![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[DIR]](/icons/folder.gif) | Mándy Iván/ | 2010-11-11 13:08 | - | |
![[DIR]](/icons/folder.gif) | Móricz Zsigmond/ | 2010-11-11 13:08 | - | |
![[DIR]](/icons/folder.gif) | MacLean, Alistair/ | 2010-11-11 13:08 | - | |
![[DIR]](/icons/folder.gif) | Marsh, Evelyn/ | 2010-11-11 13:08 | - | |
![[DIR]](/icons/folder.gif) | May, Karl/ | 2010-11-11 13:08 | - | |
![[DIR]](/icons/folder.gif) | Mcbain, Ed/ | 2010-11-11 13:08 | - | |
![[DIR]](/icons/folder.gif) | Merle, Rober/ | 2010-11-11 13:08 | - | |
![[DIR]](/icons/folder.gif) | Moldova György/ | 2010-11-11 13:08 | - | |
![[DIR]](/icons/folder.gif) | Morrison, Jim - Amerikai ima/ | 2010-11-11 13:08 | - | |
![[ ]](/icons/compressed.gif) | Morse abc txt.zip | 2010-11-11 03:12 | 474 | |
![[ ]](/icons/compressed.gif) | Massimo Pandolfi - Három történet.zip | 2010-11-11 03:50 | 1.8K | |
![[ ]](/icons/compressed.gif) | Morrison, Jim - Amerikai ima.zip | 2010-11-11 03:12 | 4.0K | |
![[ ]](/icons/compressed.gif) | M.A.G.U.S. Rpg Poén.zip | 2010-11-11 03:16 | 4.7K | |
![[ ]](/icons/compressed.gif) | Minya Balázs - Sötét véletlen Ynev fantasy.rtf.zip | 2010-11-11 02:49 | 7.1K | |
![[ ]](/icons/compressed.gif) | Minya Balázs - Az áruló Ynev fantasy.rtf.zip | 2010-11-11 02:49 | 7.8K | |
![[ ]](/icons/compressed.gif) | Massimo Pandolfi - A Fehér tenger.zip | 2010-11-11 03:50 | 11K | |
![[ ]](/icons/compressed.gif) | Murphy tapasztalatai a biztosításról.txt.zip | 2010-11-11 03:22 | 12K | |
![[ ]](/icons/compressed.gif) | Moorcock, Michael - Az Utolso Varázslat.zip | 2010-11-11 03:04 | 17K | |
![[ ]](/icons/compressed.gif) | Magyar-cigany szótár.zip | 2010-11-11 03:03 | 18K | |
![[ ]](/icons/compressed.gif) | Mayumura, Taku - Világkiállítás - sci-fi html.zip | 2010-11-11 03:02 | 20K | |
![[ ]](/icons/compressed.gif) | Maurizio Viano - Halászat a Qumran-tó vizén.zip | 2010-11-11 03:35 | 21K | |
![[ ]](/icons/compressed.gif) | Marquez, Gabriel Garcia - Véred Nyoma A Havon.zip | 2010-11-11 04:37 | 21K | |
![[ ]](/icons/compressed.gif) | Morrell, David - Mindig hallani fogom.zip | 2010-11-11 03:29 | 21K | |
![[ ]](/icons/compressed.gif) | Morgan, Roland - Forró nyomon.zip | 2010-11-11 03:11 | 21K | |
![[ ]](/icons/compressed.gif) | Martin, George R.R. - A kereszt és a sárkány útja - novella.zip | 2010-11-11 03:59 | 22K | |
![[ ]](/icons/compressed.gif) | Mihajlov, Vlagyimir - Szuperosztályú pilóta.rtf.zip | 2010-11-11 04:27 | 23K | |
![[ ]](/icons/compressed.gif) | McIntyre, Vonda - Köd Fű és Homok.rtf.zip | 2010-11-11 04:47 | 24K | |
![[ ]](/icons/compressed.gif) | Matheson, Richard - A vizsga.zip | 2010-11-11 03:50 | 28K | |
![[ ]](/icons/compressed.gif) | Mesterházy Lajos - Sempiternin.zip | 2010-11-11 04:16 | 29K | |
![[ ]](/icons/compressed.gif) | Murray Leinster - Az első találkozás.rtf.zip | 2010-11-11 03:22 | 34K | |
![[ ]](/icons/compressed.gif) | Mihaleczky Péter Az uralkodó álma - sci-fi novella.zip | 2010-11-11 04:27 | 37K | |
![[ ]](/icons/compressed.gif) | Martin, George R.R. - A Peripheral Affair.pdf.zip | 2010-11-11 03:59 | 38K | |
![[ ]](/icons/compressed.gif) | MacLean, Katherina - Ha eljön az esős évszak.zip | 2010-11-11 03:24 | 39K | |
![[ ]](/icons/compressed.gif) | Martin, George R.R. - Homokkirályok az elbeszélés.zip | 2010-11-11 03:59 | 40K | |
![[ ]](/icons/compressed.gif) | Murphy egyéb törvényei.txt.zip | 2010-11-11 03:22 | 41K | |
![[ ]](/icons/compressed.gif) | Monty Python - Jelenetek.zip | 2010-11-11 03:15 | 41K | |
![[ ]](/icons/compressed.gif) | Malac viccek.zip | 2010-11-11 03:32 | 43K | |
![[ ]](/icons/compressed.gif) | Menyhért Mészáros László - Hofi maffia.txt.zip | 2010-11-11 04:08 | 45K | |
![[ ]](/icons/compressed.gif) | Moorcock, Michael - Íme az ember.zip | 2010-11-11 03:04 | 47K | |
