9.3K | |
![[ ]](/icons/unknown.gif) | P G Thomas - Hátrányos helyzet.rtf | 2006-06-25 06:35 | 9.2K | |
![[ ]](/icons/compressed.gif) | Áprilisi boszorkány.htm.zip | 2007-03-24 02:59 | 9.2K | |
![[TXT]](/icons/text.gif) | ebolaj.htm | 2006-08-24 18:22 | 9.2K | |
![[ ]](/icons/compressed.gif) | Az eperszín_ ablakszem.htm.zip | 2007-03-24 02:59 | 9.2K | |
![[ ]](/icons/unknown.gif) | Peter Cartur - A köd.rtf | 2006-06-25 06:36 | 9.2K | |
![[ ]](/icons/compressed.gif) | Robert Sheckley - Fold, levego, tuz es viz.zip | 2006-05-29 11:23 | 9.2K | |
![[TXT]](/icons/text.gif) | Green Widow (Zöld Özvegy).htm | 2007-03-24 02:59 | 9.2K | |
![[ ]](/icons/compressed.gif) | Ray Bradbury - Einar bácsi.zip | 2007-03-22 16:58 | 9.2K | |
![[ ]](/icons/unknown.gif) | A különös,magas ház a ködben.rar | 2007-03-24 02:55 | 9.2K | |
![[ ]](/icons/compressed.gif) | Clifford D Simak - Sétálni egy város utcáin.zip | 2007-03-26 18:54 | 9.2K | |
![[ ]](/icons/compressed.gif) | Fredrik Brown és Mack Reynolds - Füles meg én meg a Mars-lakók.zip | 2007-03-22 17:44 | 9.2K | |
![[ ]](/icons/compressed.gif) | Weores Sandor-Holdaskönyv.zip | 2007-03-24 02:55 | 9.2K | |
![[ ]](/icons/compressed.gif) | Az ismeretlen felé.htm.zip | 2007-03-24 02:59 | 9.2K | |
![[ ]](/icons/compressed.gif) | Graham Greene-A hidon tull.zip | 2007-03-24 02:55 | 9.2K | |
![[ ]](/icons/compressed.gif) | Mobile, Frank_Robbantások - sci-fi novella - html.zip | 2006-01-07 09:00 | 9.2K | |
![[ ]](/icons/unknown.gif) | Tóth-Czifra András - Egy kis hiba.rtf | 2006-06-25 07:23 | 9.2K | |
![[TXT]](/icons/text.gif) | Krampampuli bólé.htm | 2007-03-24 02:59 | 9.2K | |
![[ ]](/icons/compressed.gif) | Dmitrij Alekszandrovics Bilenkin - Tilalom.zip | 2007-03-21 19:26 | 9.1K | |
![[ ]](/icons/compressed.gif) | Iványosi Szabó Gábor_Érzelem - sci-fi novella - html.zip | 2006-01-07 09:05 | 9.1K | |
![[ ]](/icons/compressed.gif) | Frederic Brown és M Reynolds - Füles meg én meg a Mars-lakók.zip | 2007-03-22 17:44 | 9.1K | |
![[ ]](/icons/compressed.gif) | Ray Bradbury - Rozsda.zip | 2007-02-21 16:47 | 9.1K | |
![[ ]](/icons/compressed.gif) | BradburyRozsda.zip | 2007-02-21 16:47 | 9.1K | |
![[TXT]](/icons/text.gif) | Tarajos sertéskaraj.txt | 2007-03-24 02:59 | 9.1K | |
![[ ]](/icons/compressed.gif) | Chretien De Troyes-Az oroszlan lovag.zip | 2007-03-24 02:52 | 9.1K | |
![[ ]](/icons/compressed.gif) | Csupor Béla_Szemét dolgok - sci-fi novella - html.zip | 2006-01-07 09:09 | 9.1K | |
![[ ]](/icons/compressed.gif) | Knight, Damon_Embert szolgálni - html.zip | 2006-01-07 08:52 | 9.1K | |
![[ ]](/icons/unknown.gif) | Preacher - Csata után.rtf | 2006-06-25 06:39 | 9.1K | |
![[ ]](/icons/compressed.gif) | A ködkürt.htm.zip | 2007-03-24 02:59 | 9.1K | |
![[TXT]](/icons/text.gif) | feltalal.txt | 2007-03-24 02:58 | 9.1K | |
![[TXT]](/icons/text.gif) | MAIN.HTM | 2007-03-24 02:59 | 9.1K | |
![[ ]](/icons/compressed.gif) | Ambrose Bierce - Legkedvesebb gyilkosságom.zip | 2006-05-29 10:59 | 9.1K | |
![[ ]](/icons/compressed.gif) | Robert Sheckley - A potyautas.zip | 2006-05-29 11:22 | 9.1K | |
![[ ]](/icons/unknown.gif) | Hideg levegő.rar | 2007-03-24 02:55 | 9.1K | |
![[ ]](/icons/unknown.gif) | Totius - Nem is emlékszem.rtf | 2006-06-25 07:22 | 9.0K | |
![[ ]](/icons/compressed.gif) | Arthur C Clarke - Isten kilencmilliárd neve.zip | 2007-03-23 13:30 | 9.0K | |
![[TXT]](/icons/text.gif) | 07.HTM | 2007-03-24 02:55 | 9.0K | |
![[ ]](/icons/compressed.gif) | Herbert W. Franke - Ketezer ev elteltevel.zip | 2006-05-29 11:08 | 9.0K | |
![[ ]](/icons/compressed.gif) | aldiss_brian_w_a_szuperjatekok_kitartanak_egy_nyarat.zip | 2007-03-24 02:52 | 9.0K | |
![[ ]](/icons/compressed.gif) | Brian W. Aldiss - A szuperjatekok kitartanak egy nyarat.zip | 2006-05-29 11:00 | 9.0K | |
![[ ]](/icons/compressed.gif) | Brown, Fredric_A tükörterem - sci-fi novella - rtf.zip | 2006-01-07 09:06 | 9.0K | |
![[ ]](/icons/unknown.gif) | Stöki - Lenn délen édes éjen.rtf | 2006-06-25 07:18 | 9.0K | |
![[ ]](/icons/unknown.gif) | Nyitrai Antal - Mindegy.rtf | 2006-06-25 06:34 | 9.0K | |
![[ ]](/icons/compressed.gif) | Egy ember délr_l.htm.zip | 2007-03-24 02:59 | 9.0K | |
![[ ]](/icons/compressed.gif) | SmithHolvannak.zip | 2007-02-21 16:35 | 9.0K | |
![[ ]](/icons/compressed.gif) | brown_fredric_harmagedon.zip | 2007-03-24 02:54 | 9.0K | |
![[ ]](/icons/compressed.gif) | Ray Bradbury - Ködkürt.zip | 2007-03-22 16:59 | 9.0K | |
![[ ]](/icons/compressed.gif) | moricz_zsigmond_barbarok.zip | 2007-03-24 02:58 | 9.0K | |
![[ ]](/icons/compressed.gif) | Gaku, Koniszi_A föld alatti Paradicsom - sci-fi novella - rtf.zip | 2006-01-07 09:08 | 9.0K | |
![[ ]](/icons/compressed.gif) | Fritz Leiber - Az ember aki sosem fiatalodott meg.zip | 2007-03-26 16:28 | 9.0K | |
![[ ]](/icons/compressed.gif) | Herbert W. Franke - A kalciumfalo.zip | 2006-05-29 11:03 | 8.9K | |
![[TXT]](/icons/text.gif) | ufocsern.txt | 2007-03-24 02:58 | 8.9K | |
![[ ]](/icons/compressed.gif) | Le Guin, Ursula K._Az út iránya - sci-fi novella - rtf.zip | 2006-01-07 09:04 | 8.9K | |
![[TXT]](/icons/text.gif) | Ohio black beauty.htm | 2007-03-24 02:59 | 8.9K | |
![[ ]](/icons/compressed.gif) | aldiss_brian_w_de_ki_potolhat_egy_embert.zip | 2007-03-24 02:52 | 8.9K | |
![[ ]](/icons/compressed.gif) | Brian W. Aldiss - De ki pótolhat egy embert.zip | 2006-05-29 11:00 | 8.9K | |
![[TXT]](/icons/text.gif) | Knock Out Drink.htm | 2007-03-24 02:59 | 8.9K | |
![[ ]](/icons/compressed.gif) | Lovecraft, Howard Philips_Randolph Carter vallomása - novella - rtf.zip | 2006-01-07 09:03 | 8.9K | |
![[ ]](/icons/compressed.gif) | Fredrik Brown és Mack Reynolds - A karikatúrista.zip | 2007-03-22 17:44 | 8.8K | |
![[ ]](/icons/compressed.gif) | A buddhista karma tana.zip | 2007-03-24 02:53 | 8.8K | |
![[ ]](/icons/compressed.gif) | Oscar Wilde-A bolond herceg.zip | 2007-03-24 02:58 | 8.8K | |
![[ ]](/icons/unknown.gif) | Erich Zann muzsikája.rar | 2007-03-24 02:55 | 8.8K | |
![[ ]](/icons/compressed.gif) | Frederic Brown és M Reynolds - A karikaturista.zip | 2007-03-22 17:44 | 8.8K | |
![[TXT]](/icons/text.gif) | szibrejt.txt | 2007-03-24 02:58 | 8.8K | |
![[ ]](/icons/compressed.gif) | Lovecraft, Howard Phillips_Dagon - novella - html.zip | 2006-01-07 09:03 | 8.8K | |
![[ ]](/icons/unknown.gif) | Szemi - Lidércfény.rtf | 2006-06-25 07:19 | 8.8K | |
![[TXT]](/icons/text.gif) | akolostoratka.txt | 2007-04-15 14:07 | 8.8K | |
![[ ]](/icons/compressed.gif) | Ulthar macskái.zip | 2007-03-26 16:56 | 8.8K | |
![[ ]](/icons/compressed.gif) | A pusztító.htm.zip | 2007-03-24 02:59 | 8.8K | |
![[ ]](/icons/compressed.gif) | A gyilkos.htm.zip | 2007-03-24 02:59 | 8.8K | |
![[TXT]](/icons/text.gif) | III_05.HTM | 2007-03-24 02:54 | 8.8K | |
![[ ]](/icons/compressed.gif) | Mobile, Frank_A bilokációs kém - sci-fi novella - html.zip | 2006-01-07 09:00 | 8.8K | |
![[ ]](/icons/unknown.gif) | Az alkimista.rar | 2007-03-24 02:55 | 8.8K | |
![[TXT]](/icons/text.gif) | alabecsu.txt | 2007-03-24 02:58 | 8.8K | |
![[ ]](/icons/compressed.gif) | Kaleidoszkóp.htm.zip | 2007-03-24 02:59 | 8.8K | |
![[ ]](/icons/unknown.gif) | 13.DOC | 2007-11-13 22:43 | 8.8K | |
![[ ]](/icons/compressed.gif) | pohl_frederik_millio_nap.zip | 2007-03-24 02:54 | 8.8K | |
![[ ]](/icons/compressed.gif) | Frederik Pohl - Millió_nap.zip | 2004-06-21 11:41 | 8.8K | |
![[ ]](/icons/compressed.gif) | Frederik Pohl - Millió Nap.zip | 2007-03-26 18:11 | 8.8K | |
![[ ]](/icons/unknown.gif) | A kriptában.rar | 2007-03-24 02:55 | 8.8K | |
![[ ]](/icons/compressed.gif) | nemere_istvan_sohasem_reszket_a_kezem_hu_doc.zip | 2007-03-24 02:58 | 8.7K | |
![[ ]](/icons/compressed.gif) | Nemere István - Sohasem_reszket_a_kezem_hu_doc.zip | 2006-05-29 11:13 | 8.7K | |
![[ ]](/icons/compressed.gif) | kain_abel.zip | 2007-03-24 03:00 | 8.7K | |
![[ ]](/icons/unknown.gif) | A kutya.rar | 2007-03-24 02:55 | 8.7K | |
![[ ]](/icons/unknown.gif) | Spred - Portré.rtf | 2006-06-25 07:18 | 8.7K | |
![[TXT]](/icons/text.gif) | SANGRIA.HTM | 2007-03-24 02:59 | 8.7K | |
![[ ]](/icons/compressed.gif) | Kazar Jozsef-A kuzdelem.zip | 2007-03-24 02:56 | 8.7K | |
![[ ]](/icons/compressed.gif) | Howard, Robert Erwin_A holtak emlékeznek - novella - html.zip | 2006-01-07 09:06 | 8.7K | |
![[TXT]](/icons/text.gif) | jetihima.txt | 2007-03-24 02:58 | 8.7K | |
![[ ]](/icons/unknown.gif) | Zyro - A Kutya.rtf | 2006-06-25 07:35 | 8.7K | |
![[TXT]](/icons/text.gif) | 02_01.HTM | 2007-03-24 02:55 | 8.7K | |
![[ ]](/icons/compressed.gif) | KondasNX03.zip | 2007-02-21 15:59 | 8.7K | |
![[ ]](/icons/compressed.gif) | Einar bácsi.htm.zip | 2007-03-24 02:59 | 8.7K | |
![[TXT]](/icons/text.gif) | Konfetti Bólé.htm | 2007-03-24 02:59 | 8.7K | |
![[TXT]](/icons/text.gif) | Kalandozás a trópusokon.htm | 2007-03-24 02:59 | 8.7K | |
![[ ]](/icons/compressed.gif) | gazdag_erzsi_mesebolt_hu_txt.zip | 2007-03-24 02:54 | 8.7K | |
![[TXT]](/icons/text.gif) | Bum Bum Tequila.htm | 2007-03-24 02:59 | 8.6K | |
![[ ]](/icons/compressed.gif) | Ursula K Le Guin - A hajótörött idegen első jelentése Derb nagyurának.zip | 2007-03-26 15:44 | 8.6K | |
![[ ]](/icons/unknown.gif) | 40.rtf | 2007-11-13 22:36 | 8.6K | |
![[ ]](/icons/unknown.gif) | Trini - Ítélkezés.rtf | 2006-06-25 07:22 | 8.6K | |
![[ ]](/icons/compressed.gif) | Csorba László_Vörös-fekete - sci-fi novella - html.zip | 2006-01-07 09:10 | 8.6K | |
![[TXT]](/icons/text.gif) | Az utolsó bezárt ajtó.htm | 2007-03-24 02:56 | 8.6K | |
![[ ]](/icons/compressed.gif) | Gor, Gennagyij_A kép - sci-fi novella - rtf.zip | 2006-01-07 09:08 | 8.6K | |
![[ ]](/icons/compressed.gif) | Lovecraft, Howard Phillips_Erich Zann zenéje - novella - txt.zip | 2006-01-07 09:03 | 8.6K | |
![[TXT]](/icons/text.gif) | 03_01.HTM | 2007-03-24 02:55 | 8.6K | |
![[TXT]](/icons/text.gif) | Római Bólé.htm | 2007-03-24 02:59 | 8.6K | |
![[ ]](/icons/compressed.gif) | Lloyd, Everet_Ylrick alászáll - sci-fi novella - html.zip | 2006-01-07 09:03 | 8.6K | |
![[ ]](/icons/compressed.gif) | pohl_frederik_a_nepszamlalok.zip | 2007-03-24 02:54 | 8.6K | |
![[ ]](/icons/compressed.gif) | Frederik Pohl - A népszámlálók.zip | 2006-05-29 11:02 | 8.6K | |
![[TXT]](/icons/text.gif) | agep.htm | 2006-08-24 18:22 | 8.6K | |
![[ ]](/icons/unknown.gif) | Tóth Gábor - Kardpróba.rtf | 2006-06-25 07:22 | 8.5K | |
![[ ]](/icons/compressed.gif) | Howard, Robert Erwin_De mind csak hasztalan - novella - html.zip | 2006-01-07 09:06 | 8.5K | |
![[ ]](/icons/compressed.gif) | Clarke, Arthur C._Isten kilencmilliárd neve - sci-fi novella - rtf.zip | 2006-01-07 09:10 | 8.5K | |
![[ ]](/icons/compressed.gif) | A tömeg.htm.zip | 2007-03-24 02:59 | 8.5K | |
![[ ]](/icons/compressed.gif) | Arthur C. Clarke - Isten kilencmilliárd neve.zip | 2004-06-21 11:40 | 8.5K | |
![[TXT]](/icons/text.gif) | elatktar.txt | 2007-03-24 02:58 | 8.5K | |
![[ ]](/icons/unknown.gif) | Uray Hunor - Maskarádé.rtf | 2006-06-25 07:23 | 8.5K | |
![[ ]](/icons/compressed.gif) | There are more things.zip | 2007-03-24 02:56 | 8.5K | |
![[ ]](/icons/unknown.gif) | H. P. Lovecraft - Dagon.rar | 2007-03-24 02:55 | 8.5K | |
![[ ]](/icons/compressed.gif) | Áldozati báránycomb.htm.zip | 2007-03-24 02:59 | 8.5K | |
![[TXT]](/icons/text.gif) | elethala.txt | 2007-03-24 02:58 | 8.4K | |
![[TXT]](/icons/text.gif) | Whisky alapú italok.htm | 2007-03-24 02:59 | 8.4K | |
![[ ]](/icons/compressed.gif) | clarke_arthur_c_isten_kilencmilliard_neve_hu_rtf.zip | 2007-03-24 02:49 | 8.4K | |
![[ ]](/icons/compressed.gif) | Ray Bradbury - Napfény és árnyék.zip | 2007-03-22 17:00 | 8.4K | |
![[ ]](/icons/compressed.gif) | VarsavszkijKisertetek.zip | 2007-02-21 16:18 | 8.4K | |
![[TXT]](/icons/text.gif) | jap_ufo.txt | 2007-03-24 02:58 | 8.4K | |
![[ ]](/icons/unknown.gif) | Santito - Swan története.rtf | 2006-06-25 07:16 | 8.4K | |
![[ ]](/icons/unknown.gif) | A Hold-láp.rar | 2007-03-24 02:55 | 8.4K | |
![[TXT]](/icons/text.gif) | vampirok.txt | 2007-03-24 02:58 | 8.4K | |
![[ ]](/icons/unknown.gif) | Szemi - Álmok.rtf | 2006-06-25 07:20 | 8.4K | |
![[TXT]](/icons/text.gif) | tudatlel.txt | 2007-03-24 02:58 | 8.4K | |
![[ ]](/icons/unknown.gif) | Sztorm - Angel.rtf | 2006-06-25 07:20 | 8.3K | |
![[ ]](/icons/unknown.gif) | holtakeml.ace | 2007-03-24 02:52 | 8.3K | |
![[TXT]](/icons/text.gif) | menu_array.js | 2007-03-24 02:59 | 8.3K | |
![[IMG]](/icons/image2.gif) | korakasmap2.gif | 2007-04-15 16:35 | 8.3K | |
![[TXT]](/icons/text.gif) | Dagadó.txt | 2007-03-24 02:59 | 8.3K | |
![[ ]](/icons/unknown.gif) | Santito - Dace története.rtf | 2006-06-25 07:16 | 8.3K | |
![[ ]](/icons/compressed.gif) | orwell_george_zamjatyin_mi_hu_rtf.zip | 2007-03-24 02:54 | 8.3K | |
![[ ]](/icons/compressed.gif) | Herbert W. Franke - A lazado szamitogep.zip | 2006-05-29 11:03 | 8.3K | |
![[ ]](/icons/compressed.gif) | Arthur C Clarke - A csillag.zip | 2007-03-23 13:29 | 8.3K | |
![[ ]](/icons/compressed.gif) | Robert Sheckley - Járványrend.zip | 2006-05-29 11:23 | 8.3K | |
![[ ]](/icons/compressed.gif) | Anja Karurarenen-A bor kora.zip | 2007-03-24 02:49 | 8.2K | |
![[TXT]](/icons/text.gif) | elarultk.txt | 2007-03-24 02:58 | 8.2K | |
![[ ]](/icons/compressed.gif) | nesvadba_josef_angyal.zip | 2006-05-10 06:22 | 8.2K | |
![[ ]](/icons/compressed.gif) | Julio Cortazar-A sziget delben.zip | 2007-03-24 02:56 | 8.2K | |
![[TXT]](/icons/text.gif) | Csirkeételek 2.txt | 2007-03-24 02:59 | 8.2K | |
![[ ]](/icons/compressed.gif) | Robert E Howard-De mind csak hasztalan.zip | 2007-03-24 02:59 | 8.2K | |
![[TXT]](/icons/text.gif) | A bérgyilkos.htm | 2007-03-24 02:56 | 8.2K | |
![[ ]](/icons/unknown.gif) | Anton Donev - Az ideális férj.rtf | 2006-07-10 19:27 | 8.2K | |
![[ ]](/icons/compressed.gif) | aldiss_brian_w_szegeny_kis_harcos.zip | 2007-03-24 02:52 | 8.2K | |
![[ ]](/icons/compressed.gif) | Brian W. Aldiss - Szegény kis harcos.zip | 2006-05-29 11:00 | 8.2K | |
![[TXT]](/icons/text.gif) | Fejedelmi frissensültek.htm | 2007-03-24 02:59 | 8.1K | |
![[ ]](/icons/unknown.gif) | Zyro - Isbard mezeje.rtf | 2006-06-25 07:36 | 8.1K | |
![[ ]](/icons/compressed.gif) | asimov_isaac_a_vizzel_boritott_hely_rtf.zip | 2007-03-24 02:55 | 8.1K | |
![[ ]](/icons/compressed.gif) | AsimovAvizzel.zip | 2007-02-21 16:01 | 8.1K | |
![[ ]](/icons/compressed.gif) | king_stephen_a_kaszas_kepmasa.zip | 2007-03-24 03:00 | 8.1K | |
![[ ]](/icons/compressed.gif) | ritchie_jack_lelekkufarok.zip | 2007-03-24 02:55 | 8.1K | |
![[ ]](/icons/compressed.gif) | RitchieLelekkufarok.zip | 2007-02-21 16:30 | 8.1K | |
![[TXT]](/icons/text.gif) | NOVELLA1.HTM | 2007-03-24 03:01 | 8.1K | |
![[ ]](/icons/unknown.gif) | Onnan túlról.rar | 2007-03-24 02:55 | 8.1K | |
![[ ]](/icons/compressed.gif) | brown_fredric_a_tukorterem.zip | 2007-03-24 02:54 | 8.1K | |
![[TXT]](/icons/text.gif) | kreszecs.txt | 2007-03-24 02:58 | 8.1K | |
![[ ]](/icons/compressed.gif) | Cherryh, C J - Időfonalak.zip | 2007-03-23 13:19 | 8.1K | |
![[ ]](/icons/compressed.gif) | Nemere István - Kísérletek.zip | 2007-03-26 17:42 | 8.1K | |
![[ ]](/icons/compressed.gif) | updike_john_az_ajulas_hu_txt.zip | 2007-03-24 02:56 | 8.1K | |
![[ ]](/icons/compressed.gif) | Ray Bradbury - A vakáció.zip | 2007-03-22 16:57 | 8.0K | |
![[ ]](/icons/unknown.gif) | Norel - Futás.rtf | 2006-06-25 06:34 | 8.0K | |
![[ ]](/icons/compressed.gif) | Gennagyij Gor - A kep.zip | 2006-05-29 11:03 | 8.0K | |
![[TXT]](/icons/text.gif) | Lórúgás.htm | 2007-03-24 02:59 | 8.0K | |
![[ ]](/icons/unknown.gif) | Neil gaiman-Mesek a homokban | 2007-03-24 02:58 | 8.0K | |
![[ ]](/icons/compressed.gif) | Ray Bradbury - Szasszaparilla-illat.zip | 2007-03-22 17:00 | 8.0K | |
![[ ]](/icons/unknown.gif) | A megnevezhetetlen.rar | 2007-03-24 02:55 | 8.0K | |
![[ ]](/icons/compressed.gif) | Ray Bradbury - Időgép.zip | 2007-03-22 16:59 | 8.0K | |
![[ ]](/icons/compressed.gif) | Napfény és árnyék.htm.zip | 2007-03-24 02:59 | 7.9K | |
![[TXT]](/icons/text.gif) | Eltevések - Befottek, dzsemek és egyebek.txt | 2007-03-24 02:59 | 7.9K | |
![[TXT]](/icons/text.gif) | Eltevések - Befőttek, dzsemek és egyebek.txt | 2007-03-24 02:59 | 7.9K | |
![[ ]](/icons/unknown.gif) | H. P. Lovecraft - Iranon útja.rar | 2007-03-24 02:55 | 7.9K | |
![[ ]](/icons/compressed.gif) | aldiss_brian_w_T.zip | 2007-03-24 02:52 | 7.9K | |
![[ ]](/icons/compressed.gif) | Brian W. Aldiss - T.zip | 2006-05-29 11:00 | 7.9K | |
![[ ]](/icons/compressed.gif) | WhiteEgykis.zip | 2007-02-21 16:09 | 7.9K | |
![[ ]](/icons/compressed.gif) | Lloyd, Everet_A tó rejtélye - sci-fi novella - html.zip | 2006-01-07 09:03 | 7.8K | |
![[ ]](/icons/unknown.gif) | Horlik Zoltán - Darton kocsmája.rtf | 2006-07-10 19:59 | 7.8K | |
![[ ]](/icons/compressed.gif) | Marionett Rt..htm.zip | 2007-03-24 02:59 | 7.8K | |
![[ ]](/icons/compressed.gif) | Bajzafi Ferenc_Földi termés - sci-fi novella - html.zip | 2006-01-07 09:11 | 7.8K | |
![[TXT]](/icons/text.gif) | Ópium - Egy idegorvos levelesládájából.htm | 2007-03-24 02:52 | 7.8K | |
![[ ]](/icons/unknown.gif) | H. P. Lovecraft - Celephais.rar | 2007-03-24 02:55 | 7.8K | |
![[TXT]](/icons/text.gif) | novella11.htm | 2007-03-24 03:01 | 7.8K | |
![[ ]](/icons/compressed.gif) | Ray Bradbury - A város.zip | 2007-03-22 16:57 | 7.8K | |
![[ ]](/icons/compressed.gif) | Clifford D Simak - Túl a folyón és az erdőn.zip | 2007-03-26 18:54 | 7.8K | |
![[TXT]](/icons/text.gif) | rejtener.txt | 2007-03-24 02:58 | 7.8K | |
![[ ]](/icons/compressed.gif) | John Wyndham - A kerék.zip | 2007-03-26 19:55 | 7.8K | |
![[TXT]](/icons/text.gif) | A varázsló halála.htm | 2007-03-24 02:52 | 7.8K | |
![[ ]](/icons/compressed.gif) | A feledés fátyla.zip | 2007-03-26 16:56 | 7.7K | |
![[ ]](/icons/unknown.gif) | 44.rtf | 2007-11-13 22:36 | 7.7K | |
![[TXT]](/icons/text.gif) | gabonako.txt | 2007-03-24 02:58 | 7.7K | |
![[TXT]](/icons/text.gif) | MIMI.JS | 2007-03-24 02:59 | 7.7K | |
![[ ]](/icons/unknown.gif) | A VILÁG LEGSZEBB VÍZIHULLÁJA.ace | 2007-03-24 02:54 | 7.6K | |
![[IMG]](/icons/image2.gif) | BARKER.GIF | 2007-03-24 02:52 | 7.6K | |
![[ ]](/icons/compressed.gif) | Robert Sheckley - A játék.zip | 2006-05-29 11:22 | 7.6K | |
![[ ]](/icons/compressed.gif) | A koldus és a gyémánt.zip | 2007-04-15 04:01 | 7.6K | |
![[ ]](/icons/compressed.gif) | A vakáció.htm.zip | 2007-03-24 02:59 | 7.6K | |
![[ ]](/icons/compressed.gif) | HickeyHilda.zip | 2007-02-21 16:36 | 7.6K | |
![[ ]](/icons/unknown.gif) | fasorban.ace | 2007-03-24 02:52 | 7.6K | |
![[ ]](/icons/unknown.gif) | Zyro - Talán nem.rtf | 2006-06-25 07:36 | 7.6K | |
![[ ]](/icons/unknown.gif) | Syrith-ungmaiel - Dicsőséges szeretet quo vadis.rtf | 2006-06-25 07:19 | 7.6K | |
![[TXT]](/icons/text.gif) | 03.HTM | 2007-03-24 02:55 | 7.6K | |
![[ ]](/icons/unknown.gif) | Vastag gerendák.ace | 2007-03-24 03:01 | 7.6K | |
![[ ]](/icons/unknown.gif) | Szemi - Végtelenül.rtf | 2006-06-25 07:19 | 7.6K | |
![[ ]](/icons/compressed.gif) | Az apa hazaér a munkából.zip | 2007-03-24 02:49 | 7.5K | |
![[ ]](/icons/compressed.gif) | Ray Bradbury - Marionett Rt.zip | 2007-03-22 16:59 | 7.5K | |
![[ ]](/icons/compressed.gif) | Tanulas villamolvasas segitsegevel.zip | 2007-03-24 03:00 | 7.5K | |
![[ ]](/icons/compressed.gif) | Capt. H. G. Bishop - A megfagyott jégtröszt.zip | 2007-03-21 19:27 | 7.5K | |
![[ ]](/icons/compressed.gif) | Id_gép.htm.zip | 2007-03-24 02:59 | 7.5K | |
![[ ]](/icons/compressed.gif) | Ray Bradbury - Perzselő tűz.zip | 2007-03-22 17:00 | 7.5K | |
![[TXT]](/icons/text.gif) | Szerelem.htm | 2007-03-24 02:55 | 7.5K | |
![[ ]](/icons/compressed.gif) | A gonosz lelkész.zip | 2007-04-06 15:23 | 7.5K | |
![[ ]](/icons/unknown.gif) | Fekete Gyula - Fantasztikus történetek 2975-ből.rtf | 2006-07-10 19:43 | 7.5K | |
![[ ]](/icons/compressed.gif) | Terry Prachett - A Kegyetlenség Színháza.zip | 2007-03-26 18:20 | 7.5K | |
![[ ]](/icons/unknown.gif) | BookReaderMidlet.class | 2007-03-24 02:54 | 7.5K | |
![[ ]](/icons/compressed.gif) | orwell_george_az_angol_gyilkossagok_alkonya_hu_rtf.zip | 2007-03-24 02:54 | 7.5K | |
![[ ]](/icons/unknown.gif) | Jack C Haldeman - Az ítélet napja.rtf | 2006-07-10 20:14 | 7.5K | |
![[ ]](/icons/compressed.gif) | dek_liven_a_sargu_bogese.zip | 2007-03-24 02:57 | 7.4K | |
![[ ]](/icons/compressed.gif) | LivenDekAsargu.zip | 2007-02-21 15:59 | 7.4K | |
![[TXT]](/icons/text.gif) | Brandy alapú koktélok.htm | 2007-03-24 02:59 | 7.4K | |
![[ ]](/icons/compressed.gif) | Szasszaparilla - illat.htm.zip | 2007-03-24 02:59 | 7.4K | |
![[ ]](/icons/unknown.gif) | Tege - Béke.rtf | 2006-06-25 07:20 | 7.4K | |
![[TXT]](/icons/text.gif) | Táskák a levesben - elfelejtett levesbetétek.htm | 2007-03-24 02:59 | 7.4K | |
![[ ]](/icons/unknown.gif) | H. P. Lovecraft- Randolph Carter Vallomása.rar | 2007-03-24 02:55 | 7.4K | |
![[ ]](/icons/unknown.gif) | Rorimack - Utolsó napon.rtf | 2006-06-25 07:15 | 7.4K | |
![[ ]](/icons/unknown.gif) | foldon.ace | 2007-03-24 02:52 | 7.4K | |
![[ ]](/icons/compressed.gif) | Frederic Brown - A tükörterem.zip | 2007-03-22 17:43 | 7.4K | |
![[ ]](/icons/compressed.gif) | A város 1.htm.zip | 2007-03-24 02:59 | 7.4K | |
![[ ]](/icons/compressed.gif) | A város.htm.zip | 2007-03-24 02:59 | 7.4K | |
![[TXT]](/icons/text.gif) | szerelem.htm | 2006-08-24 18:23 | 7.4K | |
![[ ]](/icons/compressed.gif) | Lovecraft, Howard Phillips_Ulthar macskái - novella - html.txt.zip | 2006-01-07 09:03 | 7.4K | |
![[ ]](/icons/compressed.gif) | Howard, Robert Erwin_A férfi a földön - novella - html.zip | 2006-01-07 09:06 | 7.4K | |
![[ ]](/icons/compressed.gif) | Fritz Leiber - Rossz üzletmenet.zip | 2007-03-26 16:28 | 7.4K | |
![[ ]](/icons/compressed.gif) | Mobile, Frank_A legyőzhetetlen ország - sci-fi novella - html.zip | 2006-01-07 09:00 | 7.3K | |
![[ ]](/icons/unknown.gif) | Szabo Tamas-A haborunak ember kell.ZIP | 2007-03-24 03:00 | 7.3K | |
![[ ]](/icons/compressed.gif) | william_tenn_-_a_pszt!-hadmuvelet.zip | 2004-06-21 11:42 | 7.3K | |
![[ ]](/icons/compressed.gif) | William Tenn - A Pszt!-hadmuvelet.zip | 2006-05-29 11:28 | 7.3K | |
![[ ]](/icons/compressed.gif) | Haga Tivadar_A felfedező - sci-fi novella - html.zip | 2006-01-07 09:06 | 7.3K | |
![[ ]](/icons/compressed.gif) | Nana Triban es Balla Fasszeke-Szungatya,az oroszlan fia.zip | 2007-03-24 02:58 | 7.3K | |
![[ ]](/icons/unknown.gif) | Dagon.rar | 2007-03-24 02:55 | 7.3K | |
![[ ]](/icons/unknown.gif) | The crawling chaos.rar | 2007-03-24 02:55 | 7.3K | |
![[IMG]](/icons/image2.gif) | 3.GIF | 2007-03-24 02:59 | 7.3K | |
![[ ]](/icons/compressed.gif) | Renier, Raoul, vagyis Kornya Zsolt_A képzelet egy másik világa - html.zip | 2006-01-07 08:54 | 7.3K | |
![[ ]](/icons/compressed.gif) | asimov_isaac_csillagfeny.zip | 2007-03-24 02:55 | 7.3K | |
![[ ]](/icons/compressed.gif) | Isaac Asimov - Csillagfeny.zip | 2006-05-10 06:19 | 7.3K | |
![[ ]](/icons/compressed.gif) | Henrich Altov - Ikarosz és Dedalosz.zip | 2007-03-21 19:09 | 7.3K | |
![[ ]](/icons/compressed.gif) | AsimovCsillagfeny.zip | 2007-02-21 16:03 | 7.3K | |
![[TXT]](/icons/text.gif) | Erdélyi ételek.txt | 2007-03-24 02:59 | 7.3K | |
![[ ]](/icons/unknown.gif) | c.class | 2007-03-24 02:54 | 7.3K | |
![[ ]](/icons/unknown.gif) | Rajkai Zoltán - A mesék áldozata.rtf | 2006-06-25 06:41 | 7.3K | |
![[TXT]](/icons/text.gif) | Articsóka.txt | 2007-03-24 02:59 | 7.2K | |
![[ ]](/icons/unknown.gif) | sivatag.ace | 2007-03-24 02:52 | 7.2K | |
![[ ]](/icons/unknown.gif) | hajnal.ace | 2007-03-24 02:52 | 7.2K | |
![[TXT]](/icons/text.gif) | 01_05.HTM | 2007-03-24 02:55 | 7.2K | |
![[TXT]](/icons/text.gif) | Baglyoknak leánya.htm | 2007-03-24 02:58 | 7.2K | |
![[TXT]](/icons/text.gif) | A vadn_ és a kis édes.htm | 2007-03-24 02:52 | 7.2K | |
![[IMG]](/icons/image2.gif) | Antalya.gif | 2007-04-15 15:44 | 7.2K | |
![[ ]](/icons/compressed.gif) | Jane Yolen-Szfinx szolam.zip | 2007-03-24 02:56 | 7.2K | |
![[TXT]](/icons/text.gif) | 02.HTM | 2007-03-24 02:55 | 7.1K | |
![[ ]](/icons/compressed.gif) | Cherryh, C J - Cassandra.zip | 2007-03-23 13:19 | 7.1K | |
![[ ]](/icons/compressed.gif) | A kegyetlenseg szinhaza-Novella a korongviragrol.zip | 2007-03-24 03:00 | 7.1K | |
![[ ]](/icons/compressed.gif) | Ray Bradbury - A repülő masina.zip | 2007-03-22 16:56 | 7.1K | |
![[TXT]](/icons/text.gif) | belsoora.txt | 2007-03-24 02:58 | 7.1K | |
![[TXT]](/icons/text.gif) | vampir.txt | 2007-03-24 02:58 | 7.1K | |
![[ ]](/icons/compressed.gif) | cholnoky_viktor_a_szurke_ember_hu_rtf_nncl3006-704v1.zip | 2007-03-24 02:52 | 7.1K | |
![[ ]](/icons/compressed.gif) | Brown, Bill_A csillagkacsák - sci-fi novella - html.zip | 2006-01-07 09:07 | 7.1K | |
![[ ]](/icons/compressed.gif) | Le Guin, Ursula K._Az út iránya - txt.zip | 2006-01-07 08:50 | 7.1K | |
![[ ]](/icons/compressed.gif) | Szép arany almáit a Nap.htm.zip | 2007-03-24 02:59 | 7.0K | |
![[TXT]](/icons/text.gif) | NOVELLA2.HTM | 2007-03-24 03:01 | 7.0K | |
![[ ]](/icons/compressed.gif) | Dmitrij Alekszandrovics Bilenkin - Űrhidegfóbia.zip | 2007-03-21 19:26 | 7.0K | |
![[ ]](/icons/unknown.gif) | Rubin Gábor - Kalandorok.rtf | 2006-07-10 20:47 | 7.0K | |
![[ ]](/icons/compressed.gif) | Perzsel_ t_z.htm.zip | 2007-03-24 02:59 | 7.0K | |
![[ ]](/icons/compressed.gif) | gibson_william_egy_hologramrozsa_toredeke.zip | 2007-03-24 03:01 | 7.0K | |
![[TXT]](/icons/text.gif) | Szombat este.htm | 2007-03-24 02:52 | 6.9K | |
![[ ]](/icons/compressed.gif) | Ray Bradbury - A nyári futás hangja.zip | 2007-03-22 16:56 | 6.9K | |
![[ ]](/icons/compressed.gif) | Születés és katasztrófa.htm.zip | 2007-03-24 02:59 | 6.9K | |
![[ ]](/icons/compressed.gif) | Rossz üzletmenet.htm.zip | 2007-03-24 02:54 | 6.9K | |
![[ ]](/icons/compressed.gif) | Robert Sheckley - A vakarózás.zip | 2006-05-29 11:22 | 6.9K | |
![[TXT]](/icons/text.gif) | A vonat.htm | 2007-03-24 02:58 | 6.9K | |
![[ ]](/icons/unknown.gif) | Rorimack - Vírus.rtf | 2006-06-25 07:15 | 6.9K | |
![[TXT]](/icons/text.gif) | 01_09.HTM | 2007-03-24 02:55 | 6.9K | |
![[ ]](/icons/compressed.gif) | ori_istvan_a_szerelem_illata_hu_doc.zip | 2007-03-24 02:58 | 6.9K | |
![[ ]](/icons/compressed.gif) | Bilenkin, Dmitrij_Űrhidegfóbia - sci-fi novella - rtf.zip | 2006-01-07 09:13 | 6.9K | |
![[ ]](/icons/unknown.gif) | Iranon útja.rar | 2007-03-24 02:55 | 6.9K | |
![[ ]](/icons/unknown.gif) | 0.1 | 2007-03-24 02:54 | 6.9K | |
![[IMG]](/icons/image2.gif) | e-zaba2.gif | 2007-03-24 02:53 | 6.8K | |
![[ ]](/icons/compressed.gif) | Chandler, Bertram A._Egy párnak a fele - sci-fi novella - rtf.zip | 2006-01-07 09:10 | 6.8K | |
![[TXT]](/icons/text.gif) | Tor.htm | 2007-03-24 02:52 | 6.8K | |
![[ ]](/icons/unknown.gif) | H. P. Lovecraft - A Fehér Hajó.rar | 2007-03-24 02:55 | 6.8K | |
![[IMG]](/icons/image2.gif) | okostud1.gif | 2007-03-24 02:53 | 6.8K | |
![[TXT]](/icons/text.gif) | Norbi étrend.txt | 2007-03-24 02:59 | 6.8K | |
![[ ]](/icons/compressed.gif) | Lovecraft, Howard Philips_A sólyom-foki halász - novella - rtf.zip | 2006-01-07 09:03 | 6.8K | |
![[ ]](/icons/compressed.gif) | Brian W. Aldiss - Konfluencia.zip | 2006-05-29 11:00 | 6.8K | |
![[TXT]](/icons/text.gif) | szinezek.htm | 2007-03-24 02:53 | 6.8K | |
![[TXT]](/icons/text.gif) | Eltevések - Aszalás.txt | 2007-03-24 02:59 | 6.8K | |
![[ ]](/icons/compressed.gif) | cholnoky_viktor_tartini_ordoge_hu_rtf_nncl3008-704v1.zip | 2007-03-24 02:52 | 6.8K | |
![[ ]](/icons/compressed.gif) | Körkörös romok.zip | 2007-03-24 02:56 | 6.8K | |
![[ ]](/icons/unknown.gif) | A kívülálló.rar | 2007-03-24 02:55 | 6.8K | |
![[ ]](/icons/compressed.gif) | vancsa_istvan_sor_hu_txt.zip | 2007-03-24 03:00 | 6.7K | |
![[TXT]](/icons/text.gif) | CURRY-s receptek.txt | 2007-03-24 02:59 | 6.7K | |
![[ ]](/icons/unknown.gif) | Péter Zsolt - A csónak.rtf | 2006-06-25 06:39 | 6.7K | |
![[TXT]](/icons/text.gif) | hitalalm.txt | 2007-03-24 02:58 | 6.7K | |
![[ ]](/icons/compressed.gif) | moricz_zsigmond_csata.zip | 2007-03-24 02:58 | 6.6K | |