![[ ]](/icons/compressed.gif) | Martin, George R.R. - Call Him Moses.pdf.zip | 2010-11-11 03:59 | 47K | |
![[ ]](/icons/compressed.gif) | Murphy menedzser törvénykönyve.zip | 2010-11-11 03:22 | 49K | |
![[ ]](/icons/compressed.gif) | Mettew Gardener - A hatodik kakukkszó.doc.zip | 2010-11-11 03:45 | 49K | |
![[ ]](/icons/compressed.gif) | Maruzs Éva Scifi novellái.zip | 2010-11-11 03:50 | 50K | |
![[ ]](/icons/compressed.gif) | Martin, Les - A hala mezeje (Ifju Indiana Jones).zip | 2010-11-11 04:39 | 52K | |
![[ ]](/icons/compressed.gif) | Magyar edzéselméleti szakirodalom.zip | 2010-11-11 03:24 | 52K | |
![[ ]](/icons/compressed.gif) | Montanus, Ambrose - Komics.zip | 2010-11-11 03:15 | 57K | |
![[ ]](/icons/compressed.gif) | Mcqueen, Eugene A remulet napja.zip | 2010-11-11 04:19 | 57K | |
![[ ]](/icons/compressed.gif) | Monty Python - Brian élete.zip | 2010-11-11 03:15 | 59K | |
![[ ]](/icons/compressed.gif) | Martonné Homok Erzsébet - A tóparti ház.txt.zip | 2010-11-11 03:50 | 60K | |
![[ ]](/icons/compressed.gif) | Martin, Les - X aktak Tigris tigris.zip | 2010-11-11 04:35 | 66K | |
![[ ]](/icons/compressed.gif) | Mallery, Susan - Fogd a kezem!.txt.zip | 2010-11-11 04:35 | 75K | |
![[ ]](/icons/compressed.gif) | Marvin Novellái egész jók.zip | 2010-11-11 03:50 | 75K | |
![[ ]](/icons/compressed.gif) | Mallery, Susan - Árva szívek.txt.zip | 2010-11-11 04:35 | 79K | |
![[ ]](/icons/compressed.gif) | Merey, Peter - Lahor Xween bosszuja.zip | 2010-11-11 04:08 | 82K | |
![[ ]](/icons/compressed.gif) | Miller, Victor B. - Lány a folyóban.txt.zip | 2010-11-11 02:49 | 89K | |
![[ ]](/icons/compressed.gif) | Meteorok viharában Scifi elbeszélések.zip | 2010-11-11 03:45 | 91K | |
![[ ]](/icons/compressed.gif) | Miller, Victor B. - Rekviem egy zsaruért.txt.zip | 2010-11-11 02:49 | 93K | |
![[ ]](/icons/compressed.gif) | Morris Desmond - Miért csinalja a lo.zip | 2010-11-11 04:01 | 94K | |
![[ ]](/icons/compressed.gif) | Martin-Chauffier - Kalandok a kalózhajón.zip | 2010-11-11 04:35 | 96K | |
![[ ]](/icons/compressed.gif) | Minahan John Jeremy Kamasz love story.zip | 2010-11-11 02:49 | 96K | |
![[ ]](/icons/compressed.gif) | Malamud Bernard - Jozip nepe.zip | 2010-11-11 03:32 | 98K | |
![[ ]](/icons/compressed.gif) | Morris Desmond - Miért csinálja a macska.zip | 2010-11-11 04:01 | 99K | |
![[ ]](/icons/compressed.gif) | Martin, George R.R. - And Seven Times Never Kill Man.pdf.zip | 2010-11-11 03:59 | 103K | |
![[ ]](/icons/compressed.gif) | Macchiavelli, Loriano Cavedoni márkiné ékszerei.zip | 2010-11-11 03:18 | 103K | |
![[ ]](/icons/compressed.gif) | M. E. Matje - A művészinas.zip | 2010-11-11 03:16 | 103K | |
![[ ]](/icons/compressed.gif) | Mobile, Frank Scifi novellák.zip | 2010-11-11 03:12 | 112K | |
![[ ]](/icons/compressed.gif) | Marquez, Gabriel Garcia - Banatos kurvaim_ emlekezete.zip | 2010-11-11 04:37 | 114K | |
![[ ]](/icons/compressed.gif) | Myiles na Gopaleen - A fába szorult féreg.zip | 2010-11-11 03:22 | 116K | |
![[ ]](/icons/compressed.gif) | Murray Leinster - A Grekek ajándéka.zip | 2010-11-11 03:22 | 116K | |
![[ ]](/icons/compressed.gif) | Milne, Larry Szellemirtok 1.zip | 2010-11-11 02:49 | 119K | |
![[ ]](/icons/compressed.gif) | Macchiavelli, Loriano Valaki gyilkolja a motorosokat.zip | 2010-11-11 03:18 | 120K | |
![[ ]](/icons/compressed.gif) | McAlary Mike - Cop Land.zip | 2010-11-11 03:02 | 121K | |
![[ ]](/icons/compressed.gif) | McClary, Mike - Cop Land.zip | 2010-11-11 04:39 | 121K | |
![[ ]](/icons/compressed.gif) | Murányi-Kovács Endre - Gilbert kapitány.zip | 2010-11-11 03:22 | 125K | |
![[ ]](/icons/compressed.gif) | Martin, George R.R. - Arms of the Kraken.pdf.zip | 2010-11-11 03:59 | 131K | |
![[ ]](/icons/compressed.gif) | Malcolm Webster - A jedi hatalma.zip | 2010-11-11 03:32 | 134K | |
![[ ]](/icons/compressed.gif) | McCay Bill - Lazadas (stargate).zip | 2010-11-11 04:39 | 134K | |