![[TXT]](/icons/text.gif) | Erdélyiek figyelmébe! + Mit kirol neveztek el_.txt | 2007-03-24 02:59 | 6.6K | |
![[TXT]](/icons/text.gif) | Erdélyiek figyelmébe! + Mit kiről neveztek el_.txt | 2007-03-24 02:59 | 6.6K | |
![[ ]](/icons/compressed.gif) | Halloween in a Suburb (vers).zip | 2007-03-26 16:55 | 6.6K | |
![[TXT]](/icons/text.gif) | Árny - Parabola.htm | 2007-03-24 02:53 | 6.6K | |
![[TXT]](/icons/text.gif) | SZINEZEK.HTM | 2007-03-24 02:59 | 6.6K | |
![[ ]](/icons/compressed.gif) | bond_nelson_furcsa_hang_a_kockabol.zip | 2007-03-24 02:58 | 6.6K | |
![[ ]](/icons/compressed.gif) | BondHang.zip | 2007-02-21 16:33 | 6.6K | |
![[ ]](/icons/compressed.gif) | Frederic Brown - Harmagedón.zip | 2007-03-22 17:44 | 6.6K | |
![[ ]](/icons/compressed.gif) | zsarolas.zip | 2007-02-21 16:08 | 6.6K | |
![[ ]](/icons/compressed.gif) | Hoyle, Fred - Zsarolás.zip | 2005-06-22 15:42 | 6.6K | |
![[ ]](/icons/compressed.gif) | Fred Hoyle-Zsarolas.zip | 2007-03-24 02:54 | 6.6K | |
![[ ]](/icons/unknown.gif) | Wyquin - Malőr.rtf | 2006-06-25 07:35 | 6.6K | |
![[ ]](/icons/compressed.gif) | Ray Bradbury - A tetovált ember.zip | 2007-03-22 16:56 | 6.6K | |
![[ ]](/icons/compressed.gif) | Hoyle, Fred_Zsarolás - rtf.zip | 2006-01-07 08:50 | 6.6K | |
![[TXT]](/icons/text.gif) | Csönd.htm | 2007-03-24 02:53 | 6.6K | |
![[IMG]](/icons/image2.gif) | e-zaba1.gif | 2007-03-24 02:53 | 6.6K | |
![[TXT]](/icons/text.gif) | E-TAB2.HTM | 2007-03-24 02:59 | 6.5K | |
![[ ]](/icons/compressed.gif) | orwell_george_irodalom_es_totalitarizmus_hu_rtf.zip | 2007-03-24 02:54 | 6.5K | |
![[ ]](/icons/unknown.gif) | Voicu Bugariu - A vikingek hangja.rtf | 2006-06-25 07:32 | 6.5K | |
![[ ]](/icons/unknown.gif) | sws - Angyalszárnyak.rtf | 2006-06-25 07:19 | 6.5K | |
![[ ]](/icons/unknown.gif) | Gregg Chamberlain - Apró hiba.rtf | 2006-07-10 19:49 | 6.5K | |
![[ ]](/icons/unknown.gif) | 13.rtf | 2007-11-13 22:28 | 6.5K | |
![[ ]](/icons/compressed.gif) | A nyári futás hangja.htm.zip | 2007-03-24 02:59 | 6.5K | |
![[ ]](/icons/compressed.gif) | Ray Bradbury - A tó.zip | 2007-03-22 16:56 | 6.5K | |
![[ ]](/icons/compressed.gif) | Lovecraft, Howard Phillips_A Fehér Hajó - novella - html.zip | 2006-01-07 09:03 | 6.5K | |
![[ ]](/icons/compressed.gif) | pronzini_bill_bibor_tehen.zip | 2007-03-24 02:51 | 6.5K | |
![[ ]](/icons/compressed.gif) | PronziniBibortehen.zip | 2007-02-21 16:39 | 6.5K | |
![[ ]](/icons/compressed.gif) | Herbert W. Franke - A fegyverkereskedo.zip | 2006-05-29 11:03 | 6.5K | |
![[TXT]](/icons/text.gif) | Kenyerek.txt | 2007-03-24 02:59 | 6.5K | |
![[ ]](/icons/compressed.gif) | asimov_isaac_a_fenyvers.zip | 2007-03-24 02:55 | 6.5K | |
![[ ]](/icons/compressed.gif) | Karádi Kázmér_Ikeridő - sci-fi novella - html.zip | 2006-01-07 09:05 | 6.4K | |
![[ ]](/icons/compressed.gif) | Fialkowski, Konrad_Az elképzelt valóság modellje - sci-fi novella - rtf.zip | 2006-01-07 09:08 | 6.4K | |
![[TXT]](/icons/text.gif) | csiguska.htm | 2007-03-24 02:54 | 6.4K | |
![[TXT]](/icons/text.gif) | CIKK.CSS | 2007-03-24 02:59 | 6.4K | |
![[ ]](/icons/compressed.gif) | Herbert W. Franke - Miert nem lovod le Peggy-t.zip | 2006-05-29 11:08 | 6.4K | |
![[IMG]](/icons/image2.gif) | NOVELLA.GIF | 2007-03-24 03:01 | 6.4K | |
![[ ]](/icons/compressed.gif) | Emlékezet.zip | 2007-03-26 16:55 | 6.4K | |
![[ ]](/icons/unknown.gif) | Randolph Carter vallomása.rar | 2007-03-24 02:55 | 6.4K | |
![[TXT]](/icons/text.gif) | IV_04.HTM | 2007-03-24 02:54 | 6.4K | |
![[ ]](/icons/unknown.gif) | milkshakes.doc | 2007-03-24 02:59 | 6.3K | |
![[ ]](/icons/unknown.gif) | mcribR_sandwich.doc | 2007-03-24 02:59 | 6.3K | |
![[ ]](/icons/compressed.gif) | Clifford D Simak - -Túl a folyón és az erdőn.zip | 2007-03-26 18:54 | 6.3K | |
![[ ]](/icons/compressed.gif) | Herbert W. Franke - Enni, elni nem meghalni.zip | 2006-05-29 11:08 | 6.3K | |
![[TXT]](/icons/text.gif) | A svindler - avagy a lóvátevés egzakt tudománya.htm | 2007-03-24 02:53 | 6.3K | |
![[ ]](/icons/unknown.gif) | sws - A nevekről szóló tanítás.rtf | 2006-06-25 07:18 | 6.3K | |
![[ ]](/icons/unknown.gif) | Quake4Config.cfg | 2006-09-16 22:53 | 6.3K | |
![[ ]](/icons/compressed.gif) | Hidy Mátyás_Az ítélet - sci-fi novella - html.txt.zip | 2006-01-07 09:06 | 6.3K | |
![[ ]](/icons/compressed.gif) | Fowler, Karen Joy_Hátország - sci-fi novella - rtf.zip | 2006-01-07 09:08 | 6.3K | |
![[ ]](/icons/unknown.gif) | Zarbon - Elveszett szív.rtf | 2006-06-25 07:35 | 6.3K | |
![[ ]](/icons/compressed.gif) | Ilja Varsavszkij - Orgonaszínű bolygó.zip | 2007-03-26 19:37 | 6.3K | |
![[IMG]](/icons/image2.gif) | CITROMFU.JPG | 2007-03-24 02:59 | 6.3K | |
![[ ]](/icons/compressed.gif) | The Cats (vers).zip | 2007-03-26 16:56 | 6.2K | |
![[ ]](/icons/unknown.gif) | Herbert W Franke - A békeszegő.rtf | 2006-07-10 19:52 | 6.2K | |
![[TXT]](/icons/text.gif) | Esti szürkület.htm | 2007-03-24 02:52 | 6.2K | |
![[ ]](/icons/compressed.gif) | moricz_zsigmond_sustorgos_ropogos_tafotaban.zip | 2007-03-24 02:58 | 6.2K | |
![[ ]](/icons/compressed.gif) | aldiss_brian_w_ujonnan_erkezo_regi_ismerosok.zip | 2007-03-24 02:52 | 6.2K | |
![[ ]](/icons/compressed.gif) | Brian W. Aldiss - Újonnan érkező, régi ismerősök.zip | 2006-05-29 11:00 | 6.2K | |
![[TXT]](/icons/text.gif) | Receptek, vegyes.txt | 2007-03-24 02:59 | 6.2K | |
![[ ]](/icons/unknown.gif) | Skylis T Tomahawk - Tragédia.rtf | 2006-06-25 07:18 | 6.2K | |
![[ ]](/icons/compressed.gif) | Darázs Endre_Vércsap - sci-fi novella - html.zip | 2006-01-07 09:09 | 6.2K | |
![[ ]](/icons/unknown.gif) | Soóki Tamás - Requiem.rtf | 2006-06-25 07:18 | 6.2K | |
![[ ]](/icons/compressed.gif) | Hidy Mátyás_A töketlenség napja - sci-fi novella - html.zip | 2006-01-07 09:06 | 6.2K | |
![[TXT]](/icons/text.gif) | fejpenz.htm | 2006-08-24 18:22 | 6.2K | |
![[ ]](/icons/compressed.gif) | molekularis.zip | 2007-02-21 16:03 | 6.2K | |
![[ ]](/icons/compressed.gif) | Varsavszkij, Ilja_Molekuláris kávéház - sci-fi - word.zip | 2006-01-07 08:44 | 6.2K | |
![[ ]](/icons/compressed.gif) | Ray Bradbury - A mosoly.zip | 2007-03-22 16:56 | 6.2K | |
![[ ]](/icons/compressed.gif) | The Festival (vers).zip | 2007-03-26 16:56 | 6.2K | |
![[ ]](/icons/unknown.gif) | E-SZAMOK.RAR | 2007-03-24 02:59 | 6.1K | |
![[ ]](/icons/compressed.gif) | Bózsó Péter_Lehetőség - sci-fi novella - html.zip | 2006-01-07 09:04 | 6.1K | |
![[ ]](/icons/compressed.gif) | Ray Bradbury - A szemétgyűjtő.zip | 2007-03-22 16:56 | 6.1K | |
![[TXT]](/icons/text.gif) | NOVELLA5.HTM | 2007-03-24 03:01 | 6.1K | |
![[ ]](/icons/unknown.gif) | H. P. Lovecraft - A más istenek.rar | 2007-03-24 02:55 | 6.1K | |
![[ ]](/icons/compressed.gif) | Juhász György_Az idő pénz - sci-fi novella - html.zip | 2006-01-07 09:05 | 6.1K | |
![[ ]](/icons/unknown.gif) | Alexei Panshin - Hogyan fedezte föl Georges Duchamps a világ meghódítására szőtt összeesküvést.rtf | 2006-07-10 19:26 | 6.1K | |
![[TXT]](/icons/text.gif) | A.T.Tyson- Egy könnyű kis vacsora.ace | 2007-03-24 02:49 | 6.1K | |
![[ ]](/icons/compressed.gif) | E.A.Poe - Az áruló szív.zip | 2006-05-29 11:01 | 6.1K | |
![[ ]](/icons/unknown.gif) | Olman - Láng, füst, hamu.rtf | 2006-06-25 06:35 | 6.0K | |
![[ ]](/icons/unknown.gif) | Peter Phillips - Ellenvarázslat.rtf | 2006-06-25 06:36 | 6.0K | |
![[ ]](/icons/unknown.gif) | A barlangi szörnyeteg.rar | 2007-03-24 02:55 | 6.0K | |
![[ ]](/icons/unknown.gif) | Filet~o~FishR.doc | 2007-03-24 02:59 | 6.0K | |
![[ ]](/icons/unknown.gif) | Cheeseburger.doc | 2007-03-24 02:59 | 6.0K | |
![[ ]](/icons/unknown.gif) | Gáspár András - Két életem egy halálom ful.rtf | 2007-11-14 01:05 | 6.0K | |
![[TXT]](/icons/text.gif) | e-tab2.htm | 2007-03-24 02:53 | 6.0K | |
![[ ]](/icons/compressed.gif) | Ray Bradbury - A kezdet vége.zip | 2007-03-22 16:55 | 6.0K | |
![[ ]](/icons/compressed.gif) | Van Vogt, A. E._A Nagy Bíró - sci-fi novella - rtf.zip | 2006-01-07 08:45 | 6.0K | |
![[ ]](/icons/compressed.gif) | Tokei Ferenc-Kinai viccek.zip | 2007-03-24 03:00 | 6.0K | |
![[ ]](/icons/unknown.gif) | Szemi - Éber Álom.rtf | 2006-06-25 07:20 | 5.9K | |
![[ ]](/icons/compressed.gif) | block_lawrence_a_legjobb_borton.zip | 2007-03-24 02:57 | 5.9K | |
![[ ]](/icons/compressed.gif) | BlockAlegjobb.zip | 2007-02-21 16:33 | 5.9K | |
![[ ]](/icons/compressed.gif) | Block - A legjobb.zip | 2005-06-22 17:00 | 5.9K | |
![[TXT]](/icons/text.gif) | Pezsg_ alapú italok.htm | 2007-03-24 02:59 | 5.9K | |
![[ ]](/icons/compressed.gif) | asimov_isaac_a_halhatatlan_kolto.zip | 2007-03-24 02:55 | 5.9K | |
![[ ]](/icons/compressed.gif) | Isaac Asimov - A halhatatlan költő.zip | 2006-05-10 06:19 | 5.9K | |
![[ ]](/icons/compressed.gif) | AsimovAhalhatatlan.zip | 2007-02-21 16:01 | 5.9K | |
![[TXT]](/icons/text.gif) | Libaételek.txt | 2007-03-24 02:59 | 5.9K | |
![[TXT]](/icons/text.gif) | 03_07.HTM | 2007-03-24 02:55 | 5.9K | |
![[ ]](/icons/compressed.gif) | Selma Lagerlof-A csaszar latomasa.zip | 2007-03-24 03:00 | 5.9K | |
![[TXT]](/icons/text.gif) | MEK.HTML | 2007-03-24 02:53 | 5.9K | |
![[TXT]](/icons/text.gif) | pilotak.txt | 2007-03-24 02:58 | 5.9K | |
![[TXT]](/icons/text.gif) | urjarmu.txt | 2007-03-24 02:58 | 5.8K | |
![[ ]](/icons/compressed.gif) | Ghenti Guido-A csapfuro.zip | 2007-03-24 02:55 | 5.8K | |
![[ ]](/icons/unknown.gif) | Zyro - Kezdet.rtf | 2006-06-25 07:36 | 5.8K | |
![[ ]](/icons/unknown.gif) | Varga László - Újrakezdés.rtf | 2006-06-25 08:16 | 5.8K | |
![[ ]](/icons/compressed.gif) | Robert Sheckley - A tokeletes asszony.zip | 2006-05-29 11:22 | 5.8K | |
![[ ]](/icons/unknown.gif) | quarter_pounderR.doc | 2007-03-24 02:59 | 5.8K | |
![[ ]](/icons/unknown.gif) | The Doom that came to Sarnath.rar | 2007-03-24 02:55 | 5.8K | |
![[ ]](/icons/unknown.gif) | A fehér hajó.rar | 2007-03-24 02:55 | 5.8K | |
![[ ]](/icons/compressed.gif) | Ray Bradbury - A világ utolsó éjszakája.zip | 2007-03-22 16:57 | 5.8K | |
![[ ]](/icons/compressed.gif) | Wayne Chapman - A bárd és a fenevadak.zip | 2007-03-23 05:20 | 5.8K | |
![[TXT]](/icons/text.gif) | FEJ.JS | 2007-03-24 02:59 | 5.8K | |
![[TXT]](/icons/text.gif) | II_06.HTM | 2007-03-24 02:54 | 5.8K | |
![[ ]](/icons/unknown.gif) | Raud - Ottfelejtve.rtf | 2006-06-25 06:42 | 5.8K | |
![[ ]](/icons/compressed.gif) | Sutherland - Iftan kardjai.zip | 2007-03-25 05:20 | 5.8K | |
![[ ]](/icons/unknown.gif) | W Hilton-Young - A választás.rtf | 2006-06-25 07:32 | 5.8K | |
![[ ]](/icons/compressed.gif) | SutherlandIftankardjai.zip | 2007-02-21 16:35 | 5.8K | |
![[ ]](/icons/compressed.gif) | Pichon, J.-Ch_A gép - sci-fi novella - rtf.zip | 2006-01-07 08:55 | 5.8K | |
![[ ]](/icons/compressed.gif) | A mosoly.htm.zip | 2007-03-24 02:59 | 5.8K | |
![[ ]](/icons/compressed.gif) | dian_girard_-_nincs_ott_semmi.zip | 2004-06-21 11:42 | 5.7K | |
![[ ]](/icons/compressed.gif) | Dian Girard - Nincs ott semmi.zip | 2006-05-29 11:01 | 5.7K | |
![[ ]](/icons/compressed.gif) | Bihari Péter_Elfelejteni - sci-fi novella - html.zip | 2006-01-07 09:13 | 5.7K | |
![[TXT]](/icons/text.gif) | 2millio.txt | 2007-03-24 02:58 | 5.7K | |
![[TXT]](/icons/text.gif) | Kalandozások a trópusokon.txt | 2007-03-24 02:59 | 5.7K | |
![[ ]](/icons/compressed.gif) | Bihari Péter_Szörnyetegek sorsa - sci-fi novella - html.zip | 2006-01-07 09:13 | 5.7K | |
![[ ]](/icons/compressed.gif) | Graham Greene-Kinos baleset.zip | 2007-03-24 02:55 | 5.7K | |
![[ ]](/icons/compressed.gif) | Knight, Damon_A kezelő - sci-fi novella - rtf.zip | 2006-01-07 09:05 | 5.7K | |
![[ ]](/icons/compressed.gif) | A halott szeret_.htm.zip | 2007-03-24 02:55 | 5.7K | |
![[ ]](/icons/compressed.gif) | Robert Sheckley - Hulladek eltavolitas.zip | 2006-05-29 11:23 | 5.7K | |
![[ ]](/icons/compressed.gif) | A szemétgy_jt_.htm.zip | 2007-03-24 02:59 | 5.7K | |
![[ ]](/icons/compressed.gif) | Karádi Kázmér_A csillagok pora - sci-fi novella - html.zip | 2006-01-07 09:05 | 5.7K | |
![[ ]](/icons/compressed.gif) | A E. Van Vogt - A Nagy Bíró.zip | 2007-03-21 16:07 | 5.6K | |
![[TXT]](/icons/text.gif) | rejtlegi.txt | 2007-03-24 02:58 | 5.6K | |
![[ ]](/icons/compressed.gif) | Gabriella Bosie-nek[1874-1960]szolo hang.zip | 2007-03-24 02:54 | 5.6K | |
![[TXT]](/icons/text.gif) | Tatar bifsztek.txt | 2007-03-24 02:59 | 5.6K | |
![[TXT]](/icons/text.gif) | tabornok.txt | 2007-03-24 02:58 | 5.6K | |
![[TXT]](/icons/text.gif) | BEVEZET.HTM | 2007-03-24 02:58 | 5.5K | |
![[ ]](/icons/compressed.gif) | A kezdet vége.htm.zip | 2007-03-24 02:59 | 5.5K | |
![[ ]](/icons/compressed.gif) | Ray Bradbury - Arany Sárkány, Ezüst Szél.zip | 2007-03-22 16:57 | 5.5K | |
![[ ]](/icons/compressed.gif) | Csernai Zoltán_Kövek - sci-fi novella - html.zip | 2006-01-07 09:10 | 5.5K | |
![[ ]](/icons/compressed.gif) | moricz_zsigmond_tragedia.zip | 2007-03-24 02:58 | 5.4K | |
![[ ]](/icons/compressed.gif) | ziborov - katasztrofa.zip | 2006-05-10 06:28 | 5.4K | |
![[ ]](/icons/compressed.gif) | ZiborovKatasztrofa.zip | 2007-02-21 16:08 | 5.4K | |
![[IMG]](/icons/image2.gif) | HITCH.GIF | 2007-03-24 02:58 | 5.4K | |
![[ ]](/icons/unknown.gif) | H. P. Lovecraft - A gonosz lelkész.rar | 2007-03-24 02:55 | 5.4K | |
![[TXT]](/icons/text.gif) | menu.js | 2007-04-15 15:23 | 5.4K | |
![[ ]](/icons/unknown.gif) | ALOMA.ZIP | 2007-03-24 02:49 | 5.4K | |
![[TXT]](/icons/text.gif) | oroklet.htm | 2006-08-24 18:23 | 5.4K | |
![[ ]](/icons/compressed.gif) | Lem, Stanislaw_Hogyan maradt meg a világ - novella - word.zip | 2006-01-07 09:03 | 5.4K | |
![[ ]](/icons/compressed.gif) | Az éjszaka.htm.zip | 2007-03-24 02:55 | 5.4K | |
![[TXT]](/icons/text.gif) | osrobban.txt | 2007-03-24 02:58 | 5.4K | |
![[TXT]](/icons/text.gif) | Marhapörköltek .txt | 2007-03-24 02:59 | 5.4K | |
![[ ]](/icons/compressed.gif) | Herbert W. Franke - Az uvegvaros.zip | 2006-05-29 11:04 | 5.3K | |
![[ ]](/icons/unknown.gif) | Koli kaják.rar | 2007-03-24 02:59 | 5.3K | |
![[ ]](/icons/unknown.gif) | Sambucus - Haláli.rtf | 2006-06-25 07:15 | 5.3K | |
![[ ]](/icons/compressed.gif) | Herbert W. Franke - A szazlabuak.zip | 2006-05-29 11:03 | 5.3K | |
![[TXT]](/icons/text.gif) | A szörnyeteg.htm | 2007-03-24 02:58 | 5.3K | |
![[ ]](/icons/compressed.gif) | Maruzs Éva_Pillangók tánca - sci-fi novella - html.zip | 2006-01-07 09:01 | 5.3K | |
![[ ]](/icons/compressed.gif) | Girard, Dian_Nincs ott semmi - sci-fi novella - html.zip | 2006-01-07 09:08 | 5.3K | |
![[ ]](/icons/unknown.gif) | H. P. Lovecraft - Polaris.rar | 2007-03-24 02:55 | 5.3K | |
![[ ]](/icons/unknown.gif) | gibson_william_idoru_ful_hu_nncl2575-6a7v1.rtf | 2007-11-14 05:13 | 5.2K | |
![[ ]](/icons/compressed.gif) | Bajzafi Ferenc_Sziszüphosz és a kapitány - sci-fi novella - html.zip | 2006-01-07 09:11 | 5.2K | |
![[ ]](/icons/compressed.gif) | Ray Bradbury - Az országút.zip | 2007-03-22 16:57 | 5.2K | |
![[TXT]](/icons/text.gif) | Fejedelmi frissensültek.txt | 2007-03-24 02:59 | 5.2K | |
![[TXT]](/icons/text.gif) | header.htm | 2007-03-24 02:53 | 5.2K | |
![[TXT]](/icons/text.gif) | Fogyókúrás receptek 2.txt | 2007-03-24 02:59 | 5.2K | |
![[ ]](/icons/compressed.gif) | Damon Knight - A kezelő.zip | 2007-03-26 15:35 | 5.2K | |
![[IMG]](/icons/image2.gif) | SAUL.JPG | 2007-03-24 02:58 | 5.2K | |
![[ ]](/icons/unknown.gif) | brooks_terry_shannara_a_kard_ful.rtf | 2007-02-08 17:03 | 5.2K | |
![[ ]](/icons/unknown.gif) | A más istenek.rar | 2007-03-24 02:55 | 5.1K | |
![[ ]](/icons/unknown.gif) | E-SZAMOK.MEK | 2007-03-24 02:59 | 5.1K | |
![[ ]](/icons/unknown.gif) | Petruz - Rémesék.rtf | 2006-06-25 06:37 | 5.1K | |
![[TXT]](/icons/text.gif) | Aperifitek.htm | 2007-03-24 02:59 | 5.1K | |
![[ ]](/icons/compressed.gif) | Mihaleczky Péter_Az ellenőröket lelövik, ugye - sci-fi novella - html.zip | 2006-01-07 09:00 | 5.1K | |
![[TXT]](/icons/text.gif) | bilokaci.txt | 2007-03-24 02:58 | 5.1K | |
![[IMG]](/icons/image2.gif) | CSOMBOR.JPG | 2007-03-24 02:59 | 5.1K | |
![[ ]](/icons/compressed.gif) | vendetta.zip | 2007-03-24 02:57 | 5.1K | |
![[ ]](/icons/unknown.gif) | asimov_kavics_az_ egben_fulszoveg.rtf | 2007-11-13 22:04 | 5.1K | |
![[ ]](/icons/compressed.gif) | Karádi Kázmér_Játszd újra Titanic - sci-fi novella - html.zip | 2006-01-07 09:06 | 5.1K | |
![[ ]](/icons/unknown.gif) | Az vr legmélyén fvlszöveg.rtf | 2007-11-13 22:55 | 5.0K | |
![[ ]](/icons/compressed.gif) | Arany Sárkány, Ezüst Szél.htm.zip | 2007-03-24 02:59 | 5.0K | |
![[ ]](/icons/compressed.gif) | Ázott kenyér.zip | 2007-03-24 02:56 | 5.0K | |
![[ ]](/icons/compressed.gif) | Robert Sheckley - A test.zip | 2006-05-29 11:22 | 5.0K | |
![[ ]](/icons/compressed.gif) | Dmitrij Alekszandrovics Bilenkin - Pokolian modern.zip | 2007-03-21 19:26 | 5.0K | |
![[ ]](/icons/compressed.gif) | maupassant_vendetta.zip | 2007-03-24 02:55 | 5.0K | |
![[ ]](/icons/compressed.gif) | maupassant_-_vendetta.zip | 2004-06-21 11:42 | 5.0K | |
![[ ]](/icons/compressed.gif) | Maupassant - Vendetta.zip | 2006-05-29 11:12 | 5.0K | |
![[TXT]](/icons/text.gif) | menu_items.js | 2007-04-15 15:23 | 5.0K | |
![[TXT]](/icons/text.gif) | menu_items.j | 2007-04-15 14:13 | 5.0K | |
![[IMG]](/icons/image2.gif) | Yrerre_Fogado.gif | 2007-04-15 14:46 | 5.0K | |
![[ ]](/icons/compressed.gif) | Maruzs Éva_Nagyságrendek - sci-fi novella - html.zip | 2006-01-07 09:01 | 5.0K | |
![[TXT]](/icons/text.gif) | oleldmeg.txt | 2007-03-24 02:58 | 5.0K | |
![[ ]](/icons/compressed.gif) | Ambrose Bierce - Ebolaj.zip | 2006-05-29 10:59 | 5.0K | |
![[ ]](/icons/unknown.gif) | Edmond Hamilton-A szamkivetett.ZIP | 2007-03-24 02:53 | 5.0K | |
![[ ]](/icons/compressed.gif) | Hamilton, Edmond_A számkivetett - sci-fi novella - html.zip | 2006-01-07 09:06 | 5.0K | |
![[ ]](/icons/compressed.gif) | Mempo Giardinelli-Borges elveszett konyve.zip | 2007-03-24 02:57 | 5.0K | |
![[TXT]](/icons/text.gif) | akiksoha.txt | 2007-03-24 02:58 | 5.0K | |
![[ ]](/icons/compressed.gif) | Maruzs Éva_Közeledik - sci-fi novella - html.zip | 2006-01-07 09:01 | 4.9K | |
![[ ]](/icons/compressed.gif) | En la noche.htm.zip | 2007-03-24 02:59 | 4.9K | |
![[ ]](/icons/unknown.gif) | hoszakad.ace | 2007-03-24 02:52 | 4.9K | |
![[TXT]](/icons/text.gif) | hatodik.txt | 2007-03-24 02:58 | 4.9K | |
![[ ]](/icons/unknown.gif) | Koncz Ferenc-hullocsillag | 2007-03-24 02:56 | 4.9K | |
![[IMG]](/icons/image2.gif) | SAVGAM01.HDR | 2006-09-16 22:52 | 4.9K | |
![[IMG]](/icons/image2.gif) | SAVGAM00.HDR | 2006-09-16 22:52 | 4.9K | |
![[ ]](/icons/compressed.gif) | Herbert W. Franke - Taviranyitas.zip | 2006-05-29 11:08 | 4.9K | |
![[ ]](/icons/compressed.gif) | Ray Bradbury - A gyalogjáró.zip | 2007-03-22 16:55 | 4.9K | |
![[ ]](/icons/compressed.gif) | A repül_ masina.htm.zip | 2007-03-24 02:59 | 4.9K | |
![[TXT]](/icons/text.gif) | kolumbus.txt | 2007-03-24 02:58 | 4.9K | |
![[ ]](/icons/unknown.gif) | nemere_istvan_a_kozmosz_korbacsa_ful_hu_nncl656-3d3v3.rtf | 2006-07-13 18:01 | 4.9K | |
![[TXT]](/icons/text.gif) | Ételekbe való fuszerek.txt | 2007-03-24 02:59 | 4.9K | |
![[TXT]](/icons/text.gif) | Ételekbe való fűszerek.txt | 2007-03-24 02:59 | 4.9K | |
![[ ]](/icons/unknown.gif) | Családi regény sor (CS) | 2007-04-15 14:54 | 4.8K | |
![[TXT]](/icons/text.gif) | idotleni.txt | 2007-03-24 02:58 | 4.8K | |
![[TXT]](/icons/text.gif) | fogyaszt.htm | 2007-03-24 02:53 | 4.8K | |
![[TXT]](/icons/text.gif) | eletment.txt | 2007-03-24 02:58 | 4.8K | |
![[TXT]](/icons/text.gif) | FOGYASZT.HTM | 2007-03-24 02:59 | 4.8K | |
![[TXT]](/icons/text.gif) | Találkoztam anyámmal.htm | 2007-03-24 02:52 | 4.8K | |
![[TXT]](/icons/text.gif) | benordog.txt | 2007-03-24 02:58 | 4.8K | |
![[TXT]](/icons/text.gif) | esocsina.txt | 2007-03-24 02:58 | 4.8K | |
![[TXT]](/icons/text.gif) | Melyik fuszer mibe jó.txt | 2007-03-24 02:59 | 4.8K | |
![[TXT]](/icons/text.gif) | Melyik fűszer mibe jó.txt | 2007-03-24 02:59 | 4.8K | |
![[TXT]](/icons/text.gif) | tevedes.txt | 2007-03-24 02:58 | 4.8K | |
![[ ]](/icons/compressed.gif) | Robert E Howard-Az aranykoponya atka.zip | 2007-03-24 02:59 | 4.8K | |
![[TXT]](/icons/text.gif) | utazjovo.txt | 2007-03-24 02:58 | 4.8K | |
![[TXT]](/icons/text.gif) | karma.htm | 2007-03-24 02:53 | 4.8K | |
![[TXT]](/icons/text.gif) | varazsve.txt | 2007-03-24 02:58 | 4.8K | |
![[ ]](/icons/unknown.gif) | twillight - Az utolsó varázslat.rtf | 2006-06-25 07:22 | 4.8K | |
![[IMG]](/icons/image2.gif) | DEAN.JPG | 2007-03-24 02:58 | 4.8K | |
![[ ]](/icons/compressed.gif) | Isaac Asimov - A pokol tüze.zip | 2007-03-22 05:29 | 4.7K | |
![[IMG]](/icons/image2.gif) | KING.JPG | 2007-03-24 02:58 | 4.7K | |
![[ ]](/icons/compressed.gif) | Az országút.htm.zip | 2007-03-24 02:59 | 4.7K | |
![[TXT]](/icons/text.gif) | WIANDT.CSS | 2007-03-24 02:59 | 4.7K | |
![[ ]](/icons/compressed.gif) | Vendetta.htm.zip | 2007-03-24 02:55 | 4.7K | |
![[ ]](/icons/compressed.gif) | Gulyás Sándor_Négydimenziós álom - sci-fi novella - html.zip | 2006-01-07 09:08 | 4.7K | |
![[TXT]](/icons/text.gif) | reghipno.txt | 2007-03-24 02:58 | 4.7K | |
![[ ]](/icons/compressed.gif) | Sóvárgás.htm.zip | 2007-03-24 02:59 | 4.7K | |
![[ ]](/icons/compressed.gif) | Robert Sheckley - Retteges az ejszakaban.zip | 2006-05-29 11:23 | 4.7K | |
![[ ]](/icons/compressed.gif) | Robert Sheckley - Rettegés az éjszakában.zip | 2007-03-26 18:49 | 4.7K | |
![[ ]](/icons/compressed.gif) | Paracelsus rózsája.zip | 2007-03-24 02:56 | 4.7K | |
![[TXT]](/icons/text.gif) | verhat.txt | 2007-03-24 02:58 | 4.7K | |
![[TXT]](/icons/text.gif) | vakjosno.txt | 2007-03-24 02:58 | 4.7K | |
![[TXT]](/icons/text.gif) | Sangriák.htm | 2007-03-24 02:59 | 4.6K | |
![[ ]](/icons/compressed.gif) | Hidy Mátyás_Zuhanás - sci-fi novella - html.zip | 2006-01-07 09:06 | 4.6K | |
![[ ]](/icons/unknown.gif) | tuzzo.ace | 2007-03-24 02:52 | 4.6K | |
![[TXT]](/icons/text.gif) | szellems.txt | 2007-03-24 02:58 | 4.6K | |
![[ ]](/icons/unknown.gif) | Örkény István - Budapest.rtf | 2006-06-25 07:36 | 4.6K | |
![[ ]](/icons/compressed.gif) | ansaloni_kalendarium.zip | 2006-05-10 06:19 | 4.6K | |
![[ ]](/icons/unknown.gif) | orangyal.ace | 2007-03-24 02:52 | 4.6K | |
![[TXT]](/icons/text.gif) | mihullik.txt | 2007-03-24 02:58 | 4.6K | |
![[TXT]](/icons/text.gif) | tolkienv.TXT | 2007-03-24 02:54 | 4.6K | |
![[TXT]](/icons/text.gif) | noebarka.txt | 2007-03-24 02:58 | 4.6K | |
![[ ]](/icons/unknown.gif) | Gombareceptek.rar | 2007-03-24 02:59 | 4.6K | |
![[ ]](/icons/compressed.gif) | Nemere István_Szörny az űrben - novella - txt.zip | 2006-01-07 08:57 | 4.6K | |
![[TXT]](/icons/text.gif) | laborpar.txt | 2007-03-24 02:58 | 4.6K | |
![[ ]](/icons/unknown.gif) | Margaret Weis és Don Perrin_Halálbrigád (Káosz háború 1.) fülszöveg.rtf | 2005-02-25 11:09 | 4.6K | |
![[TXT]](/icons/text.gif) | tfonok.txt | 2007-03-24 02:58 | 4.6K | |
![[TXT]](/icons/text.gif) | szorny.txt | 2007-03-24 02:58 | 4.6K | |
![[ ]](/icons/compressed.gif) | Juhász György_Relativitás - sci-fi novella - html.zip | 2006-01-07 09:05 | 4.6K | |
![[ ]](/icons/compressed.gif) | asimov_isaac_a_pokol_tuze_hu_doc.zip | 2007-03-24 02:55 | 4.6K | |
![[TXT]](/icons/text.gif) | rontgena.txt | 2007-03-24 02:58 | 4.6K | |
![[ ]](/icons/compressed.gif) | Dóka Péter_Védelmi rendszer - sci-fi novella - html.zip | 2006-01-07 09:09 | 4.5K | |
![[ ]](/icons/unknown.gif) | Rubin Gábor - Acélöklű bátor Joe.rtf | 2006-07-10 20:47 | 4.5K | |
![[TXT]](/icons/text.gif) | Káposzta savanyitás.txt | 2007-03-24 02:59 | 4.5K | |
![[TXT]](/icons/text.gif) | gyanusta.txt | 2007-03-24 02:58 | 4.5K | |
![[ ]](/icons/compressed.gif) | j-ch._pichon_-_a_gép.zip | 2004-06-21 11:42 | 4.5K | |
![[ ]](/icons/compressed.gif) | J-Ch. Pichon - A gép.zip | 2006-05-29 11:12 | 4.5K | |
![[TXT]](/icons/text.gif) | A nagyi hív.htm | 2007-03-24 02:52 | 4.5K | |
![[ ]](/icons/unknown.gif) | brooks_terry_shannara_az elso_kiraly_fül.rtf | 2007-02-08 18:05 | 4.5K | |
![[ ]](/icons/compressed.gif) | bittmann_stefan_novella_a_kornyezetrol.zip | 2007-03-24 03:00 | 4.5K | |
![[ ]](/icons/compressed.gif) | BittmannNovella.zip | 2007-02-21 16:33 | 4.5K | |
![[ ]](/icons/unknown.gif) | A gonosz lelkész.rar | 2007-03-24 02:55 | 4.5K | |
![[ ]](/icons/compressed.gif) | Ray Bradbury - Hímzés.zip | 2007-03-22 16:59 | 4.5K | |
![[TXT]](/icons/text.gif) | masvilag.txt | 2007-03-24 02:58 | 4.5K | |
![[TXT]](/icons/text.gif) | szerelem.txt | 2007-03-24 02:58 | 4.5K | |
![[ ]](/icons/compressed.gif) | Györfi-Deák György_Az angyalok tükre - sci-fi novella - html.zip | 2006-01-07 09:07 | 4.4K | |
![[TXT]](/icons/text.gif) | kert.txt | 2007-03-24 02:58 | 4.4K | |
![[ ]](/icons/compressed.gif) | al_nussbaum_-_könnyű_préda.zip | 2004-06-21 11:42 | 4.4K | |
![[ ]](/icons/compressed.gif) | Az utolsó meló.htm.zip | 2007-03-24 03:00 | 4.4K | |
![[TXT]](/icons/text.gif) | tavcsore.txt | 2007-03-24 02:58 | 4.4K | |
![[TXT]](/icons/text.gif) | latnokok.txt | 2007-03-24 02:58 | 4.4K | |
![[ ]](/icons/compressed.gif) | A gyalogjáró.htm.zip | 2007-03-24 02:59 | 4.4K | |
![[ ]](/icons/unknown.gif) | webster_malcolm_a_jedi_hatalma_fulszoveg.rtf | 2007-03-24 02:54 | 4.4K | |
![[ ]](/icons/unknown.gif) | A sólyom-foki halász.rar | 2007-03-24 02:55 | 4.4K | |
![[ ]](/icons/unknown.gif) | Big MacR.doc | 2007-03-24 02:59 | 4.4K | |
![[TXT]](/icons/text.gif) | urboljot.txt | 2007-03-24 02:58 | 4.4K | |
![[ ]](/icons/compressed.gif) | Frederic Brown - A fegyver.zip | 2007-03-22 17:43 | 4.4K | |
![[TXT]](/icons/text.gif) | Rácponty.txt | 2007-03-24 02:59 | 4.4K | |
![[TXT]](/icons/text.gif) | Levesbetétek.txt | 2007-03-24 02:59 | 4.4K | |
![[ ]](/icons/compressed.gif) | Juhász György_Vérrák - sci-fi novella - html.zip | 2006-01-07 09:05 | 4.4K | |
![[TXT]](/icons/text.gif) | fkullo.txt | 2007-03-24 02:58 | 4.4K | |
![[TXT]](/icons/text.gif) | nyomaves.txt | 2007-03-24 02:58 | 4.4K | |
![[TXT]](/icons/text.gif) | felyukak.txt | 2007-03-24 02:58 | 4.4K | |
![[TXT]](/icons/text.gif) | vanvelet.txt | 2007-03-24 02:58 | 4.4K | |
![[TXT]](/icons/text.gif) | ESZAMOK.HTM | 2007-03-24 02:59 | 4.4K | |
![[TXT]](/icons/text.gif) | bermuda.txt | 2007-03-24 02:58 | 4.3K | |
![[TXT]](/icons/text.gif) | csatater.txt | 2007-03-24 02:58 | 4.3K | |
![[TXT]](/icons/text.gif) | csoda.txt | 2007-03-24 02:58 | 4.3K | |
![[ ]](/icons/unknown.gif) | Selmeci György - A roncsban.rtf | 2006-07-10 20:47 | 4.3K | |
![[ ]](/icons/compressed.gif) | king_stephen_a_koldus_es_a_gyemant.zip | 2007-03-24 03:00 | 4.3K | |
![[ ]](/icons/compressed.gif) | Fredric Brown - A fegyver.zip | 2007-03-22 17:44 | 4.3K | |
![[TXT]](/icons/text.gif) | ragadozo.txt | 2007-03-24 02:58 | 4.3K | |
![[ ]](/icons/compressed.gif) | Lovecraft, Howard Philips_A feledés fátyla - novella - rtf.zip | 2006-01-07 09:03 | 4.3K | |
![[ ]](/icons/compressed.gif) | brown_fredric_valasz.zip | 2007-03-24 02:54 | 4.3K | |
![[ ]](/icons/unknown.gif) | Petruz - Rémesék 2.rtf | 2006-06-25 06:37 | 4.3K | |
![[ ]](/icons/unknown.gif) | Polaris.rar | 2007-03-24 02:55 | 4.3K | |
![[TXT]](/icons/text.gif) | eltuntha.txt | 2007-03-24 02:58 | 4.3K | |
![[ ]](/icons/compressed.gif) | Hidy Mátyás_Sztónia - sci-fi novella - html.zip | 2006-01-07 09:06 | 4.3K | |
![[ ]](/icons/compressed.gif) | Herbert W. Franke - Vigyazat, gyalogosok!.zip | 2006-05-29 11:09 | 4.3K | |
![[ ]](/icons/compressed.gif) | Ervin Ounappu-A Hold.zip | 2007-03-24 02:53 | 4.3K | |
![[TXT]](/icons/text.gif) | negyedik.txt | 2007-03-24 02:58 | 4.3K | |
![[TXT]](/icons/text.gif) | eszamok.htm | 2007-03-24 02:53 | 4.3K | |
![[TXT]](/icons/text.gif) | orokelet.txt | 2007-03-24 02:58 | 4.3K | |
![[TXT]](/icons/text.gif) | ismeleny.txt | 2007-03-24 02:58 | 4.3K | |
![[ ]](/icons/compressed.gif) | A Világ utolsó éjszakája.htm.zip | 2007-03-24 02:59 | 4.3K | |
![[TXT]](/icons/text.gif) | nyelvzse.txt | 2007-03-24 02:58 | 4.3K | |
![[ ]](/icons/compressed.gif) | Bahnov, Vladlen_Somnambula - sci-fi novella - html.zip | 2006-01-07 09:10 | 4.3K | |
![[ ]](/icons/compressed.gif) | Karinthy F-Stanci neni,Fredi es a marki.zip | 2007-03-24 02:56 | 4.3K | |
![[ ]](/icons/unknown.gif) | H. P. Lovecraft - Ulthar macskái.rar | 2007-03-24 02:55 | 4.3K | |
![[ ]](/icons/compressed.gif) | Ray Bradbury - Már nem látom többé.zip | 2007-03-22 16:59 | 4.2K | |
![[TXT]](/icons/text.gif) | pingvin.txt | 2007-03-24 02:58 | 4.2K | |
![[TXT]](/icons/text.gif) | hanyuszt.txt | 2007-03-24 02:58 | 4.2K | |
![[TXT]](/icons/text.gif) | vbosszu.txt | 2007-03-24 02:58 | 4.2K | |
![[TXT]](/icons/text.gif) | megelozk.txt | 2007-03-24 02:58 | 4.2K | |
![[TXT]](/icons/text.gif) | mathilde.txt | 2007-03-24 02:58 | 4.2K | |
![[ ]](/icons/unknown.gif) | Sterr J E - A leghatalmasabb mágus.rtf | 2006-06-25 07:18 | 4.2K | |
![[ ]](/icons/compressed.gif) | moricz_zsigmond_het_krajcar.zip | 2007-03-24 02:58 | 4.2K | |
![[TXT]](/icons/text.gif) | ukozmosz.txt | 2007-03-24 02:58 | 4.2K | |
![[ ]](/icons/unknown.gif) | A leszármazott.rar | 2007-03-24 02:55 | 4.2K | |
![[TXT]](/icons/text.gif) | hazater.txt | 2007-03-24 02:58 | 4.2K | |
![[TXT]](/icons/text.gif) | talalman.txt | 2007-03-24 02:58 | 4.2K | |
![[TXT]](/icons/text.gif) | amikor.txt | 2007-03-24 02:58 | 4.2K | |
![[TXT]](/icons/text.gif) | megvidou.txt | 2007-03-24 02:58 | 4.2K | |
![[ ]](/icons/compressed.gif) | vonnegut_kurt_vegszavak_egy_evszazadhoz_hu_txt.zip | 2007-03-24 02:57 | 4.2K | |
![[TXT]](/icons/text.gif) | selma.txt | 2007-03-24 02:58 | 4.2K | |
![[TXT]](/icons/text.gif) | nemporla.txt | 2007-03-24 02:58 | 4.2K | |
![[TXT]](/icons/text.gif) | jeanne.txt | 2007-03-24 02:58 | 4.2K | |
![[ ]](/icons/compressed.gif) | Eric Frank Russel - Az egyetlen megoldás.zip | 2007-03-26 18:31 | 4.2K | |
![[TXT]](/icons/text.gif) | elhamvad.txt | 2007-03-24 02:58 | 4.2K | |
![[TXT]](/icons/text.gif) | eloszobo.txt | 2007-03-24 02:58 | 4.2K | |
![[TXT]](/icons/text.gif) | Álom.htm | 2007-03-24 02:54 | 4.2K | |
![[TXT]](/icons/text.gif) | borlatas.txt | 2007-03-24 02:58 | 4.2K | |
![[TXT]](/icons/text.gif) | tuzesviz.txt | 2007-03-24 02:58 | 4.2K | |
![[TXT]](/icons/text.gif) | hold.txt | 2007-03-24 02:58 | 4.2K | |
![[TXT]](/icons/text.gif) | Levesek 2.txt | 2007-03-24 02:59 | 4.2K | |
![[TXT]](/icons/text.gif) | repultek.txt | 2007-03-24 02:58 | 4.2K | |
![[ ]](/icons/compressed.gif) | Arthur C Clarke - A másik tigris.zip | 2007-03-23 13:30 | 4.2K | |
![[TXT]](/icons/text.gif) | stigma.txt | 2007-03-24 02:58 | 4.2K | |
![[TXT]](/icons/text.gif) | profetal.txt | 2007-03-24 02:58 | 4.2K | |
![[TXT]](/icons/text.gif) | vereklye.txt | 2007-03-24 02:58 | 4.2K | |
![[TXT]](/icons/text.gif) | pilhalal.txt | 2007-03-24 02:58 | 4.2K | |
![[TXT]](/icons/text.gif) | egyember.txt | 2007-03-24 02:58 | 4.2K | |
![[TXT]](/icons/text.gif) | rejtmars.txt | 2007-03-24 02:58 | 4.2K | |
![[ ]](/icons/compressed.gif) | Bajzafi Ferenc_Otthon, édes otthon - sci-fi novella - html.zip | 2006-01-07 09:11 | 4.2K | |
![[TXT]](/icons/text.gif) | polpara.txt | 2007-03-24 02:58 | 4.2K | |
![[ ]](/icons/compressed.gif) | FrankeBizalmatlansag.zip | 2007-02-21 16:26 | 4.2K | |
![[TXT]](/icons/text.gif) | emberek.txt | 2007-03-24 02:58 | 4.2K | |
![[TXT]](/icons/text.gif) | osregufo.txt | 2007-03-24 02:58 | 4.2K | |
![[TXT]](/icons/text.gif) | uzenet.txt | 2007-03-24 02:58 | 4.2K | |
![[TXT]](/icons/text.gif) | terenerg.txt | 2007-03-24 02:58 | 4.1K | |
![[TXT]](/icons/text.gif) | kudarcso.txt | 2007-03-24 02:58 | 4.1K | |
![[ ]](/icons/compressed.gif) | Ray Bradbury - A sárkány.zip | 2007-03-22 16:56 | 4.1K | |
![[ ]](/icons/compressed.gif) | Hidy Mátyás_Egyedül - sci-fi novella - html.zip | 2006-01-07 09:06 | 4.1K | |
![[TXT]](/icons/text.gif) | vilagveg.txt | 2007-03-24 02:58 | 4.1K | |
![[TXT]](/icons/text.gif) | akilatja.txt | 2007-03-24 02:58 | 4.1K | |
![[TXT]](/icons/text.gif) | atokul.txt | 2007-03-24 02:58 | 4.1K | |
![[TXT]](/icons/text.gif) | kapcsola.txt | 2007-03-24 02:58 | 4.1K | |
![[TXT]](/icons/text.gif) | darwinma.txt | 2007-03-24 02:58 | 4.1K | |
![[IMG]](/icons/image2.gif) | SZ_LECFT.GIF | 2007-03-24 03:01 | 4.1K | |
![[TXT]](/icons/text.gif) | kenergia.txt | 2007-03-24 02:58 | 4.1K | |
![[TXT]](/icons/text.gif) | Testvérgyilkosság.htm | 2007-03-24 02:54 | 4.1K | |
![[TXT]](/icons/text.gif) | Chow mein.txt | 2007-03-24 02:59 | 4.1K | |
![[ ]](/icons/compressed.gif) | Herbert W. Franke - Invazio.zip | 2006-05-29 11:08 | 4.1K | |
![[TXT]](/icons/text.gif) | kumajos.txt | 2007-03-24 02:58 | 4.1K | |
![[TXT]](/icons/text.gif) | hipnozis.txt | 2007-03-24 02:58 | 4.1K | |
![[TXT]](/icons/text.gif) | tudashau.txt | 2007-03-24 02:58 | 4.1K | |
![[TXT]](/icons/text.gif) | kozmidou.txt | 2007-03-24 02:58 | 4.1K | |
![[ ]](/icons/unknown.gif) | vegszoveg.rtf | 2007-11-13 23:15 | 4.1K | |
![[TXT]](/icons/text.gif) | idoember.txt | 2007-03-24 02:58 | 4.1K | |
![[TXT]](/icons/text.gif) | idoutazo.txt | 2007-03-24 02:58 | 4.0K | |
![[ ]](/icons/compressed.gif) | asimov_isaac_az_utolso_komp.zip | 2007-03-24 02:55 | 4.0K | |
![[TXT]](/icons/text.gif) | bioenerg.txt | 2007-03-24 02:58 | 4.0K | |
![[TXT]](/icons/text.gif) | lourdes.txt | 2007-03-24 02:58 | 4.0K | |
![[TXT]](/icons/text.gif) | kulkiser.txt | 2007-03-24 02:58 | 4.0K | |
![[TXT]](/icons/text.gif) | idegenla.txt | 2007-03-24 02:58 | 4.0K | |
![[TXT]](/icons/text.gif) | gabonakr.txt | 2007-03-24 02:58 | 4.0K | |
![[TXT]](/icons/text.gif) | Répatorta. 2.txt | 2007-03-24 02:59 | 4.0K | |
![[TXT]](/icons/text.gif) | 13.HTM | 2007-03-24 02:55 | 4.0K | |
![[ ]](/icons/compressed.gif) | Hímzés.htm.zip | 2007-03-24 02:59 | 4.0K | |
![[TXT]](/icons/text.gif) | lochness.txt | 2007-03-24 02:58 | 4.0K | |
![[TXT]](/icons/text.gif) | vilagvg.txt | 2007-03-24 02:58 | 4.0K | |
![[TXT]](/icons/text.gif) | verzoszo.txt | 2007-03-24 02:58 | 4.0K | |
![[ ]](/icons/unknown.gif) | oledata.mso | 2007-03-24 02:58 | 4.0K | |
![[TXT]](/icons/text.gif) | halottla.txt | 2007-03-24 02:58 | 4.0K | |
![[TXT]](/icons/text.gif) | urbrokon.txt | 2007-03-24 02:58 | 4.0K | |
![[TXT]](/icons/text.gif) | eltitbiz.txt | 2007-03-24 02:58 | 4.0K | |
![[TXT]](/icons/text.gif) | gombvill.txt | 2007-03-24 02:58 | 4.0K | |
![[TXT]](/icons/text.gif) | emklonok.txt | 2007-03-24 02:58 | 4.0K | |
![[TXT]](/icons/text.gif) | elatkvar.txt | 2007-03-24 02:58 | 4.0K | |
![[TXT]](/icons/text.gif) | user.cfg | 2006-09-16 22:50 | 4.0K | |
![[ ]](/icons/unknown.gif) | Demonhercegno_fulszoveg.rtf | 2007-03-24 02:54 | 4.0K | |
![[TXT]](/icons/text.gif) | Fogyókúrás receptek.txt | 2007-03-24 02:59 | 4.0K | |
![[TXT]](/icons/text.gif) | egpogyer.txt | 2007-03-24 02:58 | 4.0K | |
![[TXT]](/icons/text.gif) | titkvila.txt | 2007-03-24 02:58 | 4.0K | |
![[TXT]](/icons/text.gif) | tektudas.txt | 2007-03-24 02:58 | 4.0K | |
![[TXT]](/icons/text.gif) | gyogyitk.txt | 2007-03-24 02:58 | 4.0K | |
![[TXT]](/icons/text.gif) | stigmak.txt | 2007-03-24 02:58 | 4.0K | |
![[TXT]](/icons/text.gif) | foldtech.txt | 2007-03-24 02:58 | 4.0K | |
![[ ]](/icons/compressed.gif) | brown_fredric_a_fegyver.zip | 2007-03-24 02:54 | 4.0K | |
![[ ]](/icons/unknown.gif) | A szörnyű öregember.rar | 2007-03-24 02:55 | 4.0K | |
![[TXT]](/icons/text.gif) | Digestivek és pick-me-up-ok.htm | 2007-03-24 02:59 | 3.9K | |
![[TXT]](/icons/text.gif) | koddeval.txt | 2007-03-24 02:58 | 3.9K | |
![[ ]](/icons/unknown.gif) | San - A rakpart kövén ültem én.rtf | 2006-06-25 07:16 | 3.9K | |
![[ ]](/icons/unknown.gif) | ido.ace | 2007-03-24 02:52 | 3.9K | |
![[ ]](/icons/unknown.gif) | A VARÁZSDOBOZ SZELLEME.ace | 2007-03-24 03:00 | 3.9K | |
![[TXT]](/icons/text.gif) | melolato.txt | 2007-03-24 02:58 | 3.9K | |
![[TXT]](/icons/text.gif) | tmfelett.txt | 2007-03-24 02:58 | 3.9K | |
![[TXT]](/icons/text.gif) | masvilgk.txt | 2007-03-24 02:58 | 3.9K | |
![[TXT]](/icons/text.gif) | atomrobb.txt | 2007-03-24 02:58 | 3.9K | |
![[TXT]](/icons/text.gif) | Koktélok.htm | 2007-03-24 02:59 | 3.9K | |
![[TXT]](/icons/text.gif) | polterge.txt | 2007-03-24 02:58 | 3.9K | |
![[TXT]](/icons/text.gif) | ufokutat.txt | 2007-03-24 02:58 | 3.9K | |
![[TXT]](/icons/text.gif) | edes.htm | 2007-03-24 02:53 | 3.9K | |
![[ ]](/icons/compressed.gif) | Renier, Raoul, vagyis Kornya Zsolt_Logosz - html.zip | 2006-01-07 08:54 | 3.9K | |
![[TXT]](/icons/text.gif) | szalaman.txt | 2007-03-24 02:58 | 3.9K | |
![[TXT]](/icons/text.gif) | EDES.HTM | 2007-03-24 02:59 | 3.9K | |
![[ ]](/icons/compressed.gif) | Frederic Brown - Kapcsolat.zip | 2007-03-22 17:44 | 3.9K | |
![[ ]](/icons/unknown.gif) | Sterr J E - Megint játék.rtf | 2006-06-25 07:18 | 3.9K | |
![[TXT]](/icons/text.gif) | felelem.txt | 2007-03-24 02:58 | 3.9K | |
![[TXT]](/icons/text.gif) | zakadaly.txt | 2007-03-24 02:58 | 3.9K | |
![[TXT]](/icons/text.gif) | halebopp.txt | 2007-03-24 02:58 | 3.9K | |
![[ ]](/icons/compressed.gif) | james_gunn_-_szerelem.zip | 2004-06-21 11:42 | 3.9K | |
![[ ]](/icons/compressed.gif) | James Gunn - Szerelem.zip | 2006-05-29 11:12 | 3.9K | |
![[TXT]](/icons/text.gif) | betegseg.txt | 2007-03-24 02:58 | 3.9K | |
![[ ]](/icons/unknown.gif) | 47.rtf | 2007-11-13 22:36 | 3.9K | |
![[ ]](/icons/compressed.gif) | Maruzs Éva_Szörnyike - sci-fi novella - html.zip | 2006-01-07 09:01 | 3.8K | |
![[TXT]](/icons/text.gif) | varazslo.txt | 2007-03-24 02:58 | 3.8K | |
![[ ]](/icons/compressed.gif) | A Sárkány.htm.zip | 2007-03-24 02:59 | 3.8K | |
![[ ]](/icons/compressed.gif) | terry_bisson_-_nyomd_le_annát.zip | 2004-06-21 11:42 | 3.8K | |
![[ ]](/icons/compressed.gif) | Terry Bisson - Nyomd le Annát.zip | 2006-05-29 11:27 | 3.8K | |
![[TXT]](/icons/text.gif) | idocsapd.txt | 2007-03-24 02:58 | 3.8K | |
![[TXT]](/icons/text.gif) | kijatsz.txt | 2007-03-24 02:58 | 3.8K | |
![[TXT]](/icons/text.gif) | Keresztez_dés.htm | 2007-03-24 02:54 | 3.8K | |
![[ ]](/icons/unknown.gif) | Alapítvány és Föld_fülszöveg.rtf | 2007-11-14 00:22 | 3.8K | |
![[TXT]](/icons/text.gif) | pszichos.txt | 2007-03-24 02:58 | 3.8K | |
![[ ]](/icons/compressed.gif) | Herbert W. Franke - Targyalas.zip | 2006-05-29 11:08 | 3.8K | |
![[ ]](/icons/compressed.gif) | Ursula K Le Guin - A fehér szamár.zip | 2007-03-26 15:44 | 3.8K | |
![[TXT]](/icons/text.gif) | 00.HTM | 2007-03-24 02:55 | 3.8K | |
![[TXT]](/icons/text.gif) | mumia.txt | 2007-03-24 02:58 | 3.8K | |
![[TXT]](/icons/text.gif) | iroatka.txt | 2007-03-24 02:58 | 3.8K | |
![[TXT]](/icons/text.gif) | nevestud.txt | 2007-03-24 02:58 | 3.8K | |
![[ ]](/icons/compressed.gif) | Bihari Péter_Áramszünet - sci-fi novella - html.zip | 2006-01-07 09:13 | 3.8K | |
![[ ]](/icons/unknown.gif) | orpheus.ace | 2007-03-24 02:52 | 3.8K | |
![[ ]](/icons/compressed.gif) | Cricket, Michael T._A vezeklés - sci-fi novella - html.zip | 2006-01-07 09:10 | 3.8K | |
![[TXT]](/icons/text.gif) | akarat.txt | 2007-03-24 02:58 | 3.8K | |
![[TXT]](/icons/text.gif) | gyozrak.txt | 2007-03-24 02:58 | 3.8K | |
![[ ]](/icons/compressed.gif) | Már nem látom többé.htm.zip | 2007-03-24 02:59 | 3.8K | |
![[ ]](/icons/compressed.gif) | Herbert W. Franke - Baratsag.zip | 2006-05-29 11:04 | 3.8K | |
![[TXT]](/icons/text.gif) | gyogykez.txt | 2007-03-24 02:58 | 3.7K | |
![[TXT]](/icons/text.gif) | foldgomb.txt | 2007-03-24 02:58 | 3.7K | |
![[ ]](/icons/unknown.gif) | H. P. Lovecraft - A sátáni kacaj.rar | 2007-03-24 02:55 | 3.7K | |
![[ ]](/icons/unknown.gif) | Koncz Ferenc-Deja Vu | 2007-03-24 02:56 | 3.7K | |
![[ ]](/icons/compressed.gif) | Herbert W. Franke - Tuzkigyok.zip | 2006-05-29 11:08 | 3.7K | |
![[ ]](/icons/compressed.gif) | varazsfuvek.zip | 2007-03-24 03:00 | 3.7K | |
![[ ]](/icons/compressed.gif) | Maruzs Éva_Gyöngy a kirakatban - sci-fi novella - html.zip | 2006-01-07 09:01 | 3.7K | |
![[TXT]](/icons/text.gif) | halalall.txt | 2007-03-24 02:58 | 3.7K | |
![[ ]](/icons/compressed.gif) | Frederic Brown - A bosszúálló flotta.zip | 2007-03-22 17:43 | 3.7K | |
![[ ]](/icons/compressed.gif) | Dmitrij Alekszandrovics Bilenkin - Eltörött az eszkuder.zip | 2007-03-21 19:26 | 3.7K | |
![[TXT]](/icons/text.gif) | bejelent.htm | 2006-08-24 18:22 | 3.7K | |
![[IMG]](/icons/image2.gif) | 1.GIF | 2007-03-24 02:59 | 3.7K | |
![[TXT]](/icons/text.gif) | IV_02.HTM | 2007-03-24 02:54 | 3.7K | |
![[TXT]](/icons/text.gif) | rejoslat.txt | 2007-03-24 02:58 | 3.7K | |
![[TXT]](/icons/text.gif) | levitaci.txt | 2007-03-24 02:58 | 3.6K | |
![[ ]](/icons/compressed.gif) | A képzelt város.zip | 2007-03-24 02:55 | 3.6K | |
![[ ]](/icons/unknown.gif) | Save01.sav | 2006-09-16 22:51 | 3.6K | |
![[TXT]](/icons/text.gif) | tulvilag.txt | 2007-03-24 02:58 | 3.6K | |
![[TXT]](/icons/text.gif) | pavlov.txt | 2007-03-24 02:58 | 3.6K | |
![[TXT]](/icons/text.gif) | A törvény kapujában.htm | 2007-03-24 02:54 | 3.6K | |
![[TXT]](/icons/text.gif) | tulihlet.txt | 2007-03-24 02:58 | 3.6K | |
![[ ]](/icons/compressed.gif) | Larry Niven - Lyukember.zip | 2007-03-26 17:46 | 3.6K | |
![[ ]](/icons/compressed.gif) | Robert Sheckley - Tökéletesasszony.zip | 2007-03-26 18:51 | 3.6K | |
![[ ]](/icons/unknown.gif) | Qu Janng Csien-Az eszmeket teljesen kifejezo beszedrol | 2007-03-24 02:58 | 3.6K | |
![[ ]](/icons/compressed.gif) | Maruzs Éva_Rázós ügy - sci-fi novella - html.zip | 2006-01-07 09:01 | 3.6K | |
![[TXT]](/icons/text.gif) | idegen.txt | 2007-03-24 02:58 | 3.6K | |
![[TXT]](/icons/text.gif) | telekine.txt | 2007-03-24 02:58 | 3.6K | |
![[ ]](/icons/compressed.gif) | Kismama.zip | 2007-03-24 02:55 | 3.6K | |
![[ ]](/icons/compressed.gif) | A lebeszélőben.zip | 2007-03-24 02:56 | 3.6K | |
![[TXT]](/icons/text.gif) | mszentek.txt | 2007-03-24 02:58 | 3.6K | |
![[ ]](/icons/compressed.gif) | Ujszövetségi Apokrif levél.zip | 2007-03-24 02:55 | 3.6K | |
![[TXT]](/icons/text.gif) | ufogyogy.txt | 2007-03-24 02:58 | 3.6K | |
![[TXT]](/icons/text.gif) | hivatalo.txt | 2007-03-24 02:58 | 3.5K | |
![[TXT]](/icons/text.gif) | malta.txt | 2007-03-24 02:58 | 3.5K | |
![[TXT]](/icons/text.gif) | tudomufo.txt | 2007-03-24 02:58 | 3.5K | |
![[ ]](/icons/compressed.gif) | Clarke, Arthur C._A másik tigris - novella - html.zip | 2006-01-07 09:10 | 3.5K | |
![[TXT]](/icons/text.gif) | IV_01.HTM | 2007-03-24 02:54 | 3.5K | |
![[TXT]](/icons/text.gif) | titkhang.txt | 2007-03-24 02:58 | 3.5K | |
![[TXT]](/icons/text.gif) | felvilla.txt | 2007-03-24 02:58 | 3.5K | |
![[TXT]](/icons/text.gif) | joslat.txt | 2007-03-24 02:58 | 3.5K | |
![[TXT]](/icons/text.gif) | regeszet.txt | 2007-03-24 02:58 | 3.5K | |
![[ ]](/icons/compressed.gif) | Bahnov, Vladlen_Hát így történt a dolog - sci-fi novella - html.zip | 2006-01-07 09:10 | 3.5K | |
![[ ]](/icons/compressed.gif) | Herbert W. Franke - Mentes.zip | 2004-06-21 11:41 | 3.5K | |
![[ ]](/icons/unknown.gif) | Nyarlathotep.rar | 2007-03-24 02:55 | 3.5K | |
![[ ]](/icons/compressed.gif) | A második tigris.zip | 2007-03-24 02:49 | 3.5K | |
![[IMG]](/icons/image2.gif) | Dungeon_also_szint.gif | 2007-04-15 15:44 | 3.5K | |
![[TXT]](/icons/text.gif) | Esterhazy-torta!.txt | 2007-03-24 02:59 | 3.5K | |
![[TXT]](/icons/text.gif) | Ételek római tálban.txt | 2007-03-24 02:59 | 3.4K | |
![[TXT]](/icons/text.gif) | rovidlat.txt | 2007-03-24 02:58 | 3.4K | |
![[ ]](/icons/compressed.gif) | Herbert W. Franke - A sebesult.zip | 2006-05-29 11:03 | 3.4K | |
![[TXT]](/icons/text.gif) | Fondan készités.txt | 2007-03-24 02:59 | 3.4K | |
![[TXT]](/icons/text.gif) | tanacsok.htm | 2007-03-24 02:53 | 3.4K | |
![[ ]](/icons/unknown.gif) | 00.rtf | 2007-11-13 22:10 | 3.4K | |
![[IMG]](/icons/image2.gif) | LEXIKA.GIF | 2007-03-24 02:58 | 3.4K | |
![[ ]](/icons/compressed.gif) | Istar Pokoljárása.zip | 2007-03-24 02:55 | 3.4K | |
![[TXT]](/icons/text.gif) | adalek.htm | 2007-03-24 02:53 | 3.4K | |
![[TXT]](/icons/text.gif) | EGESZHAT.HTM | 2007-03-24 02:59 | 3.4K | |
![[TXT]](/icons/text.gif) | jetifeny.txt | 2007-03-24 02:58 | 3.4K | |
![[TXT]](/icons/text.gif) | Kolbászos batyu, pizzás táska.txt | 2007-03-24 02:59 | 3.4K | |
![[TXT]](/icons/text.gif) | egeszhat.htm | 2007-03-24 02:53 | 3.4K | |
![[TXT]](/icons/text.gif) | ADALEK.HTM | 2007-03-24 02:59 | 3.4K | |
![[TXT]](/icons/text.gif) | ufojaras.txt | 2007-03-24 02:58 | 3.4K | |
![[TXT]](/icons/text.gif) | csodaszr.txt | 2007-03-24 02:58 | 3.4K | |
![[TXT]](/icons/text.gif) | finnugor.txt | 2007-03-24 02:58 | 3.4K | |
![[ ]](/icons/compressed.gif) | heidelore_kruge_-_fejpénz.zip | 2004-06-21 11:42 | 3.4K | |
![[ ]](/icons/compressed.gif) | Heidelore Kruge - Fejpénz.zip | 2006-05-29 11:03 | 3.4K | |
![[TXT]](/icons/text.gif) | reltunes.txt | 2007-03-24 02:58 | 3.4K | |
![[ ]](/icons/compressed.gif) | Robert Sheckley - Öt perccel korábban.zip | 2007-03-26 18:49 | 3.4K | |
![[TXT]](/icons/text.gif) | Alma pie vagy pite (amerikai recept).txt | 2007-03-24 02:59 | 3.4K | |
![[TXT]](/icons/text.gif) | Gombócok.txt | 2007-03-24 02:59 | 3.4K | |
![[ ]](/icons/compressed.gif) | Gorobovszkij, Alekszandr_A véletlen - sci-fi novella - html.zip | 2006-01-07 09:08 | 3.3K | |
![[TXT]](/icons/text.gif) | eleink.txt | 2007-03-24 02:58 | 3.3K | |
![[TXT]](/icons/text.gif) | NOVELLAK.HTM | 2007-03-24 03:01 | 3.3K | |
![[ ]](/icons/compressed.gif) | Bisson, Terry_Nyomd le Annát - sci-fi novella - html.zip | 2006-01-07 09:13 | 3.3K | |
![[ ]](/icons/compressed.gif) | Gajdács Ádám_Magány - sci-fi novella - html.zip | 2006-01-07 09:08 | 3.3K | |
![[ ]](/icons/unknown.gif) | Ulthar macskái.rar | 2007-03-24 02:55 | 3.3K | |
![[TXT]](/icons/text.gif) | Csirkemájkavalkád.txt | 2007-03-24 02:59 | 3.3K | |
![[ ]](/icons/compressed.gif) | Chance, Paul_Takarítási küszöb - sci-fi novella - html.zip | 2006-01-07 09:10 | 3.3K | |
![[ ]](/icons/compressed.gif) | Sárkány.zip | 2007-03-24 02:59 | 3.3K | |
![[IMG]](/icons/image2.gif) | alapfentitil | 2007-04-15 14:53 | 3.3K | |
![[TXT]](/icons/text.gif) | ANTIOXI.HTM | 2007-03-24 02:59 | 3.3K | |
![[TXT]](/icons/text.gif) | 04_01.HTM | 2007-03-24 02:55 | 3.3K | |
![[TXT]](/icons/text.gif) | Tudnivaló koktélokról.txt | 2007-03-24 02:59 | 3.3K | |
![[ ]](/icons/compressed.gif) | Avram Davidson - Az utolsó varázsló.zip | 2007-03-23 21:40 | 3.3K | |
![[TXT]](/icons/text.gif) | antioxi.htm | 2007-03-24 02:53 | 3.3K | |
![[ ]](/icons/compressed.gif) | Herbert W. Franke - A lelet.zip | 2006-05-29 11:03 | 3.3K | |
![[TXT]](/icons/text.gif) | megiseln.txt | 2007-03-24 02:58 | 3.3K | |
![[ ]](/icons/compressed.gif) | jörg_gernreich_-_az_öröklét_küszöbén.zip | 2004-06-21 11:42 | 3.3K | |
![[ ]](/icons/compressed.gif) | Jörg Gernreich - Az öröklét küszöbén.zip | 2006-05-29 11:12 | 3.3K | |
![[ ]](/icons/compressed.gif) | Herbert W. Franke - A bizonyitek.zip | 2004-06-21 11:41 | 3.3K | |
![[TXT]](/icons/text.gif) | tortjosl.txt | 2007-03-24 02:58 | 3.3K | |
![[TXT]](/icons/text.gif) | tulelomu.txt | 2007-03-24 02:58 | 3.3K | |
![[ ]](/icons/compressed.gif) | Brown, Frederic_A fegyver - sci-fi novella - txt.zip | 2006-01-07 09:07 | 3.2K | |
![[TXT]](/icons/text.gif) | TANACSOK.HTM | 2007-03-24 02:59 | 3.2K | |
![[TXT]](/icons/text.gif) | orvosok.txt | 2007-03-24 02:58 | 3.2K | |
![[TXT]](/icons/text.gif) | vilagfal.txt | 2007-03-24 02:58 | 3.2K | |
![[ ]](/icons/unknown.gif) | Kozmikus összecsapás fülszöveg.rtf | 2004-05-30 16:55 | 3.2K | |
![[TXT]](/icons/text.gif) | atlat.txt | 2007-03-24 02:58 | 3.2K | |
![[ ]](/icons/compressed.gif) | Herbert W. Franke - Hozott isten idehaza.zip | 2006-05-29 11:08 | 3.2K | |
![[TXT]](/icons/text.gif) | tenyerjo.txt | 2007-03-24 02:58 | 3.2K | |
![[TXT]](/icons/text.gif) | hatatele.txt | 2007-03-24 02:58 | 3.2K | |
![[TXT]](/icons/text.gif) | csodahaz.txt | 2007-03-24 02:58 | 3.2K | |
![[TXT]](/icons/text.gif) | rfodrasz.txt | 2007-03-24 02:58 | 3.2K | |
![[TXT]](/icons/text.gif) | fejszamo.txt | 2007-03-24 02:58 | 3.2K | |
![[TXT]](/icons/text.gif) | darwintk.txt | 2007-03-24 02:58 | 3.2K | |
![[TXT]](/icons/text.gif) | Fondü 2.txt | 2007-03-24 02:59 | 3.2K | |
![[TXT]](/icons/text.gif) | kulonos.txt | 2007-03-24 02:58 | 3.2K | |
![[TXT]](/icons/text.gif) | aroma.htm | 2007-03-24 02:53 | 3.2K | |
![[ ]](/icons/compressed.gif) | Cartur, Peter_A köd - sci-fi novella - html.zip | 2006-01-07 09:10 | 3.2K | |
![[TXT]](/icons/text.gif) | AROMA.HTM | 2007-03-24 02:59 | 3.2K | |
![[TXT]](/icons/text.gif) | nemcsalo.txt | 2007-03-24 02:58 | 3.2K | |
![[ ]](/icons/compressed.gif) | Herbert W. Franke - Talalmany.zip | 2006-05-29 11:08 | 3.2K | |
![[TXT]](/icons/text.gif) | fantomok.txt | 2007-03-24 02:58 | 3.2K | |
![[TXT]](/icons/text.gif) | Húsvéti étel.txt | 2007-03-24 02:59 | 3.1K | |
![[TXT]](/icons/text.gif) | Babahús.htm | 2007-03-24 02:58 | 3.1K | |
![[TXT]](/icons/text.gif) | Disznótoros receptek 15_ Sózott szalonnák.txt | 2007-03-24 02:59 | 3.1K | |
![[TXT]](/icons/text.gif) | nyivajkak.htm | 2007-03-24 02:54 | 3.1K | |
![[ ]](/icons/compressed.gif) | X-Files.zip | 2007-03-24 03:01 | 3.1K | |
![[TXT]](/icons/text.gif) | LT.HTM | 2007-03-24 02:59 | 3.1K | |
![[TXT]](/icons/text.gif) | Élesztő és finomliszt nélküli kenyér.txt | 2007-03-24 02:59 | 3.1K | |
![[ ]](/icons/unknown.gif) | H. P. Lovecraft - A feledés fátyla.rar | 2007-03-24 02:55 | 3.1K | |
![[TXT]](/icons/text.gif) | Mézes mákoslevél.txt | 2007-03-24 02:59 | 3.1K | |
![[TXT]](/icons/text.gif) | csontvaz.txt | 2007-03-24 02:58 | 3.1K | |
![[IMG]](/icons/image2.gif) | wiandtcim02222.gif | 2007-03-24 02:59 | 3.1K | |
![[TXT]](/icons/text.gif) | Koktél nevek.txt | 2007-03-24 02:59 | 3.1K | |
![[TXT]](/icons/text.gif) | bajvan.txt | 2007-03-24 02:58 | 3.1K | |
![[TXT]](/icons/text.gif) | ujelet.txt | 2007-03-24 02:58 | 3.1K | |
![[TXT]](/icons/text.gif) | Római tál.txt | 2007-03-24 02:59 | 3.1K | |
![[TXT]](/icons/text.gif) | foldreng.txt | 2007-03-24 02:58 | 3.1K | |
![[ ]](/icons/unknown.gif) | fülszöveg.rtf | 2007-11-13 21:39 | 3.1K | |
![[TXT]](/icons/text.gif) | Csirkeételek.txt | 2007-03-24 02:59 | 3.1K | |
![[TXT]](/icons/text.gif) | sorsunk.txt | 2007-03-24 02:58 | 3.1K | |
![[TXT]](/icons/text.gif) | Bodza.txt | 2007-03-24 02:59 | 3.1K | |
![[ ]](/icons/compressed.gif) | Lovecraft, Howard Philips_Emlékezet - novella - rtf.zip | 2006-01-07 09:03 | 3.1K | |
![[TXT]](/icons/text.gif) | Pizza.txt | 2007-03-24 02:59 | 3.1K | |
![[TXT]](/icons/text.gif) | MIMI.CSS | 2007-03-24 02:59 | 3.1K | |
![[ ]](/icons/compressed.gif) | Ray Bradbury - Az ajándék.zip | 2007-03-22 16:57 | 3.1K | |
![[TXT]](/icons/text.gif) | kulhalal.txt | 2007-03-24 02:58 | 3.1K | |
![[ ]](/icons/compressed.gif) | Csorba László_A nagy verseny - sci-fi novella - html.zip | 2006-01-07 09:10 | 3.1K | |
![[TXT]](/icons/text.gif) | epitkez.txt | 2007-03-24 02:58 | 3.0K | |
![[ ]](/icons/compressed.gif) | devenyi_tibor_felhivas.zip | 2007-03-24 02:52 | 3.0K | |
![[ ]](/icons/compressed.gif) | devenyi_felhivas.zip | 2007-02-21 15:59 | 3.0K | |
![[ ]](/icons/unknown.gif) | The book(eng).rar | 2007-03-24 02:55 | 3.0K | |
![[TXT]](/icons/text.gif) | hamisjos.txt | 2007-03-24 02:58 | 3.0K | |
![[ ]](/icons/compressed.gif) | Herbert W. Franke - Megkettozve.zip | 2006-05-29 11:08 | 3.0K | |
![[ ]](/icons/unknown.gif) | props.ini | 2007-03-24 02:54 | 3.0K | |
![[ ]](/icons/compressed.gif) | Mihaleczky Péter_Élmény - sci-fi novella - html.zip | 2006-01-07 09:00 | 3.0K | |
![[ ]](/icons/compressed.gif) | Pechszéria.htm.zip | 2007-03-24 03:00 | 3.0K | |
![[TXT]](/icons/text.gif) | tucsalo2.txt | 2007-03-24 02:58 | 3.0K | |
![[TXT]](/icons/text.gif) | tesla.txt | 2007-03-24 02:58 | 3.0K | |
![[TXT]](/icons/text.gif) | Forró csoki 2.txt | 2007-03-24 02:59 | 3.0K | |
![[TXT]](/icons/text.gif) | usaelnok.txt | 2007-03-24 02:58 | 3.0K | |
![[TXT]](/icons/text.gif) | foldiuze.txt | 2007-03-24 02:58 | 3.0K | |
![[ ]](/icons/unknown.gif) | Melegszendvicsek.rar | 2007-03-24 02:59 | 3.0K | |
![[TXT]](/icons/text.gif) | jegyjovo.txt | 2007-03-24 02:58 | 3.0K | |
![[TXT]](/icons/text.gif) | antidarw.txt | 2007-03-24 02:58 | 3.0K | |
![[TXT]](/icons/text.gif) | Híres sütemények.txt | 2007-03-24 02:59 | 3.0K | |
![[TXT]](/icons/text.gif) | pech.txt | 2007-03-24 02:58 | 3.0K | |
![[TXT]](/icons/text.gif) | kevertos.txt | 2007-03-24 02:58 | 3.0K | |
![[TXT]](/icons/text.gif) | vedikusi.txt | 2007-03-24 02:58 | 3.0K | |
![[TXT]](/icons/text.gif) | szuper.txt | 2007-03-24 02:58 | 3.0K | |
![[TXT]](/icons/text.gif) | higgyunk.txt | 2007-03-24 02:58 | 2.9K | |
![[IMG]](/icons/image2.gif) | HATTER.JPG | 2007-03-24 02:58 | 2.9K | |
![[TXT]](/icons/text.gif) | azgyoz.txt | 2007-03-24 02:58 | 2.9K | |
![[TXT]](/icons/text.gif) | osleves.txt | 2007-03-24 02:58 | 2.9K | |
![[TXT]](/icons/text.gif) | besznove.txt | 2007-03-24 02:58 | 2.9K | |
![[ ]](/icons/unknown.gif) | 1001.MEK | 2007-03-24 02:57 | 2.9K | |
![[TXT]](/icons/text.gif) | okorirep.txt | 2007-03-24 02:58 | 2.9K | |
![[TXT]](/icons/text.gif) | feketete.txt | 2007-03-24 02:58 | 2.9K | |
![[ ]](/icons/compressed.gif) | Kruge, Heidelore_Fejpénz - sci-fi novella - html.zip | 2006-01-07 09:05 | 2.9K | |
![[ ]](/icons/unknown.gif) | Új rendszer.ZIP | 2007-03-24 02:56 | 2.9K | |
![[TXT]](/icons/text.gif) | aidsnelk.txt | 2007-03-24 02:58 | 2.9K | |
![[TXT]](/icons/text.gif) | techkise.txt | 2007-03-24 02:58 | 2.9K | |
![[TXT]](/icons/text.gif) | osrobb.txt | 2007-03-24 02:58 | 2.9K | |
![[ ]](/icons/compressed.gif) | Maruzs Éva_Az az ostoba számítógép - sci-fi novella - html.zip | 2006-01-07 09:01 | 2.9K | |
![[TXT]](/icons/text.gif) | vaneelet.txt | 2007-03-24 02:58 | 2.9K | |
![[ ]](/icons/compressed.gif) | Herbert W. Franke - A raketa.zip | 2006-05-29 11:03 | 2.9K | |
![[ ]](/icons/compressed.gif) | Harry Harrison-Csak en virasztok.zip | 2007-03-24 02:55 | 2.8K | |
![[TXT]](/icons/text.gif) | mitoszro.txt | 2007-03-24 02:58 | 2.8K | |
![[TXT]](/icons/text.gif) | nepigymr.txt | 2007-03-24 02:58 | 2.8K | |
![[TXT]](/icons/text.gif) | Fogyókúrás étrend.txt | 2007-03-24 02:59 | 2.8K | |
![[TXT]](/icons/text.gif) | sport.txt | 2007-03-24 02:58 | 2.8K | |
![[TXT]](/icons/text.gif) | titanic.txt | 2007-03-24 02:58 | 2.8K | |
![[ ]](/icons/compressed.gif) | Boleska Gábor_A kísérlet - sci-fi novella - html.zip | 2006-01-07 09:12 | 2.8K | |
![[ ]](/icons/unknown.gif) | H. P. Lovecraft - A dolog a holdfényben.rar | 2007-03-24 02:55 | 2.8K | |
![[ ]](/icons/compressed.gif) | Gernreich, Jörg_Az öröklét küszöbén - sci-fi novella - html.zip | 2006-01-07 09:08 | 2.8K | |
![[TXT]](/icons/text.gif) | Halál.htm | 2007-03-24 02:58 | 2.8K | |
![[TXT]](/icons/text.gif) | Joghurtos suti.txt | 2007-03-24 02:59 | 2.8K | |
![[ ]](/icons/compressed.gif) | Angela Carter-Farkasember.zip | 2007-03-24 02:49 | 2.8K | |
![[ ]](/icons/compressed.gif) | Herbert W. Franke - Ut az ismeretlenbe.zip | 2006-05-29 11:09 | 2.8K | |
![[TXT]](/icons/text.gif) | SURITO.HTM | 2007-03-24 02:59 | 2.8K | |
![[TXT]](/icons/text.gif) | Öntetek.txt | 2007-03-24 02:59 | 2.7K | |
![[ ]](/icons/compressed.gif) | poeversek.zip | 2007-03-24 02:53 | 2.7K | |
![[TXT]](/icons/text.gif) | eletprog.txt | 2007-03-24 02:58 | 2.7K | |
![[IMG]](/icons/image2.gif) | POKOL.GIF | 2007-03-24 02:52 | 2.7K | |
![[TXT]](/icons/text.gif) | surito.htm | 2007-03-24 02:53 | 2.7K | |
![[TXT]](/icons/text.gif) | Kínai húsleves töltött tésztabatyukkal.txt | 2007-03-24 02:59 | 2.7K | |
![[ ]](/icons/compressed.gif) | Bihari Péter_Veszélyes éj - sci-fi novella - html.zip | 2006-01-07 09:13 | 2.7K | |
![[ ]](/icons/compressed.gif) | mikes_gyorgy_sci-fi.zip | 2007-02-21 16:12 | 2.7K | |
![[TXT]](/icons/text.gif) | Narancsos tüzdelt pulykamell.txt | 2007-03-24 02:59 | 2.7K | |
![[IMG]](/icons/image2.gif) | VER.JPG | 2007-03-24 02:58 | 2.7K | |
![[ ]](/icons/unknown.gif) | sci-fi.ace | 2007-03-24 02:52 | 2.7K | |
![[ ]](/icons/compressed.gif) | Nemere István_Most már mindörökké - novella - txt.zip | 2006-01-07 08:57 | 2.7K | |
![[ ]](/icons/compressed.gif) | Nemere István_Szökevény - novella - txt.zip | 2006-01-07 08:57 | 2.7K | |
![[ ]](/icons/unknown.gif) | H. P. Lovecraft - Amit a Hold hoz.rar | 2007-03-24 02:55 | 2.7K | |
![[TXT]](/icons/text.gif) | LIBA PÁCOLÁSA ÉS FÜSTÖLÉSE.txt | 2007-03-24 02:59 | 2.7K | |
![[ ]](/icons/compressed.gif) | Herbert W. Franke - Harc.zip | 2006-05-29 11:08 | 2.7K | |