![[ ]](/icons/compressed.gif) | Mccay, Bill - Lázadás html.zip | 2010-11-11 04:39 | 134K | |
![[ ]](/icons/compressed.gif) | Mordecai, Roshwald - A hetedik szint.zip | 2010-11-11 03:11 | 138K | |
![[ ]](/icons/compressed.gif) | Malamud Bernard - A beszelo lo.zip | 2010-11-11 03:32 | 141K | |
![[ ]](/icons/compressed.gif) | Moorcock, Michael - A fekete folyoso.zip | 2010-11-11 03:15 | 141K | |
![[ ]](/icons/compressed.gif) | Máté Gyorgy Nem szentiras.zip | 2010-11-11 03:33 | 147K | |
![[ ]](/icons/compressed.gif) | Moody Susan Fekete penny.zip | 2010-11-11 03:15 | 150K | |
![[ ]](/icons/compressed.gif) | Martin Jozsef - A Volkswagen-sztori.zip | 2010-11-11 03:31 | 150K | |
![[ ]](/icons/compressed.gif) | Matje, Milica Edvinovna - A művészinas - html.zip | 2010-11-11 03:50 | 150K | |
![[ ]](/icons/compressed.gif) | Mowat, Farley - Ne féljünk a farkastól.zip | 2010-11-11 03:22 | 152K | |
![[ ]](/icons/compressed.gif) | McIntyre, Vonda - Khan haragja (startrek).zip | 2010-11-11 04:47 | 152K | |
![[ ]](/icons/compressed.gif) | Monette, Paul - A Ragadozo.zip | 2010-11-11 03:15 | 155K | |
![[ ]](/icons/compressed.gif) | Méhes Károly - Lassan minden titok.zip | 2010-11-11 03:33 | 158K | |
![[ ]](/icons/compressed.gif) | Macgregor, Rob - Indiana Jones és az óriások tánca.zip | 2010-11-11 03:54 | 158K | |
![[ ]](/icons/compressed.gif) | McQuay, Mike - Gyanú (Asimov Robotvárosa).zip | 2010-11-11 04:19 | 158K | |
![[ ]](/icons/compressed.gif) | McGivern, William P. - A nagy leszámolás.zip | 2010-11-11 04:47 | 161K | |
![[ ]](/icons/compressed.gif) | Mányi Lászlo - Hová tunt Dorman professzor agya.zip | 2010-11-11 03:33 | 163K | |
![[ ]](/icons/compressed.gif) | Milne, Larry - Szellemirtók (1-2 könyv).zip | 2010-11-11 02:49 | 165K | |
![[ ]](/icons/compressed.gif) | Morrell, David - Rambo2 Vietnamban.zip | 2010-11-11 03:29 | 165K | |
![[ ]](/icons/compressed.gif) | Munkacsi Miklos A mangofa negyedik gyumolcse.zip | 2010-11-11 03:22 | 166K | |
![[ ]](/icons/compressed.gif) | Moravia, Alberto - Levelek a Szaharából.zip | 2010-11-11 03:11 | 166K | |
![[ ]](/icons/compressed.gif) | Marek Jiri Az egyenlitotol delre.zip | 2010-11-11 04:35 | 167K | |
![[ ]](/icons/compressed.gif) | Martin Clark Ashton - Shadoni krónika.zip | 2010-11-11 03:31 | 170K | |
![[ ]](/icons/compressed.gif) | Makkai Sándor - Zsadány község története.zip | 2010-11-11 03:32 | 170K | |
![[ ]](/icons/compressed.gif) | Menghini Luigi - A felhőbirodalom.zip | 2010-11-11 04:40 | 171K | |
![[ ]](/icons/compressed.gif) | Maerov, Lauri - Tökéletes másolatt.zip | 2010-11-11 03:24 | 172K | |
![[ ]](/icons/compressed.gif) | MacDonald, John J. - Bíbor szabadesés.zip | 2010-11-11 03:18 | 174K | |
![[ ]](/icons/compressed.gif) | MacDonald, John J. - Gyilkosság a Karib tengeren.zip | 2010-11-11 03:18 | 175K | |
![[ ]](/icons/compressed.gif) | Macgregor, Rob - Indiana Jones és az özönvíz legendája.zip | 2010-11-11 03:54 | 176K | |
![[ ]](/icons/compressed.gif) | MacAlan, Peter Valkűr direktiva.zip | 2010-11-11 03:16 | 177K | |
![[ ]](/icons/compressed.gif) | Mowat, Farley - Meg kell ölni a bálnát.zip | 2010-11-11 03:22 | 178K | |
![[ ]](/icons/compressed.gif) | Makkai Sándor - Magyarok csillaga.zip | 2010-11-11 03:32 | 179K | |
![[ ]](/icons/compressed.gif) | Morrell, David - Rambo3 (Afganisztán).zip | 2010-11-11 03:29 | 179K | |
![[ ]](/icons/compressed.gif) | Mesta Gabriel A teremtők árnyai (StarCraft).zip | 2010-11-11 04:16 | 182K | |
![[ ]](/icons/compressed.gif) | Macdonald, Ross Ember a foldben.zip | 2010-11-11 03:54 | 185K | |
![[ ]](/icons/compressed.gif) | Mazzaro Ed Chicagoi történet.zip | 2010-11-11 03:02 | 193K | |
![[ ]](/icons/compressed.gif) | Mccay, Bill - Bosszú rtf.zip | 2010-11-11 04:39 | 193K | |
![[ ]](/icons/compressed.gif) | Marc Levy - Ha igaz volna....zip | 2010-11-11 04:35 | 194K | |