![[ ]](/icons/compressed.gif) | Fredric Brown - A lidércálom szürkében.zip | 2007-03-22 17:44 | 2.7K | |
![[IMG]](/icons/image2.gif) | ANNE.JPG | 2007-03-24 02:58 | 2.7K | |
![[ ]](/icons/compressed.gif) | Az ajándék.htm.zip | 2007-03-24 02:59 | 2.6K | |
![[ ]](/icons/compressed.gif) | Hidy Mátyás_Eredeti Művek Bizottsága - sci-fi novella - html.zip | 2006-01-07 09:06 | 2.6K | |
![[ ]](/icons/compressed.gif) | Cabada, Carlos_Nem tudott olvasni - sci-fi novella - html.zip | 2006-01-07 09:11 | 2.6K | |
![[ ]](/icons/compressed.gif) | Alan Bloch - Az ember az másmilyen.zip | 2007-03-21 19:31 | 2.6K | |
![[ ]](/icons/compressed.gif) | Frederic Brown - A lidércálom szürkében.zip | 2007-03-22 17:43 | 2.6K | |
![[TXT]](/icons/text.gif) | Szerelmeslevél sütik.txt | 2007-03-24 02:59 | 2.6K | |
![[TXT]](/icons/text.gif) | Fácán szarvasgombával.txt | 2007-03-24 02:59 | 2.6K | |
![[ ]](/icons/unknown.gif) | Lecsós ételek.rar | 2007-03-24 02:59 | 2.6K | |
![[TXT]](/icons/text.gif) | EMULG.HTM | 2007-03-24 02:59 | 2.6K | |
![[TXT]](/icons/text.gif) | Aszalás.txt | 2007-03-24 02:59 | 2.6K | |
![[IMG]](/icons/image2.gif) | NEIL2.JPG | 2007-03-24 02:58 | 2.6K | |
![[ ]](/icons/compressed.gif) | Knight, Damon_Az időbörze - novella - txt.zip | 2006-01-07 08:52 | 2.6K | |
![[IMG]](/icons/image2.gif) | POPPY2.JPG | 2007-03-24 02:58 | 2.6K | |
![[ ]](/icons/compressed.gif) | sfrajz.zip | 2007-02-21 16:38 | 2.6K | |
![[ ]](/icons/compressed.gif) | Sinkó István - scifirajz.zip | 2006-08-24 18:24 | 2.6K | |
![[IMG]](/icons/image2.gif) | KARLOFF.JPG | 2007-03-24 02:58 | 2.6K | |
![[TXT]](/icons/text.gif) | halalmut.txt | 2007-03-24 02:58 | 2.6K | |
![[ ]](/icons/unknown.gif) | Ex Oblivione.rar | 2007-03-24 02:55 | 2.6K | |
![[IMG]](/icons/image2.gif) | 170.GIF | 2007-03-24 02:59 | 2.6K | |
![[TXT]](/icons/text.gif) | emulg.htm | 2007-03-24 02:53 | 2.6K | |
![[IMG]](/icons/image2.gif) | VISSZA.GIF | 2007-03-24 02:59 | 2.6K | |
![[IMG]](/icons/image2.gif) | SRAIMI.JPG | 2007-03-24 02:58 | 2.5K | |
![[TXT]](/icons/text.gif) | Ponty Orly-i módra.txt | 2007-03-24 02:59 | 2.5K | |
![[TXT]](/icons/text.gif) | menyasszony.htm | 2007-03-24 02:54 | 2.5K | |
![[TXT]](/icons/text.gif) | aking.htm | 2006-08-24 18:22 | 2.5K | |
![[TXT]](/icons/text.gif) | vermadar.txt | 2007-03-24 02:58 | 2.5K | |
![[TXT]](/icons/text.gif) | CIM-MENU.HTM | 2007-03-24 02:59 | 2.5K | |
![[TXT]](/icons/text.gif) | LEVESEK.HTM | 2007-03-24 02:59 | 2.5K | |
![[IMG]](/icons/image2.gif) | BARK.GIF | 2007-03-24 02:58 | 2.5K | |
![[TXT]](/icons/text.gif) | SAVANYU.HTM | 2007-03-24 02:59 | 2.5K | |
![[IMG]](/icons/image2.gif) | HR.JPG | 2007-03-24 02:52 | 2.5K | |
![[TXT]](/icons/text.gif) | Marhaszelet meggyszószban.txt | 2007-03-24 02:59 | 2.5K | |
![[TXT]](/icons/text.gif) | ujtudoma.txt | 2007-03-24 02:58 | 2.4K | |
![[ ]](/icons/compressed.gif) | Bahnov, Vladlen_A csillagokba - sci-fi novella - html.zip | 2006-01-07 09:10 | 2.4K | |
![[ ]](/icons/compressed.gif) | Herbert W. Franke - A vegzet.zip | 2006-05-29 11:03 | 2.4K | |
![[ ]](/icons/compressed.gif) | young_wayland_hilton_a_valasztas_hu_rtf.zip | 2007-03-24 03:01 | 2.4K | |
![[ ]](/icons/compressed.gif) | Ernest Hemingway-Ma pentek van.zip | 2007-03-24 02:53 | 2.4K | |
![[TXT]](/icons/text.gif) | Diós szuflé.txt | 2007-03-24 02:59 | 2.4K | |
![[TXT]](/icons/text.gif) | Halászlé.txt | 2007-03-24 02:59 | 2.4K | |
![[IMG]](/icons/image2.gif) | graf2.gif | 2007-11-13 22:08 | 2.4K | |
![[TXT]](/icons/text.gif) | ufolesen.txt | 2007-03-24 02:58 | 2.4K | |
![[TXT]](/icons/text.gif) | Nyári levesek 1_.txt | 2007-03-24 02:59 | 2.4K | |
![[TXT]](/icons/text.gif) | miregond.txt | 2007-03-24 02:58 | 2.4K | |
![[TXT]](/icons/text.gif) | savanyu.htm | 2007-03-24 02:53 | 2.4K | |
![[TXT]](/icons/text.gif) | Töltött pontyfilé.txt | 2007-03-24 02:59 | 2.4K | |
![[IMG]](/icons/image2.gif) | KAT1U.GIF | 2007-03-24 02:59 | 2.4K | |
![[IMG]](/icons/image2.gif) | POE.JPG | 2007-03-24 02:58 | 2.4K | |
![[ ]](/icons/unknown.gif) | A feledés fátyla.rar | 2007-03-24 02:55 | 2.4K | |
![[TXT]](/icons/text.gif) | tavolbal.txt | 2007-03-24 02:58 | 2.4K | |
![[IMG]](/icons/image2.gif) | WES.JPG | 2007-03-24 02:58 | 2.3K | |
![[TXT]](/icons/text.gif) | megbabra.txt | 2007-03-24 02:58 | 2.3K | |
![[TXT]](/icons/text.gif) | hihetetl.txt | 2007-03-24 02:58 | 2.3K | |
![[ ]](/icons/compressed.gif) | Bajzafi Ferenc_Egy falat, egy korty - sci-fi novella - html.zip | 2006-01-07 09:10 | 2.3K | |
![[TXT]](/icons/text.gif) | Fahejas pulyka gyumolcsokkel.txt | 2007-03-24 02:59 | 2.3K | |
![[ ]](/icons/compressed.gif) | Frederic Brown - Válasz.zip | 2007-03-22 17:44 | 2.3K | |
![[TXT]](/icons/text.gif) | Falafel és csicseriborsó saláta.txt | 2007-03-24 02:59 | 2.3K | |
![[TXT]](/icons/text.gif) | Rizses paprikás.txt | 2007-03-24 02:59 | 2.3K | |
![[IMG]](/icons/image2.gif) | SCRIPT.PNG | 2007-03-24 02:59 | 2.3K | |
![[TXT]](/icons/text.gif) | envampir.txt | 2007-03-24 02:58 | 2.3K | |
![[TXT]](/icons/text.gif) | ENZIM.HTM | 2007-03-24 02:59 | 2.3K | |
![[IMG]](/icons/image2.gif) | PERKINS.JPG | 2007-03-24 02:58 | 2.3K | |
![[ ]](/icons/unknown.gif) | A dolog a holdfényben.rar | 2007-03-24 02:55 | 2.3K | |
![[TXT]](/icons/text.gif) | Sárgarépás vagdalt.txt | 2007-03-24 02:59 | 2.3K | |
![[IMG]](/icons/image2.gif) | STRAUB2.JPG | 2007-03-24 02:58 | 2.3K | |
![[IMG]](/icons/image2.gif) | MATHESON.JPG | 2007-03-24 02:58 | 2.3K | |
![[ ]](/icons/compressed.gif) | Bugariu, Voicu_A vikingek hangja - sci-fi novella - html.zip | 2006-01-07 09:05 | 2.3K | |
![[TXT]](/icons/text.gif) | Almás csirke.txt | 2007-03-24 02:59 | 2.3K | |
![[TXT]](/icons/text.gif) | Finomfozelék.txt | 2007-03-24 02:59 | 2.3K | |
![[TXT]](/icons/text.gif) | Finomfőzelék.txt | 2007-03-24 02:59 | 2.3K | |
![[ ]](/icons/compressed.gif) | Lovecraft, Howard Phillips_Ex Oblivione - novella - html.zip | 2006-01-07 09:03 | 2.3K | |
![[TXT]](/icons/text.gif) | lincoln.txt | 2007-03-24 02:58 | 2.3K | |
![[TXT]](/icons/text.gif) | enzim.htm | 2007-03-24 02:53 | 2.3K | |
![[IMG]](/icons/image2.gif) | BRADBU.JPG | 2007-03-24 02:58 | 2.3K | |
![[IMG]](/icons/image2.gif) | ASH.JPG | 2007-03-24 02:58 | 2.2K | |
![[IMG]](/icons/image2.gif) | KOZEP.GIF | 2007-03-24 03:01 | 2.2K | |
![[TXT]](/icons/text.gif) | valasz.htm | 2006-08-24 18:24 | 2.2K | |
![[IMG]](/icons/image2.gif) | ENGLUND.JPG | 2007-03-24 02:58 | 2.2K | |
![[TXT]](/icons/text.gif) | Pulyka + csirke.txt | 2007-03-24 02:59 | 2.2K | |
![[IMG]](/icons/image2.gif) | BALRA.GIF | 2007-03-24 03:01 | 2.2K | |
![[IMG]](/icons/image2.gif) | JOBBRA.GIF | 2007-03-24 03:01 | 2.2K | |
![[TXT]](/icons/text.gif) | A baleset oka.txt | 2006-05-29 11:00 | 2.2K | |
![[TXT]](/icons/text.gif) | IMPR.HTM | 2007-03-24 02:59 | 2.2K | |
![[IMG]](/icons/image2.gif) | YOUNG.JPG | 2007-03-24 02:58 | 2.2K | |
![[IMG]](/icons/image2.gif) | ACONAND.JPG | 2007-03-24 02:58 | 2.2K | |
![[IMG]](/icons/image2.gif) | SAVINI.JPG | 2007-03-24 02:58 | 2.2K | |
![[ ]](/icons/compressed.gif) | Hidy Mátyás_Nyolcadik utas - sci-fi novella - html.zip | 2006-01-07 09:06 | 2.2K | |
![[TXT]](/icons/text.gif) | Keszeg sütve.txt | 2007-03-24 02:59 | 2.2K | |
![[TXT]](/icons/text.gif) | Márványszelet2.txt | 2007-03-24 02:59 | 2.2K | |
![[TXT]](/icons/text.gif) | Recept Stahl Judittól pizzatészta.txt | 2007-03-24 02:59 | 2.2K | |
![[TXT]](/icons/text.gif) | Paprikás tonhal tepsiben.txt | 2007-03-24 02:59 | 2.2K | |
![[TXT]](/icons/text.gif) | Alap pizzatészta Stahl Judittól.txt | 2007-03-24 02:59 | 2.2K | |
![[IMG]](/icons/image2.gif) | LUGOSIB.JPG | 2007-03-24 02:58 | 2.2K | |
![[ ]](/icons/compressed.gif) | allen_woody_aforizmak.zip | 2007-03-24 03:01 | 2.2K | |
![[TXT]](/icons/text.gif) | veletlen.txt | 2007-03-24 02:58 | 2.2K | |
![[ ]](/icons/compressed.gif) | Földvári György_Hőség - sci-fi novella - html.zip | 2006-01-07 09:08 | 2.2K | |
![[TXT]](/icons/text.gif) | Marhapörkölt burgonyagombóccal .txt | 2007-03-24 02:59 | 2.1K | |
![[TXT]](/icons/text.gif) | Juhtúrós lasagne.txt | 2007-03-24 02:59 | 2.1K | |
![[ ]](/icons/compressed.gif) | Herbert W. Franke - Eroszak.zip | 2006-05-29 11:08 | 2.1K | |
![[ ]](/icons/unknown.gif) | ZbThumbnail.info | 2007-03-24 02:54 | 2.1K | |
![[TXT]](/icons/text.gif) | Sonkás-tormás csirke.txt | 2007-03-24 02:59 | 2.1K | |
![[IMG]](/icons/image2.gif) | menu_logo1bg_100x32.gif | 2007-03-24 02:59 | 2.1K | |
![[ ]](/icons/unknown.gif) | hiba.rtf | 2007-11-13 22:01 | 2.1K | |
![[TXT]](/icons/text.gif) | Szalámik.txt | 2007-03-24 02:59 | 2.1K | |
![[IMG]](/icons/image2.gif) | 16.GIF | 2007-03-24 02:55 | 2.1K | |
![[ ]](/icons/unknown.gif) | Amit a Hold hoz.rar | 2007-03-24 02:55 | 2.1K | |
![[ ]](/icons/compressed.gif) | Herbert W. Franke - Az idegen asszony.zip | 2006-05-29 11:04 | 2.1K | |
![[ ]](/icons/compressed.gif) | Maruzs Éva_Csakugyan változnak az idők - sci-fi novella - html.zip | 2006-01-07 09:01 | 2.1K | |
![[IMG]](/icons/image2.gif) | 9.GIF | 2007-03-24 02:55 | 2.1K | |
![[TXT]](/icons/text.gif) | Mexikói csirke.txt | 2007-03-24 02:59 | 2.1K | |
![[IMG]](/icons/image2.gif) | 8.GIF | 2007-03-24 02:55 | 2.1K | |
![[TXT]](/icons/text.gif) | Gyümölcskenyér 3.txt | 2007-03-24 02:59 | 2.1K | |
![[TXT]](/icons/text.gif) | ELOSZO.HTM | 2007-03-24 02:59 | 2.1K | |
![[IMG]](/icons/image2.gif) | 15.GIF | 2007-03-24 02:55 | 2.1K | |
![[IMG]](/icons/image2.gif) | 10.GIF | 2007-03-24 02:55 | 2.1K | |
![[IMG]](/icons/image2.gif) | 14.GIF | 2007-03-24 02:55 | 2.1K | |
![[IMG]](/icons/image2.gif) | 0.GIF | 2007-03-24 02:55 | 2.1K | |
![[IMG]](/icons/image2.gif) | TONY.JPG | 2007-03-24 02:58 | 2.1K | |
![[IMG]](/icons/image2.gif) | BIER.JPG | 2007-03-24 02:58 | 2.1K | |
![[IMG]](/icons/image2.gif) | 11.GIF | 2007-03-24 02:55 | 2.1K | |
![[IMG]](/icons/image2.gif) | ROMERO.JPG | 2007-03-24 02:58 | 2.1K | |
![[IMG]](/icons/image2.gif) | 13.GIF | 2007-03-24 02:55 | 2.1K | |
![[IMG]](/icons/image2.gif) | 7.GIF | 2007-03-24 02:55 | 2.1K | |
![[TXT]](/icons/text.gif) | Gombás tonhal.txt | 2007-03-24 02:59 | 2.1K | |
![[IMG]](/icons/image2.gif) | 17.GIF | 2007-03-24 02:55 | 2.0K | |
![[IMG]](/icons/image2.gif) | 4.GIF | 2007-03-24 02:55 | 2.0K | |
![[IMG]](/icons/image2.gif) | 12.GIF | 2007-03-24 02:55 | 2.0K | |
![[IMG]](/icons/image2.gif) | 18.GIF | 2007-03-24 02:55 | 2.0K | |
![[TXT]](/icons/text.gif) | Pányi pulyka.txt | 2007-03-24 02:59 | 2.0K | |
![[IMG]](/icons/image2.gif) | 5.GIF | 2007-03-24 02:55 | 2.0K | |
![[IMG]](/icons/image2.gif) | BOSWELL.JPG | 2007-03-24 02:58 | 2.0K | |
![[IMG]](/icons/image2.gif) | 6.GIF | 2007-03-24 02:55 | 2.0K | |
![[TXT]](/icons/text.gif) | eloszo.htm | 2007-03-24 02:53 | 2.0K | |
![[IMG]](/icons/image2.gif) | LOVE2.JPG | 2007-03-24 02:58 | 2.0K | |
![[TXT]](/icons/text.gif) | Csirkemell dióval.txt | 2007-03-24 02:59 | 2.0K | |
![[ ]](/icons/compressed.gif) | Philip José Farmer - Az állatok királya.zip | 2006-05-29 11:13 | 2.0K | |
![[TXT]](/icons/text.gif) | Portói körtedesszert.txt | 2007-03-24 02:59 | 2.0K | |
![[TXT]](/icons/text.gif) | Örmény fűleves.txt | 2007-03-24 02:59 | 2.0K | |
![[TXT]](/icons/text.gif) | Tonhal steak párolt spárgával.txt | 2007-03-24 02:59 | 2.0K | |
![[ ]](/icons/compressed.gif) | Kivégzési szabályzat.htm.zip | 2007-03-24 02:58 | 2.0K | |
![[TXT]](/icons/text.gif) | impr.htm | 2007-03-24 02:53 | 2.0K | |
![[ ]](/icons/compressed.gif) | Maruzs Éva_A levél - sci-fi novella - html.zip | 2006-01-07 09:01 | 2.0K | |
![[TXT]](/icons/text.gif) | Narancslekvár mikroban.txt | 2007-03-24 02:59 | 1.9K | |
![[TXT]](/icons/text.gif) | gyilkoss.txt | 2007-03-24 02:58 | 1.9K | |
![[TXT]](/icons/text.gif) | Pita.txt | 2007-03-24 02:59 | 1.9K | |
![[TXT]](/icons/text.gif) | Padlizsánkrém.txt | 2007-03-24 02:59 | 1.9K | |
![[ ]](/icons/unknown.gif) | RKONYHA.MEK | 2007-03-24 02:59 | 1.9K | |
![[IMG]](/icons/image2.gif) | MARIO.JPG | 2007-03-24 02:58 | 1.9K | |
![[TXT]](/icons/text.gif) | Barackos morzsolt torta.txt | 2007-03-24 02:59 | 1.9K | |
![[IMG]](/icons/image2.gif) | RPG_LOGO.GIF | 2007-03-24 03:01 | 1.9K | |
![[IMG]](/icons/image2.gif) | CARP.JPG | 2007-03-24 02:58 | 1.9K | |
![[IMG]](/icons/image2.gif) | image001.gif | 2007-03-24 02:58 | 1.9K | |
![[TXT]](/icons/text.gif) | Zöldséges bárányragu.txt | 2007-03-24 02:59 | 1.9K | |
![[TXT]](/icons/text.gif) | A híd.htm | 2007-03-24 02:54 | 1.9K | |
![[TXT]](/icons/text.gif) | Monty kedvence.txt | 2007-03-24 02:59 | 1.9K | |
![[TXT]](/icons/text.gif) | Amerikai pite.txt | 2007-03-24 02:59 | 1.9K | |
![[IMG]](/icons/image2.gif) | BLATTY.JPG | 2007-03-24 02:58 | 1.9K | |
![[TXT]](/icons/text.gif) | Saláták.txt | 2007-03-24 02:59 | 1.9K | |
![[TXT]](/icons/text.gif) | IRODALOM.HTM | 2007-03-24 02:59 | 1.9K | |
![[ ]](/icons/unknown.gif) | H. P. Lovecraft - Emlékezet.rar | 2007-03-24 02:55 | 1.9K | |
![[TXT]](/icons/text.gif) | Bográcsos paprikás.txt | 2007-03-24 02:59 | 1.9K | |
![[IMG]](/icons/image2.gif) | PLESA.JPG | 2007-03-24 02:58 | 1.9K | |
![[TXT]](/icons/text.gif) | Finom morzsolt sütemény.txt | 2007-03-24 02:59 | 1.9K | |
![[TXT]](/icons/text.gif) | Sajtos uborkasaláta2.txt | 2007-03-24 02:59 | 1.8K | |
![[TXT]](/icons/text.gif) | Barna- vagy spanyol mártás.txt | 2007-03-24 02:59 | 1.8K | |
![[TXT]](/icons/text.gif) | Tonhal zöldségágyon.txt | 2007-03-24 02:59 | 1.8K | |
![[ ]](/icons/compressed.gif) | Ovidiu Bufnila-Azelveszet Amerika.zip | 2007-03-24 02:58 | 1.8K | |
![[IMG]](/icons/image2.gif) | FULCI.JPG | 2007-03-24 02:58 | 1.8K | |
![[TXT]](/icons/text.gif) | irodalom.htm | 2007-03-24 02:53 | 1.8K | |
![[ ]](/icons/unknown.gif) | Lorka,Frederico Garcia-A fekete bu romanca.ZIP | 2007-03-24 02:57 | 1.8K | |
![[TXT]](/icons/text.gif) | Sóban sült csirke.txt | 2007-03-24 02:59 | 1.8K | |
![[IMG]](/icons/image2.gif) | PINHEAD.JPG | 2007-03-24 02:58 | 1.8K | |
![[IMG]](/icons/image2.gif) | LINN.JPG | 2007-03-24 02:58 | 1.8K | |
![[TXT]](/icons/text.gif) | Tejben pácolt sertésszelet.txt | 2007-03-24 02:59 | 1.8K | |
![[TXT]](/icons/text.gif) | Szüreti marhapörkölt .txt | 2007-03-24 02:59 | 1.8K | |
![[TXT]](/icons/text.gif) | Gesztenyegerinc.txt | 2007-03-24 02:59 | 1.8K | |
![[IMG]](/icons/image2.gif) | STAT.GIF | 2007-03-24 02:59 | 1.8K | |
![[TXT]](/icons/text.gif) | Töltött pulykamell.txt | 2007-03-24 02:59 | 1.8K | |
![[IMG]](/icons/image2.gif) | STOKER.JPG | 2007-03-24 02:58 | 1.8K | |
![[TXT]](/icons/text.gif) | Kókuszos csirke 2.txt | 2007-03-24 02:59 | 1.8K | |
![[TXT]](/icons/text.gif) | Hagymás pecsenye.txt | 2007-03-24 02:59 | 1.8K | |
![[TXT]](/icons/text.gif) | Vörös citrom-koktél.htm | 2007-03-24 02:59 | 1.8K | |
![[TXT]](/icons/text.gif) | BET7.HTM | 2007-03-24 02:58 | 1.8K | |
![[TXT]](/icons/text.gif) | GARDEN.CSS | 2007-03-24 02:59 | 1.8K | |
![[TXT]](/icons/text.gif) | Nyári franciasaláta.txt | 2007-03-24 02:59 | 1.8K | |
![[TXT]](/icons/text.gif) | Pisztráng mandulával sütve.txt | 2007-03-24 02:59 | 1.7K | |
![[TXT]](/icons/text.gif) | Lasagne.txt | 2007-03-24 02:59 | 1.7K | |
![[IMG]](/icons/image2.gif) | KANE.JPG | 2007-03-24 02:58 | 1.7K | |
![[TXT]](/icons/text.gif) | Narancsdzsem 2.txt | 2007-03-24 02:59 | 1.7K | |
![[TXT]](/icons/text.gif) | Haltekercs.txt | 2007-03-24 02:59 | 1.7K | |
![[TXT]](/icons/text.gif) | Brüsszeli almatorta.txt | 2007-03-24 02:59 | 1.7K | |
![[ ]](/icons/unknown.gif) | Cseh receptek.rar | 2007-03-24 02:59 | 1.7K | |
![[TXT]](/icons/text.gif) | Kókuszos csirke.txt | 2007-03-24 02:59 | 1.7K | |
![[TXT]](/icons/text.gif) | 18.HTM | 2007-03-24 02:55 | 1.7K | |
![[TXT]](/icons/text.gif) | Csokoládés biscotti.txt | 2007-03-24 02:59 | 1.7K | |
![[IMG]](/icons/image2.gif) | LAYMON.JPG | 2007-03-24 02:58 | 1.7K | |
![[TXT]](/icons/text.gif) | Kelkáposzta fozelék.txt | 2007-03-24 02:59 | 1.7K | |
![[TXT]](/icons/text.gif) | Kelkáposzta főzelék.txt | 2007-03-24 02:59 | 1.7K | |
![[IMG]](/icons/image2.gif) | KEVIW.JPG | 2007-03-24 02:58 | 1.7K | |
![[TXT]](/icons/text.gif) | Gőzgombóc.txt | 2007-03-24 02:59 | 1.7K | |
![[TXT]](/icons/text.gif) | Különleges olasz pizza.txt | 2007-03-24 02:59 | 1.7K | |
![[TXT]](/icons/text.gif) | Gombás sonkatekercs.txt | 2007-03-24 02:59 | 1.7K | |
![[TXT]](/icons/text.gif) | fulszov.txt | 2007-11-13 20:59 | 1.7K | |
![[IMG]](/icons/image2.gif) | GUN3.JPG | 2007-03-24 02:58 | 1.7K | |
![[ ]](/icons/unknown.gif) | menu.pck | 2007-03-24 02:54 | 1.7K | |
![[TXT]](/icons/text.gif) | Nyúlmájból.txt | 2007-03-24 02:59 | 1.7K | |
![[TXT]](/icons/text.gif) | Vendégváró.txt | 2007-03-24 02:59 | 1.7K | |
![[IMG]](/icons/image2.gif) | FRED.GIF | 2007-03-24 02:58 | 1.7K | |
![[TXT]](/icons/text.gif) | Zöldséges libavagdalt.txt | 2007-03-24 02:59 | 1.7K | |
![[TXT]](/icons/text.gif) | Calvados.txt | 2007-03-24 02:59 | 1.7K | |
![[TXT]](/icons/text.gif) | Szakállasi törpeharcsa paprikás.txt | 2007-03-24 02:59 | 1.7K | |
![[TXT]](/icons/text.gif) | Fácán.txt | 2007-03-24 02:59 | 1.6K | |
![[IMG]](/icons/image2.gif) | JAMIELEE.JPG | 2007-03-24 02:58 | 1.6K | |
![[TXT]](/icons/text.gif) | Szilveszteri sajttorta.txt | 2007-03-24 02:59 | 1.6K | |
![[TXT]](/icons/text.gif) | Bodza 2.txt | 2007-03-24 02:59 | 1.6K | |
![[TXT]](/icons/text.gif) | Halfilé balkáni zöldségekkel.txt | 2007-03-24 02:59 | 1.6K | |
![[TXT]](/icons/text.gif) | Sajtos csirkefalatok.txt | 2007-03-24 02:59 | 1.6K | |
![[TXT]](/icons/text.gif) | Erdélyi rakottkáposzta.txt | 2007-03-24 02:59 | 1.6K | |
![[IMG]](/icons/image2.gif) | BLOCH.JPG | 2007-03-24 02:58 | 1.6K | |
![[TXT]](/icons/text.gif) | Kenyértészta.txt | 2007-03-24 02:59 | 1.6K | |
![[TXT]](/icons/text.gif) | Gombás tokány kapros túrógombóccal.txt | 2007-03-24 02:59 | 1.6K | |
![[TXT]](/icons/text.gif) | Tyúkhúslevesek.txt | 2007-03-24 02:59 | 1.6K | |
![[TXT]](/icons/text.gif) | Zöldséges hústekercs.txt | 2007-03-24 02:59 | 1.6K | |
![[TXT]](/icons/text.gif) | Töltött metélt.txt | 2007-03-24 02:59 | 1.6K | |
![[TXT]](/icons/text.gif) | Almás vagdalt.txt | 2007-03-24 02:59 | 1.6K | |
![[TXT]](/icons/text.gif) | Szalonnás lecsó.txt | 2007-03-24 02:59 | 1.6K | |
![[ ]](/icons/compressed.gif) | Bloch, Alan_Az ember az másmilyen - sci-fi novella - html.zip | 2006-01-07 09:12 | 1.6K | |
![[TXT]](/icons/text.gif) | Csirke ínyenceknek.txt | 2007-03-24 02:59 | 1.6K | |
![[TXT]](/icons/text.gif) | Füstöltpisztráng leves.txt | 2007-03-24 02:59 | 1.6K | |
![[TXT]](/icons/text.gif) | Csicsóka.txt | 2007-03-24 02:59 | 1.6K | |
![[TXT]](/icons/text.gif) | Ravioli tejszínmártással.txt | 2007-03-24 02:59 | 1.5K | |
![[TXT]](/icons/text.gif) | Palacsinta.txt | 2007-03-24 02:59 | 1.5K | |
![[TXT]](/icons/text.gif) | Eszterházy torta.txt | 2007-03-24 02:59 | 1.5K | |
![[IMG]](/icons/image2.gif) | BUTTON9.JPG | 2007-03-24 02:58 | 1.5K | |
![[ ]](/icons/unknown.gif) | Rimbaud,Arthur-Esti imadsag.ZIP | 2007-03-24 02:59 | 1.5K | |
![[TXT]](/icons/text.gif) | Meggyes gesztenyerolád.txt | 2007-03-24 02:59 | 1.5K | |
![[TXT]](/icons/text.gif) | Mandulás palacsinta.txt | 2007-03-24 02:59 | 1.5K | |
![[TXT]](/icons/text.gif) | Sonkagulyás.txt | 2007-03-24 02:59 | 1.5K | |
![[TXT]](/icons/text.gif) | Oszibarackparfé.txt | 2007-03-24 02:59 | 1.5K | |
![[TXT]](/icons/text.gif) | Őszibarackparfé.txt | 2007-03-24 02:59 | 1.5K | |
![[ ]](/icons/compressed.gif) | farmer_philip_jose_az_allatok_kiralya.zip | 2007-03-24 02:58 | 1.5K | |
![[TXT]](/icons/text.gif) | enncl | 2007-11-14 04:42 | 1.5K | |
![[IMG]](/icons/image2.gif) | LOGO.GIF | 2007-03-24 02:59 | 1.5K | |
![[IMG]](/icons/image2.gif) | DCRONE.JPG | 2007-03-24 02:58 | 1.5K | |
![[TXT]](/icons/text.gif) | CSOMO.HTM | 2007-03-24 02:59 | 1.5K | |
![[TXT]](/icons/text.gif) | Kovászos káposztasaláta.txt | 2007-03-24 02:59 | 1.5K | |
![[TXT]](/icons/text.gif) | menu_tpl.js | 2007-04-15 15:23 | 1.5K | |
![[TXT]](/icons/text.gif) | Fahéjas meggytorta.txt | 2007-03-24 02:59 | 1.5K | |
![[IMG]](/icons/image2.gif) | HEATHER.JPG | 2007-03-24 02:58 | 1.5K | |
![[TXT]](/icons/text.gif) | Fácán római tálban.txt | 2007-03-24 02:59 | 1.5K | |
![[TXT]](/icons/text.gif) | Baklava.txt | 2007-03-24 02:59 | 1.5K | |
![[ ]](/icons/unknown.gif) | b.class | 2007-03-24 02:54 | 1.5K | |
![[TXT]](/icons/text.gif) | Különleges fôtt csokikrém.txt | 2007-03-24 02:59 | 1.5K | |
![[TXT]](/icons/text.gif) | Farsangi fánk.txt | 2007-03-24 02:59 | 1.5K | |
![[TXT]](/icons/text.gif) | Rokfortos pulyka.txt | 2007-03-24 02:59 | 1.5K | |
![[TXT]](/icons/text.gif) | Puncstotra.txt | 2007-03-24 02:59 | 1.5K | |
![[ ]](/icons/compressed.gif) | Frederic Brown - Vége.zip | 2007-03-22 17:44 | 1.5K | |
![[TXT]](/icons/text.gif) | Dubarry módra.txt | 2007-03-24 02:59 | 1.5K | |
![[TXT]](/icons/text.gif) | Sovány kacsasült.txt | 2007-03-24 02:59 | 1.5K | |
![[TXT]](/icons/text.gif) | Fondü.txt | 2007-03-24 02:59 | 1.5K | |
![[TXT]](/icons/text.gif) | Egészséges desszertek-Édességek.txt | 2007-03-24 02:59 | 1.5K | |
![[TXT]](/icons/text.gif) | Déligyümölcs bólé.txt | 2007-03-24 02:59 | 1.5K | |
![[TXT]](/icons/text.gif) | Cipóban sült füstölt csülök.txt | 2007-03-24 02:59 | 1.5K | |
![[TXT]](/icons/text.gif) | Petrezselyemkrém-leves.txt | 2007-03-24 02:59 | 1.5K | |
![[TXT]](/icons/text.gif) | Maradékok felhasználása.txt | 2007-03-24 02:59 | 1.5K | |
![[TXT]](/icons/text.gif) | Újházy-tyúkhúsleves.txt | 2007-03-24 02:59 | 1.5K | |
![[TXT]](/icons/text.gif) | Pikáns krumplisaláta.txt | 2007-03-24 02:59 | 1.5K | |
![[TXT]](/icons/text.gif) | Hollandi mártás.txt | 2007-03-24 02:59 | 1.5K | |
![[TXT]](/icons/text.gif) | Egzotikus pulykarolad.txt | 2007-03-24 02:59 | 1.5K | |
![[TXT]](/icons/text.gif) | Tojásos-sajtos galuska.txt | 2007-03-24 02:59 | 1.5K | |
![[TXT]](/icons/text.gif) | Aranygaluska borhabbal.txt | 2007-03-24 02:59 | 1.4K | |
![[TXT]](/icons/text.gif) | Spanyol fokhagymás krumpli.txt | 2007-03-24 02:59 | 1.4K | |
![[TXT]](/icons/text.gif) | Húspuding.txt | 2007-03-24 02:59 | 1.4K | |
![[TXT]](/icons/text.gif) | Orosházi tarhonyás csirkéhez.txt | 2007-03-24 02:59 | 1.4K | |
![[TXT]](/icons/text.gif) | csomo.htm | 2007-03-24 02:53 | 1.4K | |
![[TXT]](/icons/text.gif) | Gesztenyés gombás plykatekercs.txt | 2007-03-24 02:59 | 1.4K | |
![[ ]](/icons/compressed.gif) | Isaac Asimov - Robottörténetek.zip | 2007-03-22 05:30 | 1.4K | |
![[TXT]](/icons/text.gif) | Gyümölcsös túrós lepény.txt | 2007-03-24 02:59 | 1.4K | |
![[TXT]](/icons/text.gif) | Közönséges húsleves.txt | 2007-03-24 02:59 | 1.4K | |
![[TXT]](/icons/text.gif) | Gombában sült tojás.txt | 2007-03-24 02:59 | 1.4K | |
![[TXT]](/icons/text.gif) | Rizses rakott zöldség.txt | 2007-03-24 02:59 | 1.4K | |
![[TXT]](/icons/text.gif) | Lúdláb torta.txt | 2007-03-24 02:59 | 1.4K | |
![[TXT]](/icons/text.gif) | Burgonyalepény.txt | 2007-03-24 02:59 | 1.4K | |
![[TXT]](/icons/text.gif) | Rumos banán.txt | 2007-03-24 02:59 | 1.4K | |
![[TXT]](/icons/text.gif) | Barackos kocka.txt | 2007-03-24 02:59 | 1.4K | |
![[TXT]](/icons/text.gif) | Burekas.txt | 2007-03-24 02:59 | 1.4K | |
![[TXT]](/icons/text.gif) | Hagymás lepény.txt | 2007-03-24 02:59 | 1.4K | |
![[TXT]](/icons/text.gif) | Hagymás káposztasaláta.txt | 2007-03-24 02:59 | 1.4K | |
![[TXT]](/icons/text.gif) | Gyümölcskrém formában.txt | 2007-03-24 02:59 | 1.4K | |
![[TXT]](/icons/text.gif) | Fuszeres diós-mézes torta.txt | 2007-03-24 02:59 | 1.4K | |
![[TXT]](/icons/text.gif) | Fűszeres diós-mézes torta.txt | 2007-03-24 02:59 | 1.4K | |
![[TXT]](/icons/text.gif) | Hamis gulyásleves.txt | 2007-03-24 02:59 | 1.4K | |
![[TXT]](/icons/text.gif) | Egybensült disznóból.txt | 2007-03-24 02:59 | 1.4K | |
![[TXT]](/icons/text.gif) | Csokoládés almakarikák.txt | 2007-03-24 02:59 | 1.4K | |
![[TXT]](/icons/text.gif) | Burgonyás szendvics.txt | 2007-03-24 02:59 | 1.4K | |
![[TXT]](/icons/text.gif) | Babgulyás.txt | 2007-03-24 02:59 | 1.4K | |
![[TXT]](/icons/text.gif) | Gyümölcsös sajtsaláta.txt | 2007-03-24 02:59 | 1.4K | |
![[TXT]](/icons/text.gif) | Croquetts.txt | 2007-03-24 02:59 | 1.4K | |
![[TXT]](/icons/text.gif) | Sajtos gomba.txt | 2007-03-24 02:59 | 1.4K | |
![[TXT]](/icons/text.gif) | Fondü 3.txt | 2007-03-24 02:59 | 1.4K | |
![[TXT]](/icons/text.gif) | Pácolt csirkecomb hegedus módra.txt | 2007-03-24 02:59 | 1.4K | |
![[TXT]](/icons/text.gif) | Pácolt csirkecomb hegedűs módra.txt | 2007-03-24 02:59 | 1.4K | |
![[TXT]](/icons/text.gif) | Palacsinta torta.txt | 2007-03-24 02:59 | 1.4K | |
![[TXT]](/icons/text.gif) | Júliusi krumpli.txt | 2007-03-24 02:59 | 1.4K | |
![[ ]](/icons/unknown.gif) | Azathoth(eng).rar | 2007-03-24 02:55 | 1.4K | |
![[TXT]](/icons/text.gif) | Almás palacsinta.txt | 2007-03-24 02:59 | 1.4K | |
![[TXT]](/icons/text.gif) | Téli meggyestorta.txt | 2007-03-24 02:59 | 1.4K | |
![[TXT]](/icons/text.gif) | Tejfolben gozolgo citromfuves parolt csirke.txt | 2007-03-24 02:59 | 1.4K | |
![[TXT]](/icons/text.gif) | Kaviárral töltött fánk.txt | 2007-03-24 02:59 | 1.4K | |
![[TXT]](/icons/text.gif) | Kapros túróslepény.txt | 2007-03-24 02:59 | 1.4K | |
![[TXT]](/icons/text.gif) | Töltött csirkecomb.txt | 2007-03-24 02:59 | 1.4K | |
![[TXT]](/icons/text.gif) | Parolt savanyu kaposzta tort krumplival, husi korettel vagy.txt | 2007-03-24 02:59 | 1.4K | |
![[TXT]](/icons/text.gif) | Gombás ételek.txt | 2007-03-24 02:59 | 1.4K | |
![[TXT]](/icons/text.gif) | Tyúkhúsleves zsemlegombóccal.txt | 2007-03-24 02:59 | 1.4K | |
![[TXT]](/icons/text.gif) | Csirkecomb olaszosan.txt | 2007-03-24 02:59 | 1.4K | |
![[ ]](/icons/unknown.gif) | ujonc_a_vilagurben_ful.rtf | 2007-11-13 21:20 | 1.4K | |
![[TXT]](/icons/text.gif) | Zöldséges omlett 1.txt | 2007-03-24 02:59 | 1.4K | |
![[TXT]](/icons/text.gif) | Szardíniás spagetti.txt | 2007-03-24 02:59 | 1.4K | |
![[TXT]](/icons/text.gif) | PIZZA A LA TARÁNY.txt | 2007-03-24 02:59 | 1.4K | |
![[TXT]](/icons/text.gif) | Paprikás burgonya.txt | 2007-03-24 02:59 | 1.4K | |
![[TXT]](/icons/text.gif) | Gyümölcsös túrókrém.txt | 2007-03-24 02:59 | 1.4K | |
![[TXT]](/icons/text.gif) | Csülkös krumplileves.txt | 2007-03-24 02:59 | 1.3K | |
![[TXT]](/icons/text.gif) | Joghurtos pudingtorta.txt | 2007-03-24 02:59 | 1.3K | |
![[TXT]](/icons/text.gif) | Ínyenc krumplifozelék.txt | 2007-03-24 02:59 | 1.3K | |
![[TXT]](/icons/text.gif) | Ínyenc krumplifőzelék.txt | 2007-03-24 02:59 | 1.3K | |
![[TXT]](/icons/text.gif) | sargasze.txt | 2007-03-24 02:58 | 1.3K | |
![[TXT]](/icons/text.gif) | Diós rántott csirke.txt | 2007-03-24 02:59 | 1.3K | |
![[TXT]](/icons/text.gif) | Bakonyi zsiványpecsenye.txt | 2007-03-24 02:59 | 1.3K | |
![[TXT]](/icons/text.gif) | Omlós pizza rozmaring mártással.txt | 2007-03-24 02:59 | 1.3K | |
![[TXT]](/icons/text.gif) | Pudingos piskótakocka.txt | 2007-03-24 02:59 | 1.3K | |
![[ ]](/icons/unknown.gif) | mcd.l.t.R.doc | 2007-03-24 02:59 | 1.3K | |
![[TXT]](/icons/text.gif) | Sakk tekercs.txt | 2007-03-24 02:59 | 1.3K | |
![[TXT]](/icons/text.gif) | Zabos sütik.txt | 2007-03-24 02:59 | 1.3K | |
![[TXT]](/icons/text.gif) | Pulykamell paprikamártással.txt | 2007-03-24 02:59 | 1.3K | |
![[TXT]](/icons/text.gif) | Disznóhús római tálban.txt | 2007-03-24 02:59 | 1.3K | |
![[TXT]](/icons/text.gif) | Tepsis csigatészta.txt | 2007-03-24 02:59 | 1.3K | |
![[TXT]](/icons/text.gif) | Törpeharcs Petya módra.txt | 2007-03-24 02:59 | 1.3K | |
![[TXT]](/icons/text.gif) | Fuszeres Graham torta.txt | 2007-03-24 02:59 | 1.3K | |
![[TXT]](/icons/text.gif) | Fűszeres Graham torta.txt | 2007-03-24 02:59 | 1.3K | |
![[TXT]](/icons/text.gif) | Párolt rizs.txt | 2007-03-24 02:59 | 1.3K | |
![[TXT]](/icons/text.gif) | Gyümölcsös túrótorta.txt | 2007-03-24 02:59 | 1.3K | |
![[TXT]](/icons/text.gif) | Magyaros gombaleves.txt | 2007-03-24 02:59 | 1.3K | |
![[TXT]](/icons/text.gif) | Gombás lecsó.txt | 2007-03-24 02:59 | 1.3K | |
![[TXT]](/icons/text.gif) | Omlós pizza gombával, rozmaring mártással.txt | 2007-03-24 02:59 | 1.3K | |
![[TXT]](/icons/text.gif) | Általános piskóta.txt | 2007-03-24 02:59 | 1.3K | |
![[TXT]](/icons/text.gif) | Pikáns sajtleves.txt | 2007-03-24 02:59 | 1.3K | |
![[TXT]](/icons/text.gif) | Tejfölben párolt tojás.txt | 2007-03-24 02:59 | 1.3K | |