![[ ]](/icons/compressed.gif) | MIIB - Sötét zsaruk II..zip | 2010-11-11 04:27 | 197K | |
![[ ]](/icons/compressed.gif) | McClure, Ken - Transzplantáció.zip | 2010-11-11 04:39 | 198K | |
![[ ]](/icons/compressed.gif) | Morrell, David - Elveszettek.zip | 2010-11-11 03:11 | 198K | |
![[ ]](/icons/compressed.gif) | Moorcock, Michael - Az igazgyöngy erődje.zip | 2010-11-11 03:15 | 202K | |
![[ ]](/icons/compressed.gif) | Mary Higgins Clark - Ha kimondod a nevem.zip | 2010-11-11 03:50 | 204K | |
![[ ]](/icons/compressed.gif) | Martini- Eco Miben hisz aki nem hisz.zip | 2010-11-11 04:35 | 206K | |
![[ ]](/icons/compressed.gif) | Monette, Paul - Havanna.zip | 2010-11-11 03:15 | 208K | |
![[ ]](/icons/compressed.gif) | Mányi Lászlo - Cirkusz a Holdon.zip | 2010-11-11 03:33 | 209K | |
![[ ]](/icons/compressed.gif) | McMurtry, Larry - Az utolsó mozielőadás.zip | 2010-11-11 04:19 | 211K | |
![[ ]](/icons/compressed.gif) | Macgregor, Rob - Indiana Jones és az utolsó kereszteslovag.zip | 2010-11-11 03:54 | 211K | |
![[ ]](/icons/compressed.gif) | Malamud Bernard - Őstehetseg.zip | 2010-11-11 03:32 | 211K | |
![[ ]](/icons/compressed.gif) | Monette, Paul - Óvadek.zip | 2010-11-11 03:15 | 214K | |
![[ ]](/icons/compressed.gif) | Molstand, Stephen - Godzilla.zip | 2010-11-11 03:15 | 215K | |
![[ ]](/icons/compressed.gif) | Max Brand - A bajkeverő kölyök.zip | 2010-11-11 03:35 | 217K | |
![[ ]](/icons/compressed.gif) | Maynard Joyce - Baby love.zip | 2010-11-11 03:02 | 222K | |
![[ ]](/icons/compressed.gif) | Macdonald, Ross A barbar part.zip | 2010-11-11 03:18 | 225K | |
![[ ]](/icons/compressed.gif) | Morgen, Roland - Sárkányháború.zip | 2010-11-11 03:11 | 229K | |
![[ ]](/icons/compressed.gif) | McIntyre, Vonda - Az Enterprise elindul (startrek).zip | 2010-11-11 04:47 | 229K | |
![[ ]](/icons/compressed.gif) | Mailer, Norman - A kemeny fickok nem tancolnak.zip | 2010-11-11 05:01 | 233K | |
![[ ]](/icons/compressed.gif) | Macdonald, Ross Veszelyes ellenfel.zip | 2010-11-11 03:54 | 234K | |
![[ ]](/icons/compressed.gif) | Muller Horst Jelek a Holdrol.zip | 2010-11-11 03:22 | 235K | |
![[ ]](/icons/compressed.gif) | Mccarthy, Cormac - Vadlovak (Határtrilogia1).zip | 2010-11-11 04:39 | 235K | |
![[ ]](/icons/compressed.gif) | Maurier Daphne du A francia kaloz szeretoje.zip | 2010-11-11 03:35 | 235K | |
![[ ]](/icons/compressed.gif) | McGowan, Robert - Ne sirass, törzsőrmester!.zip | 2010-11-11 04:47 | 239K | |
![[ ]](/icons/compressed.gif) | Mawson, Robert - Kelj fel és járj.zip | 2010-11-11 03:35 | 243K | |
![[ ]](/icons/compressed.gif) | Méhes Károly - Zzzummm Forma 1 kaleidoszkop.zip | 2010-11-11 03:33 | 250K | |
![[ ]](/icons/compressed.gif) | Mehes Karoly Zzzummm Forma 1 kaleidoszkop.zip | 2010-11-11 04:40 | 250K | |
![[ ]](/icons/compressed.gif) | Morrell, David - A modell.zip | 2010-11-11 03:11 | 254K | |
![[ ]](/icons/compressed.gif) | Mark Wilson - A boldogság kék szörnyetege.zip | 2010-11-11 04:35 | 259K | |
![[ ]](/icons/compressed.gif) | Mark Wilson A boldogsag kek szornyetege.zip | 2010-11-11 04:35 | 259K | |
![[ ]](/icons/compressed.gif) | Macdonald, Ross A csontketrec.zip | 2010-11-11 03:54 | 262K | |
![[ ]](/icons/compressed.gif) | Mcpherson, Stella Buja Zelandia.zip | 2010-11-11 04:19 | 262K | |
![[ ]](/icons/compressed.gif) | Malamud Bernard - A mesterember.zip | 2010-11-11 03:32 | 265K | |
![[ ]](/icons/compressed.gif) | Menekülés a naprendszerből _ scifi elbeszélések.zip | 2010-11-11 04:40 | 266K | |
![[ ]](/icons/compressed.gif) | Martin Juan Munoz Kullancs a kalozkapitany.zip | 2010-11-11 03:31 | 267K | |
![[ ]](/icons/compressed.gif) | Marks I M Összeeskuves elmelet.zip | 2010-11-11 04:35 | 273K | |
![[ ]](/icons/compressed.gif) | Moorcock, Michael - Harcikutya.zip | 2010-11-11 03:04 | 274K | |