![[TXT]](/icons/text.gif) | Mexikói ragu.txt | 2007-03-24 02:59 | 1.3K | |
![[TXT]](/icons/text.gif) | Püspökkenyér.txt | 2007-03-24 02:59 | 1.3K | |
![[TXT]](/icons/text.gif) | Gesztenyével töltött libasült.txt | 2007-03-24 02:59 | 1.3K | |
![[TXT]](/icons/text.gif) | Hiros káposzta.txt | 2007-03-24 02:59 | 1.3K | |
![[TXT]](/icons/text.gif) | Burgonyaropogós.txt | 2007-03-24 02:59 | 1.3K | |
![[TXT]](/icons/text.gif) | Rokfortos krumplisaláta.txt | 2007-03-24 02:59 | 1.3K | |
![[TXT]](/icons/text.gif) | Ananászkrém.txt | 2007-03-24 02:59 | 1.3K | |
![[TXT]](/icons/text.gif) | Almás sült metélt.txt | 2007-03-24 02:59 | 1.3K | |
![[TXT]](/icons/text.gif) | Szerecsendiós csirke.txt | 2007-03-24 02:59 | 1.3K | |
![[TXT]](/icons/text.gif) | Sajtos zöldség.txt | 2007-03-24 02:59 | 1.3K | |
![[TXT]](/icons/text.gif) | Bakonyi borda.txt | 2007-03-24 02:59 | 1.3K | |
![[TXT]](/icons/text.gif) | Narancsos sárgarépa-saláta.txt | 2007-03-24 02:59 | 1.3K | |
![[TXT]](/icons/text.gif) | Téli vacsorasaláta.txt | 2007-03-24 02:59 | 1.3K | |
![[TXT]](/icons/text.gif) | Francia rakott burgonya 1.txt | 2007-03-24 02:59 | 1.3K | |
![[TXT]](/icons/text.gif) | Sáfrányos rizs.txt | 2007-03-24 02:59 | 1.3K | |
![[TXT]](/icons/text.gif) | Mustáros sült burgonya.txt | 2007-03-24 02:59 | 1.3K | |
![[TXT]](/icons/text.gif) | Sonkás lángos.txt | 2007-03-24 02:59 | 1.3K | |
![[TXT]](/icons/text.gif) | Illatos csirkenyársak.txt | 2007-03-24 02:59 | 1.3K | |
![[TXT]](/icons/text.gif) | Érlelt vegyessaláta.txt | 2007-03-24 02:59 | 1.3K | |
![[TXT]](/icons/text.gif) | Mézes karácsonyra.txt | 2007-03-24 02:59 | 1.3K | |
![[TXT]](/icons/text.gif) | Mont Blanc gesztenyepüré.txt | 2007-03-24 02:59 | 1.3K | |
![[TXT]](/icons/text.gif) | Ordogi chilli.txt | 2007-03-24 02:59 | 1.3K | |
![[TXT]](/icons/text.gif) | Epres palacsinta.txt | 2007-03-24 02:59 | 1.3K | |
![[TXT]](/icons/text.gif) | Pulykamellrolád mandulás körtével.txt | 2007-03-24 02:59 | 1.3K | |
![[TXT]](/icons/text.gif) | Parfékockák.txt | 2007-03-24 02:59 | 1.3K | |
![[TXT]](/icons/text.gif) | Narancsos piskóta.txt | 2007-03-24 02:59 | 1.3K | |
![[TXT]](/icons/text.gif) | Diós kókuszos szelet.txt | 2007-03-24 02:59 | 1.3K | |
![[TXT]](/icons/text.gif) | Almás fahéjkocka.txt | 2007-03-24 02:59 | 1.3K | |
![[TXT]](/icons/text.gif) | Törpeharcsa Gyurci módra.txt | 2007-03-24 02:59 | 1.3K | |
![[TXT]](/icons/text.gif) | Joker-tarhonya.txt | 2007-03-24 02:59 | 1.3K | |
![[TXT]](/icons/text.gif) | 2 féle kacsamáj.txt | 2007-03-24 02:59 | 1.3K | |
![[TXT]](/icons/text.gif) | Jeges citromleves.txt | 2007-03-24 02:59 | 1.3K | |
![[TXT]](/icons/text.gif) | Kovászos uborka.txt | 2007-03-24 02:59 | 1.3K | |
![[TXT]](/icons/text.gif) | Aldiss.txt | 2007-03-24 21:00 | 1.3K | |
![[TXT]](/icons/text.gif) | Zelleres-köményes szolosaláta.txt | 2007-03-24 02:59 | 1.3K | |
![[TXT]](/icons/text.gif) | Zelleres-köményes szőlősaláta.txt | 2007-03-24 02:59 | 1.3K | |
![[TXT]](/icons/text.gif) | Almás kosárkák.txt | 2007-03-24 02:59 | 1.3K | |
![[TXT]](/icons/text.gif) | Sajtos töltött sonka.txt | 2007-03-24 02:59 | 1.2K | |
![[TXT]](/icons/text.gif) | Sváb káposzta.txt | 2007-03-24 02:59 | 1.2K | |
![[TXT]](/icons/text.gif) | Paradicsomos tojássaláta.txt | 2007-03-24 02:59 | 1.2K | |
![[TXT]](/icons/text.gif) | Fokhagymás öntött saláta.txt | 2007-03-24 02:59 | 1.2K | |
![[TXT]](/icons/text.gif) | Téli reteksaláta.txt | 2007-03-24 02:59 | 1.2K | |
![[TXT]](/icons/text.gif) | Csalamádé.txt | 2007-03-24 02:59 | 1.2K | |
![[TXT]](/icons/text.gif) | PÖRKÖLT.TXT | 2007-03-24 02:59 | 1.2K | |
![[TXT]](/icons/text.gif) | Krémes palacsinta.txt | 2007-03-24 02:59 | 1.2K | |
![[TXT]](/icons/text.gif) | Makói csirkemell.txt | 2007-03-24 02:59 | 1.2K | |
![[TXT]](/icons/text.gif) | Fagyik.txt | 2007-03-24 02:59 | 1.2K | |
![[TXT]](/icons/text.gif) | Krumplifozelék.txt | 2007-03-24 02:59 | 1.2K | |
![[TXT]](/icons/text.gif) | Krumplifőzelék.txt | 2007-03-24 02:59 | 1.2K | |
![[TXT]](/icons/text.gif) | Granola.txt | 2007-03-24 02:59 | 1.2K | |
![[TXT]](/icons/text.gif) | Almás rolád.txt | 2007-03-24 02:59 | 1.2K | |
![[TXT]](/icons/text.gif) | Olasz csirkecomb.txt | 2007-03-24 02:59 | 1.2K | |
![[TXT]](/icons/text.gif) | Almás gyümölcskenyér.txt | 2007-03-24 02:59 | 1.2K | |
![[TXT]](/icons/text.gif) | Lekváros kifli.txt | 2007-03-24 02:59 | 1.2K | |
![[TXT]](/icons/text.gif) | Hagymás tojássaláta.txt | 2007-03-24 02:59 | 1.2K | |
![[TXT]](/icons/text.gif) | Napraforgómagos saláta.txt | 2007-03-24 02:59 | 1.2K | |
![[TXT]](/icons/text.gif) | Éjszaka.htm | 2007-03-24 02:54 | 1.2K | |
![[TXT]](/icons/text.gif) | Rácz ponty.txt | 2007-03-24 02:59 | 1.2K | |
![[TXT]](/icons/text.gif) | Lebbencsleves.txt | 2007-03-24 02:59 | 1.2K | |
![[TXT]](/icons/text.gif) | Püspökkenyér'.txt | 2007-03-24 02:59 | 1.2K | |
![[TXT]](/icons/text.gif) | Krumplis rétes.txt | 2007-03-24 02:59 | 1.2K | |
![[TXT]](/icons/text.gif) | Tepsis tonhal.txt | 2007-03-24 02:59 | 1.2K | |
![[TXT]](/icons/text.gif) | Gurulós tarhonya.txt | 2007-03-24 02:59 | 1.2K | |
![[TXT]](/icons/text.gif) | Börek.txt | 2007-03-24 02:59 | 1.2K | |
![[IMG]](/icons/image2.gif) | origo_alj.gif | 2007-03-24 02:59 | 1.2K | |
![[TXT]](/icons/text.gif) | Zsákbamacska.txt | 2007-03-24 02:59 | 1.2K | |
![[IMG]](/icons/image2.gif) | STAT(1).GIF | 2007-03-24 02:59 | 1.2K | |
![[TXT]](/icons/text.gif) | Sajtgombóc leves.txt | 2007-03-24 02:59 | 1.2K | |
![[TXT]](/icons/text.gif) | Sajtos túrótorta.txt | 2007-03-24 02:59 | 1.2K | |
![[TXT]](/icons/text.gif) | Marhagulyás.txt | 2007-03-24 02:59 | 1.2K | |
![[TXT]](/icons/text.gif) | Gombás rakott burgonya.txt | 2007-03-24 02:59 | 1.2K | |
![[TXT]](/icons/text.gif) | Töltött kacsa tejszines mártással.txt | 2007-03-24 02:59 | 1.2K | |
![[TXT]](/icons/text.gif) | Oszibarackleves.txt | 2007-03-24 02:59 | 1.2K | |
![[TXT]](/icons/text.gif) | Erdélyi rakott káposzta.txt | 2007-03-24 02:59 | 1.2K | |
![[TXT]](/icons/text.gif) | Őszibarackleves.txt | 2007-03-24 02:59 | 1.2K | |
![[TXT]](/icons/text.gif) | Sajtos zöldfuszermártás.txt | 2007-03-24 02:59 | 1.2K | |
![[TXT]](/icons/text.gif) | Sajtos zöldfűszermártás.txt | 2007-03-24 02:59 | 1.2K | |
![[TXT]](/icons/text.gif) | Csukott szendvicsek.txt | 2007-03-24 02:59 | 1.2K | |
![[TXT]](/icons/text.gif) | Diós-lekváros tekercs.txt | 2007-03-24 02:59 | 1.2K | |
![[ ]](/icons/compressed.gif) | brecht_bertolt_vedekezes_az_eroszak_ellen.zip | 2007-03-24 02:51 | 1.2K | |
![[TXT]](/icons/text.gif) | Fagylaltos oszibarack.txt | 2007-03-24 02:59 | 1.2K | |
![[TXT]](/icons/text.gif) | Fagylaltos őszibarack.txt | 2007-03-24 02:59 | 1.2K | |
![[TXT]](/icons/text.gif) | Sajtos uborkasaláta.txt | 2007-03-24 02:59 | 1.2K | |
![[TXT]](/icons/text.gif) | Szivárvány gyümölcskocsonya.txt | 2007-03-24 02:59 | 1.2K | |
![[TXT]](/icons/text.gif) | Kínaikel-saláta.txt | 2007-03-24 02:59 | 1.2K | |
![[TXT]](/icons/text.gif) | Nyers salátatál.txt | 2007-03-24 02:59 | 1.2K | |
![[TXT]](/icons/text.gif) | Tepsis lazac.txt | 2007-03-24 02:59 | 1.2K | |
![[TXT]](/icons/text.gif) | Melegen szendvics, hidegen saláta.txt | 2007-03-24 02:59 | 1.2K | |
![[TXT]](/icons/text.gif) | Almás csirkeleves.txt | 2007-03-24 02:59 | 1.2K | |
![[TXT]](/icons/text.gif) | Tavaszi csirke.txt | 2007-03-24 02:59 | 1.2K | |
![[TXT]](/icons/text.gif) | Spagetti budai módra.txt | 2007-03-24 02:59 | 1.2K | |
![[TXT]](/icons/text.gif) | Chop suey.txt | 2007-03-24 02:59 | 1.2K | |
![[TXT]](/icons/text.gif) | BUDAI.TXT | 2007-03-24 02:59 | 1.2K | |
![[TXT]](/icons/text.gif) | Zengoi töltött rostélyos.txt | 2007-03-24 02:59 | 1.2K | |
![[TXT]](/icons/text.gif) | Zengői töltött rostélyos.txt | 2007-03-24 02:59 | 1.2K | |
![[TXT]](/icons/text.gif) | Gombás-tejszines pulykamell.txt | 2007-03-24 02:59 | 1.2K | |
![[ ]](/icons/unknown.gif) | salvatore_ra_klonok_tamadasa.id | 2007-03-24 02:54 | 1.2K | |
![[TXT]](/icons/text.gif) | Walesi részeges bébikacsa.txt | 2007-03-24 02:59 | 1.2K | |
![[TXT]](/icons/text.gif) | Forgácsfánk.txt | 2007-03-24 02:59 | 1.2K | |
![[TXT]](/icons/text.gif) | Zöldséges omlett 2.txt | 2007-03-24 02:59 | 1.2K | |
![[TXT]](/icons/text.gif) | Sült paprikasaláta.txt | 2007-03-24 02:59 | 1.2K | |
![[ ]](/icons/unknown.gif) | Emlékezet.rar | 2007-03-24 02:55 | 1.2K | |
![[TXT]](/icons/text.gif) | Almasaláta.txt | 2007-03-24 02:59 | 1.2K | |
![[TXT]](/icons/text.gif) | Agglegénykompót.txt | 2007-03-24 02:59 | 1.2K | |
![[TXT]](/icons/text.gif) | Rakott szelet.txt | 2007-03-24 02:59 | 1.2K | |
![[TXT]](/icons/text.gif) | Krémeslepény.txt | 2007-03-24 02:59 | 1.2K | |
![[TXT]](/icons/text.gif) | Rántott szardínia citrommártással.txt | 2007-03-24 02:59 | 1.2K | |
![[TXT]](/icons/text.gif) | Zöldséges sáfrányos haltál.txt | 2007-03-24 02:59 | 1.2K | |
![[TXT]](/icons/text.gif) | Hawaii tekercs.txt | 2007-03-24 02:59 | 1.2K | |
![[TXT]](/icons/text.gif) | Málnabolé.html | 2007-03-24 02:59 | 1.2K | |
![[TXT]](/icons/text.gif) | Gyümölcskenyér.txt | 2007-03-24 02:59 | 1.2K | |
![[TXT]](/icons/text.gif) | Töltött burgonya.txt | 2007-03-24 02:59 | 1.1K | |
![[TXT]](/icons/text.gif) | Ági naranxsos harcsája.txt | 2007-03-24 02:59 | 1.1K | |
![[TXT]](/icons/text.gif) | Vörösboros puncstorta.txt | 2007-03-24 02:59 | 1.1K | |
![[TXT]](/icons/text.gif) | Kefíres kenyér.txt | 2007-03-24 02:59 | 1.1K | |
![[ ]](/icons/compressed.gif) | Brown, Frederic_Válasz - sci-fi novella - html.zip | 2006-01-07 09:07 | 1.1K | |
![[TXT]](/icons/text.gif) | Málnás-ribizlis túrófagylalt.txt | 2007-03-24 02:59 | 1.1K | |
![[TXT]](/icons/text.gif) | Pikáns szendvicstorta.txt | 2007-03-24 02:59 | 1.1K | |
![[TXT]](/icons/text.gif) | Rumos görögdinnye.txt | 2007-03-24 02:59 | 1.1K | |
![[TXT]](/icons/text.gif) | Ajvar (padlizsán fuszerkeverék, vagy mártás).txt | 2007-03-24 02:59 | 1.1K | |
![[TXT]](/icons/text.gif) | Ajvar (padlizsán fűszerkeverék, vagy mártás).txt | 2007-03-24 02:59 | 1.1K | |
![[TXT]](/icons/text.gif) | Babgulyás füstölt csülökkel.txt | 2007-03-24 02:59 | 1.1K | |
![[TXT]](/icons/text.gif) | Sajtos palacsinta.txt | 2007-03-24 02:59 | 1.1K | |
![[TXT]](/icons/text.gif) | SAJAT.CSS | 2007-03-24 02:54 | 1.1K | |
![[TXT]](/icons/text.gif) | Hagymás csirkecomb.txt | 2007-03-24 02:59 | 1.1K | |
![[TXT]](/icons/text.gif) | Flódni.txt | 2007-03-24 02:59 | 1.1K | |
![[TXT]](/icons/text.gif) | Barátleves, prófétakenyér.txt | 2007-03-24 02:59 | 1.1K | |
![[TXT]](/icons/text.gif) | Tésztakosárka.txt | 2007-03-24 02:59 | 1.1K | |
![[TXT]](/icons/text.gif) | Hagymás szalonnás krumpli.txt | 2007-03-24 02:59 | 1.1K | |
![[TXT]](/icons/text.gif) | Tégelach.txt | 2007-03-24 02:59 | 1.1K | |
![[TXT]](/icons/text.gif) | Részeges sárgabarack.txt | 2007-03-24 02:59 | 1.1K | |
![[TXT]](/icons/text.gif) | Zellerkrémleves laskagombával.txt | 2007-03-24 02:59 | 1.1K | |
![[TXT]](/icons/text.gif) | Finn palacsinta.txt | 2007-03-24 02:59 | 1.1K | |
![[IMG]](/icons/image2.gif) | FRANK.JPG | 2007-03-24 02:58 | 1.1K | |
![[TXT]](/icons/text.gif) | Aszalt gyümölccsel töltött dagadó.txt | 2007-03-24 02:59 | 1.1K | |
![[TXT]](/icons/text.gif) | Rumos barackhab.txt | 2007-03-24 02:59 | 1.1K | |
![[TXT]](/icons/text.gif) | Fejtett-bab.txt | 2007-03-24 02:59 | 1.1K | |
![[TXT]](/icons/text.gif) | Aszaltszilvás csirkemell.txt | 2007-03-24 02:59 | 1.1K | |
![[TXT]](/icons/text.gif) | Custom Tattoo Tutorial.txt | 2006-09-16 22:49 | 1.1K | |
![[TXT]](/icons/text.gif) | Sajtos pirítós zöld fuszerekkel.txt | 2007-03-24 02:59 | 1.1K | |
![[TXT]](/icons/text.gif) | Sajtos pirítós zöld fűszerekkel.txt | 2007-03-24 02:59 | 1.1K | |
![[TXT]](/icons/text.gif) | FRANCIA.TXT | 2007-03-24 02:59 | 1.1K | |
![[TXT]](/icons/text.gif) | Krumplis tojássaláta.txt | 2007-03-24 02:59 | 1.1K | |
![[TXT]](/icons/text.gif) | Lángoló almásszelet.txt | 2007-03-24 02:59 | 1.1K | |
![[TXT]](/icons/text.gif) | Rokxfortos burgonya.txt | 2007-03-24 02:59 | 1.1K | |
![[TXT]](/icons/text.gif) | Friss datolya pesto-mártással.txt | 2007-03-24 02:59 | 1.1K | |
![[TXT]](/icons/text.gif) | Sajtos-almás csirkemell.txt | 2007-03-24 02:59 | 1.1K | |
![[TXT]](/icons/text.gif) | Olajos gomba eltevése.txt | 2007-03-24 02:59 | 1.1K | |
![[TXT]](/icons/text.gif) | Kaliforniai aprórák.txt | 2007-03-24 02:59 | 1.1K | |
![[TXT]](/icons/text.gif) | Salátával töltött paprika.txt | 2007-03-24 02:59 | 1.1K | |
![[TXT]](/icons/text.gif) | Répás süti.txt | 2007-03-24 02:59 | 1.1K | |
![[TXT]](/icons/text.gif) | Francia almatorta.txt | 2007-03-24 02:59 | 1.1K | |
![[TXT]](/icons/text.gif) | Almás csirkevagdalt.txt | 2007-03-24 02:59 | 1.1K | |
![[TXT]](/icons/text.gif) | Burgonyapüré'.txt | 2007-03-24 02:59 | 1.1K | |
![[TXT]](/icons/text.gif) | Rokfortos paradicsomsaláta.txt | 2007-03-24 02:59 | 1.1K | |
![[TXT]](/icons/text.gif) | Vitaminsaláta.txt | 2007-03-24 02:59 | 1.1K | |
![[TXT]](/icons/text.gif) | Bazsalikomos töltött paradicsom.txt | 2007-03-24 02:59 | 1.1K | |
![[TXT]](/icons/text.gif) | Rumos csokoládéhab.txt | 2007-03-24 02:59 | 1.1K | |
![[TXT]](/icons/text.gif) | Csirkés zöldségsaláta.txt | 2007-03-24 02:59 | 1.1K | |
![[TXT]](/icons/text.gif) | Sült sárgarépa.txt | 2007-03-24 02:59 | 1.1K | |
![[TXT]](/icons/text.gif) | Hurkák.txt | 2007-03-24 02:59 | 1.1K | |
![[TXT]](/icons/text.gif) | Káposztagulyás.txt | 2007-03-24 02:59 | 1.1K | |
![[TXT]](/icons/text.gif) | Kovászos uborkasaláta.txt | 2007-03-24 02:59 | 1.1K | |
![[TXT]](/icons/text.gif) | Töltött francia kenyér.txt | 2007-03-24 02:59 | 1.1K | |
![[TXT]](/icons/text.gif) | Zöldséggombóc.txt | 2007-03-24 02:59 | 1.1K | |
![[TXT]](/icons/text.gif) | Spanyol mártás.txt | 2007-03-24 02:59 | 1.1K | |
![[TXT]](/icons/text.gif) | Töltött túrópalacsinta.txt | 2007-03-24 02:59 | 1.1K | |
![[TXT]](/icons/text.gif) | Lazacszeletek roston.txt | 2007-03-24 02:59 | 1.1K | |
![[TXT]](/icons/text.gif) | Apró kiflik.txt | 2007-03-24 02:59 | 1.1K | |
![[TXT]](/icons/text.gif) | Banánropogós.txt | 2007-03-24 02:59 | 1.1K | |
![[TXT]](/icons/text.gif) | Csirkepörkölt.txt | 2007-03-24 02:59 | 1.1K | |
![[TXT]](/icons/text.gif) | Kaszás lé.txt | 2007-03-24 02:59 | 1.1K | |
![[TXT]](/icons/text.gif) | Burgonyafelfújt vagdalthússal.txt | 2007-03-24 02:59 | 1.1K | |
![[TXT]](/icons/text.gif) | Afrikai csirke.txt | 2007-03-24 02:59 | 1.1K | |
![[TXT]](/icons/text.gif) | Gyümölcsvelo.txt | 2007-03-24 02:59 | 1.1K | |
![[TXT]](/icons/text.gif) | Gyümölcsvelő.txt | 2007-03-24 02:59 | 1.1K | |
![[TXT]](/icons/text.gif) | Ördögi chili.txt | 2007-03-24 02:59 | 1.1K | |
![[TXT]](/icons/text.gif) | Gyümölcsös pudingrétes.txt | 2007-03-24 02:59 | 1.1K | |
![[TXT]](/icons/text.gif) | Korhely halászlé.txt | 2007-03-24 02:59 | 1.1K | |
![[TXT]](/icons/text.gif) | Füstölthal saláta.txt | 2007-03-24 02:59 | 1.1K | |
![[TXT]](/icons/text.gif) | Sült hot dog.txt | 2007-03-24 02:59 | 1.1K | |
![[TXT]](/icons/text.gif) | Barackos túrólepény.txt | 2007-03-24 02:59 | 1.1K | |
![[TXT]](/icons/text.gif) | Almás krémes piskóta.txt | 2007-03-24 02:59 | 1.1K | |
![[TXT]](/icons/text.gif) | Brokkoli felfújt.txt | 2007-03-24 02:59 | 1.1K | |
![[TXT]](/icons/text.gif) | Paprikás csirke.txt | 2007-03-24 02:59 | 1.1K | |
![[TXT]](/icons/text.gif) | Matrózkolbász.txt | 2007-03-24 02:59 | 1.1K | |
![[TXT]](/icons/text.gif) | Cseresznyés pite.txt | 2007-03-24 02:59 | 1.1K | |
![[TXT]](/icons/text.gif) | Sült kukorica.txt | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | Csokis babapiskótatorta.txt | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | Hagymáshús zöld borssal.txt | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | Babos pizzabatyu.txt | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | Párolt kacsa.txt | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | Spenótos csirkemell.txt | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | Kocsonya.txt | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | Káposzta savanyítása.txt | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | Csokoládés palacsintafelfújt.txt | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | Párizsis nyárs.txt | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | Sonkás rakott krumpli.txt | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | Zöldséges-csirkés rizs.txt | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | Mustáros uborkamártás.txt | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | Diós gombóc.txt | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | Rokfortos tésztasaláta.txt | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | Ananász felfújt.txt | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | Mexikói bab darálthússal.txt | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | Mexikói bab darált hússal.txt | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | Gombás csirke.txt | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | Aszalt szilva es csirke.txt | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | Serpenyős rostélyos.txt | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | Mandulás csirkemell.txt | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | Sült kagyló fokhagymával.txt | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | Szerb rostélyos.txt | 2007-03-24 02:59 | 1.0K | |
![[ ]](/icons/unknown.gif) | nncl.id | 2004-12-07 18:46 | 1.0K | |
![[TXT]](/icons/text.gif) | Csirkehús almába töltve.txt | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | Dán húspogácsa.txt | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | Klasszikus zöldsaláta.txt | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | Almapuffancs.txt | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | Pizza a la TARÁNY.txt | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | Burgonyás cukkinirakottas.txt | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | Budai sült csirke.txt | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | Paradicsom ropogós burgonykalappal.txt | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | Marhapörkölt Gundel Károly módra.txt | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | Rejtett, töltött sonka.txt | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | Sajtos pulykamell.txt | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | Hagymás kukoricapuffancs.txt | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | FALATKÁK.TXT | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | Béarni libaleves.txt | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | Fuszeres túrógolyók.txt | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | Fűszeres túrógolyók.txt | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | Csabai krokett.txt | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | Tavaszi tekercs.txt | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | Mazsolás habos lepény.txt | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | Mandulás burgonyakrokett.txt | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | Baracklikőr.html | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | Nasi.txt | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | Balaton szelet.txt | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | Hamis ananászkompót.txt | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | Savanyúpaprika káposztával töltve.txt | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | Sajttal töltött csirkecomb.txt | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | Hamis vadasmártás.txt | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | Csirkecomb Hegedus módra.txt | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | Csirkecomb Hegedűs módra.txt | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | Leveles burgonypogácsa.txt | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | Tiramisu 2.txt | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | Gombaleves1.txt | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | Túrós gyümölcsös lepény.txt | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | Tejszines-kapros pulykaragu.txt | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | Ananászos savanyúkáposzta.txt | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | Szilveszteri bólék.txt | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | Habos málnatorta.txt | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | Almás krémes.txt | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | Cipóban sült csülök.txt | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | Süni.txt | 2007-03-24 02:59 | 1.0K | |
![[IMG]](/icons/image2.gif) | tart_logo.gif | 2007-03-24 03:01 | 1.0K | |
![[ ]](/icons/unknown.gif) | NNCL.ID | 2007-03-24 02:54 | 1.0K | |
![[TXT]](/icons/text.gif) | Fordított ananásztorta.txt | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | Csirke sókéregben.txt | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | Zöldséggel töltött csirkecombok.txt | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | Királyok csirkecombja.txt | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | Amaretti.txt | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | Hamis 'borjú' vagdalt.txt | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | Bazsalikomos sult hus.txt | 2007-03-24 02:59 | 1.0K | |
![[IMG]](/icons/image2.gif) | vissza.gif | 2007-03-24 02:53 | 1.0K | |
![[IMG]](/icons/image2.gif) | I.GIF | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | Csirkecomb gombában.txt | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | Erdélyi csorbaleves.txt | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | Peperonata.txt | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | Húsos rakott burgonya.txt | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | Burgonyás cipóban sült sertéscsülök.txt | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | Kínai csirke.txt | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | Gesztenyés pulykamell.txt | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | Magyaros egytál1.txt | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | Dios-marvanyos tesztasalata.txt | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | Málnaszörp.html | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | Joghurtkrém cseresznyével.txt | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | Barbecue oldalas.txt | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | Magyaros egytál.txt | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | Grilláskrémtorta.txt | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | Kapris húspogácsa.txt | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | Krémsajtos gyümölcssaláta.txt | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | ERDEI.TXT | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | Brassói aprópecsenye'.txt | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | Modenai sajtos tészta.txt | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | Majonézes vegyessaláta.txt | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | !Mindenki szakácskönyve.htm | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | Töltött kenyérszeletek.txt | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | Külföldi tésztakülönlegesség.txt | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | Csípos csirke gyömbérrel és citrommal (Ga Xao Xa Ot).txt | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | Csípős csirke gyömbérrel és citrommal (Ga Xao Xa Ot).txt | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | Almás-mézes érmék.txt | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | Johurtos vöröskáposzta.txt | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | Eper charlotte.txt | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | Szilvás kifli.txt | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | Pácolt sonka sajtbundában.txt | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | GALUSKA.TXT | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | Ünnepi almáspite.txt | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | Tepsis disznótoros.txt | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | hamilton_laurell_k_lelancolt_narcisszusz_2_hu_ful.txt | 2007-01-24 08:33 | 1.0K | |
![[IMG]](/icons/image2.gif) | SC.PNG | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | Egytál étel báránnyal....txt | 2007-03-24 02:59 | 1.0K | |
![[TXT]](/icons/text.gif) | Tavaszi burgonyagombócleves.txt | 2007-03-24 02:59 | 972 | |
![[TXT]](/icons/text.gif) | Kókuszos csirkemell.txt | 2007-03-24 02:59 | 972 | |
![[TXT]](/icons/text.gif) | Szendvicstorta.txt | 2007-03-24 02:59 | 969 | |
![[TXT]](/icons/text.gif) | Parajfánk.txt | 2007-03-24 02:59 | 969 | |
![[ ]](/icons/compressed.gif) | Juhász György_Az élet értelméről - sci-fi novella - html.zip | 2006-01-07 09:05 | 969 | |
![[TXT]](/icons/text.gif) | Tarhonya'.txt | 2007-03-24 02:59 | 968 | |
![[TXT]](/icons/text.gif) | TARHONYA.TXT | 2007-03-24 02:59 | 968 | |
![[TXT]](/icons/text.gif) | Velouté és supréme mártás.txt | 2007-03-24 02:59 | 966 | |
![[TXT]](/icons/text.gif) | Tejfölös gombás baromfiragu.txt | 2007-03-24 02:59 | 966 | |
![[TXT]](/icons/text.gif) | Sajtos sült rizs.txt | 2007-03-24 02:59 | 966 | |
![[TXT]](/icons/text.gif) | Popeye palacsinta.txt | 2007-03-24 02:59 | 966 | |
![[TXT]](/icons/text.gif) | Lazaccal töltött palacsinta.txt | 2007-03-24 02:59 | 965 | |
![[TXT]](/icons/text.gif) | Kaviáros palacsinta.txt | 2007-03-24 02:59 | 965 | |
![[TXT]](/icons/text.gif) | Házi sajt 2.txt | 2007-03-24 02:59 | 960 | |
![[TXT]](/icons/text.gif) | Csirke tojásban.txt | 2007-03-24 02:59 | 959 | |
![[TXT]](/icons/text.gif) | BURGONYA.TXT | 2007-03-24 02:59 | 959 | |
![[ ]](/icons/compressed.gif) | November.htm.zip | 2007-03-24 02:58 | 955 | |
![[TXT]](/icons/text.gif) | Túrós csusza.txt | 2007-03-24 02:59 | 954 | |
![[TXT]](/icons/text.gif) | Részeges kalácskockák.txt | 2007-03-24 02:59 | 952 | |
![[TXT]](/icons/text.gif) | Krumplis tészta.txt | 2007-03-24 02:59 | 951 | |
![[TXT]](/icons/text.gif) | Hagymamártás.txt | 2007-03-24 02:59 | 951 | |
![[TXT]](/icons/text.gif) | Baklava'.txt | 2007-03-24 02:59 | 951 | |
![[TXT]](/icons/text.gif) | Füge pálinka_bor.txt | 2007-03-24 02:59 | 950 | |
![[TXT]](/icons/text.gif) | Fagyos földieperkockák.txt | 2007-03-24 02:59 | 943 | |
![[TXT]](/icons/text.gif) | Sigillum.txt | 2007-03-24 02:59 | 941 | |
![[TXT]](/icons/text.gif) | Bográcsgulyás.txt | 2007-03-24 02:59 | 940 | |
![[TXT]](/icons/text.gif) | Hússal töltött szololevél.txt | 2007-03-24 02:59 | 938 | |
![[TXT]](/icons/text.gif) | Hússal töltött szőlőlevél.txt | 2007-03-24 02:59 | 938 | |
![[TXT]](/icons/text.gif) | Túrós csiga.txt | 2007-03-24 02:59 | 935 | |
![[TXT]](/icons/text.gif) | KNÉDLI.TXT | 2007-03-24 02:59 | 935 | |
![[TXT]](/icons/text.gif) | Barátnok narancsos gesztenyekréme.txt | 2007-03-24 02:59 | 935 | |
![[TXT]](/icons/text.gif) | Barátnők narancsos gesztenyekréme.txt | 2007-03-24 02:59 | 935 | |
![[TXT]](/icons/text.gif) | Zöldséges tepsis burgonya.txt | 2007-03-24 02:59 | 932 | |
![[TXT]](/icons/text.gif) | Kókuszos almatorta.txt | 2007-03-24 02:59 | 932 | |
![[TXT]](/icons/text.gif) | Virsli sült burgonyában.txt | 2007-03-24 02:59 | 930 | |
![[TXT]](/icons/text.gif) | Matróztál.txt | 2007-03-24 02:59 | 929 | |
![[TXT]](/icons/text.gif) | Sós gesztenyekrokett.txt | 2007-03-24 02:59 | 928 | |
![[TXT]](/icons/text.gif) | Szójafasírt.txt | 2007-03-24 02:59 | 926 | |
![[TXT]](/icons/text.gif) | Kakaós süti.txt | 2007-03-24 02:59 | 926 | |
![[TXT]](/icons/text.gif) | Fuszeres paradicsomos csicseriborsó leves.txt | 2007-03-24 02:59 | 925 | |
![[TXT]](/icons/text.gif) | Fűszeres paradicsomos csicseriborsó leves.txt | 2007-03-24 02:59 | 925 | |
![[TXT]](/icons/text.gif) | Csirke es narancs saláta.txt | 2007-03-24 02:59 | 925 | |
![[TXT]](/icons/text.gif) | Mandarinos csirke.txt | 2007-03-24 02:59 | 924 | |
![[TXT]](/icons/text.gif) | Paradicsommártás1.txt | 2007-03-24 02:59 | 923 | |
![[TXT]](/icons/text.gif) | Oroszkrémtorta.txt | 2007-03-24 02:59 | 920 | |
![[TXT]](/icons/text.gif) | focim.html | 2007-03-24 02:59 | 918 | |
![[TXT]](/icons/text.gif) | Marhahús vadszósszal, spagettivel.txt | 2007-03-24 02:59 | 918 | |
![[TXT]](/icons/text.gif) | Kókuszgolyó.txt | 2007-03-24 02:59 | 916 | |
![[TXT]](/icons/text.gif) | Alma mézkéregben.txt | 2007-03-24 02:59 | 916 | |
![[TXT]](/icons/text.gif) | Bekacomb fuszeres szoszban.txt | 2007-03-24 02:59 | 913 | |
![[TXT]](/icons/text.gif) | Édes zabpogácsa.txt | 2007-03-24 02:59 | 913 | |
![[TXT]](/icons/text.gif) | Tiszta borsos leves.txt | 2007-03-24 02:59 | 911 | |
![[TXT]](/icons/text.gif) | HÓLABDA.TXT | 2007-03-24 02:59 | 909 | |
![[TXT]](/icons/text.gif) | Gyümölcsös fagylaltkehely.txt | 2007-03-24 02:59 | 909 | |
![[TXT]](/icons/text.gif) | Sült szardellás gomba.txt | 2007-03-24 02:59 | 908 | |
![[TXT]](/icons/text.gif) | Párolt currys csirke.txt | 2007-03-24 02:59 | 907 | |
![[TXT]](/icons/text.gif) | Almamártás1.txt | 2007-03-24 02:59 | 907 | |
![[TXT]](/icons/text.gif) | Tejszínben pácolt rántott máj.txt | 2007-03-24 02:59 | 906 | |
![[TXT]](/icons/text.gif) | Körömpörkölt.txt | 2007-03-24 02:59 | 906 | |
![[TXT]](/icons/text.gif) | Tojáspörkölt.txt | 2007-03-24 02:59 | 905 | |
![[TXT]](/icons/text.gif) | Pezsgos pulyka.txt | 2007-03-24 02:59 | 905 | |
![[TXT]](/icons/text.gif) | Pezsgős pulyka.txt | 2007-03-24 02:59 | 905 | |
![[IMG]](/icons/image2.gif) | OLF.GIF | 2007-03-24 02:59 | 903 | |
![[TXT]](/icons/text.gif) | Fokhagymás füstölt csülökfalatok.txt | 2007-03-24 02:59 | 903 | |
![[TXT]](/icons/text.gif) | Bolgár rizseshús.txt | 2007-03-24 02:59 | 901 | |
![[TXT]](/icons/text.gif) | Örmény levesek.txt | 2007-03-24 02:59 | 901 | |
![[TXT]](/icons/text.gif) | Töltött sonka pirított sajttal.txt | 2007-03-24 02:59 | 897 | |
![[TXT]](/icons/text.gif) | Rácgulyás.txt | 2007-03-24 02:59 | 895 | |
![[TXT]](/icons/text.gif) | Tarka csirkesaláta.txt | 2007-03-24 02:59 | 894 | |
![[TXT]](/icons/text.gif) | Chilicon con carne.txt | 2007-03-24 02:59 | 894 | |
![[TXT]](/icons/text.gif) | Sült zeller.txt | 2007-03-24 02:59 | 893 | |
![[TXT]](/icons/text.gif) | Rántott csirkemell.txt | 2007-03-24 02:59 | 892 | |
![[TXT]](/icons/text.gif) | Vargabéles.txt | 2007-03-24 02:59 | 891 | |
![[TXT]](/icons/text.gif) | Kassai szelet.txt | 2007-03-24 02:59 | 891 | |
![[TXT]](/icons/text.gif) | Sült pulykacomb marsalával.txt | 2007-03-24 02:59 | 890 | |
![[TXT]](/icons/text.gif) | Bolgár krém.txt | 2007-03-24 02:59 | 888 | |
![[TXT]](/icons/text.gif) | Alma töltve túróval.txt | 2007-03-24 02:59 | 883 | |
![[TXT]](/icons/text.gif) | Rakott csirke juhturoval.txt | 2007-03-24 02:59 | 881 | |
![[TXT]](/icons/text.gif) | Ozgerinc.txt | 2007-03-24 02:59 | 880 | |
![[TXT]](/icons/text.gif) | Őzgerinc.txt | 2007-03-24 02:59 | 880 | |
![[TXT]](/icons/text.gif) | Csörögefánk.txt | 2007-03-24 02:59 | 879 | |
![[TXT]](/icons/text.gif) | Sajtos roló.txt | 2007-03-24 02:59 | 874 | |
![[TXT]](/icons/text.gif) | Csokidarabos püspökkenyér.txt | 2007-03-24 02:59 | 874 | |
![[TXT]](/icons/text.gif) | Halas ételek.txt | 2007-03-24 02:59 | 873 | |
![[TXT]](/icons/text.gif) | Örmény sajtos táska.txt | 2007-03-24 02:59 | 873 | |
![[TXT]](/icons/text.gif) | Virsli falatok.txt | 2007-03-24 02:59 | 872 | |
![[TXT]](/icons/text.gif) | Kozák sapka.txt | 2007-03-24 02:59 | 872 | |
![[TXT]](/icons/text.gif) | Vörösboros csirkeragu.txt | 2007-03-24 02:59 | 871 | |
![[TXT]](/icons/text.gif) | Különleges csirke 2.txt | 2007-03-24 02:59 | 871 | |
![[TXT]](/icons/text.gif) | Babapiskótás puncsszelet.txt | 2007-03-24 02:59 | 870 | |
![[TXT]](/icons/text.gif) | Ananászszörp.html | 2007-03-24 02:59 | 870 | |
![[TXT]](/icons/text.gif) | Fokhagymás kenyér.txt | 2007-03-24 02:59 | 868 | |
![[TXT]](/icons/text.gif) | Brassói aprópecsenye.txt | 2007-03-24 02:59 | 867 | |
![[TXT]](/icons/text.gif) | Barna mézes pite.txt | 2007-03-24 02:59 | 866 | |
![[TXT]](/icons/text.gif) | Bundás virsli.txt | 2007-03-24 02:59 | 865 | |
![[TXT]](/icons/text.gif) | Tormával töltött rántott szelet.txt | 2007-03-24 02:59 | 864 | |
![[TXT]](/icons/text.gif) | Paszuly leves.txt | 2007-03-24 02:59 | 863 | |
![[TXT]](/icons/text.gif) | Heringlakoma.txt | 2007-03-24 02:59 | 863 | |
![[TXT]](/icons/text.gif) | Elronthatatlan csirke.txt | 2007-03-24 02:59 | 863 | |
![[TXT]](/icons/text.gif) | Citromos rántottszelet.txt | 2007-03-24 02:59 | 863 | |
![[TXT]](/icons/text.gif) | Almás sütemény.txt | 2007-03-24 02:59 | 862 | |
![[TXT]](/icons/text.gif) | Olasz spagettileves.txt | 2007-03-24 02:59 | 859 | |
![[TXT]](/icons/text.gif) | BULOCSKI.TXT | 2007-03-24 02:59 | 859 | |
![[TXT]](/icons/text.gif) | Túrós gúla.txt | 2007-03-24 02:59 | 858 | |
![[TXT]](/icons/text.gif) | Csirkesaláta.txt | 2007-03-24 02:59 | 855 | |
![[TXT]](/icons/text.gif) | Cseh knédli.txt | 2007-03-24 02:59 | 855 | |
![[TXT]](/icons/text.gif) | Különleges csirke.txt | 2007-03-24 02:59 | 854 | |
![[TXT]](/icons/text.gif) | Tejszines csirke.txt | 2007-03-24 02:59 | 853 | |
![[TXT]](/icons/text.gif) | Mandulás csirke kínai módra.txt | 2007-03-24 02:59 | 852 | |
![[TXT]](/icons/text.gif) | Illatos csirkeragu.txt | 2007-03-24 02:59 | 851 | |
![[ ]](/icons/unknown.gif) | fulszoveg.rtf | 2004-04-13 19:17 | 850 | |
![[TXT]](/icons/text.gif) | Kosárkák.txt | 2007-03-24 02:59 | 850 | |
![[TXT]](/icons/text.gif) | Gyümölcsös rizsfelfújt.txt | 2007-03-24 02:59 | 850 | |
![[TXT]](/icons/text.gif) | Brokkolis csirkemell.txt | 2007-03-24 02:59 | 849 | |
![[TXT]](/icons/text.gif) | Gombás pulykamell.txt | 2007-03-24 02:59 | 848 | |
![[TXT]](/icons/text.gif) | Fozött mézes máz.txt | 2007-03-24 02:59 | 847 | |
![[TXT]](/icons/text.gif) | Főzött mézes máz.txt | 2007-03-24 02:59 | 847 | |
![[TXT]](/icons/text.gif) | Tejszínhabos rizs.txt | 2007-03-24 02:59 | 844 | |
![[TXT]](/icons/text.gif) | Vaníliás gyümölcsrizs.txt | 2007-03-24 02:59 | 841 | |
![[TXT]](/icons/text.gif) | Lekváros fokhagymás csirke.txt | 2007-03-24 02:59 | 840 | |
![[TXT]](/icons/text.gif) | Politikus szelet.txt | 2007-03-24 02:59 | 839 | |
![[TXT]](/icons/text.gif) | Marcipános sütike.txt | 2007-03-24 02:59 | 838 | |
![[TXT]](/icons/text.gif) | Ananászos csirkecomb.txt | 2007-03-24 02:59 | 837 | |
![[TXT]](/icons/text.gif) | Amerikai brokkolisaláta.txt | 2007-03-24 02:59 | 837 | |
![[TXT]](/icons/text.gif) | Barhesz.txt | 2007-03-24 02:59 | 836 | |
![[TXT]](/icons/text.gif) | Nemere_Istvan_A_terido_istenei_fulszoveg.txt | 2005-08-19 15:45 | 834 | |
![[TXT]](/icons/text.gif) | Mogyorós kakaótorta.txt | 2007-03-24 02:59 | 833 | |
![[TXT]](/icons/text.gif) | Palacsinta2.txt | 2007-03-24 02:59 | 832 | |
![[TXT]](/icons/text.gif) | Papagájszelet.txt | 2007-03-24 02:59 | 831 | |
![[TXT]](/icons/text.gif) | Besameles zöldségtál.txt | 2007-03-24 02:59 | 831 | |
![[TXT]](/icons/text.gif) | Szardíniasaláta.txt | 2007-03-24 02:59 | 830 | |
![[TXT]](/icons/text.gif) | Csillagos linzer.txt | 2007-03-24 02:59 | 828 | |
![[TXT]](/icons/text.gif) | Örmény hússaláta.txt | 2007-03-24 02:59 | 826 | |
![[TXT]](/icons/text.gif) | Petrezselymes krumpli.txt | 2007-03-24 02:59 | 824 | |
![[TXT]](/icons/text.gif) | Szardellás krokett.txt | 2007-03-24 02:59 | 823 | |
![[TXT]](/icons/text.gif) | Pogácsák.txt | 2007-03-24 02:59 | 823 | |
![[TXT]](/icons/text.gif) | Almasaláta pirított mandulával.txt | 2007-03-24 02:59 | 823 | |
![[TXT]](/icons/text.gif) | Töltött hal.txt | 2007-03-24 02:59 | 822 | |
![[TXT]](/icons/text.gif) | Édes mézes krumplis ropogós.txt | 2007-03-24 02:59 | 821 | |
![[TXT]](/icons/text.gif) | csillagos linzer.txt | 2007-03-24 02:59 | 819 | |
![[TXT]](/icons/text.gif) | Currys pulykaragu.txt | 2007-03-24 02:59 | 817 | |
![[TXT]](/icons/text.gif) | Bajor csirkecomb.txt | 2007-03-24 02:59 | 817 | |
![[TXT]](/icons/text.gif) | Narancsdzsem.txt | 2007-03-24 02:59 | 815 | |
![[TXT]](/icons/text.gif) | SANGRIA.TXT | 2007-03-24 02:59 | 813 | |
![[TXT]](/icons/text.gif) | Noi szeszély.txt | 2007-03-24 02:59 | 812 | |
![[TXT]](/icons/text.gif) | Női szeszély.txt | 2007-03-24 02:59 | 812 | |
![[TXT]](/icons/text.gif) | Töltött libacomb.txt | 2007-03-24 02:59 | 811 | |
![[TXT]](/icons/text.gif) | Uborkakrém.txt | 2007-03-24 02:59 | 810 | |
![[TXT]](/icons/text.gif) | Gesztenyés almatorta.txt | 2007-03-24 02:59 | 809 | |
![[TXT]](/icons/text.gif) | Boros borjúfalatok.txt | 2007-03-24 02:59 | 807 | |
![[TXT]](/icons/text.gif) | Bodzadzsem.txt | 2007-03-24 02:59 | 807 | |
![[TXT]](/icons/text.gif) | kolofon.html | 2007-11-13 21:37 | 806 | |
![[TXT]](/icons/text.gif) | Zöldséges-rízses csirke.txt | 2007-03-24 02:59 | 806 | |
![[TXT]](/icons/text.gif) | Katóka.txt | 2007-03-24 02:59 | 806 | |
![[TXT]](/icons/text.gif) | Cseresznyés kiflifelfújt mikróban.txt | 2007-03-24 02:59 | 806 | |
![[TXT]](/icons/text.gif) | Milánói makaróni.txt | 2007-03-24 02:59 | 805 | |
![[TXT]](/icons/text.gif) | Lottó tészta.txt | 2007-03-24 02:59 | 805 | |
![[TXT]](/icons/text.gif) | Kapros sertéstokány.txt | 2007-03-24 02:59 | 805 | |
![[TXT]](/icons/text.gif) | Diós gyümölcssaláta.txt | 2007-03-24 02:59 | 805 | |
![[TXT]](/icons/text.gif) | Bio zserbó.txt | 2007-03-24 02:59 | 805 | |
![[TXT]](/icons/text.gif) | Csirkemáj fehér borban.txt | 2007-03-24 02:59 | 803 | |
![[TXT]](/icons/text.gif) | Örmény hússaláta 2.txt | 2007-03-24 02:59 | 803 | |
![[TXT]](/icons/text.gif) | Mediterrán rántott csirke.txt | 2007-03-24 02:59 | 801 | |
![[TXT]](/icons/text.gif) | Melegszendvicskrém.txt | 2007-03-24 02:59 | 800 | |
![[TXT]](/icons/text.gif) | Tükörtojás rokforttal.txt | 2007-03-24 02:59 | 797 | |
![[TXT]](/icons/text.gif) | Fuszeres makaróni.txt | 2007-03-24 02:59 | 797 | |
![[TXT]](/icons/text.gif) | Fűszeres makaróni.txt | 2007-03-24 02:59 | 797 | |
![[TXT]](/icons/text.gif) | Borzas teasütemény.txt | 2007-03-24 02:59 | 797 | |
![[TXT]](/icons/text.gif) | Tepsis csülök.txt | 2007-03-24 02:59 | 795 | |
![[TXT]](/icons/text.gif) | Almás túrós béles.txt | 2007-03-24 02:59 | 795 | |
![[TXT]](/icons/text.gif) | Fatörzs.txt | 2007-03-24 02:59 | 794 | |
![[TXT]](/icons/text.gif) | FOOTER.JS | 2007-03-24 02:59 | 793 | |
![[TXT]](/icons/text.gif) | Zöldség krokett.txt | 2007-03-24 02:59 | 792 | |
![[TXT]](/icons/text.gif) | Göngyölt virsli.txt | 2007-03-24 02:59 | 792 | |
![[TXT]](/icons/text.gif) | Csokoládé parfé.txt | 2007-03-24 02:59 | 792 | |
![[TXT]](/icons/text.gif) | Lestyános csirkeraguleves.txt | 2007-03-24 02:59 | 791 | |
![[TXT]](/icons/text.gif) | Virslis tészta.txt | 2007-03-24 02:59 | 789 | |
![[TXT]](/icons/text.gif) | Répakrém.txt | 2007-03-24 02:59 | 788 | |
![[TXT]](/icons/text.gif) | Indiai rizs.txt | 2007-03-24 02:59 | 788 | |
![[TXT]](/icons/text.gif) | Hegedus húsfalat.txt | 2007-03-24 02:59 | 787 | |
![[TXT]](/icons/text.gif) | Hegedűs húsfalat.txt | 2007-03-24 02:59 | 787 | |
![[TXT]](/icons/text.gif) | Juhtúrós rakott burgonya.txt | 2007-03-24 02:59 | 785 | |
![[TXT]](/icons/text.gif) | Zserbó.txt | 2007-03-24 02:59 | 781 | |
![[TXT]](/icons/text.gif) | Sonkás kocka.txt | 2007-03-24 02:59 | 781 | |
![[TXT]](/icons/text.gif) | Gyümölcsös háromszög.txt | 2007-03-24 02:59 | 781 | |
![[TXT]](/icons/text.gif) | Sárgarépás piláf.txt | 2007-03-24 02:59 | 780 | |
![[TXT]](/icons/text.gif) | Káposztasaláta mustáros joghurtöntettel.txt | 2007-03-24 02:59 | 780 | |
![[TXT]](/icons/text.gif) | Csirkeaprólék leves.txt | 2007-03-24 02:59 | 777 | |
![[TXT]](/icons/text.gif) | Chilis bab.txt | 2007-03-24 02:59 | 777 | |
![[TXT]](/icons/text.gif) | Bazsalikomos camamberttel töltött pulykamell.txt | 2007-03-24 02:59 | 777 | |
![[TXT]](/icons/text.gif) | Arab mézesrudacskák.txt | 2007-03-24 02:59 | 777 | |
![[TXT]](/icons/text.gif) | Tiramisu.txt | 2007-03-24 02:59 | 776 | |
![[TXT]](/icons/text.gif) | Pincepörkölt .txt | 2007-03-24 02:59 | 776 | |
![[TXT]](/icons/text.gif) | Paradicsomsaláta olajos szardíniával.txt | 2007-03-24 02:59 | 775 | |
![[TXT]](/icons/text.gif) | Oszibarackos lepény.txt | 2007-03-24 02:59 | 775 | |
![[TXT]](/icons/text.gif) | JS.HTM | 2007-03-24 02:59 | 775 | |
![[TXT]](/icons/text.gif) | Őszibarackos lepény.txt | 2007-03-24 02:59 | 775 | |
![[TXT]](/icons/text.gif) | Zöldséges halleves.txt | 2007-03-24 02:59 | 774 | |
![[TXT]](/icons/text.gif) | Svédgomba 2.txt | 2007-03-24 02:59 | 774 | |
![[TXT]](/icons/text.gif) | GÁNICA.TXT | 2007-03-24 02:59 | 774 | |
![[TXT]](/icons/text.gif) | Bajor burgonya.txt | 2007-03-24 02:59 | 773 | |
![[TXT]](/icons/text.gif) | Babapiskóta.txt | 2007-03-24 02:59 | 773 | |
![[TXT]](/icons/text.gif) | Tejszínes csirkemell.txt | 2007-03-24 02:59 | 772 | |
![[TXT]](/icons/text.gif) | Piskóta 4.txt | 2007-03-24 02:59 | 772 | |
![[TXT]](/icons/text.gif) | Mézes-bábos.txt | 2007-03-24 02:59 | 772 | |
![[TXT]](/icons/text.gif) | Húsos besameles rakott tojás.txt | 2007-03-24 02:59 | 771 | |
![[TXT]](/icons/text.gif) | Almás csirkemell körettel.txt | 2007-03-24 02:59 | 770 | |
![[TXT]](/icons/text.gif) | Lencsekremleves fustolt sajttal.txt | 2007-03-24 02:59 | 769 | |
![[TXT]](/icons/text.gif) | Gombaropogós.txt | 2007-03-24 02:59 | 769 | |
![[TXT]](/icons/text.gif) | Sajtfalalatkák.txt | 2007-03-24 02:59 | 768 | |
![[TXT]](/icons/text.gif) | Hordós savanyú káposzta.txt | 2007-03-24 02:59 | 767 | |
![[TXT]](/icons/text.gif) | Érdekes csirke.txt | 2007-03-24 02:59 | 767 | |
![[TXT]](/icons/text.gif) | Rizsfelfújt.txt | 2007-03-24 02:59 | 766 | |
![[TXT]](/icons/text.gif) | Méztorta.txt | 2007-03-24 02:59 | 766 | |
![[TXT]](/icons/text.gif) | locenum.txt | 2007-03-24 02:54 | 764 | |
![[TXT]](/icons/text.gif) | Lengyel sajtmártás.txt | 2007-03-24 02:59 | 764 | |
![[TXT]](/icons/text.gif) | Sonkás kifli.txt | 2007-03-24 02:59 | 762 | |
![[TXT]](/icons/text.gif) | Piskóta 3.txt | 2007-03-24 02:59 | 762 | |
![[TXT]](/icons/text.gif) | Joghurtos csirke mikróban.txt | 2007-03-24 02:59 | 762 | |
![[TXT]](/icons/text.gif) | Duna hullám.txt | 2007-03-24 02:59 | 762 | |
![[TXT]](/icons/text.gif) | Zöldséges csirkecomb.txt | 2007-03-24 02:59 | 760 | |
![[TXT]](/icons/text.gif) | Fonott kalács.txt | 2007-03-24 02:59 | 760 | |
![[TXT]](/icons/text.gif) | Csirkecomb mustármártásban.txt | 2007-03-24 02:59 | 759 | |
![[TXT]](/icons/text.gif) | Omlós almás.txt | 2007-03-24 02:59 | 758 | |
![[TXT]](/icons/text.gif) | Kínai kukoricaleves.txt | 2007-03-24 02:59 | 755 | |
![[TXT]](/icons/text.gif) | Szekszárdi pörkölt .txt | 2007-03-24 02:59 | 753 | |
![[TXT]](/icons/text.gif) | Tepsis pulykamell gombával és sajttal.txt | 2007-03-24 02:59 | 752 | |
![[TXT]](/icons/text.gif) | Pulykamell szilvával és baconnel.txt | 2007-03-24 02:59 | 752 | |
![[TXT]](/icons/text.gif) | Krampampuli bólé.txt | 2007-03-24 02:59 | 752 | |
![[TXT]](/icons/text.gif) | Jaffai csirke.txt | 2007-03-24 02:59 | 752 | |
![[TXT]](/icons/text.gif) | Részeges szelet'.txt | 2007-03-24 02:59 | 750 | |
![[TXT]](/icons/text.gif) | Krémes mézes (grízkrémmel).txt | 2007-03-24 02:59 | 749 | |
![[TXT]](/icons/text.gif) | Sajtos-tejfölös csirke.txt | 2007-03-24 02:59 | 748 | |
![[TXT]](/icons/text.gif) | Sajtos rakott pulykamell.txt | 2007-03-24 02:59 | 746 | |
![[TXT]](/icons/text.gif) | Kenyér.txt | 2007-03-24 02:59 | 746 | |
![[TXT]](/icons/text.gif) | Gratinírozott hagymaleves.txt | 2007-03-24 02:59 | 746 | |
![[TXT]](/icons/text.gif) | Brokkoli sajtos besamel mártással.txt | 2007-03-24 02:59 | 745 | |
![[TXT]](/icons/text.gif) | Zöldbabos sertésborda.txt | 2007-03-24 02:59 | 744 | |
![[TXT]](/icons/text.gif) | Bajor fasírozott.txt | 2007-03-24 02:59 | 744 | |
![[IMG]](/icons/image2.gif) | VIZSLA.GIF | 2007-03-24 02:59 | 743 | |
![[TXT]](/icons/text.gif) | Almástorta.txt | 2007-03-24 02:59 | 743 | |
![[TXT]](/icons/text.gif) | Kagylókrémleves.txt | 2007-03-24 02:59 | 742 | |
![[TXT]](/icons/text.gif) | Hájaspogácsa.txt | 2007-03-24 02:59 | 741 | |
![[TXT]](/icons/text.gif) | CVITAMIN.TXT | 2007-03-24 02:59 | 741 | |
![[TXT]](/icons/text.gif) | Sonkaszelet sörtésztában.txt | 2007-03-24 02:59 | 739 | |
![[TXT]](/icons/text.gif) | Csirkemell kekszben.txt | 2007-03-24 02:59 | 737 | |
![[TXT]](/icons/text.gif) | Citromos hal római tálban.txt | 2007-03-24 02:59 | 736 | |
![[TXT]](/icons/text.gif) | Gyors zöldségraguleves.txt | 2007-03-24 02:59 | 735 | |
![[TXT]](/icons/text.gif) | Csirke cseresznyével.txt | 2007-03-24 02:59 | 733 | |
![[TXT]](/icons/text.gif) | Budapest tekercs.txt | 2007-03-24 02:59 | 733 | |
![[TXT]](/icons/text.gif) | Sajtos nokedli.txt | 2007-03-24 02:59 | 731 | |
![[TXT]](/icons/text.gif) | Debreceni krémes.txt | 2007-03-24 02:59 | 731 | |
![[TXT]](/icons/text.gif) | Joghurtos almatorta.txt | 2007-03-24 02:59 | 730 | |
![[TXT]](/icons/text.gif) | Rizs egyszeruen.txt | 2007-03-24 02:59 | 728 | |
![[TXT]](/icons/text.gif) | Rizs egyszerűen.txt | 2007-03-24 02:59 | 728 | |
![[TXT]](/icons/text.gif) | Pármai csirkemell.txt | 2007-03-24 02:59 | 728 | |
![[TXT]](/icons/text.gif) | Olasz zöldségleves.txt | 2007-03-24 02:59 | 728 | |
![[TXT]](/icons/text.gif) | Káposztasaláta.txt | 2007-03-24 02:59 | 728 | |
![[TXT]](/icons/text.gif) | Gesztenyés kacsasült.txt | 2007-03-24 02:59 | 728 | |
![[TXT]](/icons/text.gif) | Rizses gombaleves.txt | 2007-03-24 02:59 | 727 | |
![[IMG]](/icons/image2.gif) | LEVELEK.GIF | 2007-03-24 02:59 | 727 | |
![[TXT]](/icons/text.gif) | Egres dzsem.txt | 2007-03-24 02:59 | 726 | |
![[TXT]](/icons/text.gif) | Mézes zzserbó.txt | 2007-03-24 02:59 | 725 | |
![[TXT]](/icons/text.gif) | Francia rakott burgonya 2.txt | 2007-03-24 02:59 | 725 | |
![[TXT]](/icons/text.gif) | Sonkás szuzérmék.txt | 2007-03-24 02:59 | 724 | |
![[TXT]](/icons/text.gif) | Sonkás szűzérmék.txt | 2007-03-24 02:59 | 724 | |
![[TXT]](/icons/text.gif) | Sajtos-tejfölös csirkemell.txt | 2007-03-24 02:59 | 724 | |
![[TXT]](/icons/text.gif) | Fokhagymás diós pogácsa.txt | 2007-03-24 02:59 | 724 | |
![[TXT]](/icons/text.gif) | Capuccino fagylalt.txt | 2007-03-24 02:59 | 724 | |
![[TXT]](/icons/text.gif) | Meggymártás.txt | 2007-03-24 02:59 | 723 | |
![[TXT]](/icons/text.gif) | Húsos krumplikazal.txt | 2007-03-24 02:59 | 723 | |
![[TXT]](/icons/text.gif) | Pöttyöske.txt | 2007-03-24 02:59 | 722 | |
![[TXT]](/icons/text.gif) | Leveles túróstekercs.txt | 2007-03-24 02:59 | 719 | |
![[TXT]](/icons/text.gif) | Tordai gombás tekercs.txt | 2007-03-24 02:59 | 718 | |
![[TXT]](/icons/text.gif) | Komteszka.txt | 2007-03-24 02:59 | 717 | |
![[TXT]](/icons/text.gif) | Rumos-diós.txt | 2007-03-24 02:59 | 716 | |
![[IMG]](/icons/image2.gif) | NEW.GIF | 2007-03-24 02:59 | 716 | |
![[TXT]](/icons/text.gif) | Rozmaringgal pácolt disznó.txt | 2007-03-24 02:59 | 715 | |
![[TXT]](/icons/text.gif) | Képviselofánk.txt | 2007-03-24 02:59 | 715 | |
![[TXT]](/icons/text.gif) | Képviselőfánk.txt | 2007-03-24 02:59 | 715 | |
![[TXT]](/icons/text.gif) | filelist.xml | 2007-02-20 13:02 | 713 | |
![[TXT]](/icons/text.gif) | Legényhódító.txt | 2007-03-24 02:59 | 713 | |
![[TXT]](/icons/text.gif) | Tepsis gomba.txt | 2007-03-24 02:59 | 712 | |
![[TXT]](/icons/text.gif) | Görög rizses tyúkleves.txt | 2007-03-24 02:59 | 712 | |
![[TXT]](/icons/text.gif) | Franciasalláta.txt | 2007-03-24 02:59 | 711 | |
![[TXT]](/icons/text.gif) | Finom kókuszos.txt | 2007-03-24 02:59 | 711 | |
![[TXT]](/icons/text.gif) | Alap pizza tészta másképpen.txt | 2007-03-24 02:59 | 709 | |
![[TXT]](/icons/text.gif) | Kongó torta.txt | 2007-03-24 02:59 | 708 | |
![[TXT]](/icons/text.gif) | Kalocsai sertésborda.txt | 2007-03-24 02:59 | 707 | |
![[TXT]](/icons/text.gif) | Fokhagymás spagetti.txt | 2007-03-24 02:59 | 705 | |
![[TXT]](/icons/text.gif) | Töltött hal'.txt | 2007-03-24 02:59 | 704 | |
![[TXT]](/icons/text.gif) | Pikáns ízu sajtos lángos.txt | 2007-03-24 02:59 | 704 | |
![[TXT]](/icons/text.gif) | Pikáns ízű sajtos lángos.txt | 2007-03-24 02:59 | 704 | |
![[TXT]](/icons/text.gif) | New-England chowder.txt | 2007-03-24 02:59 | 704 | |
![[TXT]](/icons/text.gif) | Mágnás dióspite.txt | 2007-03-24 02:59 | 703 | |
![[TXT]](/icons/text.gif) | Gyümölcsös joghurttorta.txt | 2007-03-24 02:59 | 703 | |
![[TXT]](/icons/text.gif) | Szalonnás burgonyafozelék.txt | 2007-03-24 02:59 | 702 | |
![[TXT]](/icons/text.gif) | Szalonnás burgonyafőzelék.txt | 2007-03-24 02:59 | 702 | |
![[TXT]](/icons/text.gif) | Krumplis fánk.txt | 2007-03-24 02:59 | 701 | |
![[TXT]](/icons/text.gif) | Húsvéti omlós krémes.txt | 2007-03-24 02:59 | 701 | |
![[TXT]](/icons/text.gif) | Erdélyi fuszeres leves.txt | 2007-03-24 02:59 | 699 | |
![[TXT]](/icons/text.gif) | Erdélyi fűszeres leves.txt | 2007-03-24 02:59 | 699 | |
![[TXT]](/icons/text.gif) | Kukoricafozelék.txt | 2007-03-24 02:59 | 697 | |
![[TXT]](/icons/text.gif) | Kukoricafőzelék.txt | 2007-03-24 02:59 | 697 | |
![[TXT]](/icons/text.gif) | Krumplipüré'.txt | 2007-03-24 02:59 | 696 | |
![[TXT]](/icons/text.gif) | Diós béles.txt | 2007-03-24 02:59 | 696 | |
![[TXT]](/icons/text.gif) | Szalonnás gomba.txt | 2007-03-24 02:59 | 695 | |
![[TXT]](/icons/text.gif) | Olcsó vasárnapi szeletek.txt | 2007-03-24 02:59 | 694 | |
![[TXT]](/icons/text.gif) | Zakuszka.txt | 2007-03-24 02:59 | 693 | |
![[TXT]](/icons/text.gif) | Ananászos csirkemell.txt | 2007-03-24 02:59 | 693 | |
![[TXT]](/icons/text.gif) | Örmény toros leves.txt | 2007-03-24 02:59 | 693 | |
![[TXT]](/icons/text.gif) | Rántott paradicsom.txt | 2007-03-24 02:59 | 692 | |
![[TXT]](/icons/text.gif) | Dinsztelt káposzta.txt | 2007-03-24 02:59 | 692 | |
![[TXT]](/icons/text.gif) | Orosz teasütemény.txt | 2007-03-24 02:59 | 690 | |
![[TXT]](/icons/text.gif) | Francia hagymaleves.txt | 2007-03-24 02:59 | 690 | |
![[TXT]](/icons/text.gif) | Finom sütemény.txt | 2007-03-24 02:59 | 689 | |
![[TXT]](/icons/text.gif) | Pizzatészta.txt | 2007-03-24 02:59 | 688 | |
![[TXT]](/icons/text.gif) | Oszi szeletek.txt | 2007-03-24 02:59 | 688 | |
![[TXT]](/icons/text.gif) | Fokhagymaleves.txt | 2007-03-24 02:59 | 688 | |
![[TXT]](/icons/text.gif) | Őszi szeletek.txt | 2007-03-24 02:59 | 688 | |
![[TXT]](/icons/text.gif) | Polenta.txt | 2007-03-24 02:59 | 687 | |
![[TXT]](/icons/text.gif) | Leveles tepertopogácsa.txt | 2007-03-24 02:59 | 687 | |
![[TXT]](/icons/text.gif) | Leveles tepertőpogácsa.txt | 2007-03-24 02:59 | 687 | |
![[TXT]](/icons/text.gif) | STILUSOK.CSS | 2007-03-24 02:59 | 686 | |
![[TXT]](/icons/text.gif) | RAFAELLO.TXT | 2007-03-24 02:59 | 684 | |
![[TXT]](/icons/text.gif) | Mexikói sertésflekken1.txt | 2007-03-24 02:59 | 683 | |
![[TXT]](/icons/text.gif) | ILLATOS.TXT | 2007-03-24 02:59 | 682 | |
![[TXT]](/icons/text.gif) | Bolond körte.txt | 2007-03-24 02:59 | 682 | |
![[TXT]](/icons/text.gif) | Aszaltszilvás pároltrizs.txt | 2007-03-24 02:59 | 682 | |
![[TXT]](/icons/text.gif) | Alufóliás burgonya.txt | 2007-03-24 02:59 | 682 | |
![[TXT]](/icons/text.gif) | Zárdakifli.txt | 2007-03-24 02:59 | 681 | |
![[TXT]](/icons/text.gif) | Rakott palacsinta'.txt | 2007-03-24 02:59 | 681 | |
![[TXT]](/icons/text.gif) | Mazsolás vanílialeves.txt | 2007-03-24 02:59 | 681 | |
![[TXT]](/icons/text.gif) | Mazsolás sült pulykamell.txt | 2007-03-24 02:59 | 681 | |
![[TXT]](/icons/text.gif) | Csülök Pékné módra.txt | 2007-03-24 02:59 | 681 | |
![[TXT]](/icons/text.gif) | Töltött paradicsom.txt | 2007-03-24 02:59 | 680 | |
![[TXT]](/icons/text.gif) | Mexikói sertésflekken.txt | 2007-03-24 02:59 | 680 | |
![[TXT]](/icons/text.gif) | Hámán-táska.txt | 2007-03-24 02:59 | 680 | |
![[TXT]](/icons/text.gif) | Almás csirkefasírt.txt | 2007-03-24 02:59 | 680 | |
![[TXT]](/icons/text.gif) | Paradicsomos zöldségleves.txt | 2007-03-24 02:59 | 679 | |
![[TXT]](/icons/text.gif) | Burgonyafozelék.txt | 2007-03-24 02:59 | 679 | |
![[TXT]](/icons/text.gif) | Burgonyafőzelék.txt | 2007-03-24 02:59 | 679 | |
![[TXT]](/icons/text.gif) | Örmény szilvás húsleves.txt | 2007-03-24 02:59 | 679 | |
![[TXT]](/icons/text.gif) | Szárnyasalma.txt | 2007-03-24 02:59 | 676 | |
![[TXT]](/icons/text.gif) | Manduláskrém.txt | 2007-03-24 02:59 | 676 | |
![[TXT]](/icons/text.gif) | Háromféle édesség.txt | 2007-03-24 02:59 | 675 | |
![[TXT]](/icons/text.gif) | Bodzavirág pezsgo.txt | 2007-03-24 02:59 | 675 | |
![[TXT]](/icons/text.gif) | Bodzavirág pezsgő.txt | 2007-03-24 02:59 | 675 | |
![[TXT]](/icons/text.gif) | Anyuska mézese.txt | 2007-03-24 02:59 | 675 | |
![[TXT]](/icons/text.gif) | Barackos csirkemellsteak.txt | 2007-03-24 02:59 | 674 | |
![[TXT]](/icons/text.gif) | Hordós savanyúság.txt | 2007-03-24 02:59 | 673 | |
![[IMG]](/icons/image2.gif) | FEJLEC.GIF | 2007-03-24 02:59 | 673 | |
![[TXT]](/icons/text.gif) | Magyaros krumplileves.txt | 2007-03-24 02:59 | 672 | |
![[TXT]](/icons/text.gif) | Szerelmeslevél.txt | 2007-03-24 02:59 | 671 | |
![[TXT]](/icons/text.gif) | Pikáns fokhagymagerezdek.txt | 2007-03-24 02:59 | 671 | |
![[TXT]](/icons/text.gif) | Grill aranykárász.txt | 2007-03-24 02:59 | 671 | |
![[TXT]](/icons/text.gif) | Tejfölös gombaleves.txt | 2007-03-24 02:59 | 670 | |
![[TXT]](/icons/text.gif) | Házi túróstekercs.txt | 2007-03-24 02:59 | 670 | |
![[TXT]](/icons/text.gif) | Szabó úr kedvenc vacsorája.txt | 2007-03-24 02:59 | 669 | |
![[TXT]](/icons/text.gif) | Marcipán.txt | 2007-03-24 02:59 | 669 | |
![[TXT]](/icons/text.gif) | Lucskos káposzta sertésoldalassal.txt | 2007-03-24 02:59 | 669 | |
![[TXT]](/icons/text.gif) | Gesztenyével töltött pulykamellfilé Karácsonyra.txt | 2007-03-24 02:59 | 669 | |
![[TXT]](/icons/text.gif) | Ribizlis sütemény.txt | 2007-03-24 02:59 | 668 | |
![[TXT]](/icons/text.gif) | Kürtöskalács.txt | 2007-03-24 02:59 | 668 | |
![[TXT]](/icons/text.gif) | Tejfölös uborkamártás.txt | 2007-03-24 02:59 | 667 | |
![[TXT]](/icons/text.gif) | Medvetalp.txt | 2007-03-24 02:59 | 665 | |
![[TXT]](/icons/text.gif) | Juhtúrós borsós hús.txt | 2007-03-24 02:59 | 665 | |
![[TXT]](/icons/text.gif) | Mogyorókrémtorta.txt | 2007-03-24 02:59 | 663 | |
![[TXT]](/icons/text.gif) | Kuglóf.txt | 2007-03-24 02:59 | 663 | |
![[TXT]](/icons/text.gif) | Kétszínu keksz.txt | 2007-03-24 02:59 | 663 | |
![[TXT]](/icons/text.gif) | Kétszínű keksz.txt | 2007-03-24 02:59 | 663 | |
![[TXT]](/icons/text.gif) | Gombakotlett.txt | 2007-03-24 02:59 | 661 | |
![[TXT]](/icons/text.gif) | Eperfagylalt gyümölccsel.txt | 2007-03-24 02:59 | 661 | |
![[TXT]](/icons/text.gif) | Gombaleves.txt | 2007-03-24 02:59 | 660 | |
![[TXT]](/icons/text.gif) | Tejfölös gombamártás.txt | 2007-03-24 02:59 | 659 | |
![[TXT]](/icons/text.gif) | MAJONÉZ.TXT | 2007-03-24 02:59 | 659 | |
![[TXT]](/icons/text.gif) | Fácánsült.txt | 2007-03-24 02:59 | 659 | |
![[TXT]](/icons/text.gif) | Rakott gomba.txt | 2007-03-24 02:59 | 657 | |
![[TXT]](/icons/text.gif) | Pudingos süti.txt | 2007-03-24 02:59 | 656 | |
![[TXT]](/icons/text.gif) | Túrós kocka.txt | 2007-03-24 02:59 | 654 | |
![[TXT]](/icons/text.gif) | Debreceni mézes.txt | 2007-03-24 02:59 | 654 | |
![[TXT]](/icons/text.gif) | Borko-leves.txt | 2007-03-24 02:59 | 653 | |
![[TXT]](/icons/text.gif) | Borkő-leves.txt | 2007-03-24 02:59 | 653 | |
![[TXT]](/icons/text.gif) | Banan Canapé.txt | 2007-03-24 02:59 | 653 | |
![[TXT]](/icons/text.gif) | Hamis túrósrétes.txt | 2007-03-24 02:59 | 652 | |
![[TXT]](/icons/text.gif) | Gombasaláta mentás tormamártással.txt | 2007-03-24 02:59 | 651 | |
![[TXT]](/icons/text.gif) | Cseh túrós.txt | 2007-03-24 02:59 | 651 | |
![[TXT]](/icons/text.gif) | GYUVECS.TXT | 2007-03-24 02:59 | 650 | |
![[TXT]](/icons/text.gif) | Finom gyümölcskenyér.txt | 2007-03-24 02:59 | 650 | |
![[TXT]](/icons/text.gif) | Párizsikrém.txt | 2007-03-24 02:59 | 649 | |
![[TXT]](/icons/text.gif) | Diós nudli túrós tésztából.txt | 2007-03-24 02:59 | 649 | |
![[TXT]](/icons/text.gif) | Aranka göngyölt csirkéje.txt | 2007-03-24 02:59 | 649 | |
![[TXT]](/icons/text.gif) | Máj velencei módra.txt | 2007-03-24 02:59 | 644 | |
![[TXT]](/icons/text.gif) | Rafaello 6.txt | 2007-03-24 02:59 | 643 | |
![[TXT]](/icons/text.gif) | Juszt féle császármorzsa.txt | 2007-03-24 02:59 | 643 | |