![[ ]](/icons/compressed.gif) | McIntyre, Vonda - A kristálycsillag (starwars).zip | 2010-11-11 04:47 | 275K | |
![[ ]](/icons/compressed.gif) | Meade, Glenn - Brandenburg testamentum 1.zip | 2010-11-11 04:19 | 276K | |
![[ ]](/icons/compressed.gif) | Mányi Lászlo - A zöld Jaguar titka.zip | 2010-11-11 03:33 | 276K | |
![[ ]](/icons/compressed.gif) | Molnar Gábor - A dzsungel doktora rtf.zip | 2010-11-11 03:23 | 279K | |
![[ ]](/icons/compressed.gif) | Martinov, Georgij - Tamadas a Fold ellen.zip | 2010-11-11 04:35 | 279K | |
![[ ]](/icons/compressed.gif) | Mailer, Norman - Az éjszaka hadai.zip | 2010-11-11 05:01 | 281K | |
![[ ]](/icons/compressed.gif) | Mansfield Michael Tuzliderc.zip | 2010-11-11 04:35 | 283K | |
![[ ]](/icons/compressed.gif) | Moravia, Alberto - A kozonyosok.zip | 2010-11-11 03:04 | 294K | |
![[ ]](/icons/compressed.gif) | Mitchell, Margaret nyomán2 Milland, Audrey3 - Ahonnan a szél fújt.txt.zip | 2010-11-11 03:12 | 298K | |
![[ ]](/icons/compressed.gif) | Morris Desmond - A csupasz majom.zip | 2010-11-11 03:29 | 300K | |
![[ ]](/icons/compressed.gif) | Marshall, Peter - Tombol a hold.zip | 2010-11-11 03:31 | 303K | |
![[ ]](/icons/compressed.gif) | Mandics- M. Veress - Vasvilagok.zip | 2010-11-11 04:35 | 304K | |
![[ ]](/icons/compressed.gif) | Melville - Moby Dick.zip | 2010-11-11 04:40 | 311K | |
![[ ]](/icons/compressed.gif) | Morrell, David - A totem.zip | 2010-11-11 03:11 | 313K | |
![[ ]](/icons/compressed.gif) | Molnar Gábor - Az óriáskígyók földjén rtf.zip | 2010-11-11 03:23 | 314K | |
![[ ]](/icons/compressed.gif) | Meinck, Willi - Marco Polo kalandos ifjúsága.zip | 2010-11-11 04:40 | 314K | |
![[ ]](/icons/compressed.gif) | Mutzelburg-Dumas, Alexandre - A vilag ura 2 rtf.zip | 2010-11-11 03:22 | 314K | |
![[ ]](/icons/compressed.gif) | Morrell, David - Elszantan.zip | 2010-11-11 03:11 | 314K | |
![[ ]](/icons/compressed.gif) | Mandics- M. Veress - Gubolakok.zip | 2010-11-11 04:35 | 316K | |
![[ ]](/icons/compressed.gif) | Man, John - Dzsingisz kan.zip | 2010-11-11 04:35 | 317K | |
![[ ]](/icons/compressed.gif) | Mandics- M. Veress - A dromosz.zip | 2010-11-11 04:35 | 319K | |
![[ ]](/icons/compressed.gif) | Meade, Glenn - Brandenburg testamentum 2.zip | 2010-11-11 04:19 | 321K | |
![[ ]](/icons/compressed.gif) | Mutzelburg-Dumas, Alexandre - A vilag ura 1 rtf.zip | 2010-11-11 03:22 | 322K | |
![[ ]](/icons/compressed.gif) | Mcgowan, Hands - Ne sirass torzsormester.zip | 2010-11-11 04:47 | 323K | |
![[ ]](/icons/compressed.gif) | Morrell, David - A láng szövetsége.zip | 2010-11-11 03:11 | 324K | |
![[ ]](/icons/compressed.gif) | McMurtry, Larry - Becéző szavak.zip | 2010-11-11 04:19 | 325K | |
![[ ]](/icons/compressed.gif) | Moorcock, Michael - Corum kardjai.zip | 2010-11-11 03:04 | 327K | |
![[ ]](/icons/compressed.gif) | Moran Daniel Keys A gyuru.zip | 2010-11-11 03:04 | 328K | |
![[ ]](/icons/compressed.gif) | Marquez, Gabriel Garcia - Szerelem kolera idején.txt.zip | 2010-11-11 04:37 | 341K | |
![[ ]](/icons/compressed.gif) | Molnar Gábor - Éjbe zuhant évek rtf.zip | 2010-11-11 03:15 | 348K | |
![[ ]](/icons/compressed.gif) | Morrell, David - Kettős látás.zip | 2010-11-11 03:29 | 348K | |
![[ ]](/icons/compressed.gif) | MacBride, Allen Roger - Kaliban Asimov nyomán.zip | 2010-11-11 03:16 | 358K | |
![[ ]](/icons/compressed.gif) | Molnar Gábor - Az Arany Gobi kősivatagában rtf.zip | 2010-11-11 03:23 | 358K | |
![[ ]](/icons/compressed.gif) | Malamud Bernard - A lakók, Isteni kegyelem.zip | 2010-11-11 03:32 | 365K | |
![[ ]](/icons/compressed.gif) | Marshall, Peter - Nincs helyed a temetoben.zip | 2010-11-11 03:31 | 365K | |
![[ ]](/icons/compressed.gif) | Moravia, Alberto - Kisregenyek.zip | 2010-11-11 03:04 | 370K | |
![[ ]](/icons/compressed.gif) | Mackie Mary A ló nepe.zip | 2010-11-11 03:54 | 370K | |