![[TXT]](/icons/text.gif) | Barna-leves.txt | 2007-03-24 02:59 | 643 | |
![[TXT]](/icons/text.gif) | Algíri krumpli.txt | 2007-03-24 02:59 | 642 | |
![[TXT]](/icons/text.gif) | Tejbegríz.txt | 2007-03-24 02:59 | 641 | |
![[TXT]](/icons/text.gif) | Rugelach.txt | 2007-03-24 02:59 | 641 | |
![[TXT]](/icons/text.gif) | Karfiolos hús.txt | 2007-03-24 02:59 | 641 | |
![[TXT]](/icons/text.gif) | Marhapörkölt.txt | 2007-03-24 02:59 | 640 | |
![[TXT]](/icons/text.gif) | Francia vaníliafelfújt.txt | 2007-03-24 02:59 | 640 | |
![[IMG]](/icons/image2.gif) | A_LOGO3.GIF | 2007-03-24 02:59 | 639 | |
![[TXT]](/icons/text.gif) | Tejfölös szelet.txt | 2007-03-24 02:59 | 637 | |
![[TXT]](/icons/text.gif) | Szines rizssaláta.txt | 2007-03-24 02:59 | 637 | |
![[TXT]](/icons/text.gif) | Rakott palacsinta.txt | 2007-03-24 02:59 | 637 | |
![[TXT]](/icons/text.gif) | Kolbászos krumplikazal.txt | 2007-03-24 02:59 | 637 | |
![[TXT]](/icons/text.gif) | Tyuk leves.txt | 2007-03-24 02:59 | 636 | |
![[TXT]](/icons/text.gif) | Négyesi féle koleszterinmentes saláta.txt | 2007-03-24 02:59 | 636 | |
![[TXT]](/icons/text.gif) | Lebbencsleves'.txt | 2007-03-24 02:59 | 636 | |
![[TXT]](/icons/text.gif) | Fuszeres mézeskalács.txt | 2007-03-24 02:59 | 636 | |
![[TXT]](/icons/text.gif) | Fűszeres mézeskalács.txt | 2007-03-24 02:59 | 636 | |
![[TXT]](/icons/text.gif) | Aszalt leves.txt | 2007-03-24 02:59 | 636 | |
![[TXT]](/icons/text.gif) | Pulykamell.txt | 2007-03-24 02:59 | 635 | |
![[TXT]](/icons/text.gif) | Almás-sajtos-sült fotthús.txt | 2007-03-24 02:59 | 635 | |
![[TXT]](/icons/text.gif) | Almás-sajtos-sült főtthús.txt | 2007-03-24 02:59 | 635 | |
![[TXT]](/icons/text.gif) | Olasz citrom likör.txt | 2007-03-24 02:59 | 634 | |
![[TXT]](/icons/text.gif) | Egzoltikus liba v. csirkemáj.txt | 2007-03-24 02:59 | 634 | |
![[ ]](/icons/unknown.gif) | smith_l_neil_lando_calrissian_'s oseon_t-zvihara.id | 2004-12-15 08:02 | 632 | |
![[ ]](/icons/unknown.gif) | smith_l_neil_lando_calrissian_és oseon_tľzvihara.id | 2007-03-24 02:54 | 632 | |
![[TXT]](/icons/text.gif) | Fuszerezett borjútekercsek nyárson sütve.txt | 2007-03-24 02:59 | 632 | |
![[TXT]](/icons/text.gif) | Sárgadinnye ecetben.txt | 2007-03-24 02:59 | 631 | |
![[TXT]](/icons/text.gif) | Nyárson sült kagylók.txt | 2007-03-24 02:59 | 631 | |
![[TXT]](/icons/text.gif) | Nudli.txt | 2007-03-24 02:59 | 631 | |
![[TXT]](/icons/text.gif) | Diós-joghurtos céklasaláta.txt | 2007-03-24 02:59 | 631 | |
![[TXT]](/icons/text.gif) | Bácskai rizseshús.txt | 2007-03-24 02:59 | 631 | |
![[TXT]](/icons/text.gif) | Amerikai szárazbableves.txt | 2007-03-24 02:59 | 631 | |
![[TXT]](/icons/text.gif) | Mentett ropogós.txt | 2007-03-24 02:59 | 630 | |
![[TXT]](/icons/text.gif) | Egyszerü süti.txt | 2007-03-24 02:59 | 630 | |
![[TXT]](/icons/text.gif) | Sárgarépa rózsaszínben.txt | 2007-03-24 02:59 | 629 | |
![[TXT]](/icons/text.gif) | Rumos szelet'.txt | 2007-03-24 02:59 | 629 | |
![[TXT]](/icons/text.gif) | Knisesz.txt | 2007-03-24 02:59 | 629 | |
![[TXT]](/icons/text.gif) | Almás vaníliás szelet.txt | 2007-03-24 02:59 | 629 | |
![[TXT]](/icons/text.gif) | Sült fagylalt.txt | 2007-03-24 02:59 | 628 | |
![[TXT]](/icons/text.gif) | Kávékrém-torta.txt | 2007-03-24 02:59 | 628 | |
![[TXT]](/icons/text.gif) | Bolognai spagetti.txt | 2007-03-24 02:59 | 628 | |
![[TXT]](/icons/text.gif) | Szerb saláta.txt | 2007-03-24 02:59 | 627 | |
![[TXT]](/icons/text.gif) | Újburgonyás csirkemell.txt | 2007-03-24 02:59 | 627 | |
![[TXT]](/icons/text.gif) | Tengeri kagylók nyárson.txt | 2007-03-24 02:59 | 625 | |
![[TXT]](/icons/text.gif) | Kefíres kevert.txt | 2007-03-24 02:59 | 625 | |
![[TXT]](/icons/text.gif) | Búvár túrós.txt | 2007-03-24 02:59 | 625 | |
![[TXT]](/icons/text.gif) | fülszöveg.txt | 2007-11-14 01:35 | 624 | |
![[TXT]](/icons/text.gif) | Rumos szelet.txt | 2007-03-24 02:59 | 624 | |
![[TXT]](/icons/text.gif) | Bácskai gombás rizs.txt | 2007-03-24 02:59 | 622 | |
![[TXT]](/icons/text.gif) | Borsodi palacsintahalom.txt | 2007-03-24 02:59 | 621 | |
![[TXT]](/icons/text.gif) | Tepsis húsos káposzta.txt | 2007-03-24 02:59 | 620 | |
![[TXT]](/icons/text.gif) | Túrós krumpli.txt | 2007-03-24 02:59 | 620 | |
![[TXT]](/icons/text.gif) | Dóra kedvence.txt | 2007-03-24 02:59 | 620 | |
![[TXT]](/icons/text.gif) | Brassoi csirkezuza.txt | 2007-03-24 02:59 | 619 | |
![[TXT]](/icons/text.gif) | Sárgaborsóleves korianderrel.txt | 2007-03-24 02:59 | 618 | |
![[TXT]](/icons/text.gif) | Spanyol burgonyafozelék.txt | 2007-03-24 02:59 | 617 | |
![[TXT]](/icons/text.gif) | Spanyol burgonyafőzelék.txt | 2007-03-24 02:59 | 617 | |
![[TXT]](/icons/text.gif) | Túró puffancs.txt | 2007-03-24 02:59 | 616 | |
![[TXT]](/icons/text.gif) | Rakott sertésborda vajbabbal.txt | 2007-03-24 02:59 | 615 | |
![[TXT]](/icons/text.gif) | Kaliforniai rizssaláta.txt | 2007-03-24 02:59 | 615 | |
![[TXT]](/icons/text.gif) | Kókuszos különlegesség.txt | 2007-03-24 02:59 | 615 | |
![[TXT]](/icons/text.gif) | Cukkinisaláta.txt | 2007-03-24 02:59 | 615 | |
![[TXT]](/icons/text.gif) | Spagetti carbonara.txt | 2007-03-24 02:59 | 614 | |
![[TXT]](/icons/text.gif) | Rozmaringos csirke mézzel és citrommal.txt | 2007-03-24 02:59 | 614 | |
![[TXT]](/icons/text.gif) | Somlói galuska.txt | 2007-03-24 02:59 | 613 | |
![[TXT]](/icons/text.gif) | Fagyasztott tejföl felhasználása.txt | 2007-03-24 02:59 | 613 | |
![[TXT]](/icons/text.gif) | Diós hal.txt | 2007-03-24 02:59 | 612 | |
![[TXT]](/icons/text.gif) | Kati szelet.txt | 2007-03-24 02:59 | 610 | |
![[TXT]](/icons/text.gif) | Dióskürt.txt | 2007-03-24 02:59 | 610 | |
![[TXT]](/icons/text.gif) | Burgonyaleves.txt | 2007-03-24 02:59 | 610 | |
![[TXT]](/icons/text.gif) | Túrós pogácsa.txt | 2007-03-24 02:59 | 609 | |
![[TXT]](/icons/text.gif) | Serpenyos rostélyos.txt | 2007-03-24 02:59 | 609 | |
![[TXT]](/icons/text.gif) | Rántottsajt.txt | 2007-03-24 02:59 | 609 | |
![[TXT]](/icons/text.gif) | Anyós szelet.txt | 2007-03-24 02:59 | 609 | |
![[TXT]](/icons/text.gif) | CITROMOS.TXT | 2007-03-24 02:59 | 608 | |
![[TXT]](/icons/text.gif) | Sonkaropogós.txt | 2007-03-24 02:59 | 607 | |
![[TXT]](/icons/text.gif) | Nimródtáskák.txt | 2007-03-24 02:59 | 607 | |
![[TXT]](/icons/text.gif) | Borjúpörkölt.txt | 2007-03-24 02:59 | 607 | |
![[TXT]](/icons/text.gif) | Húsgombóc.txt | 2007-03-24 02:59 | 606 | |
![[TXT]](/icons/text.gif) | Gyors sajtos.txt | 2007-03-24 02:59 | 606 | |
![[TXT]](/icons/text.gif) | Brassói felhasználási javaslat.txt | 2007-03-24 02:59 | 606 | |
![[TXT]](/icons/text.gif) | Borban pácolt máj roston sütve.txt | 2007-03-24 02:59 | 606 | |
![[TXT]](/icons/text.gif) | Szilveszteri.txt | 2007-03-24 02:59 | 605 | |
![[TXT]](/icons/text.gif) | Iszákos pörkölt .txt | 2007-03-24 02:59 | 605 | |
![[TXT]](/icons/text.gif) | Hagymás rostélyos.txt | 2007-03-24 02:59 | 605 | |
![[TXT]](/icons/text.gif) | Becsinált leves.txt | 2007-03-24 02:59 | 605 | |
![[TXT]](/icons/text.gif) | Részeges szelet.txt | 2007-03-24 02:59 | 603 | |
![[TXT]](/icons/text.gif) | Nincs jobb nálam.txt | 2007-03-24 02:59 | 603 | |
![[TXT]](/icons/text.gif) | Hagymás csirkemáj.txt | 2007-03-24 02:59 | 603 | |
![[TXT]](/icons/text.gif) | Hagymás cipó kakukkfűvel.txt | 2007-03-24 02:59 | 603 | |
![[TXT]](/icons/text.gif) | Csirkecomb kókuszbundában.txt | 2007-03-24 02:59 | 603 | |
![[TXT]](/icons/text.gif) | Töltött alma.txt | 2007-03-24 02:59 | 602 | |
![[TXT]](/icons/text.gif) | Fahéjas krumplisütemény.txt | 2007-03-24 02:59 | 602 | |
![[TXT]](/icons/text.gif) | Vöröskáposzta saláta.txt | 2007-03-24 02:59 | 601 | |
![[TXT]](/icons/text.gif) | Sertéscombból alaprecept.txt | 2007-03-24 02:59 | 601 | |
![[TXT]](/icons/text.gif) | Lemezes linzer.txt | 2007-03-24 02:59 | 600 | |
![[TXT]](/icons/text.gif) | Vörösborleves.txt | 2007-03-24 02:59 | 599 | |
![[TXT]](/icons/text.gif) | Túrós rakottas.txt | 2007-03-24 02:59 | 599 | |
![[TXT]](/icons/text.gif) | Raffaello1.txt | 2007-03-24 02:59 | 599 | |
![[TXT]](/icons/text.gif) | Leveles túrópogácsa.txt | 2007-03-24 02:59 | 599 | |
![[TXT]](/icons/text.gif) | Felhoszelet.txt | 2007-03-24 02:59 | 599 | |
![[TXT]](/icons/text.gif) | Felhőszelet.txt | 2007-03-24 02:59 | 599 | |
![[TXT]](/icons/text.gif) | Cseresznyés palacsinta részegen.txt | 2007-03-24 02:59 | 599 | |
![[TXT]](/icons/text.gif) | Túrógombóc.txt | 2007-03-24 02:59 | 598 | |
![[TXT]](/icons/text.gif) | Palacsintafelfújt.txt | 2007-03-24 02:59 | 597 | |
![[TXT]](/icons/text.gif) | Csokoládés habszelet.txt | 2007-03-24 02:59 | 597 | |
![[TXT]](/icons/text.gif) | Rakott pirítós kenyérszeletek.txt | 2007-03-24 02:59 | 595 | |
![[TXT]](/icons/text.gif) | Csokis puszedli.txt | 2007-03-24 02:59 | 595 | |
![[TXT]](/icons/text.gif) | Sós stangli.txt | 2007-03-24 02:59 | 594 | |
![[TXT]](/icons/text.gif) | Görög paradicsom.txt | 2007-03-24 02:59 | 593 | |
![[TXT]](/icons/text.gif) | Diósbéles.txt | 2007-03-24 02:59 | 593 | |
![[TXT]](/icons/text.gif) | Citromos karaj.txt | 2007-03-24 02:59 | 592 | |
![[TXT]](/icons/text.gif) | Csirke Dubarry módra.txt | 2007-03-24 02:59 | 591 | |
![[TXT]](/icons/text.gif) | Édes, paradicsomos sárgaborsóleves.txt | 2007-03-24 02:59 | 591 | |
![[TXT]](/icons/text.gif) | Vajas krumplipogácsa.txt | 2007-03-24 02:59 | 590 | |
![[TXT]](/icons/text.gif) | Fehérboros nyltokány.txt | 2007-03-24 02:59 | 589 | |
![[TXT]](/icons/text.gif) | Almás-sajtos csirke.txt | 2007-03-24 02:59 | 588 | |
![[TXT]](/icons/text.gif) | Tejes vaníliás rétes.txt | 2007-03-24 02:59 | 587 | |
![[TXT]](/icons/text.gif) | Bundás zeller.txt | 2007-03-24 02:59 | 587 | |
![[TXT]](/icons/text.gif) | Amerikai rakott kenyér.txt | 2007-03-24 02:59 | 587 | |
![[TXT]](/icons/text.gif) | Tavaszi vagdalt.txt | 2007-03-24 02:59 | 586 | |
![[TXT]](/icons/text.gif) | Ropogós mézes.txt | 2007-03-24 02:59 | 586 | |
![[TXT]](/icons/text.gif) | Esztergomi linzer.txt | 2007-03-24 02:59 | 586 | |
![[TXT]](/icons/text.gif) | Orjaleves.txt | 2007-03-24 02:59 | 585 | |
![[TXT]](/icons/text.gif) | Gombás rizs.txt | 2007-03-24 02:59 | 585 | |
![[TXT]](/icons/text.gif) | Cumberland mártás.txt | 2007-03-24 02:59 | 585 | |
![[TXT]](/icons/text.gif) | Székely gulyás.txt | 2007-03-24 02:59 | 583 | |
![[TXT]](/icons/text.gif) | Buenosi marhapörkölt .txt | 2007-03-24 02:59 | 583 | |
![[TXT]](/icons/text.gif) | Bajor tojásmártás.txt | 2007-03-24 02:59 | 583 | |
![[TXT]](/icons/text.gif) | Tejes kalács.txt | 2007-03-24 02:59 | 582 | |
![[TXT]](/icons/text.gif) | Manduláscsók.txt | 2007-03-24 02:59 | 582 | |
![[TXT]](/icons/text.gif) | Forró sonkatekercs.txt | 2007-03-24 02:59 | 581 | |
![[TXT]](/icons/text.gif) | Szárazbab fozelék.txt | 2007-03-24 02:59 | 580 | |
![[TXT]](/icons/text.gif) | Szárazbab főzelék.txt | 2007-03-24 02:59 | 580 | |
![[TXT]](/icons/text.gif) | Omlett tekercs.txt | 2007-03-24 02:59 | 580 | |
![[TXT]](/icons/text.gif) | Mazsolás túrópuding.txt | 2007-03-24 02:59 | 580 | |
![[TXT]](/icons/text.gif) | abc-tart.html | 2007-03-24 02:59 | 578 | |
![[TXT]](/icons/text.gif) | Rokfortos zöldborsóleves.txt | 2007-03-24 02:59 | 578 | |
![[TXT]](/icons/text.gif) | Csirkefasírt.txt | 2007-03-24 02:59 | 577 | |
![[TXT]](/icons/text.gif) | Mazsolás szeletek.txt | 2007-03-24 02:59 | 576 | |
![[TXT]](/icons/text.gif) | Csokiszalámi.txt | 2007-03-24 02:59 | 574 | |
![[TXT]](/icons/text.gif) | Rácsos burgonya.txt | 2007-03-24 02:59 | 573 | |
![[TXT]](/icons/text.gif) | Babapiskótás.txt | 2007-03-24 02:59 | 573 | |
![[TXT]](/icons/text.gif) | Mindenki szereti.txt | 2007-03-24 02:59 | 571 | |
![[ ]](/icons/unknown.gif) | css | 2007-11-14 04:42 | 570 | |
![[TXT]](/icons/text.gif) | Túrós delkli.txt | 2007-03-24 02:59 | 570 | |
![[TXT]](/icons/text.gif) | Cseresznye vagy meggyzselé.txt | 2007-03-24 02:59 | 570 | |
![[TXT]](/icons/text.gif) | Lengyeles libacomb.txt | 2007-03-24 02:59 | 569 | |
![[TXT]](/icons/text.gif) | Farsangi szelet.txt | 2007-03-24 02:59 | 569 | |
![[TXT]](/icons/text.gif) | Részeges ananász.txt | 2007-03-24 02:59 | 568 | |
![[TXT]](/icons/text.gif) | Anci pizzaszósza.txt | 2007-03-24 02:59 | 568 | |
![[TXT]](/icons/text.gif) | Green Widow.txt | 2007-03-24 02:59 | 567 | |
![[TXT]](/icons/text.gif) | Gombapaprikás.txt | 2007-03-24 02:59 | 567 | |
![[TXT]](/icons/text.gif) | Zöldségleves1.txt | 2007-03-24 02:59 | 566 | |
![[TXT]](/icons/text.gif) | Zöldségkrémleves.txt | 2007-03-24 02:59 | 565 | |
![[TXT]](/icons/text.gif) | Túrópuding málnaízzel.txt | 2007-03-24 02:59 | 565 | |
![[TXT]](/icons/text.gif) | Ropogós újburgonya.txt | 2007-03-24 02:59 | 564 | |
![[TXT]](/icons/text.gif) | Gombás töltött kenyér.txt | 2007-03-24 02:59 | 564 | |
![[TXT]](/icons/text.gif) | Almás-sajtos csirke 2.txt | 2007-03-24 02:59 | 564 | |
![[TXT]](/icons/text.gif) | Parasztos báránysültek nyárson.txt | 2007-03-24 02:59 | 562 | |
![[TXT]](/icons/text.gif) | Boros cseresznyeleves.txt | 2007-03-24 02:59 | 562 | |
![[TXT]](/icons/text.gif) | Burgonyagombóc.txt | 2007-03-24 02:59 | 561 | |
![[TXT]](/icons/text.gif) | Székelygulyás.txt | 2007-03-24 02:59 | 560 | |
![[TXT]](/icons/text.gif) | Almamártás.txt | 2007-03-24 02:59 | 559 | |
![[TXT]](/icons/text.gif) | Pityókás narancsszelet.txt | 2007-03-24 02:59 | 557 | |
![[TXT]](/icons/text.gif) | Csoda torta.txt | 2007-03-24 02:59 | 557 | |
![[TXT]](/icons/text.gif) | POPUP.JS | 2007-03-24 02:59 | 556 | |
![[TXT]](/icons/text.gif) | Kulonleges csirke.txt | 2007-03-24 02:59 | 556 | |
![[TXT]](/icons/text.gif) | Juhtúrós kukoricagombóc.txt | 2007-03-24 02:59 | 556 | |
![[TXT]](/icons/text.gif) | Diós zelleres saláta.txt | 2007-03-24 02:59 | 556 | |
![[TXT]](/icons/text.gif) | Ribizlimártás.txt | 2007-03-24 02:59 | 555 | |
![[TXT]](/icons/text.gif) | Paradicsom mártás.txt | 2007-03-24 02:59 | 555 | |
![[TXT]](/icons/text.gif) | Baszk csirke.txt | 2007-03-24 02:59 | 555 | |
![[TXT]](/icons/text.gif) | Cumberland-mártás.txt | 2007-03-24 02:59 | 554 | |
![[TXT]](/icons/text.gif) | Túrótorta sütés nélkül.txt | 2007-03-24 02:59 | 551 | |
![[TXT]](/icons/text.gif) | Pozsonyi dióskürtös.txt | 2007-03-24 02:59 | 550 | |
![[TXT]](/icons/text.gif) | Diós kockák.txt | 2007-03-24 02:59 | 550 | |
![[TXT]](/icons/text.gif) | Márványszelet.txt | 2007-03-24 02:59 | 549 | |
![[TXT]](/icons/text.gif) | Húsos sonka hagymaruhában.txt | 2007-03-24 02:59 | 549 | |
![[TXT]](/icons/text.gif) | Édes pogácsa.txt | 2007-03-24 02:59 | 549 | |
![[TXT]](/icons/text.gif) | Sült ponty hagymaszósszal.txt | 2007-03-24 02:59 | 547 | |
![[TXT]](/icons/text.gif) | Sült derelye.txt | 2007-03-24 02:59 | 547 | |
![[TXT]](/icons/text.gif) | Hagyma mártás.txt | 2007-03-24 02:59 | 547 | |
![[TXT]](/icons/text.gif) | Bakonyi betyárleves.txt | 2007-03-24 02:59 | 547 | |
![[TXT]](/icons/text.gif) | Turbolya leves.txt | 2007-03-24 02:59 | 546 | |
![[TXT]](/icons/text.gif) | Krémes tekercs.txt | 2007-03-24 02:59 | 546 | |
![[TXT]](/icons/text.gif) | Sárgaborsó fozelékl.txt | 2007-03-24 02:59 | 545 | |
![[TXT]](/icons/text.gif) | Sárgaborsó főzelékl.txt | 2007-03-24 02:59 | 545 | |
![[TXT]](/icons/text.gif) | Reszelt túrós kakaós.txt | 2007-03-24 02:59 | 545 | |
![[TXT]](/icons/text.gif) | Hamis túrógombóc.txt | 2007-03-24 02:59 | 545 | |
![[TXT]](/icons/text.gif) | Túrós fánk 2.txt | 2007-03-24 02:59 | 544 | |
![[TXT]](/icons/text.gif) | Planter`s Bowle.txt | 2007-03-24 02:59 | 544 | |
![[TXT]](/icons/text.gif) | Meggylikor.txt | 2007-03-24 02:59 | 543 | |
![[TXT]](/icons/text.gif) | Meggylikőr.txt | 2007-03-24 02:59 | 543 | |
![[TXT]](/icons/text.gif) | Kiflik diómasszából.txt | 2007-03-24 02:59 | 543 | |
![[TXT]](/icons/text.gif) | Paulette.txt | 2007-03-24 02:59 | 542 | |
![[TXT]](/icons/text.gif) | Márványos süti.txt | 2007-03-24 02:59 | 541 | |
![[TXT]](/icons/text.gif) | Aszaltszilvás, diós pulykamell.txt | 2007-03-24 02:59 | 540 | |
![[TXT]](/icons/text.gif) | Töltött csirke.txt | 2007-03-24 02:59 | 539 | |
![[TXT]](/icons/text.gif) | Borsos tokány.txt | 2007-03-24 02:59 | 539 | |
![[TXT]](/icons/text.gif) | Hagymás krumplisaláta.txt | 2007-03-24 02:59 | 538 | |
![[TXT]](/icons/text.gif) | Debrecenis borda.txt | 2007-03-24 02:59 | 537 | |
![[TXT]](/icons/text.gif) | Lúdláb.txt | 2007-03-24 02:59 | 536 | |
![[TXT]](/icons/text.gif) | Havasi házikó.txt | 2007-03-24 02:59 | 536 | |
![[TXT]](/icons/text.gif) | Svédgomba.txt | 2007-03-24 02:59 | 535 | |
![[TXT]](/icons/text.gif) | Porhanyós uzsonnaszelet.txt | 2007-03-24 02:59 | 534 | |
![[TXT]](/icons/text.gif) | Gombafasírt.txt | 2007-03-24 02:59 | 534 | |
![[TXT]](/icons/text.gif) | Lea süti.txt | 2007-03-24 02:59 | 532 | |
![[TXT]](/icons/text.gif) | Borsos marhasült.txt | 2007-03-24 02:59 | 531 | |
![[TXT]](/icons/text.gif) | Tiroli rétes.txt | 2007-03-24 02:59 | 530 | |
![[TXT]](/icons/text.gif) | Ördöghal nyárson.txt | 2007-03-24 02:59 | 530 | |
![[TXT]](/icons/text.gif) | Vaníliás felfújt.txt | 2007-03-24 02:59 | 528 | |
![[TXT]](/icons/text.gif) | Paradicsomos babsaláta.txt | 2007-03-24 02:59 | 528 | |
![[TXT]](/icons/text.gif) | elozek2.html | 2007-11-13 21:03 | 526 | |
![[TXT]](/icons/text.gif) | Leveles sajtosrudak.txt | 2007-03-24 02:59 | 526 | |
![[TXT]](/icons/text.gif) | Kukoricás sonkás tésztasaláta.txt | 2007-03-24 02:59 | 526 | |
![[TXT]](/icons/text.gif) | elozek.html | 2007-11-13 21:03 | 525 | |
![[TXT]](/icons/text.gif) | Paradicsomleves.txt | 2007-03-24 02:59 | 525 | |
![[TXT]](/icons/text.gif) | Burgonyás szelet.txt | 2007-03-24 02:59 | 525 | |
![[TXT]](/icons/text.gif) | Ajvar-szerb paprika-padlizsán mártás.txt | 2007-03-24 02:59 | 525 | |
![[TXT]](/icons/text.gif) | Sárgarépa golyó.txt | 2007-03-24 02:59 | 523 | |
![[TXT]](/icons/text.gif) | Kukoricakoch.txt | 2007-03-24 02:59 | 523 | |
![[TXT]](/icons/text.gif) | Hamis palócleves.txt | 2007-03-24 02:59 | 523 | |
![[TXT]](/icons/text.gif) | Besamel-(tej)mártás.txt | 2007-03-24 02:59 | 523 | |
![[TXT]](/icons/text.gif) | Meggymártás1.txt | 2007-03-24 02:59 | 522 | |
![[TXT]](/icons/text.gif) | Petrezselyemzöld saláta.txt | 2007-03-24 02:59 | 521 | |
![[TXT]](/icons/text.gif) | Tartármártás.txt | 2007-03-24 02:59 | 520 | |
![[TXT]](/icons/text.gif) | nemere_istvan_a_titan_terv_ful_hu_nncl2169_63cv1.txt | 2005-08-09 18:10 | 519 | |
![[TXT]](/icons/text.gif) | Szabolcsi lepény.txt | 2007-03-24 02:59 | 519 | |
![[TXT]](/icons/text.gif) | Palacsinta3.txt | 2007-03-24 02:59 | 519 | |
![[TXT]](/icons/text.gif) | Habos csiga.txt | 2007-03-24 02:59 | 519 | |
![[TXT]](/icons/text.gif) | Sajtos rizsgombóc.txt | 2007-03-24 02:59 | 518 | |
![[TXT]](/icons/text.gif) | Mandulás tormamártás.txt | 2007-03-24 02:59 | 518 | |
![[TXT]](/icons/text.gif) | Burgonyás patkók.txt | 2007-03-24 02:59 | 518 | |
![[TXT]](/icons/text.gif) | Zeller leves.txt | 2007-03-24 02:59 | 517 | |
![[TXT]](/icons/text.gif) | Kinai zöldségleves.txt | 2007-03-24 02:59 | 517 | |
![[TXT]](/icons/text.gif) | Waldorf saláta.txt | 2007-03-24 02:59 | 516 | |
![[TXT]](/icons/text.gif) | Mézes-kókuszos kocka.txt | 2007-03-24 02:59 | 516 | |
![[TXT]](/icons/text.gif) | 3k.html | 2007-11-13 21:03 | 516 | |
![[TXT]](/icons/text.gif) | 2k.html | 2007-11-13 21:03 | 516 | |
![[TXT]](/icons/text.gif) | 1k.html | 2007-11-13 21:03 | 516 | |
![[TXT]](/icons/text.gif) | Hering saláta.txt | 2007-03-24 02:59 | 515 | |
![[TXT]](/icons/text.gif) | Csirkemáj.txt | 2007-03-24 02:59 | 515 | |
![[TXT]](/icons/text.gif) | Márványsajtos csirke.txt | 2007-03-24 02:59 | 514 | |
![[TXT]](/icons/text.gif) | Krumplispogácsa nagymama módra.txt | 2007-03-24 02:59 | 514 | |
![[TXT]](/icons/text.gif) | Nyári túrós palacsinta.txt | 2007-03-24 02:59 | 513 | |
![[TXT]](/icons/text.gif) | Linzi korongocskák.txt | 2007-03-24 02:59 | 513 | |
![[TXT]](/icons/text.gif) | Kapros, joghurtos sárgaborsóleves.txt | 2007-03-24 02:59 | 513 | |
![[TXT]](/icons/text.gif) | Citromos sertéssült.txt | 2007-03-24 02:59 | 513 | |
![[TXT]](/icons/text.gif) | Genovai rizotto.txt | 2007-03-24 02:59 | 512 | |
![[TXT]](/icons/text.gif) | Barnácska.txt | 2007-03-24 02:59 | 512 | |
![[TXT]](/icons/text.gif) | Édes tojásmártás.txt | 2007-03-24 02:59 | 512 | |
![[TXT]](/icons/text.gif) | Banános kakótorta.txt | 2007-03-24 02:59 | 510 | |
![[TXT]](/icons/text.gif) | Alufóliás sárgarépa.txt | 2007-03-24 02:59 | 510 | |
![[TXT]](/icons/text.gif) | Töltött pulykamell1.txt | 2007-03-24 02:59 | 509 | |
![[TXT]](/icons/text.gif) | Vaníliás kuglóf.txt | 2007-03-24 02:59 | 508 | |
![[TXT]](/icons/text.gif) | RIZIBIZI.TXT | 2007-03-24 02:59 | 508 | |
![[TXT]](/icons/text.gif) | Burgonyapüré.txt | 2007-03-24 02:59 | 508 | |
![[TXT]](/icons/text.gif) | Rumos meggy.txt | 2007-03-24 02:59 | 507 | |
![[TXT]](/icons/text.gif) | Angol marhasült (Roast Beef).txt | 2007-03-24 02:59 | 507 | |
![[TXT]](/icons/text.gif) | Sajtos csirkemell.txt | 2007-03-24 02:59 | 506 | |
![[TXT]](/icons/text.gif) | Ropogós, sült zöldség.txt | 2007-03-24 02:59 | 506 | |
![[TXT]](/icons/text.gif) | Narancs juice.txt | 2007-03-24 02:59 | 506 | |
![[TXT]](/icons/text.gif) | Kakaós linzerszeletek.txt | 2007-03-24 02:59 | 506 | |
![[TXT]](/icons/text.gif) | Mesealmás.txt | 2007-03-24 02:59 | 505 | |
![[TXT]](/icons/text.gif) | Füves halfilé.txt | 2007-03-24 02:59 | 505 | |
![[TXT]](/icons/text.gif) | Szilvás krumpli.txt | 2007-03-24 02:59 | 502 | |
![[TXT]](/icons/text.gif) | Metélohagyma-mártás.txt | 2007-03-24 02:59 | 502 | |
![[TXT]](/icons/text.gif) | Metélőhagyma-mártás.txt | 2007-03-24 02:59 | 502 | |
![[TXT]](/icons/text.gif) | Kanonoklepény.txt | 2007-03-24 02:59 | 501 | |
![[TXT]](/icons/text.gif) | Banán-alma müzli.txt | 2007-03-24 02:59 | 501 | |
![[TXT]](/icons/text.gif) | Piramis.txt | 2007-03-24 02:59 | 500 | |
![[TXT]](/icons/text.gif) | errata.txt | 2007-11-13 21:35 | 499 | |
![[TXT]](/icons/text.gif) | Örmény zöldség.txt | 2007-03-24 02:59 | 499 | |
![[TXT]](/icons/text.gif) | Olcsó házitorta.txt | 2007-03-24 02:59 | 498 | |
![[TXT]](/icons/text.gif) | Gyümölcsleves.txt | 2007-03-24 02:59 | 498 | |
![[TXT]](/icons/text.gif) | Budai szeletek.txt | 2007-03-24 02:59 | 497 | |
![[TXT]](/icons/text.gif) | Fehér burgonyaleves.txt | 2007-03-24 02:59 | 496 | |
![[TXT]](/icons/text.gif) | Mazsolás ánizsos kenyér.txt | 2007-03-24 02:59 | 495 | |
![[TXT]](/icons/text.gif) | Gozben fott burgonya.txt | 2007-03-24 02:59 | 495 | |
![[TXT]](/icons/text.gif) | Gőzben főtt burgonya.txt | 2007-03-24 02:59 | 495 | |
![[TXT]](/icons/text.gif) | Finom kókuszos süti.txt | 2007-03-24 02:59 | 495 | |
![[TXT]](/icons/text.gif) | Mandulás túrókrém.txt | 2007-03-24 02:59 | 494 | |
![[TXT]](/icons/text.gif) | Bum bum tequila.txt | 2007-03-24 02:59 | 494 | |
![[TXT]](/icons/text.gif) | Kedvenc szelet.txt | 2007-03-24 02:59 | 493 | |
![[TXT]](/icons/text.gif) | Diákkenyér.txt | 2007-03-24 02:59 | 493 | |
![[TXT]](/icons/text.gif) | Tojáskrém.txt | 2007-03-24 02:59 | 492 | |
![[TXT]](/icons/text.gif) | Tört burgonya.txt | 2007-03-24 02:59 | 491 | |
![[TXT]](/icons/text.gif) | Orosz hússaláta.txt | 2007-03-24 02:59 | 490 | |
![[TXT]](/icons/text.gif) | Marhahús leves.txt | 2007-03-24 02:59 | 490 | |
![[TXT]](/icons/text.gif) | Gesztenytorta.txt | 2007-03-24 02:59 | 490 | |
![[TXT]](/icons/text.gif) | Búzacsírás kekszgolyó.txt | 2007-03-24 02:59 | 488 | |
![[TXT]](/icons/text.gif) | Tavaszi eroleves.txt | 2007-03-24 02:59 | 487 | |
![[TXT]](/icons/text.gif) | Tavaszi erőleves.txt | 2007-03-24 02:59 | 487 | |
![[TXT]](/icons/text.gif) | Téli saláta.txt | 2007-03-24 02:59 | 487 | |
![[TXT]](/icons/text.gif) | Kossuth-kifli.txt | 2007-03-24 02:59 | 487 | |
![[TXT]](/icons/text.gif) | mibolmennyi.txt | 2007-03-24 02:59 | 486 | |
![[TXT]](/icons/text.gif) | mibőlmennyi.txt | 2007-03-24 02:59 | 486 | |
![[TXT]](/icons/text.gif) | Párizsi sajtmártás.txt | 2007-03-24 02:59 | 486 | |
![[TXT]](/icons/text.gif) | Uborkamártás1.txt | 2007-03-24 02:59 | 483 | |
![[TXT]](/icons/text.gif) | Tartiflett köret.txt | 2007-03-24 02:59 | 482 | |
![[TXT]](/icons/text.gif) | Kakaós tortaszeletkék.txt | 2007-03-24 02:59 | 482 | |
![[TXT]](/icons/text.gif) | Almagombóc.txt | 2007-03-24 02:59 | 482 | |
![[TXT]](/icons/text.gif) | Sajtos ropogós.txt | 2007-03-24 02:59 | 481 | |
![[TXT]](/icons/text.gif) | Borbarát burgonya.txt | 2007-03-24 02:59 | 480 | |
![[TXT]](/icons/text.gif) | Császármorzsa.txt | 2007-03-24 02:59 | 479 | |
![[TXT]](/icons/text.gif) | Burgonyafelfújt túróval.txt | 2007-03-24 02:59 | 478 | |
![[TXT]](/icons/text.gif) | Hortobágyi töltött burgonya.txt | 2007-03-24 02:59 | 477 | |
![[TXT]](/icons/text.gif) | Háziasszony remeke.txt | 2007-03-24 02:59 | 477 | |
![[TXT]](/icons/text.gif) | Bélszínszeletek örmény módra.txt | 2007-03-24 02:59 | 477 | |
![[TXT]](/icons/text.gif) | Pörkölt kicsit másként.txt | 2007-03-24 02:59 | 475 | |
![[TXT]](/icons/text.gif) | Ohio black beauty.txt | 2007-03-24 02:59 | 475 | |
![[TXT]](/icons/text.gif) | Bolognai libasült.txt | 2007-03-24 02:59 | 475 | |
![[TXT]](/icons/text.gif) | Érsekszeletek.txt | 2007-03-24 02:59 | 474 | |
![[TXT]](/icons/text.gif) | Porhanyós perecek.txt | 2007-03-24 02:59 | 472 | |
![[TXT]](/icons/text.gif) | Blue Hawaiian.txt | 2007-03-24 02:59 | 472 | |
![[TXT]](/icons/text.gif) | Tárkonyos raguleves.txt | 2007-03-24 02:59 | 471 | |
![[TXT]](/icons/text.gif) | Gyümölcsös pizza.txt | 2007-03-24 02:59 | 471 | |
![[TXT]](/icons/text.gif) | Morzsatorta.txt | 2007-03-24 02:59 | 470 | |
![[TXT]](/icons/text.gif) | Gesztenyével töltött pulyka.txt | 2007-03-24 02:59 | 470 | |
![[TXT]](/icons/text.gif) | Fahéjas csirkeszárny.txt | 2007-03-24 02:59 | 470 | |
![[TXT]](/icons/text.gif) | Rakott piskóta.txt | 2007-03-24 02:59 | 468 | |
![[TXT]](/icons/text.gif) | Ráckrumpli.txt | 2007-03-24 02:59 | 468 | |
![[TXT]](/icons/text.gif) | Hortobágyi tepertosrudak.txt | 2007-03-24 02:59 | 467 | |
![[TXT]](/icons/text.gif) | Hortobágyi tepertősrudak.txt | 2007-03-24 02:59 | 467 | |
![[TXT]](/icons/text.gif) | Puha mézes.txt | 2007-03-24 02:59 | 466 | |
![[TXT]](/icons/text.gif) | Kunsági leves.txt | 2007-03-24 02:59 | 466 | |
![[TXT]](/icons/text.gif) | Yorkshire puding.txt | 2007-03-24 02:59 | 465 | |
![[TXT]](/icons/text.gif) | Vajastáskák.txt | 2007-03-24 02:59 | 465 | |
![[TXT]](/icons/text.gif) | Foszlós fánk.txt | 2007-03-24 02:59 | 465 | |
![[TXT]](/icons/text.gif) | Diós linzer.txt | 2007-03-24 02:59 | 464 | |
![[TXT]](/icons/text.gif) | Húsos burgonyagombóc.txt | 2007-03-24 02:59 | 463 | |
![[TXT]](/icons/text.gif) | Barna süti.txt | 2007-03-24 02:59 | 462 | |
![[TXT]](/icons/text.gif) | Bundás alma.txt | 2007-03-24 02:59 | 461 | |
![[TXT]](/icons/text.gif) | Tésztába ejtett meggy.txt | 2007-03-24 02:59 | 460 | |
![[TXT]](/icons/text.gif) | Sült oszibarack.txt | 2007-03-24 02:59 | 459 | |
![[TXT]](/icons/text.gif) | Sült őszibarack.txt | 2007-03-24 02:59 | 459 | |
![[IMG]](/icons/image2.gif) | BG2(1).GIF | 2007-03-24 02:59 | 459 | |
![[TXT]](/icons/text.gif) | RIBURGER.TXT | 2007-03-24 02:59 | 458 | |
![[TXT]](/icons/text.gif) | Fahéjas csemege.txt | 2007-03-24 02:59 | 458 | |
![[TXT]](/icons/text.gif) | Mustáros marhaszelet.txt | 2007-03-24 02:59 | 456 | |
![[TXT]](/icons/text.gif) | Egyszerű torta.txt | 2007-03-24 02:59 | 455 | |
![[TXT]](/icons/text.gif) | Vegyes nyársonsült.txt | 2007-03-24 02:59 | 454 | |
![[TXT]](/icons/text.gif) | Joghurtos süti.txt | 2007-03-24 02:59 | 454 | |
![[TXT]](/icons/text.gif) | Tonhal saláta.txt | 2007-03-24 02:59 | 453 | |
![[TXT]](/icons/text.gif) | Csopakii tokány.txt | 2007-03-24 02:59 | 452 | |
![[TXT]](/icons/text.gif) | Banan- snack.txt | 2007-03-24 02:59 | 452 | |
![[TXT]](/icons/text.gif) | Papanasi.txt | 2007-03-24 02:59 | 451 | |
![[TXT]](/icons/text.gif) | Gábris leves.txt | 2007-03-24 02:59 | 451 | |
![[TXT]](/icons/text.gif) | Túrógombóc1.txt | 2007-03-24 02:59 | 450 | |
![[TXT]](/icons/text.gif) | Sajtos paradicsom.txt | 2007-03-24 02:59 | 450 | |
![[TXT]](/icons/text.gif) | Zsírban sült pufók.txt | 2007-03-24 02:59 | 449 | |
![[TXT]](/icons/text.gif) | Zöldséges rakott hal.txt | 2007-03-24 02:59 | 449 | |