![[ ]](/icons/compressed.gif) | Mailer, Norman - A fiu evangeliuma.zip | 2010-11-11 05:01 | 373K | |
![[ ]](/icons/compressed.gif) | Miksz Scifi elbeszéléskötet.zip | 2010-11-11 04:27 | 373K | |
![[ ]](/icons/compressed.gif) | Mccullers, Carson - Egy aranyszem tükrében - novellák.zip | 2010-11-11 04:39 | 375K | |
![[ ]](/icons/compressed.gif) | Martin, George R.R. - Homokkirályok és más elbeszélések.zip | 2010-11-11 03:59 | 377K | |
![[ ]](/icons/compressed.gif) | Moravia, Alberto - Gyilkossag a teniszklubban.zip | 2010-11-11 03:04 | 378K | |
![[ ]](/icons/compressed.gif) | Morrell, David - A rozsa szovetsege.zip | 2010-11-11 03:11 | 380K | |
![[ ]](/icons/compressed.gif) | Molnar Gábor - Biborvisko rtf.zip | 2010-11-11 03:23 | 381K | |
![[ ]](/icons/compressed.gif) | Molnar Gábor - Jaguarországban rtf.zip | 2010-11-11 03:23 | 386K | |
![[ ]](/icons/compressed.gif) | Morgan, Marlo - Vidd hírét az Örökkévalónak - html.zip | 2010-11-11 03:11 | 386K | |
![[ ]](/icons/compressed.gif) | Molnar Gábor - Makk és jaguar rtf.zip | 2010-11-11 03:15 | 388K | |
![[ ]](/icons/compressed.gif) | Makkai Sándor - Ördogszeker.zip | 2010-11-11 03:32 | 402K | |
![[ ]](/icons/compressed.gif) | Molnar Gábor - Ahol az ösvény véget ér rtf.zip | 2010-11-11 03:23 | 404K | |
![[ ]](/icons/compressed.gif) | Mowat, Farley - A sarkvidek Robinsonjai.zip | 2010-11-11 03:22 | 406K | |
![[ ]](/icons/compressed.gif) | Mccullers, Carson - Maganyos vadasz a sziv.zip | 2010-11-11 04:47 | 406K | |
![[ ]](/icons/compressed.gif) | Mitchell, Margaret nyomán2 Milland, Audrey2 - Scarlett gyermekei.txt.zip | 2010-11-11 03:12 | 410K | |
![[ ]](/icons/compressed.gif) | McAllister Brian - Túlélők.zip | 2010-11-11 03:24 | 415K | |
![[ ]](/icons/compressed.gif) | McAllister Brian - Kitaszitottak.zip | 2010-11-11 03:24 | 422K | |
![[ ]](/icons/compressed.gif) | Mash Robin Árnyektalanok.zip | 2010-11-11 03:50 | 438K | |
![[ ]](/icons/compressed.gif) | Menghini Luigi - Láncreakció.zip | 2010-11-11 04:40 | 442K | |
![[ ]](/icons/compressed.gif) | McAllister Brian - Átkozottak.zip | 2010-11-11 03:24 | 447K | |
![[ ]](/icons/compressed.gif) | Martin, George R.R. & Tuttle, Lisa - Windhaven.pdf.zip | 2010-11-11 03:59 | 449K | |
![[ ]](/icons/compressed.gif) | Monsarrat, Nicholas - A kegyetlen tenger-t.zip | 2010-11-11 03:15 | 451K | |
![[ ]](/icons/compressed.gif) | Miller, Walter M. Jr. - Hozsánna néked, Leibowitz.zip | 2010-11-11 02:49 | 456K | |
![[ ]](/icons/compressed.gif) | Marquez, Gabriel Garcia - Száz év magány.rtf.zip | 2010-11-11 04:37 | 458K | |
![[ ]](/icons/compressed.gif) | MacBride, Allen Roger - Inferno Asimov nyomán.zip | 2010-11-11 03:16 | 462K | |
![[ ]](/icons/compressed.gif) | Merritt Abraham A delibab harcosai.zip | 2010-11-11 04:16 | 470K | |
![[ ]](/icons/compressed.gif) | Molnar Gábor - Hogaszom az Amazonason rtf.zip | 2010-11-11 03:23 | 475K | |
![[ ]](/icons/compressed.gif) | Meyer, Stephenie 2 - New Moon (Újhold).zip | 2010-11-11 03:49 | 479K | |
![[ ]](/icons/compressed.gif) | Molnar Gábor - Barátom a vadon.zip | 2010-11-11 03:23 | 483K | |
![[ ]](/icons/compressed.gif) | Mcload, Gabriel A fekete lovag legendaja.zip | 2010-11-11 04:19 | 489K | |
![[ ]](/icons/compressed.gif) | Mitchell, Margaret nyomán2 Milland, Audrey1 - Scarlett örökében.txt.zip | 2010-11-11 03:12 | 489K | |
![[ ]](/icons/compressed.gif) | Maas Peter Serpico.zip | 2010-11-11 03:16 | 514K | |
![[ ]](/icons/compressed.gif) | Monty, Roberts Az igazi suttogo.zip | 2010-11-11 03:15 | 515K | |
![[ ]](/icons/compressed.gif) | Mc Nab Andy Hivojele- Bravo Ketto Nulla.zip | 2010-11-11 03:02 | 516K | |
![[ ]](/icons/compressed.gif) | Mauriac, Francois - Regények.zip | 2010-11-11 03:35 | 517K | |
![[ ]](/icons/compressed.gif) | McNab, Andy Bevetesre keszen.zip | 2010-11-11 04:19 | 518K | |
![[ ]](/icons/compressed.gif) | Molnar Gábor - A csendes halál démona doc.zip | 2010-11-11 03:23 | 528K | |
![[ ]](/icons/compressed.gif) | Mora Ferenc Titulasz bankoja.zip | 2010-11-11 03:04 | 529K | |
![[ ]](/icons/compressed.gif) | McKenna, Juliet E - Kétélű fegyver 2 doc.zip | 2010-11-11 03:11 | 531K | |
![[ ]](/icons/compressed.gif) | McKenna, Juliet E - Kétélű fegyver 1 doc.zip | 2010-11-11 03:11 | 531K | |
![[ ]](/icons/compressed.gif) | McKenna, Juliet E - Déli tűz 1.zip | 2010-11-11 02:53 | 537K | |
![[ ]](/icons/compressed.gif) | Mowat, Farley - A meszarlas tengere.zip | 2010-11-11 03:22 | 538K | |
![[ ]](/icons/compressed.gif) | McKenna, Juliet E - Déli tűz 2.zip | 2010-11-11 02:53 | 552K | |
![[ ]](/icons/compressed.gif) | Moore Christopher Biff evangeliuma.zip | 2010-11-11 03:04 | 558K | |
![[ ]](/icons/compressed.gif) | Mailer, Norman - Varkastely a vadonban.zip | 2010-11-11 03:32 | 558K | |
![[ ]](/icons/compressed.gif) | Martin, George R.R. - Armageddon Rag.pdf.zip | 2010-11-11 03:59 | 566K | |
![[ ]](/icons/compressed.gif) | Morgan, Marlo - Vidd hírét az igazaknak - pdf.zip | 2010-11-11 03:11 | 580K | |
![[ ]](/icons/compressed.gif) | MacBride, Allen Roger - Utopia Asimov nyomán.zip | 2010-11-11 03:18 | 589K | |
![[ ]](/icons/compressed.gif) | Mieville, China - Perdido palyaudvar vegallomas 2.zip | 2010-11-11 04:27 | 598K | |
![[ ]](/icons/compressed.gif) | Makkai Sándor - Sarga vihar.zip | 2010-11-11 03:32 | 615K | |
![[ ]](/icons/compressed.gif) | Meyer, Stephenie 4 - Breaking Dawn - Hajnalhasadás.zip | 2010-11-11 03:49 | 642K | |
![[ ]](/icons/compressed.gif) | McMurtry, Larry - Cadillac Jack.zip | 2010-11-11 04:19 | 644K | |
![[ ]](/icons/compressed.gif) | Morris, Dave tnt6 - Végtelen égbolt.zip | 2010-11-11 04:12 | 673K | |
![[ ]](/icons/compressed.gif) | Mailer, Norman - Meztelenek es holtak.zip | 2010-11-11 05:01 | 676K | |
![[ ]](/icons/compressed.gif) | Morgan Richard - Valos halal.zip | 2010-11-11 03:11 | 691K | |
![[ ]](/icons/compressed.gif) | Morris, Dave tnt4 - Atlantisz hadművelet.zip | 2010-11-11 04:01 | 697K | |
![[ ]](/icons/compressed.gif) | Mailer, Norman - Szarvaspark.zip | 2010-11-11 05:01 | 698K | |
![[ ]](/icons/compressed.gif) | Meade, Glenn - A feltamadas napja.zip | 2010-11-11 04:19 | 720K | |
![[ ]](/icons/compressed.gif) | Marton Béla - A Ceresz foglyai.zip | 2010-11-11 04:35 | 745K | |
![[ ]](/icons/compressed.gif) | Morris, Dave tnt5 - Dinoszaurusztelep.zip | 2010-11-11 04:12 | 750K | |
![[ ]](/icons/compressed.gif) | Mazan Tihor Kard es magia játékkönyv.zip | 2010-11-11 03:02 | 768K | |
![[ ]](/icons/compressed.gif) | Morris, Dave tnt3 - Szecska akcioban.zip | 2010-11-11 04:01 | 780K | |
![[ ]](/icons/compressed.gif) | Morris, Dave tnt1 - Az eltemetett kincs doc.zip | 2010-11-11 04:01 | 789K | |
![[ ]](/icons/compressed.gif) | Moravia, Alberto - A megvetes.zip | 2010-11-11 03:04 | 794K | |
![[ ]](/icons/compressed.gif) | Marcinko, Richard - A SEAL Nem Felejt.pdf.zip | 2010-11-11 04:35 | 800K | |
![[ ]](/icons/compressed.gif) | Morris, Dave tnt2 - Hatlövetűek és dobocsillagok (tininindzsa teknőcök).zip | 2010-11-11 04:01 | 807K | |
![[ ]](/icons/compressed.gif) | McKenna, Juliet E - Küzdelmes hűség doc.zip | 2010-11-11 03:11 | 807K | |
![[ ]](/icons/compressed.gif) | Meissner, Janusz - -Jan Marten kaloz regenyes historiaja.zip | 2010-11-11 04:40 | 813K | |
![[ ]](/icons/compressed.gif) | Maugham W. Somerset Örök szolgasag.zip | 2010-11-11 03:35 | 814K | |
![[ ]](/icons/compressed.gif) | Mazeau Jacques Bellary atka.zip | 2010-11-11 03:02 | 814K | |
![[ ]](/icons/compressed.gif) | Mailer, Norman - Lee Harvey Oswald.zip | 2010-11-11 05:01 | 819K | |
![[ ]](/icons/compressed.gif) | Merrick Monte Memphis Belle.zip | 2010-11-11 04:16 | 825K | |
![[ ]](/icons/compressed.gif) | Martin, Les - The Shadow Az árnyék .zip | 2010-11-11 04:39 | 838K | |