![[TXT]](/icons/text.gif) | Remuládmártás.txt | 2007-03-24 02:59 | 449 | |
![[TXT]](/icons/text.gif) | Ananászos csirkesaláta.txt | 2007-03-24 02:59 | 448 | |
![[TXT]](/icons/text.gif) | Zöldséges tepsis palacsinta.txt | 2007-03-24 02:59 | 447 | |
![[TXT]](/icons/text.gif) | Patisszonsaláta.txt | 2007-03-24 02:59 | 446 | |
![[TXT]](/icons/text.gif) | Konfetti bólé.txt | 2007-03-24 02:59 | 446 | |
![[TXT]](/icons/text.gif) | Túrós fánk.txt | 2007-03-24 02:59 | 444 | |
![[TXT]](/icons/text.gif) | Tepsis karaj.txt | 2007-03-24 02:59 | 443 | |
![[TXT]](/icons/text.gif) | Karalábéfozelék.txt | 2007-03-24 02:59 | 442 | |
![[TXT]](/icons/text.gif) | Karalábéfőzelék.txt | 2007-03-24 02:59 | 442 | |
![[TXT]](/icons/text.gif) | Sárgarépagolyók.txt | 2007-03-24 02:59 | 441 | |
![[TXT]](/icons/text.gif) | Banános torta.txt | 2007-03-24 02:59 | 441 | |
![[TXT]](/icons/text.gif) | Lekach.txt | 2007-03-24 02:59 | 439 | |
![[TXT]](/icons/text.gif) | Szepesi mogyorósszelet.txt | 2007-03-24 02:59 | 438 | |
![[TXT]](/icons/text.gif) | Répatorta.txt | 2007-03-24 02:59 | 438 | |
![[TXT]](/icons/text.gif) | Fokhagymás rakott csirke.txt | 2007-03-24 02:59 | 438 | |
![[TXT]](/icons/text.gif) | Római bólé.txt | 2007-03-24 02:59 | 437 | |
![[TXT]](/icons/text.gif) | Almás krémsajt.txt | 2007-03-24 02:59 | 437 | |
![[TXT]](/icons/text.gif) | Bundás karalábé.txt | 2007-03-24 02:59 | 436 | |
![[TXT]](/icons/text.gif) | Big Ben.txt | 2007-03-24 02:59 | 435 | |
![[TXT]](/icons/text.gif) | Almaleves argentin módra.txt | 2007-03-24 02:59 | 435 | |
![[TXT]](/icons/text.gif) | Jeges kávé.txt | 2007-03-24 02:59 | 433 | |
![[TXT]](/icons/text.gif) | Rántott sonka.txt | 2007-03-24 02:59 | 432 | |
![[TXT]](/icons/text.gif) | Paprikás csirke'.txt | 2007-03-24 02:59 | 432 | |
![[TXT]](/icons/text.gif) | Mogyorós fészek.txt | 2007-03-24 02:59 | 432 | |
![[TXT]](/icons/text.gif) | Almafozelék.txt | 2007-03-24 02:59 | 432 | |
![[TXT]](/icons/text.gif) | Almafőzelék.txt | 2007-03-24 02:59 | 432 | |
![[TXT]](/icons/text.gif) | Stefánia rizs.txt | 2007-03-24 02:59 | 431 | |
![[TXT]](/icons/text.gif) | Kiadós teasütemény.txt | 2007-03-24 02:59 | 431 | |
![[TXT]](/icons/text.gif) | Éva salátája.txt | 2007-03-24 02:59 | 431 | |
![[TXT]](/icons/text.gif) | Tom burger mikroban.txt | 2007-03-24 02:59 | 430 | |
![[TXT]](/icons/text.gif) | Tavaszi raguleves.txt | 2007-03-24 02:59 | 430 | |
![[TXT]](/icons/text.gif) | Kukoricaköret.txt | 2007-03-24 02:59 | 429 | |
![[TXT]](/icons/text.gif) | Karácsonyi mézes.txt | 2007-03-24 02:59 | 429 | |
![[TXT]](/icons/text.gif) | Kapros paradicsomsaláta.txt | 2007-03-24 02:59 | 428 | |
![[TXT]](/icons/text.gif) | Pácolt báránylapocka nyárson.txt | 2007-03-24 02:59 | 427 | |
![[TXT]](/icons/text.gif) | Csokoládé kocka.txt | 2007-03-24 02:59 | 427 | |
![[TXT]](/icons/text.gif) | Császármorzsa'.txt | 2007-03-24 02:59 | 427 | |
![[TXT]](/icons/text.gif) | Hagymás csirke római tálban.txt | 2007-03-24 02:59 | 425 | |
![[TXT]](/icons/text.gif) | Palcsinta vaníliás krémmel.txt | 2007-03-24 02:59 | 424 | |
![[TXT]](/icons/text.gif) | Aszalt szilvával töltött kacsa.txt | 2007-03-24 02:59 | 424 | |
![[TXT]](/icons/text.gif) | Császárfánk.txt | 2007-03-24 02:59 | 422 | |
![[TXT]](/icons/text.gif) | Angol vagdalt.txt | 2007-03-24 02:59 | 422 | |
![[TXT]](/icons/text.gif) | Túrófasírt.txt | 2007-03-24 02:59 | 421 | |
![[TXT]](/icons/text.gif) | Amerikai almatorta.txt | 2007-03-24 02:59 | 421 | |
![[TXT]](/icons/text.gif) | _adatlap.txt | 2007-11-13 21:03 | 420 | |
![[TXT]](/icons/text.gif) | Túrógolyó.txt | 2007-03-24 02:59 | 420 | |
![[TXT]](/icons/text.gif) | Mézes kukoricagolyók.txt | 2007-03-24 02:59 | 420 | |
![[TXT]](/icons/text.gif) | Palacsinta1.txt | 2007-03-24 02:59 | 418 | |
![[TXT]](/icons/text.gif) | Csokoládékenyér.txt | 2007-03-24 02:59 | 418 | |
![[TXT]](/icons/text.gif) | Habos epres lepény.txt | 2007-03-24 02:59 | 416 | |
![[TXT]](/icons/text.gif) | Debreceni tokány.txt | 2007-03-24 02:59 | 416 | |
![[TXT]](/icons/text.gif) | Narancs-citrom szorbet.txt | 2007-03-24 02:59 | 415 | |
![[TXT]](/icons/text.gif) | Diós zsúrszeletek.txt | 2007-03-24 02:59 | 415 | |
![[TXT]](/icons/text.gif) | Svéd gombasaláta.txt | 2007-03-24 02:59 | 411 | |
![[TXT]](/icons/text.gif) | Mandulás hal'.txt | 2007-03-24 02:59 | 411 | |
![[TXT]](/icons/text.gif) | Hering bundában sütve.txt | 2007-03-24 02:59 | 411 | |
![[TXT]](/icons/text.gif) | Gerslileves.txt | 2007-03-24 02:59 | 410 | |
![[TXT]](/icons/text.gif) | Gyümölcsös süti.txt | 2007-03-24 02:59 | 408 | |
![[TXT]](/icons/text.gif) | Krumplis tészta'.txt | 2007-03-24 02:59 | 407 | |
![[TXT]](/icons/text.gif) | Sült libacomb.txt | 2007-03-24 02:59 | 406 | |
![[TXT]](/icons/text.gif) | Non plus ultra.txt | 2007-03-24 02:59 | 405 | |
![[TXT]](/icons/text.gif) | rajz.txt | 2007-03-24 02:58 | 404 | |
![[TXT]](/icons/text.gif) | Francia burgonya.txt | 2007-03-24 02:59 | 403 | |
![[TXT]](/icons/text.gif) | Currys csirke.txt | 2007-03-24 02:59 | 402 | |
![[TXT]](/icons/text.gif) | Vaníliás darakrém.txt | 2007-03-24 02:59 | 400 | |
![[TXT]](/icons/text.gif) | Linzer.txt | 2007-03-24 02:59 | 400 | |
![[TXT]](/icons/text.gif) | Lili-kifli.txt | 2007-03-24 02:59 | 400 | |
![[TXT]](/icons/text.gif) | fulszoveg.txt | 2007-11-14 05:18 | 399 | |
![[TXT]](/icons/text.gif) | Pozsonyi kifli.txt | 2007-03-24 02:59 | 399 | |
![[TXT]](/icons/text.gif) | Ropogós burgonya.txt | 2007-03-24 02:59 | 398 | |
![[TXT]](/icons/text.gif) | Karácsonyi mézespálinka.txt | 2007-03-24 02:59 | 398 | |
![[TXT]](/icons/text.gif) | Babpástétom.txt | 2007-03-24 02:59 | 398 | |
![[TXT]](/icons/text.gif) | Csopaki pincepörkölt .txt | 2007-03-24 02:59 | 397 | |
![[TXT]](/icons/text.gif) | Vegetáriánus pizza.txt | 2007-03-24 02:59 | 396 | |
![[TXT]](/icons/text.gif) | Diós hal'.txt | 2007-03-24 02:59 | 396 | |
![[TXT]](/icons/text.gif) | Aranyleves.txt | 2007-03-24 02:59 | 395 | |
![[TXT]](/icons/text.gif) | Bostoni burgonya.txt | 2007-03-24 02:59 | 394 | |
![[TXT]](/icons/text.gif) | Repas kifli.txt | 2007-03-24 02:59 | 393 | |
![[TXT]](/icons/text.gif) | Vaníliás rétes.txt | 2007-03-24 02:59 | 391 | |
![[TXT]](/icons/text.gif) | Pizzafeltét.txt | 2007-03-24 02:59 | 391 | |
![[TXT]](/icons/text.gif) | Gyümölcskalács.txt | 2007-03-24 02:59 | 391 | |
![[TXT]](/icons/text.gif) | Tealinzer.txt | 2007-03-24 02:59 | 390 | |
![[TXT]](/icons/text.gif) | Túrófánk.txt | 2007-03-24 02:59 | 390 | |
![[TXT]](/icons/text.gif) | Zelleres tojáskrém.txt | 2007-03-24 02:59 | 388 | |
![[TXT]](/icons/text.gif) | Takaréklinzer.txt | 2007-03-24 02:59 | 388 | |
![[TXT]](/icons/text.gif) | Lekváros kavart tészta.txt | 2007-03-24 02:59 | 387 | |
![[TXT]](/icons/text.gif) | Halpástétom.txt | 2007-03-24 02:59 | 387 | |
![[TXT]](/icons/text.gif) | Tejcsokoládé.txt | 2007-03-24 02:59 | 386 | |
![[TXT]](/icons/text.gif) | Indonéz currys rizs csirkemellel.txt | 2007-03-24 02:59 | 386 | |
![[TXT]](/icons/text.gif) | Sajtos-sós szalagáré.txt | 2007-03-24 02:59 | 385 | |
![[TXT]](/icons/text.gif) | Sajtban sült csirkemell.txt | 2007-03-24 02:59 | 385 | |
![[TXT]](/icons/text.gif) | Ananászos sültcsirke.txt | 2007-03-24 02:59 | 385 | |
![[TXT]](/icons/text.gif) | Paprikás hal.txt | 2007-03-24 02:59 | 384 | |
![[TXT]](/icons/text.gif) | Krokett.txt | 2007-03-24 02:59 | 383 | |
![[TXT]](/icons/text.gif) | Burgonyatorta.txt | 2007-03-24 02:59 | 383 | |
![[TXT]](/icons/text.gif) | Habos meggyes.txt | 2007-03-24 02:59 | 382 | |
![[TXT]](/icons/text.gif) | Őzgerinces túrós.txt | 2007-03-24 02:59 | 382 | |
![[TXT]](/icons/text.gif) | Krumplis fánk'.txt | 2007-03-24 02:59 | 381 | |
![[TXT]](/icons/text.gif) | Knock Out Drink.txt | 2007-03-24 02:59 | 380 | |
![[TXT]](/icons/text.gif) | Kekszes süti.txt | 2007-03-24 02:59 | 380 | |
![[TXT]](/icons/text.gif) | Dalmát paprika.txt | 2007-03-24 02:59 | 380 | |
![[TXT]](/icons/text.gif) | rajzok.txt | 2007-11-14 05:58 | 378 | |
![[TXT]](/icons/text.gif) | Lengyel hal.txt | 2007-03-24 02:59 | 377 | |
![[TXT]](/icons/text.gif) | Fuszeres olajok.txt | 2007-03-24 02:59 | 377 | |
![[TXT]](/icons/text.gif) | Fokhagyma-mártás.txt | 2007-03-24 02:59 | 377 | |
![[TXT]](/icons/text.gif) | Fűszeres olajok.txt | 2007-03-24 02:59 | 377 | |
![[TXT]](/icons/text.gif) | Egresmártás.txt | 2007-03-24 02:59 | 376 | |
![[TXT]](/icons/text.gif) | Tejszínes kukorica.txt | 2007-03-24 02:59 | 375 | |
![[TXT]](/icons/text.gif) | Besamelmártás1.txt | 2007-03-24 02:59 | 375 | |
![[TXT]](/icons/text.gif) | Eszterházi rostályos-utánzat.txt | 2007-03-24 02:59 | 374 | |
![[TXT]](/icons/text.gif) | Szalonnás burgonya.txt | 2007-03-24 02:59 | 373 | |
![[TXT]](/icons/text.gif) | Békacomb nyárson.txt | 2007-03-24 02:59 | 373 | |
![[TXT]](/icons/text.gif) | Vaníliás perecek.txt | 2007-03-24 02:59 | 372 | |
![[TXT]](/icons/text.gif) | Túrós-almás turmix.txt | 2007-03-24 02:59 | 372 | |
![[TXT]](/icons/text.gif) | Francia karalábé.txt | 2007-03-24 02:59 | 372 | |
![[TXT]](/icons/text.gif) | Tokaji mártás.txt | 2007-03-24 02:59 | 371 | |
![[TXT]](/icons/text.gif) | Malacpörkölt.txt | 2007-03-24 02:59 | 370 | |
![[TXT]](/icons/text.gif) | Almás szelet.txt | 2007-03-24 02:59 | 369 | |
![[TXT]](/icons/text.gif) | Karácsonyfadísz.txt | 2007-03-24 02:59 | 368 | |
![[TXT]](/icons/text.gif) | Sombati lazacszelet.txt | 2007-03-24 02:59 | 367 | |
![[TXT]](/icons/text.gif) | Csirke gyorsan és egyszeruen.txt | 2007-03-24 02:59 | 367 | |
![[TXT]](/icons/text.gif) | Csirke gyorsan és egyszerűen.txt | 2007-03-24 02:59 | 367 | |
![[TXT]](/icons/text.gif) | Sajtos rúd.txt | 2007-03-24 02:59 | 366 | |
![[TXT]](/icons/text.gif) | Krumplis latkesz.txt | 2007-03-24 02:59 | 365 | |
![[TXT]](/icons/text.gif) | Sárgarépasaláta almával.txt | 2007-03-24 02:59 | 364 | |
![[TXT]](/icons/text.gif) | Piros krémsajt.txt | 2007-03-24 02:59 | 363 | |
![[TXT]](/icons/text.gif) | Metélohagyma-mártás1.txt | 2007-03-24 02:59 | 363 | |
![[TXT]](/icons/text.gif) | Metélőhagyma-mártás1.txt | 2007-03-24 02:59 | 363 | |
![[TXT]](/icons/text.gif) | Citromos pulykamell.txt | 2007-03-24 02:59 | 362 | |
![[TXT]](/icons/text.gif) | Zöldborsó leves.txt | 2007-03-24 02:59 | 361 | |
![[TXT]](/icons/text.gif) | Resztelt krumpli.txt | 2007-03-24 02:59 | 361 | |
![[TXT]](/icons/text.gif) | Raffaello2.txt | 2007-03-24 02:59 | 361 | |
![[IMG]](/icons/image2.gif) | 2.GIF | 2007-03-24 02:59 | 360 | |
![[TXT]](/icons/text.gif) | Hagymás marhaszeletek.txt | 2007-03-24 02:59 | 359 | |
![[TXT]](/icons/text.gif) | Almás csirkemell.txt | 2007-03-24 02:59 | 359 | |
![[TXT]](/icons/text.gif) | Alkoholmentes ünnepi bólé.txt | 2007-03-24 02:59 | 357 | |
![[TXT]](/icons/text.gif) | Fagyi szelet.txt | 2007-03-24 02:59 | 356 | |
![[TXT]](/icons/text.gif) | Palacsinta4.txt | 2007-03-24 02:59 | 355 | |
![[TXT]](/icons/text.gif) | Gyömbéres süti.txt | 2007-03-24 02:59 | 353 | |
![[TXT]](/icons/text.gif) | Burgundi puncs.txt | 2007-03-24 02:59 | 351 | |
![[TXT]](/icons/text.gif) | Kirándulók süteménye.txt | 2007-03-24 02:59 | 344 | |
![[TXT]](/icons/text.gif) | Olasz sertéskaraj.txt | 2007-03-24 02:59 | 343 | |
![[TXT]](/icons/text.gif) | Kakaókrém.txt | 2007-03-24 02:59 | 342 | |
![[TXT]](/icons/text.gif) | Diákkenyér'.txt | 2007-03-24 02:59 | 342 | |
![[TXT]](/icons/text.gif) | Almás kukoricasaláta.txt | 2007-03-24 02:59 | 341 | |
![[TXT]](/icons/text.gif) | Hamis mézes.txt | 2007-03-24 02:59 | 338 | |
![[TXT]](/icons/text.gif) | Hagymamártás'.txt | 2007-03-24 02:59 | 337 | |
![[TXT]](/icons/text.gif) | Székely mézescsók.txt | 2007-03-24 02:59 | 334 | |
![[TXT]](/icons/text.gif) | Tejfolos pite.txt | 2007-03-24 02:59 | 332 | |
![[TXT]](/icons/text.gif) | Besamelmártás.txt | 2007-03-24 02:59 | 332 | |
![[TXT]](/icons/text.gif) | Appel Jack Dasey.txt | 2007-03-24 02:59 | 332 | |
![[TXT]](/icons/text.gif) | Tejszínes laskagomba.txt | 2007-03-24 02:59 | 330 | |
![[TXT]](/icons/text.gif) | Tárkonyos csirkepaprikás.txt | 2007-03-24 02:59 | 330 | |
![[TXT]](/icons/text.gif) | Egész liba sütve.txt | 2007-03-24 02:59 | 330 | |
![[TXT]](/icons/text.gif) | Pezsgopuncs.txt | 2007-03-24 02:59 | 328 | |
![[TXT]](/icons/text.gif) | Pezsgőpuncs.txt | 2007-03-24 02:59 | 328 | |
![[TXT]](/icons/text.gif) | Uborkamártás.txt | 2007-03-24 02:59 | 327 | |
![[TXT]](/icons/text.gif) | Rumos szilvabefott.txt | 2007-03-24 02:59 | 327 | |
![[TXT]](/icons/text.gif) | Vaníliás teasütemény.txt | 2007-03-24 02:59 | 325 | |
![[TXT]](/icons/text.gif) | Zöldségleves.txt | 2007-03-24 02:59 | 323 | |
![[IMG]](/icons/image2.gif) | REALIKON.GIF | 2007-03-24 02:59 | 323 | |
![[TXT]](/icons/text.gif) | Paradicsommártás.txt | 2007-03-24 02:59 | 323 | |
![[TXT]](/icons/text.gif) | Káposztaleves.txt | 2007-03-24 02:59 | 322 | |
![[TXT]](/icons/text.gif) | Csirke kókusz mártásban.txt | 2007-03-24 02:59 | 320 | |
![[TXT]](/icons/text.gif) | Petrezselymes újburgonya.txt | 2007-03-24 02:59 | 318 | |
![[TXT]](/icons/text.gif) | Citromos keksz.txt | 2007-03-24 02:59 | 317 | |
![[TXT]](/icons/text.gif) | Brokkoli krémleves.txt | 2007-03-24 02:59 | 317 | |
![[TXT]](/icons/text.gif) | Anci pizza tésztája.txt | 2007-03-24 02:59 | 313 | |
![[TXT]](/icons/text.gif) | Puritán répa.txt | 2007-03-24 02:59 | 311 | |
![[TXT]](/icons/text.gif) | Raffaelló golyó.txt | 2007-03-24 02:59 | 310 | |
![[TXT]](/icons/text.gif) | Indonéz sajtmártás.txt | 2007-03-24 02:59 | 306 | |
![[TXT]](/icons/text.gif) | Alap pizza tészta.txt | 2007-03-24 02:59 | 305 | |
![[TXT]](/icons/text.gif) | Angolos burgonya.txt | 2007-03-24 02:59 | 303 | |
![[TXT]](/icons/text.gif) | Aszalt szilva rizzsel.txt | 2007-03-24 02:59 | 300 | |
![[TXT]](/icons/text.gif) | Részeges csirkemell.txt | 2007-03-24 02:59 | 293 | |
![[TXT]](/icons/text.gif) | Hagymaleves.txt | 2007-03-24 02:59 | 293 | |
![[TXT]](/icons/text.gif) | Boros kuglóf.txt | 2007-03-24 02:59 | 293 | |
![[IMG]](/icons/image2.gif) | BAL.GIF | 2007-03-24 02:57 | 293 | |
![[TXT]](/icons/text.gif) | Olajoshal házilag.txt | 2007-03-24 02:59 | 292 | |
![[IMG]](/icons/image2.gif) | HOME.GIF | 2007-03-24 02:57 | 291 | |
![[TXT]](/icons/text.gif) | Szilvmártás.txt | 2007-03-24 02:59 | 290 | |
![[IMG]](/icons/image2.gif) | JOBB.GIF | 2007-03-24 02:57 | 289 | |
![[TXT]](/icons/text.gif) | Angostura Fizz.txt | 2007-03-24 02:59 | 286 | |
![[TXT]](/icons/text.gif) | Bodza szörp.txt | 2007-03-24 02:59 | 284 | |
![[IMG]](/icons/image2.gif) | BG(1).GIF | 2007-03-24 02:59 | 283 | |
![[TXT]](/icons/text.gif) | Fogyókúra.txt | 2007-03-24 02:59 | 279 | |
![[IMG]](/icons/image2.gif) | H5.GIF | 2007-03-24 02:59 | 277 | |
![[TXT]](/icons/text.gif) | start.html | 2007-11-14 07:45 | 275 | |
![[TXT]](/icons/text.gif) | Sült paradicsom.txt | 2007-03-24 02:59 | 274 | |
![[TXT]](/icons/text.gif) | szex.txt | 2007-11-14 02:07 | 272 | |
![[TXT]](/icons/text.gif) | STIL.CSS | 2007-03-24 02:59 | 272 | |
![[IMG]](/icons/image2.gif) | printit.gif | 2007-04-15 15:23 | 269 | |
![[TXT]](/icons/text.gif) | Bierpunsch.txt | 2007-03-24 02:59 | 269 | |
![[TXT]](/icons/text.gif) | STILM.CSS | 2007-03-24 02:59 | 268 | |
![[IMG]](/icons/image2.gif) | KEDVENC.GIF | 2007-03-24 02:59 | 267 | |
![[TXT]](/icons/text.gif) | Diétás csirke.txt | 2007-03-24 02:59 | 267 | |
![[TXT]](/icons/text.gif) | Apricot Brandy Cocktail.txt | 2007-03-24 02:59 | 266 | |
![[TXT]](/icons/text.gif) | global.cfg | 2006-09-16 22:51 | 264 | |
![[TXT]](/icons/text.gif) | Boszorkányhab.txt | 2007-03-24 02:59 | 263 | |
![[TXT]](/icons/text.gif) | Gyümölcsöntet.txt | 2007-03-24 02:59 | 262 | |
![[TXT]](/icons/text.gif) | Alma-birs mártás.txt | 2007-03-24 02:59 | 261 | |
![[TXT]](/icons/text.gif) | encoding.txt | 2007-03-24 02:54 | 258 | |
![[TXT]](/icons/text.gif) | Gombás szelet.txt | 2007-03-24 02:59 | 258 | |
![[TXT]](/icons/text.gif) | Babapiskóta2.txt | 2007-03-24 02:59 | 258 | |
![[TXT]](/icons/text.gif) | Apricot Cooler.txt | 2007-03-24 02:59 | 257 | |
![[ ]](/icons/unknown.gif) | charreplace | 2007-03-24 02:54 | 256 | |
![[ ]](/icons/unknown.gif) | caseconv | 2007-03-24 02:54 | 256 | |
![[TXT]](/icons/text.gif) | Lórúgás.txt | 2007-03-24 02:59 | 256 | |
![[TXT]](/icons/text.gif) | olvasd_el.txt | 2004-04-13 15:17 | 255 | |
![[IMG]](/icons/image2.gif) | H1.GIF | 2007-03-24 02:59 | 255 | |
![[TXT]](/icons/text.gif) | Rozskenyér.txt | 2007-03-24 02:59 | 254 | |
![[IMG]](/icons/image2.gif) | H4.GIF | 2007-03-24 02:59 | 250 | |
![[IMG]](/icons/image2.gif) | pen.gif | 2007-04-15 15:23 | 245 | |
![[TXT]](/icons/text.gif) | Húsimádó pizza.txt | 2007-03-24 02:59 | 242 | |
![[TXT]](/icons/text.gif) | Blonder Engel.txt | 2007-03-24 02:59 | 242 | |
![[TXT]](/icons/text.gif) | Barackcrusta.txt | 2007-03-24 02:59 | 240 | |
![[TXT]](/icons/text.gif) | Tiroli pizza.txt | 2007-03-24 02:59 | 239 | |
![[TXT]](/icons/text.gif) | Magyaros kolbászos pizza.txt | 2007-03-24 02:59 | 238 | |
![[ ]](/icons/unknown.gif) | MANIFEST.MF | 2007-03-24 02:54 | 238 | |
![[TXT]](/icons/text.gif) | Americana.txt | 2007-03-24 02:59 | 237 | |
![[TXT]](/icons/text.gif) | Apricot Fizz.txt | 2007-03-24 02:59 | 236 | |
![[TXT]](/icons/text.gif) | Brandy Cobbler.txt | 2007-03-24 02:59 | 235 | |
![[TXT]](/icons/text.gif) | Mexikói pizza.txt | 2007-03-24 02:59 | 234 | |
![[TXT]](/icons/text.gif) | Beach Beauty.txt | 2007-03-24 02:59 | 234 | |
![[IMG]](/icons/image2.gif) | KAT2U.GIF | 2007-03-24 02:59 | 232 | |
![[IMG]](/icons/image2.gif) | H3.GIF | 2007-03-24 02:59 | 228 | |
![[TXT]](/icons/text.gif) | Absinth Coctail.txt | 2007-03-24 02:59 | 226 | |
![[TXT]](/icons/text.gif) | Pulykakakas here.txt | 2007-03-24 02:59 | 222 | |
![[TXT]](/icons/text.gif) | HALKRÉM.TXT | 2007-03-24 02:59 | 222 | |
![[TXT]](/icons/text.gif) | Banana Cow.txt | 2007-03-24 02:59 | 222 | |
![[TXT]](/icons/text.gif) | Apricot Sour.txt | 2007-03-24 02:59 | 221 | |
![[TXT]](/icons/text.gif) | Apricot Nog.txt | 2007-03-24 02:59 | 221 | |
![[TXT]](/icons/text.gif) | Zöldbabos egytálétel.txt | 2007-03-24 02:59 | 219 | |
![[TXT]](/icons/text.gif) | Bloody Mary.txt | 2007-03-24 02:59 | 219 | |
![[TXT]](/icons/text.gif) | Farmer pizza.txt | 2007-03-24 02:59 | 216 | |
![[TXT]](/icons/text.gif) | Blutorange.txt | 2007-03-24 02:59 | 214 | |
![[IMG]](/icons/image2.gif) | BG1(1).GIF | 2007-03-24 02:59 | 214 | |
![[TXT]](/icons/text.gif) | Brandy Blazer.txt | 2007-03-24 02:59 | 212 | |
![[IMG]](/icons/image2.gif) | KERESS.GIF | 2007-03-24 02:59 | 211 | |
![[TXT]](/icons/text.gif) | Egri mártás.txt | 2007-03-24 02:59 | 211 | |
![[TXT]](/icons/text.gif) | Brandied Banana Collins.txt | 2007-03-24 02:59 | 210 | |
![[TXT]](/icons/text.gif) | Artillery.txt | 2007-03-24 02:59 | 209 | |
![[IMG]](/icons/image2.gif) | DELIM.GIF | 2007-03-24 02:59 | 207 | |
![[IMG]](/icons/image2.gif) | H2.GIF | 2007-03-24 02:59 | 206 | |
![[TXT]](/icons/text.gif) | Amaretto Sour.txt | 2007-03-24 02:59 | 201 | |
![[TXT]](/icons/text.gif) | Meggymártás'.txt | 2007-03-24 02:59 | 200 | |
![[TXT]](/icons/text.gif) | Löncshúskrém.txt | 2007-03-24 02:59 | 200 | |
![[TXT]](/icons/text.gif) | Ashanti Sour.txt | 2007-03-24 02:59 | 200 | |
![[TXT]](/icons/text.gif) | Bols Blitz.txt | 2007-03-24 02:59 | 197 | |
![[TXT]](/icons/text.gif) | Bermuda Rose.txt | 2007-03-24 02:59 | 193 | |
![[TXT]](/icons/text.gif) | Affinity.txt | 2007-03-24 02:59 | 193 | |
![[TXT]](/icons/text.gif) | Abbey Cocktail.txt | 2007-03-24 02:59 | 193 | |
![[TXT]](/icons/text.gif) | Naturszelet.txt | 2007-03-24 02:59 | 192 | |
![[TXT]](/icons/text.gif) | sajtohiba.txt | 2007-11-14 05:13 | 191 | |
![[TXT]](/icons/text.gif) | Bacardi.txt | 2007-03-24 02:59 | 188 | |
![[TXT]](/icons/text.gif) | Black Magic.txt | 2007-03-24 02:59 | 186 | |
![[TXT]](/icons/text.gif) | Sós burgonya.txt | 2007-03-24 02:59 | 184 | |
![[TXT]](/icons/text.gif) | Bourbon Highball Cola.txt | 2007-03-24 02:59 | 184 | |
![[TXT]](/icons/text.gif) | Adonis1.txt | 2007-03-24 02:59 | 183 | |
![[TXT]](/icons/text.gif) | Adonis3.txt | 2007-03-24 02:59 | 179 | |
![[TXT]](/icons/text.gif) | Angels Face.txt | 2007-03-24 02:59 | 178 | |
![[ ]](/icons/unknown.gif) | CONFIG00.DAT | 2006-09-16 22:51 | 177 | |
![[TXT]](/icons/text.gif) | Tiroli mártás.txt | 2007-03-24 02:59 | 175 | |
![[TXT]](/icons/text.gif) | Rafaello.txt | 2007-03-24 02:59 | 175 | |
![[TXT]](/icons/text.gif) | BANNER.HTM | 2007-03-24 02:59 | 174 | |
![[IMG]](/icons/image2.gif) | Smilez.gif | 2007-03-24 02:59 | 173 | |
![[TXT]](/icons/text.gif) | Blue Lady.txt | 2007-03-24 02:59 | 173 | |
![[TXT]](/icons/text.gif) | Baromfimánia pizza.txt | 2007-03-24 02:59 | 173 | |
![[TXT]](/icons/text.gif) | Blue Lagoon.txt | 2007-03-24 02:59 | 170 | |
![[TXT]](/icons/text.gif) | Berliner Weiße mit Schuß.txt | 2007-03-24 02:59 | 169 | |
![[TXT]](/icons/text.gif) | Alabama.txt | 2007-03-24 02:59 | 168 | |
![[IMG]](/icons/image2.gif) | PRINT.GIF | 2007-03-24 02:59 | 167 | |
![[TXT]](/icons/text.gif) | Vanília sodó.txt | 2007-03-24 02:59 | 164 | |
![[TXT]](/icons/text.gif) | Mindenki szakácskönyve.log | 2007-03-24 02:59 | 164 | |
![[TXT]](/icons/text.gif) | Booster.txt | 2007-03-24 02:59 | 164 | |
![[TXT]](/icons/text.gif) | Balalajka.txt | 2007-03-24 02:59 | 163 | |
![[TXT]](/icons/text.gif) | Adzsika.txt | 2007-03-24 02:59 | 163 | |
![[TXT]](/icons/text.gif) | Balencia.txt | 2007-03-24 02:59 | 162 | |
![[TXT]](/icons/text.gif) | Vajas burgonya.txt | 2007-03-24 02:59 | 161 | |
![[TXT]](/icons/text.gif) | Brandy Cocktail1.txt | 2007-03-24 02:59 | 155 | |
![[TXT]](/icons/text.gif) | Americano.txt | 2007-03-24 02:59 | 155 | |
![[IMG]](/icons/image2.gif) | smile2.gif | 2007-04-15 15:05 | 152 | |
![[IMG]](/icons/image2.gif) | mailit.gif | 2007-04-15 15:23 | 152 | |
![[TXT]](/icons/text.gif) | Atholl Brose.txt | 2007-03-24 02:59 | 150 | |
![[IMG]](/icons/image2.gif) | KERESOK.GIF | 2007-03-24 02:59 | 149 | |
![[TXT]](/icons/text.gif) | Görög pizza.txt | 2007-03-24 02:59 | 145 | |
![[TXT]](/icons/text.gif) | Banshee.txt | 2007-03-24 02:59 | 145 | |
![[TXT]](/icons/text.gif) | Between the Sheets2.txt | 2007-03-24 02:59 | 143 | |
![[TXT]](/icons/text.gif) | Between The Sheets1.txt | 2007-03-24 02:59 | 143 | |
![[IMG]](/icons/image2.gif) | BORITEK.GIF | 2007-03-24 02:59 | 142 | |
![[TXT]](/icons/text.gif) | Blood and Sand.txt | 2007-03-24 02:59 | 141 | |
![[TXT]](/icons/text.gif) | Banana Bird.txt | 2007-03-24 02:59 | 141 | |
![[TXT]](/icons/text.gif) | Banana Rum Flappe.txt | 2007-03-24 02:59 | 139 | |
![[TXT]](/icons/text.gif) | Bacardi Cocktail2.txt | 2007-03-24 02:59 | 139 | |
![[TXT]](/icons/text.gif) | Andalusia.txt | 2007-03-24 02:59 | 139 | |
![[TXT]](/icons/text.gif) | Bee's kiss.txt | 2007-03-24 02:59 | 138 | |
![[TXT]](/icons/text.gif) | Köményes burgonya.txt | 2007-03-24 02:59 | 137 | |
![[TXT]](/icons/text.gif) | Bacardi Cocktail1.txt | 2007-03-24 02:59 | 137 | |
![[TXT]](/icons/text.gif) | Adonis2.txt | 2007-03-24 02:59 | 137 | |
![[IMG]](/icons/image2.gif) | OK.GIF | 2007-03-24 02:59 | 135 | |
![[IMG]](/icons/image2.gif) | OK2.GIF | 2007-03-24 02:59 | 134 | |
![[TXT]](/icons/text.gif) | Barbary Coast.txt | 2007-03-24 02:59 | 134 | |
![[TXT]](/icons/text.gif) | 2.TXT | 2007-03-24 02:59 | 134 | |
![[IMG]](/icons/image2.gif) | KOSAR.GIF | 2007-03-24 02:59 | 132 | |
![[TXT]](/icons/text.gif) | Hawaii pizza.txt | 2007-03-24 02:59 | 130 | |
![[TXT]](/icons/text.gif) | Balalaika Cocktail.txt | 2007-03-24 02:59 | 130 | |
![[TXT]](/icons/text.gif) | Angyalcsók.txt | 2007-03-24 02:59 | 128 | |
![[TXT]](/icons/text.gif) | Blenheim.txt | 2007-03-24 02:59 | 125 | |
![[TXT]](/icons/text.gif) | Alexander.txt | 2007-03-24 02:59 | 125 | |
![[IMG]](/icons/image2.gif) | showc0.gif | 2007-04-15 15:23 | 123 | |
![[TXT]](/icons/text.gif) | Velence pizza.txt | 2007-03-24 02:59 | 123 | |
![[TXT]](/icons/text.gif) | Barbara.txt | 2007-03-24 02:59 | 123 | |
![[IMG]](/icons/image2.gif) | toplista.gif | 2007-04-15 15:23 | 122 | |
![[IMG]](/icons/image2.gif) | szivarvany.gif | 2007-03-24 02:59 | 122 | |
![[IMG]](/icons/image2.gif) | showc1.gif | 2007-04-15 15:23 | 121 | |
![[TXT]](/icons/text.gif) | Belle Epoque.txt | 2007-03-24 02:59 | 121 | |
![[TXT]](/icons/text.gif) | Bee's Knees.txt | 2007-03-24 02:59 | 121 | |
![[TXT]](/icons/text.gif) | Blue Bell.txt | 2007-03-24 02:59 | 120 | |
![[TXT]](/icons/text.gif) | Anabull.txt | 2007-03-24 02:59 | 120 | |
![[TXT]](/icons/text.gif) | Aunt Aghata.txt | 2007-03-24 02:59 | 117 | |
![[TXT]](/icons/text.gif) | Alap pizza.txt | 2007-03-24 02:59 | 116 | |
![[TXT]](/icons/text.gif) | Pizza tészta.txt | 2007-03-24 02:59 | 115 | |
![[TXT]](/icons/text.gif) | Black Russian.txt | 2007-03-24 02:59 | 110 | |
![[TXT]](/icons/text.gif) | Dallas pizza.txt | 2007-03-24 02:59 | 105 | |
![[TXT]](/icons/text.gif) | Banana Bliss.txt | 2007-03-24 02:59 | 105 | |
![[TXT]](/icons/text.gif) | 3.TXT | 2007-03-24 02:59 | 97 | |
![[IMG]](/icons/image2.gif) | BG.GIF | 2007-03-24 02:59 | 96 | |
![[TXT]](/icons/text.gif) | 1.TXT | 2007-03-24 02:59 | 95 | |
![[TXT]](/icons/text.gif) | Black sombrero.txt | 2007-03-24 02:59 | 94 | |
![[IMG]](/icons/image2.gif) | smile1.gif | 2007-04-15 15:23 | 93 | |
![[IMG]](/icons/image2.gif) | SAROK.GIF | 2007-03-24 02:59 | 91 | |
![[IMG]](/icons/image2.gif) | KP.GIF | 2007-03-24 02:59 | 88 | |
![[TXT]](/icons/text.gif) | NNCLVT.TXT | 2007-03-24 02:54 | 81 | |
![[TXT]](/icons/text.gif) | nnclvt.txt | 2003-09-29 13:35 | 76 | |
![[IMG]](/icons/image2.gif) | VON.GIF | 2007-03-24 02:59 | 76 | |
![[TXT]](/icons/text.gif) | Auróra mártás.txt | 2007-03-24 02:59 | 73 | |
![[ ]](/icons/unknown.gif) | CONFIG00.VER | 2006-09-16 22:51 | 68 | |
![[IMG]](/icons/image2.gif) | spacer.gif | 2007-03-24 02:53 | 67 | |
![[IMG]](/icons/image2.gif) | UJ.GIF | 2007-03-24 02:59 | 67 | |
![[IMG]](/icons/image2.gif) | BG2.GIF | 2007-03-24 02:59 | 64 | |
![[IMG]](/icons/image2.gif) | ME2.GIF | 2007-03-24 02:59 | 62 | |
![[TXT]](/icons/text.gif) | Checkpoint1.txt | 2006-09-16 22:52 | 59 | |
![[TXT]](/icons/text.gif) | Checkpoint0.txt | 2006-09-16 22:52 | 59 | |
![[TXT]](/icons/text.gif) | NNCL.TXT | 2007-03-24 02:54 | 57 | |
![[IMG]](/icons/image2.gif) | BG3(1).GIF | 2007-03-24 02:59 | 54 | |
![[IMG]](/icons/image2.gif) | V2.GIF | 2007-03-24 02:59 | 53 | |
![[IMG]](/icons/image2.gif) | V1A.GIF | 2007-03-24 02:59 | 53 | |
![[IMG]](/icons/image2.gif) | BG1.GIF | 2007-03-24 02:59 | 52 | |
![[IMG]](/icons/image2.gif) | GETINFO.GIF | 2007-03-24 02:59 | 51 | |
![[IMG]](/icons/image2.gif) | ures.gif | 2007-04-15 15:23 | 49 | |
![[IMG]](/icons/image2.gif) | getinfo(1).gif | 2007-03-24 02:59 | 49 | |
![[TXT]](/icons/text.gif) | nncl.txt | 2007-03-24 02:54 | 48 | |
![[IMG]](/icons/image2.gif) | KERT.GIF | 2007-03-24 02:59 | 45 | |
![[TXT]](/icons/text.gif) | c.txt | 2006-09-16 22:52 | 44 | |
![[TXT]](/icons/text.gif) | CcC.txt | 2006-09-16 22:52 | 44 | |
![[IMG]](/icons/image2.gif) | BG3.GIF | 2007-03-24 02:59 | 44 | |
![[IMG]](/icons/image2.gif) | track.gif | 2007-03-24 02:53 | 43 | |
![[IMG]](/icons/image2.gif) | track(1).gif | 2007-03-24 02:53 | 43 | |
![[TXT]](/icons/text.gif) | Z.txt | 2006-09-16 22:53 | 43 | |
![[IMG]](/icons/image2.gif) | S.GIF | 2007-03-24 02:59 | 43 | |
![[IMG]](/icons/image2.gif) | S(1).GIF | 2007-03-24 02:59 | 43 | |
![[TXT]](/icons/text.gif) | Z2.txt | 2006-09-16 22:53 | 41 | |
![[TXT]](/icons/text.gif) | Quick3.txt | 2006-09-16 22:53 | 41 | |
![[TXT]](/icons/text.gif) | Quick2.txt | 2006-09-16 22:52 | 41 | |
![[TXT]](/icons/text.gif) | Quick1.txt | 2006-09-16 22:52 | 41 | |
![[TXT]](/icons/text.gif) | Quick0.txt | 2006-09-16 22:52 | 41 | |
![[IMG]](/icons/image2.gif) | KK.GIF | 2007-03-24 02:59 | 41 | |
![[IMG]](/icons/image2.gif) | Level1.tga | 2006-09-16 22:51 | 32 | |
![[ ]](/icons/unknown.gif) | Opt.dat | 2006-09-16 22:51 | 25 | |
![[ ]](/icons/unknown.gif) | font2.fd | 2007-03-24 02:54 | 11 | |
![[ ]](/icons/unknown.gif) | font1.fd | 2007-03-24 02:54 | 11 | |
![[ ]](/icons/unknown.gif) | font0.fd | 2007-03-24 02:54 | 11 | |
![[TXT]](/icons/text.gif) | PFAAF.H | 2007-03-24 02:55 | 4 | |
|