![[ ]](/icons/compressed.gif) | Martinov, Georgij - Idospiral.zip | 2010-11-11 04:35 | 839K | |
![[ ]](/icons/compressed.gif) | McCullough, Colleen - Trója éneke .zip | 2010-11-11 04:47 | 854K | |
![[ ]](/icons/compressed.gif) | Magyarosi Gizella Ki fogja a kukacot diákok aranyköpései.zip | 2010-11-11 05:01 | 861K | |
![[ ]](/icons/compressed.gif) | Meade, Glenn - Hofarkas 1-2.zip | 2010-11-11 04:40 | 863K | |
![[ ]](/icons/compressed.gif) | Mata Hari.zip | 2010-11-11 03:50 | 869K | |
![[ ]](/icons/compressed.gif) | Meyer, Stephenie 5 - Éjféli nap (Midnight Sun).pdf.zip | 2010-11-11 03:49 | 897K | |
![[ ]](/icons/compressed.gif) | Montanus, Ambrose - Egykor pdf.zip | 2010-11-11 03:15 | 954K | |
![[ ]](/icons/compressed.gif) | Malinowski Bronislaw Baloma.zip | 2010-11-11 04:35 | 1.0M | |
![[ ]](/icons/compressed.gif) | McCaffrey Anne - Pegazus nyergeben.zip | 2010-11-11 04:39 | 1.0M | |
![[ ]](/icons/compressed.gif) | McCullough Colleen Troja eneke.zip | 2010-11-11 04:47 | 1.0M | |
![[ ]](/icons/compressed.gif) | Mailer, Norman - A hóhér dala.zip | 2010-11-11 05:01 | 1.0M | |
![[ ]](/icons/compressed.gif) | Mitchell, Margaret - Elfújta a szél 1-2-3.rtf.zip | 2010-11-11 03:12 | 1.0M | |
![[ ]](/icons/compressed.gif) | Mérgezo novények, novényi mérgek.pdf.zip | 2010-11-11 03:33 | 1.0M | |
![[ ]](/icons/compressed.gif) | Megyesi Zoltan - Titkosirasok.zip | 2010-11-11 04:40 | 1.1M | |
![[ ]](/icons/compressed.gif) | Milland, Audrey - Scarlett örökében,Scarlett gyermekei,Ahonnan a szél fúj.zip | 2010-11-11 02:49 | 1.2M | |
![[ ]](/icons/compressed.gif) | Martin, George R.R. - Tüz és jég dala - 4. Varjak lakomaja.zip | 2010-11-11 04:39 | 1.2M | |
![[ ]](/icons/compressed.gif) | Martin, George R.R. - Tüz és jég dala - 1.Tronok harca.zip | 2010-11-11 03:59 | 1.2M | |
![[ ]](/icons/compressed.gif) | Meyer, Stephenie - A burok.zip | 2010-11-11 03:45 | 1.3M | |
![[ ]](/icons/compressed.gif) | Martinov, Georgij - A Föld nővere.zip | 2010-11-11 04:35 | 1.3M | |
![[ ]](/icons/compressed.gif) | Mónus Miklós - Ő és Az.zip | 2010-11-11 03:33 | 1.4M | |
![[ ]](/icons/compressed.gif) | Martin, George R.R. - Tüz és jég dala - 2. Királyok csatája.zip | 2010-11-11 04:39 | 1.5M | |
![[ ]](/icons/compressed.gif) | Mitchell, Margaret nyomán1 Ripley, Alexandra - Scarlett.zip | 2010-11-11 03:12 | 1.5M | |
![[ ]](/icons/compressed.gif) | McKenna, Juliet E - Veszélyes játszma doc.zip | 2010-11-11 03:11 | 1.7M | |
![[ ]](/icons/compressed.gif) | McKenna, Juliet E - A forgando szerencse doc.zip | 2010-11-11 04:47 | 1.7M | |
![[ ]](/icons/compressed.gif) | Mieville, China - Perdido palyaudvar vegallomas 1.zip | 2010-11-11 04:27 | 1.8M | |
![[ ]](/icons/compressed.gif) | McKenna, Juliet E - Kegyetlen eskü doc.zip | 2010-11-11 03:11 | 1.8M | |
![[ ]](/icons/compressed.gif) | Martin, George R.R. - Tüz és jég dala - 3.Kardok vihara.zip | 2010-11-11 04:39 | 1.9M | |
![[ ]](/icons/compressed.gif) | Marton Béla - Utazás a Venuszra.zip | 2010-11-11 04:35 | 2.0M | |
![[ ]](/icons/compressed.gif) | Meyer, Stephenie 1 - Alkonyat.zip | 2010-11-11 03:45 | 2.1M | |
![[ ]](/icons/compressed.gif) | Meyer, Stephenie 3 - Eclipse.zip | 2010-11-11 03:49 | 2.1M | |
![[ ]](/icons/compressed.gif) | Mikula, Valentin Stuka.zip | 2010-11-11 04:27 | 2.3M | |
![[ ]](/icons/compressed.gif) | Mattyasovszky Jenő - Hód történetek Összes (gondolom én).zip | 2010-11-11 03:50 | 4.4M | |
![[ ]](/icons/compressed.gif) | MetaGalaktika (7. hiányzik).zip | 2010-11-11 04:16 | 6.9M | |
![[ ]](/icons/compressed.gif) | Morris Desmond - Az emberállat.zip | 2010-11-11 04:01 | 12M | |
![[ ]](/icons/compressed.gif) | Magyar Színházművészeti lexikon.zip | 2010-11-11 03:28 | 19M | |
![[ ]](/icons/compressed.gif) | Magyar színháztörténet - előadóművészet, művelődéstörténet - html.zip | 2010-11-11 03:46 | 25M | |
|